| casno |
formula |
name |
INChI |
SMILES |
sketch |
other names |
| 12385136 |
H- |
Hydrogen atom anion |
InChI=1S/H/q-1 |
[H-] |
H- |
|
| 12385136 |
H |
Hydrogen atom |
InChI=1/H |
[H] |
H |
H-atom; Hydrogen; Hydrogen atom; Hydrogen radical
|
| 12385136 |
H+ |
Hydrogen atom cation |
InChI=1S/p+1 |
[H+] |
H+ |
|
| 16873179 |
D- |
Deuterium atom anion |
InChI=1S/H/q-1/i1+1 |
[2H-] |
D- |
|
| 16873179 |
D |
Deuterium atom |
InChI=1/H/i1+1 |
[2H] |
D |
Deuterium; Deuterium atom
|
| 16873179 |
D+ |
Deuterium atom cation |
InChI=1S/p+1/i1+1 |
[2H+] |
D+ |
|
| 13983205 |
HD |
Deuterium hydride |
InChI=1/H2/h1H/i1+1 |
[H][2H] |
 |
Deuterium hydride; Deuterium, mol. with hydrogen; Hydrogen-d1
|
| 7782390 |
D2 |
Deuterium diatomic |
InChI=1/H2/h1H/i1+1D |
[2H][2H] |
 |
Deuterium; UN 1957; diduterium
|
| 1333740 |
H2- |
hydrogen diatomic anion |
InChI=1S/H2/h1H/q-1 |
[H][H-] |
 |
|
| 1333740 |
H2 |
Hydrogen diatomic |
InChI=1/H2/h1H |
[H][H] |
 |
Hydrogen; Molecular hydrogen; o-Hydrogen; p-Hydrogen; UN 1966; UN 1049; dihydrogen
|
| 1333740 |
H2+ |
Hydrogen cation |
InChI=1S/H2/h1H/q+1 |
[H][H+] |
 |
|
| 28132481 |
H3+ |
hydrogen trimer cation |
InChI=1S/H3/c1-2-3-1/q+1 |
|
 |
|
| 7440597 |
He- |
Helium atom anion |
InChI=1S/He/q-1 |
[He-] |
He- |
|
| 7440597 |
He |
Helium atom |
InChI=1/He |
[He] |
He |
UN 1046; UN 1963; Helium
|
| 7440597 |
He+ |
Helium atom cation |
InChI=1S/He/q+1 |
[He+] |
He+ |
|
| 9000184 |
He2+ |
helium dimer cation |
InChI=1S/He2/c1-2/q+1 |
[He][He+] |
 |
|
| 9000219 |
HeH |
Helium hydride |
InChI=1S/HHe/h1H |
[HeH] |
 |
|
| 9000219 |
HeH+ |
Helium hydride cation |
InChI=1S/HHe/h1H/q+1 |
[He][H+] |
 |
|
| 7439932 |
Li- |
Lithium atom anion |
InChI=1S/Li/q-1 |
[Li-] |
Li- |
|
| 7439932 |
Li |
Lithium atom |
InChI=1/Li |
[Li] |
Li |
Lithium; UN 1415
|
| 7439932 |
Li+ |
Lithium atom cation |
InChI=1S/Li/q+1 |
[Li+] |
Li+ |
|
| 7580678 |
LiH- |
lithium hydride anion |
InChI=1S/Li.H/q-1; |
[LiH-] |
 |
|
| 7580678 |
LiH |
Lithium Hydride |
InChI=1/Li.H |
[LiH] |
 |
Hydrure de lithium; Lithium hydride; Lithium hydride (LiH); UN 1414; UN 2805
|
| 7580678 |
LiH+ |
lithium hydride cation |
InChI=1S/Li.H/q+1; |
[LiH+] |
 |
|
| 7440417 |
Be- |
Beryllium atom anion |
InChI=1S/Be/q-1 |
[Be-] |
Be- |
|
| 7440417 |
Be |
Beryllium atom |
InChI=1/Be |
[Be] |
Be |
Beryllium; Beryllium-9; Glucinium; Glucinum; Rcra waste number P015; UN 1567
|
| 7440417 |
Be+ |
Beryllium atom cation |
InChI=1S/Be/q+1 |
[Be+] |
Be+ |
|
| 13597972 |
BeH- |
berylium monohydride anion |
InChI=1S/Be.H/q-1; |
[BeH-] |
 |
|
| 13597972 |
BeH |
beryllium monohydride |
InChI=1/Be.H |
[BeH] |
 |
Beryllium hydride
|
| 13597972 |
BeH+ |
beryllium monohydride cation |
InChI=1S/Be.H/q+1; |
[BeH+] |
 |
|
| 7787522 |
BeH2 |
beryllium dihydride |
InChI=1/Be.2H |
[BeH2] |
 |
Beryllium hydride
|
| 7440428 |
B- |
Boron atom anion |
InChI=1S/B/q-1 |
[B-] |
B- |
|
| 7440428 |
B |
Boron atom |
InChI=1/B |
[B] |
B |
Boron
|
| 7440428 |
B+ |
Boron atom cation |
InChI=1S/B/q+1 |
[B+] |
B+ |
|
| 13766262 |
BH- |
boron monohydride anion |
InChI=1S/BH/h1H/q-1 |
[BH-] |
 |
|
| 13766262 |
BH |
Boron monohydride |
InChI=1/BH/h1H |
[BH] |
 |
Borane; Borane(1)
|
| 13766262 |
BH+ |
boron monohydride cation |
InChI=1S/BH/h1H/q+1 |
[BH+] |
 |
|
| 14452643 |
BH2 |
boron dihydride |
InChI=1/BH2/h1H2 |
[BH2] |
 |
BH2 Radical; Borane(2); Boron dihydride
|
| 13283313 |
BH3- |
boron trihydride anion |
InChI=1S/BH3/h1H3/q-1 |
[BH3-] |
 |
|
| 13283313 |
BH3 |
boron trihydride |
InChI=1/BH3/h1H3 |
B |
 |
Borane; Borane(3)
|
| 13283313 |
BH3+ |
boron trihydride cation |
InChI=1S/BH3/h1H3/q+1 |
[BH3+] |
 |
|
| 16971292 |
BH4- |
borohydride anion |
InChI=1S/BH4/h1H4/q-1 |
[BH4-] |
 |
|
| 7440440 |
C- |
Carbon atom anion |
InChI=1S/C/q-1 |
[C-] |
C- |
|
| 7440440 |
C |
Carbon atom |
InChI=1/C |
[C] |
C |
Carbon
|
| 7440440 |
C+ |
Carbon atom cation |
InChI=1S/C/q+1 |
[C+] |
C+ |
|
| 3315375 |
CH- |
methylidyne anion |
InChI=1S/CH/h1H/q-1 |
[CH-] |
 |
|
| 3315375 |
CH |
Methylidyne |
InChI=1/CH/h1H |
[CH] |
 |
Methylidyne
|
| 3315375 |
CH+ |
Methylidyne cation |
InChI=1S/CH/h1H/q+1 |
[CH+] |
 |
|
| 2465567 |
CH2- |
methylene anion |
InChI=1S/CH2/h1H2/q-1 |
[CH2-] |
 |
|
| 2465567 |
CH2 |
Methylene |
InChI=1/CH2/h1H2 |
[CH2] |
 |
Methylene
|
| 2465567 |
CH2+ |
methylene cation |
InChI=1S/CH2/h1H2/q+1 |
[CH2+] |
 |
|
| 2229074 |
CH3- |
methyl anion |
InChI=1S/CH3/h1H3/q-1 |
[CH3-] |
 |
|
| 2229074 |
CH3 |
Methyl radical |
InChI=1/CH3/h1H3 |
[CH3] |
 |
Methyl; Methyl radical
|
| 2229074 |
CH3+ |
methyl cation |
InChI=1S/CH3/h1H3/q+1 |
[CH3+] |
 |
|
| 74828 |
CH4 |
Methane |
InChI=1/CH4/h1H4 |
C |
 |
Biogas; Fire damp; Marsh gas; Methane; Methyl hydride; R 50; UN 1971; UN 1972
|
| 74828 |
CH4+ |
Methane cation |
InChI=1S/CH4/h1H4/q+1 |
[CH4+] |
 |
|
| 17778880 |
N- |
Nitrogen atom anion |
InChI=1S/N/q-1 |
[N-] |
N- |
|
| 17778880 |
N |
Nitrogen atom |
InChI=1/N |
[N] |
N |
N; Nitrogen atom; Nitrogen radical; nitrogen
|
| 17778880 |
N+ |
Nitrogen atom cation |
InChI=1S/N/q+1 |
[N+] |
N+ |
|
| 13774920 |
NH- |
Imidogen anion |
InChI=1S/HN/h1H/q-1 |
[NH-] |
 |
|
| 13774920 |
NH |
Imidogen |
InChI=1/HN/h1H |
[NH] |
 |
Imidogen; Imino
|
| 13774920 |
NH+ |
imidogen cation |
InChI=1S/HN/h1H/q+1 |
[NH+] |
 |
|
| 13770406 |
NH2- |
amino anion |
InChI=1S/H2N/h1H2/q-1 |
[NH2-] |
 |
|
| 13770406 |
NH2 |
Amino radical |
InChI=1/H2N/h1H2 |
[NH2] |
 |
Amidogen; Amino radical
|
| 13770406 |
NH2+ |
Amino cation |
InChI=1S/H2N/h1H2/q+1 |
[NH2+] |
 |
|
| 15117847 |
ND2 |
Amidogen-d2 |
InChI=1/H2N/h1H2/i1D2 |
[N]([2H])[2H] |
 |
Amidogen-D2
|
| 13550497 |
ND3 |
Ammonia-d3 |
InChI=1/H3N/h1H3/i/hD3 |
N([2H])([2H])[2H] |
 |
Ammonia-d3-
|
| 7664417 |
NH3 |
Ammonia |
InChI=1/H3N/h1H3 |
N |
 |
Ammonia; Ammonia gas; Ammonia, anhydrous; Anhydrous ammonia; Aromatic Ammonia, Vaporole; Nitro-Sil; Spirit of Hartshorn
|
| 7664417 |
NH3+ |
ammonia cation |
InChI=1S/H3N/h1H3/q+1 |
[NH3+] |
 |
|
| 14798039 |
NH4+ |
ammonium cation |
InChI=1S/H3N/h1H3/p+1 |
[NH4+] |
 |
|
| 17778802 |
O- |
Oxygen atom anion |
InChI=1S/O/q-1 |
[O-] |
O- |
|
| 17778802 |
O |
Oxygen atom |
InChI=1/O |
[O] |
O |
Atomic oxygen; Oxygen; Oxygen atom; Oxygen(sup 3P); Oxygen, atomic; Photooxygen; Singlet oxygen
|
| 17778802 |
O+ |
Oxygen atom cation |
InChI=1S/O/q+1 |
[O+] |
O+ |
|
| 3352576 |
OH- |
hydroxide anion |
InChI=1S/H2O/h1H2/p-1 |
[OH-] |
 |
Hydroxyl anion; Hydroxyl; hydroxide
|
| 3352576 |
OH |
Hydroxyl radical |
InChI=1/HO/h1H |
[OH] |
 |
