|
|
I.B.3. (II.A.2.) |
| Other names |
|---|
| 2,5-Norbornadiene; Bicyclo[2.2.1]hepta-2,5-diene; Bicyclo[2.2.1]heptadiene; 3,6-Methano-1,4-cyclohexadiene; Dicycloheptadiene; Bicyclo[2.2.1]-2,5-heptadiene; Bicyclo[2,2,1]-2,5-heptadiene; |
| INChI |
|---|
| InChI=1S/C7H8/c1-2-7-4-3-6(1)5-7/h1-4,6-7H,5H2 |
| Property | Experiment | Calculated | Comparison | |
|---|---|---|---|---|
| Energies Entropies |
Enthalpy 298.15K ![]() |
x | ||
Enthalpy 0K ![]() |
||||
| Energy 0K | 198 | |||
| Energy 298.15K | 10 | |||
| Atomization Enthalpy 298.15K | x | 0 | x | |
| Atomization Enthalpy 0K | 0 | |||
Entropy (298.15K) ![]() |
0 | |||
| Entropy at any temperature | 0 | |||
Integrated Heat Capacity ![]() |
0 | |||
Heat Capacity (Cp) ![]() |
x | 0 | x | |
| Nuclear Repulsion Energy | 195 | |||
HOMO-LUMO Energies ![]() |
192 | |||
Barriers to Internal Rotation ![]() |
0 | |||
| Geometries | Cartesians | 192 | ||
Internal Coordinates ![]() |
0 | |||
Products of moments of inertia ![]() |
185 | |||
Rotational Constants ![]() |
192 | |||
| Point Group | 196 | |||
| Vibrations | Vibrational Frequencies ![]() |
192 | ||
| Vibrational Intensities | 188 | |||
| Zero-point energies | 192 | |||
| Vibrational scaling factors | ||||
| Anharmonic frequencies and constants | ||||
| Electronic States | Electronic states | 0 | ||
| Electrostatics | Atom charges | 123 | ||
Dipole ![]() |
123 | |||
Quadrupole ![]() |
123 | |||
Polarizability ![]() |
124 | |||
| Other results | Spin | 0 | ||
| Number of basis functions | 28 | |||
| Diagnostics | 0 | |||
| Conformations | 1 | |||