Hydroxy radical; Hydroxyl; Hydroxy radical; Hydroxy
|
| 3352576 |
OH+ |
hydoxyl cation |
InChI=1S/HO/h1H/q+1 |
[OH+] |
 |
|
| 13587547 |
DO |
Hydroxyl-d |
InChI=1/HO/h1H/i1D |
[2HO] |
 |
Hydroxyl-D
|
| 7789200 |
D2O |
Deuterium oxide |
InChI=1/H2O/h1H2/i/hD2 |
O([2H])[2H] |
 |
Deuterium oxide; Dideuterium oxide; Heavy water; Heavy water-d2; Water(sup 2)-H2; Water, heavy; Water-d2
|
| 7732185 |
H2O- |
water anion |
InChI=1S/H2O/h1H2/q-1 |
[OH2-] |
 |
|
| 7732185 |
H2O |
Water |
InChI=1/H2O/h1H2 |
O |
 |
Dihydrogen oxide; Distilled water; Ice; Water vapor; Water; oxidane
|
| 7732185 |
H2O+ |
water cation |
InChI=1S/H2O/h1H2/q+1 |
[OH2+] |
 |
|
| 14940637 |
HDO |
Water-d1 |
InChI=1/H2O/h1H2/i/hD |
O[2H] |
 |
Water-D1
|
| 13968086 |
H3O+ |
hydronium |
InChI=1S/H2O/h1H2/p+1 |
[OH3+] |
 |
|
| 14762948 |
F- |
Fluorine atom anion |
InChI=1S/FH/h1H/p-1 |
[F-] |
F- |
|
| 14762948 |
F |
Fluorine atom |
InChI=1/F |
F |
F |
Fluorine atom; Fluorine radical; fluorine
|
| 14762948 |
F+ |
Fluorine atom cation |
InChI=1S/F/q+1 |
[F+] |
F+ |
|
| 14333267 |
DF |
Hydrofluoric acid-d |
InChI=1/FH/h1H/i/hD |
F[2H] |
 |
Deuterium fluoride; Hydrofluoric acid-d
|
| 7664393 |
HF- |
hydrogen fluoride anion |
InChI=1S/FH/h1H/q-1 |
[FH-] |
 |
|
| 7664393 |
HF |
Hydrogen fluoride |
InChI=1/FH/h1H |
F |
 |
Acide fluorhydrique; Acido fluoridrico; Anhydrous hydrofluoric acid; Boron tribromide; Fluoric acid; Fluorowodor; Fluorwasserstoff; Fluorwaterstof; Hydrofluoric acid; Hydrofluoride; Hydrogen fluoride; Rcra waste number U134; Rubigine; UN 1790; UN 1052
|
| 7664393 |
HF+ |
hydrogen fluoride cation |
InChI=1S/FH/h1H/q+1 |
[FH+] |
 |
|
| 12206676 |
H2F+ |
dihydrogen fluoride cation |
InChI=1S/FH2/h1H2/q+1 |
[FH2+] |
 |
|
| 7440019 |
Ne- |
Neon atom anion |
InChI=1S/Ne/q-1 |
[Ne-] |
Ne- |
|
| 7440019 |
Ne |
Neon atom |
InChI=1/Ne |
[Ne] |
Ne |
UN 1065; UN 1913; Neon
|
| 7440019 |
Ne+ |
Neon atom cation |
InChI=1S/Ne/q+1 |
[Ne+] |
Ne+ |
|
| 12200656 |
NeH |
neon hydrogen |
InChI=1S/HNe/h1H |
[NeH] |
 |
|
| 12200656 |
NeH+ |
neon hydrogen cation |
InChI=1S/Ne/p+1 |
[Ne].[H+] |
 |
|
| 7440235 |
Na- |
Sodium atom anion |
InChI=1S/Na/q-1 |
[Na-] |
Na- |
|
| 7440235 |
Na |
Sodium atom |
InChI=1/Na |
[Na] |
Na |
NA 1421; Natrium; Sodium; UN 1429; UN 1428
|
| 7440235 |
Na+ |
Sodium atom cation |
InChI=1S/Na/q+1 |
[Na+] |
Na+ |
|
| 7646697 |
NaH- |
sodium hydride anion |
InChI=1S/Na.H/q-1; |
[Na][H-] |
 |
|
| 7646697 |
NaH |
sodium hydride |
InChI=1/Na.H |
[NaH] |
 |
NAH 80; Sodium hydride; Sodium hydride (NaH); UN 1427
|
| 7646697 |
NaH+ |
sodium hydride cation |
InChI=1S/Na.H/q+1; |
[Na][H+] |
 |
|
| 7439954 |
Mg- |
Magnesium atom anion |
InChI=1S/Mg/q-1 |
[Mg-] |
Mg- |
|
| 7439954 |
Mg |
Magnesium atom |
InChI=1/Mg |
[Mg] |
Mg |
Magnesio; Magnesium; Magnesium clippings; Magnesium pellets; Magnesium powder (pyrophoric); Magnesium powdered; Magnesium ribbons; Magnesium turnings; NA 1869; RMC; UN 1418; UN 1869; UN 2950
|
| 7439954 |
Mg+ |
Magnesium atom cation |
InChI=1S/Mg/q+1 |
[Mg+] |
Mg+ |
|
| 14332537 |
MgH- |
magnesium monohydride anion |
InChI=1S/Mg.H/q-1; |
[MgH-] |
 |
|
| 14332537 |
MgH |
magnesium monohydride |
InChI=1/Mg.H |
[MgH] |
 |
Magnesium hydride
|
| 14332537 |
MgH+ |
magnesium monohydride cation |
InChI=1S/Mg.H/q+1; |
[MgH+] |
 |
|
| 7693278 |
MgH2 |
magnesium dihydride |
InChI=1/Mg.2H |
[MgH2] |
 |
Magnesium hydride
|
| 7429905 |
Al- |
Aluminum atom anion |
InChI=1S/Al/q-1 |
[Al-] |
Al- |
|
| 7429905 |
Al |
Aluminum atom |
InChI=1/Al |
[Al] |
Al |
Alaun; Aluminium; Aluminum; Aluminum 27
|
| 7429905 |
Al+ |
Aluminum atom cation |
InChI=1S/Al/q+1 |
[Al+] |
Al+ |
|
| 13967221 |
AlH- |
aluminum monohydride anion |
InChI=1S/Al.H/q-1; |
[AlH-] |
 |
|
| 13967221 |
AlH |
aluminum monohydride |
InChI=1/Al.H |
[AlH] |
 |
Aluminum hydride
|
| 13967221 |
AlH+ |
aluminum monohydride cation |
InChI=1S/Al.H/q+1; |
[AlH+] |
 |
|
| 14457659 |
AlH2- |
aluminum dihydride anion |
InChI=1S/Al.2H/q-1;; |
[AlH2-] |
 |
|
| 14457659 |
AlH2 |
aluminum dihydride |
InChI=1/Al.2H |
[AlH2] |
 |
|
| 14457659 |
AlH2+ |
aluminum dihydride cation |
InChI=1S/Al.2H/q+1;; |
[AlH2+] |
 |
|
| 7784216 |
AlH3- |
aluminum trihydride anion |
InChI=1S/Al.3H/q-1;;; |
[AlH3-] |
 |
|
| 7784216 |
AlH3 |
aluminum trihydride |
InChI=1/Al.3H |
[AlH3] |
 |
α-Aluminum trihydride; Alane; Aluminum hydride; Aluminum hydride (AlH3); Aluminum trihydride; UN 2463; alpha-Aluminum trihydride
|
| 7784216 |
AlH3+ |
aluminum trihydride cation |
InChI=1S/Al.3H/q+1;;; |
[AlH3+] |
 |
|
| 19469819 |
AlH4- |
Aluminum tetrahydride anion |
InChI=1S/Al.4H/q-1;;;; |
[Al-].[H].[H].[H].[H] |
 |
|
| 7440213 |
Si- |
Silicon atom anion |
InChI=1S/Si/q-1 |
[Si-] |
Si- |
|
| 7440213 |
Si |
Silicon atom |
InChI=1/Si |
[Si] |
Si |
Defoamer S-10; Silicon; UN 1346
|
| 7440213 |
Si+ |
Silicon atom cation |
InChI=1S/Si/q+1 |
[Si+] |
Si+ |
|
| 13774942 |
SiH- |
silicon monohydride anion |
InChI=1S/HSi/h1H/q-1 |
[SiH-] |
 |
|
| 13774942 |
SiH |
Silylidyne |
InChI=1/HSi/h1H |
[SiH] |
 |
Silicon hydride; Silylidyne
|
| 13774942 |
SiH+ |
silicon monohydride cation |
InChI=1S/HSi/h1H/q+1 |
[SiH+] |
 |
|
| 13825906 |
SiH2- |
silicon dihydride anion |
InChI=1S/H2Si/h1H2/q-1 |
[SiH2-] |
 |
|
| 13825906 |
SiH2 |
silicon dihydride |
InChI=1/H2Si/h1H2 |
[SiH2] |
 |
Silylene; Silylene radical
|
| 13825906 |
SiH2+ |
silicon dihydride cation |
InChI=1S/H2Si/h1H2/q+1 |
[SiH2+] |
 |
|
| 13765441 |
SiH3- |
silyl anion |
InChI=1S/H3Si/h1H3/q-1 |
[SiH3-] |
 |
|
| 13765441 |
SiH3 |
silyl |
InChI=1/H3Si/h1H3 |
[SiH3] |
 |
Silyl radical
|
| 13765441 |
SiH3+ |
silyl cation |
InChI=1S/H3Si/h1H3/q+1 |
[SiH3+] |
 |
|
| 7803625 |
SiH4 |
Silane |
InChI=1/H4Si/h1H4 |
[SiH4] |
 |
Monosilane; Silane; Silicane; Silicon hydride; Silicon hydride (SiH4); Silicon tetrahydride; UN 2203
|
| 7803625 |
SiH4+ |
Silane cation |
InChI=1S/H4Si/h1H4/q+1 |
[SiH4+] |
 |
|
| 7723140 |
P- |
Phosphorus atom anion |
InChI=1S/P/q-1 |
[P-] |
P- |
|
| 7723140 |
P |
Phosphorus atom |
InChI=1/P |
[P] |
P |
Phosphorous; Phosphorus; Phosphorus, red; Phosphorus-30; Red phosphorus; White phosphorus; UN 1338
|
| 7723140 |
P+ |
Phosphorus atom cation |
InChI=1S/P/q+1 |
[P+] |
P+ |
|
| 13967141 |
PH- |
phosphorus monohydride anion |
InChI=1S/HP/h1H/q-1 |
[PH-] |
 |
|
| 13967141 |
PH |
phosphorus monohydride |
InChI=1/HP/h1H |
[PH] |
 |
Phosphinidene
|
| 13967141 |
PH+ |
phosphorus monohydride cation |
InChI=1S/HP/h1H/q+1 |
[PH+] |
 |
|
| 13765430 |
PH2- |
Phosphino anion |
InChI=1S/H2P/h1H2/q-1 |
[PH2-] |
 |
|
| 13765430 |
PH2 |
Phosphino radical |
InChI=1/H2P/h1H2 |
[PH2] |
 |
Phosphino; Phosphino radical
|
| 13765430 |
PH2+ |
Phosphino cation |
InChI=1S/H2P/h1H2/q+1 |
[PH2+] |
 |
|
| 7803512 |
PH3 |
Phosphine |
InChI=1/H3P/h1H3 |
P |
 |
Celphos; Delicia; Detia; Detia gas ex-B; Fosforowodor; Gas-ex-B; Hydrogen phosphide; Phosphene; Phosphine; Phosphorus hydride; Phosphorus trihydride; Phosphorwasserstoff; Rcra waste number P096; UN 2199; phosphane
|
| 7803512 |
PH3+ |
Phosphine cation |
InChI=1S/H3P/h1H3/q+1 |
[PH3+] |
 |
|
| 9000195 |
PH4+ |
phosphonium cation |
InChI=1S/H3P/h1H3/p+1 |
[PH4+] |
 |
Phosphine, protonated; phosphonium
|
| 7704349 |
S- |
Sulfur atom anion |
InChI=1S/S/q-1 |
[S-] |
S- |
|
| 7704349 |
S |
Sulfur atom |
InChI=1/S |
[S] |
S |
Asulfa-Supra; Atomic sulfur; Bensulfoid; Brimstone; Colloidal sulfur; Colloidal-S; Colsul; component of Bensulfoid; Corosul D and S; Cosan; Cosan 80; Crystex; Elosal; Flour sulfur; Flowers of sulfur; Flowers of sulphur; Ground vocle sulfur; Hexasul; Kolloidschwefel 95; Kolo 100; Kolofog; Kolospray; Kumulus; Magnetic 70, 90, and 95; Micowetsulf; Microflotox; Netzschwefel; Polsulkol Extra; Precipitated sulfur; RC-Schwefel Extra; Sofril; Sperlox-S; Spersul; Spersul thiovit; Sublimed sulfur; Sufran; Sufran D; Sulfex; Sulfidal; Sulforon; Sulfur; Sulfur atom; Sulfur Soap; Sulfur, Precipitated; Sulikol; Sulkol; Sulsol; Sultaf; Super cosan; Svovl; Thiolux; Thiovit; Ultra Sulfur
|
| 7704349 |
S+ |
Sulfur atom cation |
InChI=1S/S/q+1 |
[S+] |
S+ |
|
| 13780239 |
DS |
Mercapto-d |
InChI=1/HS/h1H/i1D |
[S][2H] |
 |
Mercapto-D
|
| 13940211 |
SH- |
mercapto anion |
InChI=1S/H2S/h1H2/p-1 |
[SH-] |
 |
HS anion; hydrogensulfide
|
| 13940211 |
SH |
Mercapto radical |
InChI=1/HS/h1H |
[SH] |
 |
Mercapto; Mercapto radical
|
| 13940211 |
SH+ |
sulfur monohydride cation |
InChI=1S/HS/h1H/q+1 |
[SH+] |
 |
|
| 13536942 |
D2S |
Hydrogen sulfide-d2 |
InChI=1/H2S/h1H2/i/hD2 |
S([2H])[2H] |
 |
Hydrogen sulfide-D2
|
| 7783064 |
H2S- |
Hydrogen sulfide anion |
InChI=1S/H2S/h1H2/q-1 |
[SH2-] |
 |
|
| 7783064 |
H2S |
Hydrogen sulfide |
InChI=1/H2S/h1H2 |
S |
 |
Acide sulfhydrique; Dihydrogen monosulfide; Dihydrogen sulfide; Hepatic gas; Hydrogen sulfide; Hydrogen sulfide (H2S); Hydrogen sulfuric acid; Hydrogene sulfure; Hydrogen-sulphide-; Hydrosulfuric acid; Idrogeno solforato; Rcra waste number U135; Schwefelwasserstoff; Siarkowodor; Stink damp; Sulfur hydride; Sulfureted hydrogen; Sulfuretted hydrogen; UN 1053; Zwavelwaterstof
|
| 7783064 |
H2S+ |
Hydrogen sulfide cation |
InChI=1S/H2S/h1H2/q+1 |
[SH2+] |
 |
|
| 18155210 |
H3S+ |
H3S+ |
InChI=1S/H2S/h1H2/p+1 |
[SH3+] |
 |
|
| 22537151 |
Cl- |
Chlorine atom anion |
InChI=1S/ClH/h1H/p-1 |
[Cl-] |
Cl- |
|
| 22537151 |
Cl |
Chlorine atom |
InChI=1/Cl |
[Cl] |
Cl |
Chlorine atom; Chlorine radical; chlorine
|
| 22537151 |
Cl+ |
Chlorine atom cation |
InChI=1S/Cl/q+1 |
[Cl+] |
Cl+ |
|
| 7698057 |
DCl |
Hydrochloric acid-d |
InChI=1/ClH/h1H/i/hD |
[2HCl] |
 |
Hydrochloric acid-d
|
| 7647010 |
HCl- |
hydrogen chloride anion |
InChI=1S/ClH/h1H/q-1 |
[ClH-] |
 |
|
| 7647010 |
HCl |
Hydrogen chloride |
InChI=1/ClH/h1H |
Cl |
 |
Acide chlorhydrique; Acido cloridrico; Anhydrous hydrochloric acid; Anhydrous hydrogen chloride; Basilin; Chloorwaterstof; Chlorohydric acid; Chlorowodor; Chlorwasserstoff; Dilute hydrochloric acid; Hydrochloric Acid; Hydrochloric acid gas; Hydrochloric acid mixture; Hydrochloric acid, anhydrous; Hydrochloride; Hydrogen chloride; Hydrogen-chloride-anhydrous-; Muriatic acid; NA 1789; Salzsaeure; Spirits of salt; UN 1050; UN 1789; UN 2186
|
| 7647010 |
HCl+ |
hydrogen chloride cation |
InChI=1S/ClH/h1H/q+1 |
[ClH+] |
 |
|
| 42348414 |
H2Cl+ |
dihydrogen monochloride cation |
InChI=1S/ClH2/h1H2/q+1 |
[ClH2+] |
 |
|
| 7440371 |
Ar- |
Argon atom anion |
InChI=1S/Ar/q-1 |
[Ar-] |
Ar- |
|
| 7440371 |
Ar |
Argon atom |
InChI=1/Ar |
[Ar] |
Ar |
UN 1006; UN 1951; Argon
|
| 7440371 |
Ar+ |
Argon atom cation |
InChI=1/Ar/q+1 |
[Ar+] |
Ar+ |
|
| 12254681 |
ArH+ |
Argon hydride cation |
InChI=1S/Ar/q+1 |
[ArH+] |
 |
|
| 7440097 |
K- |
Potassium atom anion |
InChI=1S/K/q-1 |
[K-] |
K- |
|
| 7440097 |
K |
Potassium atom |
InChI=1/K |
[K] |
K |
UN 1420; UN 2257
|
| 7440097 |
K+ |
Potassium atom cation |
InChI=1S/K/q+1 |
[K+] |
K+ |
|
| 7693267 |
KH |
Potassium hydride |
InChI=1/K.H |
[KH] |
 |
|
| 7440702 |
Ca- |
Calcium atom anion |
InChI=1S/Ca/q-1 |
[Ca-] |
Ca- |
|
| 7440702 |
Ca |
Calcium atom |
InChI=1/Ca |
[Ca] |
Ca |
|
| 7440702 |
Ca+ |
Calcium atom cation |
InChI=1S/Ca/q+1 |
[Ca+] |
Ca+ |
|
| 14452756 |
CaH |
Calcium monohydride |
InChI=1S/Ca.H |
[CaH] |
 |
|
| 7789788 |
CaH2 |
Calcium Hydride |
1S/Ca.2H |
[CaH2] |
 |
Calcium dihydride; calcium hydride
|
| 7440326 |
Ti- |
Titanium atom anion |
InChI=1S/Ti/q-1 |
[Ti-] |
Ti- |
|
| 7440326 |
Ti |
Titanium atom |
InChI=1/Ti |
[Ti] |
Ti |
|
| 7440326 |
Ti+ |
Titanium atom cation |
InChI=1S/Ti/q+1 |
[Ti+] |
Ti+ |
|
| 7440508 |
Cu- |
Copper atom anion |
InChI=1S/Cu/q-1 |
[Cu-] |
Cu- |
|
| 7440508 |
Cu |
Copper atom |
InChI=1/Cu |
[Cu] |
Cu |
|
| 7440508 |
Cu+ |
Copper atom cation |
InChI=1S/Cu/q+1 |
[Cu+] |
Cu+ |
|
| 13517005 |
CuH |
Copper monohydride |
InChI=1S/Cu.H |
[CuH] |
 |
|
| 7440666 |
Zn- |
Zinc atom anion |
InChI=1S/Zn/q-1 |
[Zn-] |
Zn- |
|
| 7440666 |
Zn |
Zinc atom |
InChI=1/Zn |
[Zn] |
Zn |
|
| 7440666 |
Zn+ |
Zinc atom cation |
InChI=1S/Zn/q+1 |
[Zn+] |
Zn+ |
|
| 13981878 |
ZnH |
Zinc monohydride |
InChI=1S/Zn.H |
[ZnH] |
 |
|
| 14018827 |
ZnH2 |
Zinc hydride |
InChI=1S/Zn.2H |
[ZnH2] |
 |
|
| 7440564 |
Ge |
Germanium atom |
InChI=1S/Ge |
[Ge] |
Ge |
|
| 13572991 |
GeH |
germylidene |
InChI=1S/GeH/h1H |
[GeH] |
 |
|
| 24968556 |
GeH2 |
germylene |
InChI=1S/GeH2/h1H2 |
[GeH2] |
 |
|
| 13765452 |
GeH3 |
germyl radical |
InChI=1S/GeH3/h1H3 |
[GeH3] |
 |
|
| 7782652 |
GeH4 |
Germane |
InChI=1S/GeH4/h1H4 |
[GeH4] |
 |
|
| 7440382 |
As- |
Arsenic anion |
InChI=1S/As/q-1 |
[As-] |
As- |
|
| 7440382 |
As |
Arsenic atomic |
InChI=1S/As |
[As] |
As |
Arsen
|
| 7440382 |
As+ |
Arsenic cation |
InChI=1S/As/q+1 |
[As+] |
As+ |
|
| 12628089 |
AsH |
Arsenic monohydride |
InChI=1S/AsH/h1H |
[AsH] |
 |
|
| 14644452 |
AsH2 |
Arsenic dihydride |
InChI=1S/AsH2/h1H2 |
[AsH2] |
 |
|
| 7784421 |
AsH3 |
Arsine |
InChI=1S/AsH3/h1H3 |
[AsH3] |
 |
Arsenic trihydride; Arsenic hydride; Arsenous hydride; Hydrogen arsenide; UN 2188; arsine
|
| 7784421 |
AsH3+ |
Arsine cation |
InChI=1S/AsH3/h1H3/q+1 |
[AsH3+] |
 |
|
| 7782492 |
Se- |
Selenium atom anion |
InChI=1S/Se/q-1 |
[Se-] |
Se- |
|
| 7782492 |
Se |
Selenium atom |
InChI=1/Se |
[Se] |
Se |
Selenium
|
| 7782492 |
Se+ |
Selenium atom cation |
InChI=1S/Se/q+1 |
[Se+] |
Se+ |
|
| 13940222 |
HSe- |
selenium monohydride anion |
InChI=1S/H2Se/h1H2/p-1 |
[SeH-] |
 |
|
| 13940222 |
HSe |
Selenium monohydride |
InChI=1/HSe/h1H |
[SeH] |
 |
|
| 13940222 |
HSe+ |
selenium monohydride cation |
InChI=1S/HSe/h1H/q+1 |
[SeH+] |
 |
|
| 7783075 |
H2Se |
Hydrogen selenide |
InChI=1/H2Se/h1H2 |
[SeH2] |
 |
|
| 7783075 |
H2Se+ |
Hydrogen selenide cation |
InChI=1S/H2Se/h1H2/q+1 |
[SeH2+] |
 |
|
| 10097322 |
Br- |
Bromine atom anion |
InChI=1S/BrH/h1H/p-1 |
[Br-] |
Br- |
|
| 10097322 |
Br |
Bromine atom |
InChI=1/Br |
[Br] |
Br |
bromine; bromine
|
| 10097322 |
Br+ |
Bromine atom cation |
InChI=1S/Br/q+1 |
[Br+] |
Br+ |
|
| 10035106 |
HBr- |
hydrogen bromide anion |
InChI=1S/BrH/h1H/q-1 |
[BrH-] |
 |
|
| 10035106 |
HBr |
hydrogen bromide |
InChI=1/BrH/h1H |
Br |
 |
Bromwasserstoff; Hydrobromic acid; hydrogen bromide
|
| 10035106 |
HBr+ |
hydrogen bromide cation |
InChI=1S/BrH/h1H |
[BrH+] |
 |
|
| 7439909 |
Kr |
Krypton atom |
InChI=1S/Kr |
[Kr] |
Kr |
|
| 14362448 |
I- |
Iodine atom anion |
InChI=1S/HI/h1H/p-1 |
[I-] |
I- |
|
| 14362448 |
I |
Iodine atom |
InChI=1/I |
[I] |
I |
|
| 14362448 |
I+ |
Iodine atom cation |
InChI=1S/I/q+1 |
[I+] |
I+ |
|
| 10034852 |
HI |
Hydrogen iodide |
InChI=1/HI/h1H |
I |
 |
Hydriodic acid; Hydroiodic acid; hydrogen iodide
|
| 14452596 |
Li2- |
lithium dimer anion |
InChI=1S/2Li/q;-1 |
[Li]=[Li-] |
 |
|
| 14452596 |
Li2 |
Lithium diatomic |
InChI=1/2Li |
[Li][Li] |
 |
Lithium; Lithium dimer; dilithium
|
| 14452596 |
Li2+ |
lithium diatomic cation |
InChI=1S/2Li/q;+1 |
[Li][Li+] |
 |
|
| 14452609 |
Be2- |
Beryllium dimer anion |
InChI=1S/2Be/q;-1 |
[Be-]#[Be] |
 |
|
| 14452609 |
Be2 |
Beryllium diatomic |
InChI=1/2Be |
[Be][Be] |
 |
Beryllium; diberyllium
|
| 14452609 |
Be2+ |
Beryllium diatomic cation |
InChI=1S/2Be/q;+1 |
[Be+][Be] |
 |
|
| 14452610 |
B2- |
Boron diatomic anion |
InChI=1S/B2/c1-2/q-1 |
[B-]#B |
 |
|
| 14452610 |
B2 |
Boron diatomic |
InChI=1/B2/c1-2 |
[B]=[B] |
 |
boron; boron dimer; diboron
|
| 14452610 |
B2+ |
Boron diatomic cation |
InChI=1S/B2/c1-2/q+1 |
[B+]=[B] |
 |
|
| 18099451 |
B2H4 |
Diborane(4) D2d |
InChI=1S/B2H4/c1-2/h1-2H2 |
BB |
 |
|
| 16949158 |
LiBH4 |
Lithium borohydride |
InChI=1S/BH4.Li/h1H4;/q-1;+1 |
[Li+].[BH4-] |
 |
lithium tetrahydroborate
|
| 9000348 |
HBHHBH |
Diborane(4) C2V |
|
[BH2][BH2] |
 |
|
| 19287457 |
B2H6 |
Diborane |
InChI=1/2BH3/h2*1H3 |
B.B |
 |
Boron hydride; Diboron hexahydride; Boroethane; UN 1911
|
| 12011540 |
BC- |
boron monocarbide anion |
InChI=1S/CB/c1-2/q-1 |
B#[C-] |
 |
Boron carbide
|
| 12011540 |
BC |
boron monocarbide |
InChI=1S/CB/c1-2 |
B#[C] |
 |
Boron carbide
|
| 12011540 |
BC+ |
boron monocarbide cation |
InChI=1S/CB/c1-2/q+1 |
B#[C+] |
 |
Boron carbide
|
| 12070154 |
C2- |
carbon diatomic anion |
InChI=1S/C2/c1-2/q-1 |
[C-]=[C] |
 |
|
| 12070154 |
C2 |
Carbon diatomic |
InChI=1/C2/c1-2 |
[C]#[C] |
 |
Carbon (C2); Carbon dimer; Dicarbon
|
| 12070154 |
C2+ |
carbon diatomic cation |
InChI=1S/C2/c1-2/q+1 |
[C+]#[C] |
 |
|
| 2122487 |
C2H- |
Ethynyl anion |
InChI=1S/C2H/c1-2/h1H/q-1 |
[C-]#C |
 |
|
| 2122487 |
C2H |
Ethynyl radical |
InChI=1/C2H/c1-2/h1H |
[C]#C |
 |
Ethynyl; Ethynyl radical
|
| 2122487 |
C2H+ |
Ethynyl cation |
InChI=1S/C2H/c1-2/h1H/q+1 |
[C+]#C |
 |
|
| 74862 |
C2H2 |
Acetylene |
InChI=1/C2H2/c1-2/h1-2H |
C#C |
 |
Acetylen; Acetylene; Ethine; Ethyne; Narcylen; Vinylene; UN 1001
|
| 74862 |
C2H2+ |
acetylene cation |
InChI=1S/C2H2/c1-2/h1-2H/q+1 |
[CH]=[CH+] |
 |
|
| 2143693 |
CCH2 |
vinylidene |
InChI=1/C2H2/c1-2/h1H2 |
[C]=C |
 |
|
| 2669898 |
C2H3 |
vinyl |
InChI=1/C2H3/c1-2/h1H,2H2 |
[CH]=C |
 |
Vinyl; Vinyl radical
|
| 2669898 |
C2H3+ |
vinyl cation |
InChI=1S/C2H3/c1-2/h1H,2H2/q+1 |
[CH+]=C |
 |
|
| 917544 |
CH3Li |
methyl lithium |
InChI=1S/CH3.Li/h1H3; |
[Li]C |
 |
|
| 74851 |
C2H4- |
Ethylene anion |
InChI=1S/C2H4/c1-2/h1-2H2/q-1 |
[CH2][CH2-] |
 |
|
| 74851 |
C2H4 |
Ethylene |
InChI=1/C2H4/c1-2/h1-2H2 |
C=C |
 |
Acetene; Athylen; Bicarburretted hydrogen; Elayl; Ethene; Ethylene; Liquid ethyene; Olefiant gas; UN 1038; UN 1962
|
| 74851 |
C2H4+ |
Ethylene cation |
InChI=1S/C2H4/c1-2/h1-2H2/q+1 |
[CH2][CH2+] |
 |
|
| 4218502 |
CH3CH |
methylmethylene |
InChI=1S/C2H4/c1-2/h1H,2H3 |
[CH]C |
 |
|
| 2025561 |
C2H5 |
Ethyl radical |
InChI=1/C2H5/c1-2/h1H2,2H3 |
[CH2]C |
 |
Ethyl radical; ethyl
|
| 2025561 |
C2H5+ |
Ethyl cation |
InChI=1S/C2H5/c1-2-3-1/h1-2H2/q+1 |
[CH2+]C |
 |
|
| 74840 |
C2H6 |
Ethane |
InChI=1/C2H6/c1-2/h1-2H3 |
CC |
 |
Bimethyl; Dimethyl; Ethane; Ethyl hydride; Methylmethane; UN 1035; UN 1961
|
| 2074875 |
CN- |
cyanide anion |
InChI=1S/CN/c1-2/q-1 |
[C-]#N |
 |
Cyanide
|
| 2074875 |
CN |
Cyano radical |
InChI=1/CN/c1-2 |
[C]#N |
 |
Cyano radical; Cyanogen
|
| 2074875 |
CN+ |
Cyano cation |
InChI=1S/CN/c1-2/q+1 |
[C+]#N |
 |
|
| 7727379 |
N2- |
nitrogen diatomic anion |
InChI=1S/N2/c1-2/q-1 |
[N-]=[N] |
 |
|
| 7727379 |
N2 |
Nitrogen diatomic |
InChI=1/N2/c1-2 |
N#N |
 |
Diatomic nitrogen; Dinitrogen; Molecular nitrogen; Nitrogen; Nitrogen gas; Nitrogen-14; UN 1066; UN 1977
|
| 7727379 |
N2+ |
diatomic nitrogen cation |
InChI=1S/N2/c1-2/q+1 |
[N+]#N |
 |
|
| 10043115 |
BN- |
boron nitride anion |
InChI=1S/BN/c1-2/q-1 |
[B]=[N-] |
 |
|
| 10043115 |
BN |
boron nitride |
InChI=1/BN/c1-2 |
B#N |
 |
|
| 10043115 |
BN+ |
boron nitride cation |
InChI=1S/BN/c1-2/q+1 |
[B+]=[N] |
 |
|
| 32746319 |
LiN |
Lithium Nitride |
InChI=1S/Li.N |
[Li][N] |
 |
|
| 32746319 |
LiN+ |
Lithium Nitride cation |
InChI=1S/Li.N/q+1; |
[Li+][N] |
 |
|
| 37279111 |
BeN- |
Beryllium mononitride anion |
InChI=1S/Be.N/q;-1 |
[Be]=[N-] |
 |
|
| 37279111 |
BeN |
Beryllium mononitride |
InChI=1S/Be.N |
[Be]=[N] |
 |
|
| 37279111 |
BeN+ |
Beryllium mononitride cation |
InChI=1S/Be.N/q+1; |
[Be+][N] |
 |
|
| 36882130 |
NNH |
Dinitrogen monohydride |
InChI=1/HN2/c1-2/h1H |
N=[N] |
 |
|
| 36882130 |
NNH+ |
Dinitrogen monohydride cation |
InChI=1S/N2/c1-2/p+1 |
[NH+]#N |
 |
|
| 40493810 |
HNB |
hydrogen nitrogen boron |
InChI=1S/BHN/c1-2/h2H |
[NH][B] |
 |
|
| 6914074 |
HNC |
hydrogen isocyanide |
InChI=1/CHN/c1-2/h2H |
[NH+]#[C-] |
 |
Isocyanic acid
|
| 74908 |
HCN- |
Hydrogen cyanide anion |
InChI=1S/CHN/c1-2/h1H/q-1 |
[CH-]=[N] |
 |
|
| 74908 |
HCN |
Hydrogen cyanide |
InChI=1/CHN/c1-2/h1H |
C#N |
 |
AC; Acide cyanhydrique; Acido cianidrico; Aero liquid hcn; Aero@ Liquid HCN; Blausaeure; Blausaeure (German); Blauwzuur; Carbon hydride nitride; Carbon hydride nitride (CHN); Cyaanwaterstof; Cyanwasserstoff; Cyclon; Cyclone B; Cyjanowodor; Evercyn; Fluohydric acid gas; Formic anammonide; Formonitrile; Hydrocyanic acid; Hydrofluoric acid gas; Hydrogen cyanide; NA 1051; Prussic Acid; Prussic acid, unstabilized; Rcra waste number P063; Zaclondiscoids; UN 1051; UN 1613; UN 1614
|
| 74908 |
HCN+ |
hydrogen cyanide cation |
InChI=1S/CHN/c1-2/h1H/q+1 |
[CH+][N] |
 |
|
| 9000286 |
H2CN+ |
H2CN+ |
InChI=1S/CH2N/c1-2/h1H2/q+1 |
[CH2+][N] |
 |
protonated hydrogen cyanide
|
| 9000306 |
HCNH+ |
HCNH+ |
InChI=1S/CH2N/c1-2/h1-2H/q+1 |
C#[NH+] |
 |
InChI=1S/CHN/c1-2/h1H/p+1; [CH+][NH]; methylidyneammonium
|
| 9000317 |
CNH2+ |
CNH2+ |
InChI=1S/CH2N/c1-2/h2H2/q+1 |
[C]=[NH2+] |
 |
|
| 15626434 |
N2H2 |
trans-diazine |
InChI=1/H2N2/c1-2/h1-2H/b2-1+ |
N=N |
 |
(E)-Diazene; E-diazine; t-diazine; diazine; diazene
|
| 2053294 |
CH2NH |
Methanimine |
InChI=1/CH3N/c1-2/h2H,1H2 |
C=N |
 |
Methanimine; Methyleneimine
|
| 302012 |
N2H4 |
Hydrazine |
InChI=1/H4N2/c1-2/h1-2H2 |
NN |
 |
Diamide; Diamide hydrate; Diamine; Hydrazine; Hydrazine, anhydrous; Hydrazyna; Levoxine; Rcra waste number U133; UN 2030; UN 2029
|
| 10507296 |
CH2NH2+ |
methyleneamine cation |
InChI=1S/CH3N/c1-2/h2H,1H2/p+1 |
C=[NH2+] |
 |
|
| 74895 |
CH3NH2 |
methyl amine |
InChI=1/CH5N/c1-2/h2H2,1H3 |
CN |
 |
Aminomethane; Anhydrous methylamine; Carbinamine; Mercurialin; Methanamine; Methylamine; Methylaminen; Metilamine; Metyloamina; Monomethylamine; UN 1235; UN 1061
|
| 22 |
NH3NH3 |
Ammonia Dimer |
InChI=1/H6N2/c1-3-2/h1H2,2H3 |
N.N |
 |
|
| 13774817 |
BH3NH3 |
borane ammonia |
InChI=1S/BH6N/c1-2/h1-2H3 |
[BH3-][NH3+] |
 |
|
| 17000009 |
CH3NH3+ |
protonated methylamine |
InChI=1S/CH5N/c1-2/h2H2,1H3/p+1 |
C[NH3+] |
 |
|
| 12505770 |
BO- |
boron monoxide anion |
InChI=1S/BO/c1-2/q-1 |
[B][O-] |
 |
|
| 12505770 |
BO |
boron monoxide |
InChI=1/BO/c1-2 |
[B]=O |
 |
Boron monoxide; Boron oxide
|
| 12505770 |
BO+ |
boron monoxide cation |
InChI=1S/BO/c1-2/q+1 |
[B+]=O |
 |
|
| 10102439 |
NO- |
nitric oxide anion |
InChI=1S/NO/c1-2/q-1 |
[N-]=O |
 |
|
| 10102439 |
NO |
Nitric oxide |
InChI=1/NO/c1-2 |
[N]=O |
 |
Amidogen, oxo-; Nitric oxide; Nitrogen monoxide; Nitrogen oxide; Nitrogen oxide (NO); Nitrosyl radical
|
| 10102439 |
NO+ |
nitric oxide cation |
InChI=1S/NO/c1-2/q+1 |
[O+]#N |
 |
|
| 12142777 |
LiO- |
lithium oxide anion |
InChI=1S/Li.O/q;-1 |
[Li][O-] |
 |
|
| 12142777 |
LiO |
lithium oxide |
InChI=1/Li.O |
[Li][O] |
 |
Lithium oxide
|
| 12142777 |
LiO+ |
lithium oxide cation |
InChI=1S/Li.O/q+1; |
[Li+]=O |
 |
|
| 7782447 |
O2- |
oxygen diatomic anion |
InChI=1S/O2/c1-2/q-1 |
[O-][O] |
 |
|
| 7782447 |
O2 |
Oxygen diatomic |
InChI=1/O2/c1-2 |
O=O |
 |
Dioxygen; Molecular oxygen; Oxygen; Oxygen molecule; Oxygen-16; UN 1072; UN 1073
|
| 7782447 |
O2+ |
diatomic oxygen cation |
InChI=1S/O2/c1-2/q+1 |
[O+]=O |
 |
|
| 1304569 |
BeO- |
Beryllium monoxide anion |
InChI=1S/Be.O/q;-1 |
[Be][O-] |
 |
|
| 1304569 |
BeO |
beryllium oxide |
InChI=1/Be.O |
[Be]=O |
 |
BeO; Beryllia; Beryllium monoxide; Beryllium oxide; Beryllium oxide (BeO); Beryllium oxide, α; Thermalox
|
| 1304569 |
BeO+ |
Beryllium monoxide cation |
InChI=1S/Be.O/q;+1 |
[Be+][O] |
 |
|
| 630080 |
CO- |
carbon monoxide anion |
InChI=1S/CO/c1-2/q-1 |
[C][O-] |
 |
|
| 630080 |
CO |
Carbon monoxide |
InChI=1/CO/c1-2 |
[C]=O |
 |
Carbon monooxide; Carbon monoxide; Carbon monoxide, cryogenic liquid; Carbon oxide; Carbon oxide (CO); Carbon oxide (CO1+); Carbone; Carbonic oxide; Carbonio; Exhaust Gas; Flue gas; Flue gasnide; Kohlenmonoxid; Kohlenoxyd; Koolmonoxyde; Monoxide; NA 9202; Oxyde de carbone; UN 1016; Wegla tlenek
|
| 630080 |
CO+ |
carbon monoxide cation |
InChI=1S/CO/c1-2/q+1 |
[C+]=O |
 |
|
| 1310663 |
LiOH |
lithium hydroxide |
InChI=1/Li.H2O/h;1H2/q+1;/p-1 |
[Li]O |
 |
Lithium Hydroxide; Lithium hydroxide hydrate; Lithium hydroxide, monohydrate; UN 2680
|
| 2597446 |
HCO- |
formyl anion |
InChI=1S/CHO/c1-2/h1H/q-1 |
[CH-]=O |
 |
|
| 2597446 |
HCO |
Formyl radical |
InChI=1/CHO/c1-2/h1H |
[CH]=O |
 |
Formyl; Formyl radical
|
| 2597446 |
HCO+ |
Formyl cation |
InChI=1S/CHO/c1-2/h1H/q+1 |
[CH+]=O |
 |
|
| 3170830 |
HO2- |
Hydroperoxy anion |
InChI=1S/H2O2/c1-2/h1-2H/p-1 |
O[O-] |
 |
|
| 3170830 |
HO2 |
Hydroperoxy radical |
InChI=1/HO2/c1-2/h1H |
O[O] |
 |
Hydroperoxo; Hydroperoxy radical; hydroperoxyl
|
| 3170830 |
HO2+ |
Hydroperoxy cation |
InChI=1S/HO2/c1-2/h1H/q+1 |
O[O+] |
 |
|
| 20611590 |
HBO |
Boron hydride oxide |
InChI=1/BHO/c1-2/h1H |
B=O |
 |
Boron hydride oxide; oxoborane
|
| 20768687 |
BeOH |
beryllium hydroxide |
InChI=1/Be.H2O/h;1H2/q+1;/p-1 |
[Be]O |
 |
BeOH; Beryllium hydroxide
|
| 14332286 |
HNO- |
Nitrosyl hydride anion |
InChI=1S/HNO/c1-2/h1H/q-1 |
[NH-][O] |
 |
|
| 14332286 |
HNO |
Nitrosyl hydride |
InChI=1/HNO/c1-2/h1H |
N=O |
 |
Nitrosyl hydride
|
| 14332286 |
HNO+ |
Nitrosyl hydride cation |
InChI=1S/HNO/c1-2/h1H/q+1 |
[NH+]=O |
 |
|
| 7722841 |
H2O2 |
Hydrogen peroxide |
InChI=1/H2O2/c1-2/h1-2H |
OO |
 |
Dihydrogen dioxide; Elawox; Hydrogen dioxide; Hydrogen oxide; Hydrogen peroxide; Hydrogen peroxide (H2O2); Hydrogen Peroxide [Topical Solution]; Hydrogen peroxide solution; Perhydrol; Perossido di idrogeno; Peroxaan; Peroxyde d'hydrogene; Superoxol; T-Stuff; Waterstofperoxyde; UN 2014; Wasserstoffperoxid
|
| 7722841 |
H2O2+ |
Hydrogen peroxide cation |
InChI=1S/H2O2/c1-2/h1-2H/q+1 |
O[OH+] |
 |
|
| 50000 |
H2CO- |
formaldehyde anion |
InChI=1S/CH2O/c1-2/h1H2/q-1 |
C=[O-] |
 |
|
| 50000 |
H2CO |
Formaldehyde |
InChI=1/CH2O/c1-2/h1H2 |
C=O |
 |
Aldehyd mravenci; Aldehyde formique; Aldeide formica; BFV; FA; Fannoform; Formaldehyd; Formaldehyde; Formaldehyde, gas; Formalin; Formalin 40; Formalina; Formaline; Formalin-loesungen; Formalith; Formic aldehyde; Formol; Fyde; Hoch; Ivalon; Karsan; Lysoform; Methaldehyde; Methanal; Methyl aldehyde; Methylene glycol; Methylene oxide; Morbicid; NCI-C02799; Oplossingen; Oxomethane; Oxymethylene; Paraform; Polyoxymethylene glycols; Rcra waste number U122; Superlysoform; UN 2209; UN 1198
|
| 50000 |
H2CO+ |
formaldehyde cation |
InChI=1S/CH2O/c1-2/h1H2/q+1 |
C=[O+] |
 |
|
| 2143682 |
CH3O- |
methoxy anion |
InChI=1S/CH3O/c1-2/h1H3/q-1 |
C[O-] |
 |
|
| 2143682 |
CH3O |
Methoxy radical |
InChI=1/CH3O/c1-2/h1H3 |
C[O] |
 |
Methoxy; Methoxy radical; methoxyl
|
| 2597435 |
CH2OH |
Hydroxymethyl radical |
InChI=1/CH3O/c1-2/h2H,1H2 |
[CH2]O |
 |
Hydroxymethyl; Hydroxymethyl radical; Methyl radical, hydroxy-; Methyl, hydroxy-
|
| 2597435 |
CH2OH+ |
hydroxymethyl cation |
InChI=1S/CH3O/c1-2/h2H,1H2/q+1 |
[CH2+]O |
 |
|
| 9000359 |
H3O2+ |
hydrogen peroxide, protonated |
InChI=1S/H2O2/c1-2/h1-2H/p+1 |
O[OH2+] |
 |
|
| 9000253 |
NH3O |
Ammonia Oxide |
InChI=1S/H3NO/c1-2/h1H3 |
[NH3+][O-] |
 |
amine oxide
|
| 7803498 |
NH2OH |
hydroxylamine |
InChI=1/H3NO/c1-2/h2H,1H2 |
NO |
 |
Oxammonium; hydroxylamine
|
| 67561 |
CH3OH- |
Methyl alcohol anion |
InChI=1S/CH4O/c1-2/h2H,1H3/q-1 |
C[OH-] |
 |
|
| 67561 |
CH3OH |
Methyl alcohol |
InChI=1/CH4O/c1-2/h2H,1H3 |
CO |
 |
Alcool methylique; Alcool metilico; Carbinol; Colonial spirit; Columbian spirit; Columbian spirits; Hydroxymethane; Metanolo; Methanol; Methyl Alcohol; Methyl hydrate; Methyl hydroxide; Methylalkohol; Methylol; Metylowy alkohol; Monohydroxymethane; Pyroxylic spirit; Rcra waste number U154; Wood alcohol; UN 1230; Wood spirit; Wood naphtha
|
| 67561 |
CH3OH+ |
Methyl alcohol cation |
InChI=1S/CH4O/c1-2/h2H,1H3/q+1 |
C[OH+] |
 |
|
| 25655838 |
H2OH2O |
water dimer |
InChI=1S/2H2O/h2*1H2 |
O.O |
 |
waterdimer
|
| 33 |
H2ONH3 |
Water Ammonia Dimer |
InChI=1/H5NO/c1-3-2/h2H,1H3 |
N.O |
 |
|
| 12061700 |
FO- |
flourine oxide anion |
InChI=1S/FO/c1-2/q-1 |
F[O-] |
 |
|
| 12061700 |
FO |
Oxygen monofluoride |
InChI=1/FO/c1-2 |
F[O] |
 |
Oxygen fluoride
|
| 12061700 |
FO+ |
fluorine monoxide cation |
InChI=1S/FO/c1-2/q+1 |
F[O+] |
 |
|
| 13768600 |
BF- |
Boron monofluoride anion |
InChI=1S/BF/c1-2/q-1 |
[B][F-] |
 |
|
| 13768600 |
BF |
Boron monofluoride |
InChI=1/BF/c1-2 |
[B]F |
 |
Fluoroborane
|
| 13768600 |
BF+ |
Boron monofluoride cation |
InChI=1S/BF/c1-2/q+1 |
[B+]F |
 |
|
| 13597961 |
BeF- |
Beryllium monofluoride anion |
InChI=1S/Be.FH/h;1H/p-1 |
[Be][F-] |
 |
|
| 13597961 |
BeF |
Beryllium monofluoride |
InChI=1/Be.FH/h;1H/q+1;/p-1 |
[Be]F |
 |
Beryllium fluoride
|
| 13597961 |
BeF+ |
Beryllium monofluoride cation |
InChI=1S/Be.FH/h;1H/q+2;/p-1 |
[Be+]F |
 |
|
| 3889756 |
CF- |
carbon monofluoride anion |
InChI=1S/CF/c1-2/q-1 |
[C-]F |
 |
|
| 3889756 |
CF |
Fluoromethylidyne |
InChI=1/CF/c1-2 |
[C]F |
 |
Fluoromethylidyne
|
| 3889756 |
CF+ |
carbon monofluoride cation |
InChI=1S/CF/c1-2/q+1 |
[C+]F |
 |
|
| 7782414 |
F2- |
flourine diatomic anion |
InChI=1S/F2/c1-2/q-1 |
[F-]F |
 |
|
| 7782414 |
F2 |
Fluorine diatomic |
InChI=1/F2/c1-2 |
FF |
 |
Bifluoriden; Fluor; Fluorine; Fluorine, compressed; Fluoro; Fluorures acide; Fluoruri acidi; Rcra waste number P056; Saeure fluoride; UN 1045; difluorine
|
| 7782414 |
F2+ |
flourine diatomic cation |
InChI=1S/F2/c1-2/q+1 |
[F+]F |
 |
|
| 7789244 |
LiF- |
lithium fluoride anion |
InChI=1S/FH.Li/h1H;/p-1 |
[Li][F-] |
 |
|
| 7789244 |
LiF |
lithium fluoride |
InChI=1/FH.Li/h1H;/q;+1/p-1 |
[Li]F |
 |
Fluorolithium; Lithium fluoride; Lithium fluoride (Li3F3); Lithium fluoride (LiF); Lithium fluorure; Lithium monofluoride; NTL 50; TLD 100; TLD 700; Trilithium trifluoride
|
| 7789244 |
LiF+ |
lithium fluoride cation |
InChI=1S/FH.Li/h1H;/q;+2/p-1 |
[Li+]F |
 |
|
| 13967061 |
NF- |
nitrogen monofluorine anion |
InChI=1S/FN/c1-2/q-1 |
[N-]F |
 |
Fluoroimidogen anion
|
| 13967061 |
NF |
nitrogen fluoride |
InChI=1/FN/c1-2 |
[N]F |
 |
Fluoroimidogen
|
| 13967061 |
NF+ |
nitrogen monofluoirde cation |
InChI=1S/FN/c1-2/q+1 |
[N+]F |
 |
Fluoroimidogen cation
|
| 14034798 |
HOF |
Hypofluorous acid |
InChI=1/FHO/c1-2/h2H |
FO |
 |
Hypofluorous acid
|
| 18130740 |
FHF- |
FHF- |
|
|
 |
|
| 18130740 |
FHF |
FHF |
|
|
 |
|
| 13453526 |
HCF |
Fluoromethylene |
InChI=1/CHF/c1-2/h1H |
[CH]F |
 |
Fluoromethylene
|
| 3744294 |
CH2F |
fluoromethyl radical |
1S/CH2F/c1-2/h1H2 |
[CH2]F |
 |
Methyl, fluoro-; Methyl radical, fluoro-; fluoromethane
|
| 30664121 |
H2F2 |
Hydrogen fluoride dimer |
InChI=1/F2H2/c1-3-2/h1H |
F.F |
 |
Hydrogen fluoride dimer
|
| 15861059 |
NH2F |
monofluoroamine |
InChI=1S/FH2N/c1-2/h2H2 |
NF |
 |
Monofluoroammonia; Fluoroamine
|
| 593533 |
CH3F |
Methyl fluoride |
InChI=1/CH3F/c1-2/h1H3 |
CF |
 |
Fluoromethane; Freon 41; Methane, fluoro-; Methyl fluoride; UN 2454
|
| 12185056 |
Ne2 |
Neon dimer |
InChI=1S/Ne2/c1-2 |
[Ne][Ne] |
 |
|
| 12333492 |
NaLi- |
lithium sodium anion |
InChI=1S/Li.Na/q-1; |
[Na][Li-] |
 |
|
| 12333492 |
NaLi |
lithium sodium |
InChI=1S/Li.Na |
[Na][Li] |
 |
|
| 12333492 |
NaLi+ |
lithium sodium cation |
InChI=1S/Li.Na/q+1; |
[Na][Li+] |
 |
|
| 25681792 |
Na2- |
sodium dimer anion |
InChI=1S/2Na/q;-1 |
[Na]=[Na-] |
 |
|
| 25681792 |
Na2 |
Sodium diatomic |
InChI=1/2Na |
[Na][Na] |
 |
Sodium; Sodium dimer; disodium
|
| 25681792 |
Na2+ |
sodium dimer cation |
InChI=1S/2Na/q;+1 |
[Na][Na+] |
 |
|
| 12401864 |
NaO- |
sodium oxide anion |
InChI=1S/Na.O/q;-1 |
[Na][O-] |
 |
|
| 12401864 |
NaO |
sodium monoxide |
InChI=1/Na.O |
[Na][O] |
 |
Calcined soda; Disodium monoxide; Disodium oxide; Sodium monoxide; Sodium oxide; UN 1825
|
| 12401864 |
NaO+ |
sodium oxide cation |
InChI=1S/Na.O/q+1; |
[Na+][O] |
 |
|
| 1310732 |
NaOH |
sodium hydroxide |
InChI=1/Na.H2O/h;1H2/q+1;/p-1 |
[Na]O |
 |
Aetznatron; Ascarite; Caustic soda; Collo-Grillrein; Collo-Tapetta; Fuers Rohr; Hydroxyde de sodium; Liquid-plumr; Lye; Natriumhydroxid; Natriumhydroxyde; Plung; Rohrputz; Rohrreiniger Rofix; Soda lye; Soda, caustic; Sodio(idrossido di); Sodium hydrate; Sodium Hydroxide; Sodium hydroxide (Na(OH)); Sodium hydroxide, anhydrous; Sodium(hydroxyde de); White caustic
|
| 7681494 |
NaF- |
sodium fluoride anion |
InChI=1S/FH.Na/h1H;/p-1 |
[Na][F-] |
 |
|
| 7681494 |
NaF |
sodium fluoride |
InChI=1/FH.Na/h1H;/q;+1/p-1 |
[Na]F |
 |
Alcoa sodium fluoride; Antibulit; Checkmate; FDA 0101; Floridine; Florocid; Fluonatril; Fluoraday; Fluorid sodny; Fluoride, sodium; Fluorident; Fluorinse; Fluorol; Fluorure de sodium; Flura; Flura Drops; Flurexal; Flursol; Flux; Fungol B; Gel II; Karidium; Koreberon; Les-Cav; Liquiflur; Luride; Minute-Gel; NCI-C55221; Ossalin; Ossin; Osteopor-F; Pediaflor; Pergantene; Roach salt; Sodium flouride; Sodium Fluoride; Sodium fluoride (Na2F2); Sodium fluoride (NaF); Sodium fluoride cyclic dimer; Sodium fluorure; Sodium hydrofluoride; Sodium monofluoride; t-Fluoride; Zymafluor; Xaridium; Villiaumite
|
| 7681494 |
NaF+ |
sodium fluoride cation |
InChI=1S/FH.Na/h1H;/q;+2/p-1 |
[Na+]F |
 |
|
| 29904798 |
Mg2- |
magnesium dimer anion |
InChI=1S/2Mg/q;-1 |
[Mg]#[Mg-] |
 |
|
| 29904798 |
Mg2 |
Magnesium diatomic |
InChI=1/2Mg |
[Mg]=[Mg] |
 |
Magnesium; Magnesium dimer; dimagnesium
|
| 29904798 |
Mg2+ |
magnesium dimer cation |
InChI=1S/2Mg/q;+1 |
[Mg][Mg+] |
 |
|
| 1309484 |
MgO- |
magnesium oxide anion |
InChI=1S/Mg.O/q-1; |
[Mg][O-] |
 |
|
| 1309484 |
MgO |
magnesium oxide |
InChI=1/Mg.O |
[Mg]=O |
 |
Akro-mag; Animag; Calcined brucite; Calcined magnesia; Calcined magnesite; Granmag; Magcal; Magchem 100; Maglite; Magnesia; Magnesia usta; Magnesium Oxide; Magnesium oxide (MgO); Magnezu tlenek; Magox; Magox 85; Magox 90; Magox 95; Magox 98; Magox op; Marmag; Oxymag; Periclase; Seawater magnesia
|
| 1309484 |
MgO+ |
magnesium oxide cation |
InChI=1S/Mg.O/q;+1 |
[Mg+][O] |
 |
|
| 12141116 |
MgOH |
magnesium hydroxide |
InChI=1/Mg.H2O/h;1H2/q+1;/p-1 |
[Mg]O |
 |
Magnesium hydroxide
|
| 14953287 |
MgF- |
magnesium fluoride anion |
InChI=1S/FH.Mg/h1H;/p-1 |
[Mg][F-] |
 |
|
| 14953287 |
MgF |
Magnesium monofluoride |
InChI=1/FH.Mg/h1H;/q;+1/p-1 |
[Mg]F |
 |
Magnesium fluoride
|
| 14953287 |
MgF+ |
magnesium fluoride cation |
InChI=1S/FH.Mg/h1H;/q;+2/p-1 |
[Mg+]F |
 |
|
| 32752946 |
Al2- |
aluminum dimer anion |
InChI=1S/2Al/q;-1 |
[Al]#[Al-] |
 |
|
| 32752946 |
Al2 |
Aluminum diatomic |
InChI=1/2Al |
[Al]#[Al] |
 |
Aluminum; dialuminum
|
| 32752946 |
Al2+ |
aluminum dimer cation |
InChI=1S/2Al/q;+1 |
[Al]=[Al+] |
 |
|
| 24304005 |
AlN- |
aluminum mononitride anion |
InChI=1S/Al.N/q;-1 |
[Al]=[N-] |
 |
|
| 24304005 |
AlN |
Aluminum nitride |
InChI=1/Al.N |
[Al]#N |
 |
|
| 24304005 |
AlN+ |
aluminum mononitride cation |
InChI=1S/Al.N/q+1; |
[Al+]=[N] |
 |
|
| 14457648 |
AlO- |
Aluminum monoxide anion |
InChI=1S/Al.O/q;-1 |
[Al][O-] |
 |
|
| 14457648 |
AlO |
Aluminum monoxide |
InChI=1/Al.O |
[Al]=O |
 |
Aluminum oxide
|
| 14457648 |
AlO+ |
aluminum monoxide cation |
InChI=1S/Al.O/q+1; |
[Al+]=O |
 |
|
| 13595829 |
AlF- |
Aluminum monofluoride anion |
InChI=1S/Al.FH/h;1H/p-1 |
[Al][F-] |
 |
|
| 13595829 |
AlF |
Aluminum monofluoride |
InChI=1/Al.FH/h;1H/q+1;/p-1 |
[Al]F |
 |
Aluminum fluoride; Aluminum monofluoride; aluminum(I) fluoride
|
| 13595829 |
AlF+ |
Aluminum monofluoride cation |
InChI=1S/Al.FH/h;1H/q+2;/p-1 |
[Al+]F |
 |
|
| 12597352 |
Si2- |
silcon dimer anion |
InChI=1S/Si2/c1-2/q-1 |
[Si]#[Si-] |
 |
|
| 12597352 |
Si2 |
Silicon diatomic |
InChI=1/Si2/c1-2 |
[Si]=[Si] |
 |
Silicon dimer; silicon dimer
; disilicon
|
| 12597352 |
Si2+ |
silcon dimer cation |
InChI=1S/Si2/c1-2/q+1 |
[Si]#[Si+] |
 |
|
| 409212 |
SiC- |
silicon monocarbide anion |
InChI=1S/CSi/c1-2/q-1 |
[Si]#[C-] |
 |
|
| 409212 |
SiC |
silicon monocarbide |
InChI=1S/CSi/c1-2 |
[Si]#[C] |
 |
Silicon carbide
|
| 409212 |
SiC+ |
silicon monocarbide cation |
InChI=1S/CSi/c1-2/q+1 |
[Si]#[C+] |
 |
|
| 51067846 |
CH2SiH2 |
silaethylene |
InChI=1S/CH4Si/c1-2/h1-2H2 |
C=Si |
 |
|
| 1590870 |
Si2H6 |
disilane |
InChI=1/H6Si2/c1-2/h1-2H3 |
[SiH3][SiH3] |
 |
Disilane; Silicoethane
|
| 992949 |
CH3SiH3 |
methyl silane |
InChI=1/CH6Si/c1-2/h1-2H3 |
[SiH3]C |
 |
Methylsilane; Silaethane; Silane, methyl-
|
| 12033602 |
SiN- |
silicon mononitride anion |
InChI=1S/NSi/c1-2/q-1 |
[Si]=[N-] |
 |
|
| 12033602 |
SiN |
Silicon nitride |
InChI=1/NSi/c1-2 |
[Si]#N |
 |
Silicon nitride; Silicon nitride (SiN)
|
| 12033602 |
SiN+ |
silicon mononitride cation |
InChI=1S/NSi/c1-2/q+1 |
[Si+]#N |
 |
|
| 10097286 |
SiO- |
silicon monoxide anion |
InChI=1S/OSi/c1-2/q-1 |
[Si-]=O |
 |
|
| 10097286 |
SiO |
Silicon monoxide |
InChI=1/OSi/c1-2 |
[Si][O] |
 |
Silicon monoxide; Silicon oxide; Silicon(II) oxide; Silylene, oxo-
|
| 10097286 |
SiO+ |
silicon monoxide cation |
InChI=1S/OSi/c1-2/q+1 |
[Si]#[O+] |
 |
|
| 11128248 |
SiF- |
silicon monofluoride anion |
InChI=1S/FSi/c1-2/q-1 |
[Si-]F |
 |
|
| 11128248 |
SiF |
silicon monofluoride |
InChI=1/FSi/c1-2 |
[Si]F |
 |
Fluorosilylidyne; Silicon fluoride; Silylidyne, fluoro-
|
| 11128248 |
SiF+ |
silicon monofluoride cation |
InChI=1S/FSi/c1-2/q+1 |
[Si]=[F+] |
 |
|
| 13537332 |
SiH3F |
monofluorosilane |
InChI=1/FH3Si/c1-2/h2H3 |
[SiH3]F |
 |
Fluorosilane; Silane, fluoro-
|
| 12326851 |
CP- |
carbon monophosphide anion |
InChI=1S/CP/c1-2/q-1 |
[C-]#P |
 |
|
| 12326851 |
CP |
Carbon monophosphide |
InChI=1/CP/c1-2 |
[C]=[P] |
 |
Carbon phosphide
|
| 12326851 |
CP+ |
carbon monophosphide cation |
InChI=1S/CP/c1-2/q+1 |
[C]#[P+] |
 |
|
| 12185090 |
P2- |
phosphorus dimer anion |
InChI=1S/P2/c1-2/q-1 |
[P]=[P-] |
 |
|
| 12185090 |
P2 |
Phosphorus diatomic |
InChI=1/P2/c1-2 |
P#P |
 |
Phosphorus; Phosphorus dimer; Phosphorus dimer; phosphorus(III) phosphide
|
| 12185090 |
P2+ |
phosphorus dimer cation |
InChI=1S/P2/c1-2/q+1 |
P#[P+] |
 |
|
| 12137643 |
SiP- |
Silicon monophosphide anion |
InChI=1S/PSi/c1-2/q-1 |
[Si]#[P-] |
 |
|
| 12137643 |
SiP |
Silicon monophosphide |
InChI=1S/PSi/c1-2 |
[Si]#P |
 |
|
| 12137643 |
SiP+ |
Silicon monophosphide cation |
InChI=1S/PSi/c1-2/q+1 |
[Si]#[P+] |
 |
|
| 17739478 |
PN- |
phosphorus nitride anion |
InChI=1S/NP/c1-2/q-1 |
[P]=[N-] |
 |
|
| 17739478 |
PN |
Phosphorus mononitride |
InChI=1/NP/c1-2 |
P#N |
 |
Phosphorous nitride; Phosphorus nitride
|
| 17739478 |
PN+ |
phosphorus nitride cation |
InChI=1S/NP/c1-2/q+1 |
P#[N+] |
 |
|
| 13817066 |
HPO |
HPO |
InChI=1/HOP/c1-2/h1H |
P=O |
 |
|
| 13817066 |
HPO+ |
HPO cation |
InChI=1S/HOP/c1-2/h2H/q+1 |
[PH+]=O |
 |
|
| 6829523 |
HCP |
HCP |
InChI=1/CHP/c1-2/h1H |
C#P |
 |
CHP; Methinophosphide; Phosphaethyne; methylidynephosphine
|
| 61183537 |
CH2PH |
H2CPH |
InChI=1/CH3P/c1-2/h2H,1H2 |
[CH2]=[PH] |
 |
Phosphethene; methylenephosphine
|
| 13445506 |
P2H4 |
H2PPH2 |
InChI=1/H4P2/c1-2/h1-2H2 |
PP |
 |
Diphosphine
|
| 593544 |
CH3PH2 |
Methyl phosphine |
InChI=1/CH5P/c1-2/h2H2,1H3 |
PC |
 |
Methylphosphine; Phosphine, methyl-
|
| 14452665 |
PO- |
phosphorus monoxide anion |
InChI=1S/OP/c1-2/q-1 |
[P-]=O |
 |
|
| 14452665 |
PO |
Phosphorus monoxide |
InChI=1/OP/c1-2 |
[P]=O |
 |
Phosphorus oxide
|
| 14452665 |
PO+ |
phosphorus monoxide cation |
InChI=1S/OP/c1-2/q+1 |
O=[P+] |
 |
|
| 16027922 |
PF- |
phosphorus monofluoride anion |
InChI=1S/FP/c1-2/q-1 |
[P][F-] |
 |
|
| 16027922 |
PF |
phosphorus monofluoride |
InChI=1/FP/c1-2 |
[P]F |
 |
Phosphorus fluoride; Phosphorus monofluoride
|
| 16027922 |
PF+ |
phosphorus monofluoride cation |
InChI=1S/FP/c1-2/q+1 |
[P+]F |
 |
|
| 23550450 |
S2- |
sulfur dimer anion |
InChI=1S/S2/c1-2/q-1 |
[S][S-] |
 |
|
| 23550450 |
S2 |
Sulfur diatomic |
InChI=1/S2/c1-2 |
S=S |
 |
Sulfur; disulfur
|
| 23550450 |
S2+ |
sulfur dimer cation |
InChI=1S/S2/c1-2/q+1 |
S=[S+] |
 |
|
| 12228396 |
BS- |
boron monosulfide anion |
InChI=1S/BS/c1-2/q-1 |
[B][S-] |
 |
|
| 12228396 |
BS |
boron sulfide |
InChI=1/BS/c1-2 |
[B]=S |
 |
Boron sulfide
|
| 12228396 |
BS+ |
boron monosulfide cation |
InChI=1S/BS/c1-2/q+1 |
B#[S+] |
 |
|
| 12251900 |
AlS- |
aluminum monosulfide anion |
InChI=1S/Al.S/q;-1 |
[Al][S-] |
 |
|
| 12251900 |
AlS |
Aluminum sulfide |
InChI=1/Al.S |
[Al]=S |
 |
Aluminum sulfide
|
| 12251900 |
AlS+ |
aluminum monosulfide cation |
InChI=1S/Al.S/q+1; |
[Al+]=S |
 |
|
| 12281366 |
PS- |
phosphorus monosulfide anion |
InChI=1S/PS/c1-2/q-1 |
[P][S-] |
 |
|
| 12281366 |
PS |
phosphorus sulfide |
InChI=1/PS/c1-2 |
[P]=S |
 |
Phosphorus sulfide
|
| 12281366 |
PS+ |
phosphorus monosulfide cation |
InChI=1S/PS/c1-2/q+1 |
[P+]=S |
 |
|
| 12504415 |
SiS- |
silicon monosulfide anion |
InChI=1S/SSi/c1-2/q-1 |
[Si][S-] |
 |
|
| 12504415 |
SiS |
silicon monosulfide |
InChI=1S/SSi/c1-2 |
[Si]=S |
 |
Silicon monosulfide; Silicon sulfide; silicon(II) sulfide
|
| 12504415 |
SiS+ |
silicon monosulfide cation |
InChI=1S/SSi/c1-2/q+1 |
[Si+]=S |
 |
|
| 13827322 |
SO- |
sulfur monoxide anion |
InChI=1S/OS/c1-2/q-1 |
[S][O-] |
 |
|
| 13827322 |
SO |
Sulfur monoxide |
InChI=1/OS/c1-2 |
S=O |
 |
Sulfur monoxide; Sulfur oxide
|
| 13827322 |
SO+ |
sulfur monoxide cation |
InChI=1S/OS/c1-2/q+1 |
[S+]=O |
 |
|
| 13598226 |
BeS- |
Beryllium monosulfide anion |
InChI=1S/Be.S/q;-1 |
[Be][S-] |
 |
|
| 13598226 |
BeS |
beryllium sulfide |
InChI=1/Be.S |
[Be]=S |
 |
Beryllium sulfide; Beryllium sulfide (BeS)
|
| 13598226 |
BeS+ |
Beryllium monosulfide cation |
InChI=1S/Be.S/q+1; |
[Be+][S] |
 |
|
| 12032369 |
MgS- |
magnesium sulfide anion |
InChI=1S/Mg.S/q;-1 |
[Mg][S-] |
 |
|
| 12032369 |
MgS |
magnesium sulfide |
InChI=1/Mg.S |
[Mg]=S |
 |
Magnesium sulfide; Magnesium sulfide (MgS)
|
| 12032369 |
MgS+ |
magnesium sulfide cation |
InChI=1S/Mg.S/q+1; |
[S][Mg+] |
 |
|
| 12033566 |
NS- |
nitrogen sulfide anion |
InChI=1S/NS/c1-2/q-1 |
[N-]=S |
 |
|
| 12033566 |
NS |
Mononitrogen monosulfide |
InChI=1/NS/c1-2 |
[N]=S |
 |
Nitrogen sulfide; Sulfur nitride
|
| 12033566 |
NS+ |
nitrogen sulfide cation |
InChI=1S/NS/c1-2/q+1 |
N#[S+] |
 |
|
| 2944050 |
CS- |
carbon monosulfide anion |
InChI=1S/CS/c1-2/q-1 |
[C-]=S |
 |
|
| 2944050 |
CS |
carbon monosulfide |
InChI=1/CS/c1-2 |
[C]=S |
 |
Carbon sulfide
|
| 2944050 |
CS+ |
carbon monosulfide cation |
InChI=1S/CS/c1-2/q+1 |
[C+]=S |
 |
|
| 9000242 |
HNS- |
HNS- |
InChI=1S/HNS/c1-2/h1H/q-1 |
[NH][S-] |
 |
|
| 9000242 |
HNS |
HNS |
InChI=1S/HNS/c1-2/h1H |
N=S |
 |
|
| 14457853 |
HBS |
hydrogen boron sulfide |
InChI=1S/BHS/c1-2/h1H |
B=S |
 |
Boron hydride sulfide; thioxoborane
|
| 36058283 |
HCS- |
Thioformyl anion |
InChI=1S/CHS/c1-2/h1H/q-1 |
[CH-]=S |
 |
|
| 36058283 |
HCS |
Thioformyl radical |
InChI=1/CHS/c1-2/h1H |
[CH]=S |
 |
|
| 36058283 |
HCS+ |
Thioformyl cation |
InChI=1S/CHS/c1-2/h1H/q+1 |
[CH+]=S |
 |
|
| 13465071 |
H2S2 |
HSSH |
InChI=1/H2S2/c1-2/h1-2H |
SS |
 |
Dihydrogen disulfide; Disulfane
|
| 865361 |
H2CS |
Thioformaldehyde |
InChI=1/CH2S/c1-2/h1H2 |
C=S |
 |
Thioformaldehyde; methanethial
|
| 7175759 |
CH3S |
thiomethoxy |
InChI=1/CH3S/c1-2/h1H3 |
C[S] |
 |
Methylthio radical
|
| 74931 |
CH3SH |
Methanethiol |
InChI=1/CH4S/c1-2/h2H,1H3 |
CS |
 |
Mercaptan methylique; Mercaptomethane; Methaanthiol; Methanethiol; Methanthiol; Methvtiolo; Methyl mercaptan; Methyl sulfhydrate; Methyl thioalcohol; Methylmercaptaan; Metilmercaptano; Rcra waste number U153; Thiomethanol; UN 1064
|
| 16068965 |
SF- |
sulfur monofluoride anion |
InChI=1S/FS/c1-2/q-1 |
[S-]F |
 |
|
| 16068965 |
SF |
Monosulfur monofluoride |
InChI=1/FS/c1-2 |
[S]F |
 |
Sulfur fluoride
|
| 16068965 |
SF+ |
sulfur monofluoride cation |
InChI=1S/FS/c1-2/q+1 |
S=[F+] |
 |
|
| 17167554 |
PCl- |
phosphorus monochloride anion |
InChI=1S/ClP/c1-2/q-1 |
[P-]Cl |
 |
|
| 17167554 |
PCl |
phosphorus chloride |
InChI=1/ClP/c1-2 |
[P]Cl |
 |
Phosphorus chloride
|
| 17167554 |
PCl+ |
phosphorus monochloride cation |
InChI=1S/ClP/c1-2/q+1 |
[P]=[Cl+] |
 |
|
| 20583555 |
BCl- |
boron monochloride anion |
InChI=1S/BCl/c1-2/q-1 |
[B][Cl-] |
 |
|
| 20583555 |
BCl |
boron monochloride |
InChI=1/BCl/c1-2 |
B#Cl |
 |
Boron monochloride; Chloroborane
|
| 20583555 |
BCl+ |
boron monochloride cation |
InChI=1S/BCl/c1-2/q+1 |
[B+]Cl |
 |
|
| 14989298 |
MgCl- |
magnesium monochloride anion |
InChI=1S/ClH.Mg/h1H;/p-1 |
[Cl-][Mg] |
 |
|
| 14989298 |
MgCl |
magnesium monochloride |
InChI=1/ClH.Mg/h1H;/q;+1/p-1 |
[Mg]Cl |
 |
Magnesium chloride
|
| 14989298 |
MgCl+ |
magnesium monochloride cation |
InChI=1S/ClH.Mg/h1H;/q;+2/p-1 |
[Mg+]Cl |
 |
|
| 14989301 |
ClO- |
chlorine monoxide anion |
InChI=1S/ClO/c1-2/q-1 |
[O-]Cl |
 |
|
| 14989301 |
ClO |
Monochlorine monoxide |
InChI=1/ClO/c1-2 |
Cl[O] |
 |
Chlorine oxide
|
| 14989301 |
ClO+ |
chlorine monoxide cation |
InChI=1S/ClO/c1-2/q+1 |
[O+]Cl |
 |
|
| 14989323 |
SCl- |
sulfur monochloride anion |
InChI=1S/ClS/c1-2/q-1 |
[S-]Cl |
 |
|
| 14989323 |
SCl |
sulfur monochloride |
InChI=1/ClS/c1-2 |
[S]Cl |
 |
Sulfur chloride
|
| 14989323 |
SCl+ |
sulfur monochloride cation |
InChI=1S/ClS/c1-2/q+1 |
S=[Cl+] |
 |
|
| 13966579 |
SiCl- |
silicon monochloride anion |
InChI=1S/ClSi/c1-2/q-1 |
[Si-]Cl |
 |
|
| 13966579 |
SiCl |
Clorosilylidyne |
InChI=1/ClSi/c1-2 |
[Si]Cl |
 |
Clorosilylidyne
|
| 13966579 |
SiCl+ |
silicon monochloride cation |
InChI=1S/ClSi/c1-2/q+1 |
[Si+]Cl |
 |
|
| 3889767 |
CCl- |
carbon monochloride anion |
InChI=1S/CCl/c1-2/q-1 |
[C-]Cl |
 |
|
| 3889767 |
CCl |
carbon monochloride |
InChI=1/CCl/c1-2 |
[C]Cl |
 |
Chloromethylidyne
|
| 3889767 |
CCl+ |
carbon monochloride cation |
InChI=1S/CCl/c1-2/q+1 |
[C+]Cl |
 |
|
| 7782505 |
Cl2- |
chlorine diatomic anion |
InChI=1S/Cl2/c1-2/q-1 |
[Cl-]Cl |
 |
|
| 7782505 |
Cl2 |
Chlorine diatomic |
InChI=1/Cl2/c1-2 |
ClCl |
 |
Bertholite; Chloor; Chlor; Chlore; Chlorine; Chlorine mol.; Cloro; Molecular chlorine; UN 1017; dichlorine
|
| 7782505 |
Cl2+ |
chlorine diatomic cation |
InChI=1S/Cl2/c1-2/q+1 |
[Cl+]Cl |
 |
|
| 7647145 |
NaCl- |
sodium chloride anion |
InChI=1S/ClH.Na/h1H;/p-1 |
[Na][Cl-] |
 |
|
| 7647145 |
NaCl |
Sodium Chloride |
InChI=1/ClH.Na/h1H;/q;+1/p-1 |
[Na]Cl |
 |
Ayr; Common salt; Dendritis; Extra fine 200 salt; Extra fine 325 salt; Flexivial; Gingivyl; Halite; Hyposaline; Iodized salt; Natriumchlorid; Purex; Rock salt; Saline; Salt; Sea salt; Slow Sodium; Sodium chloric; Sodium Chloride; Sodium chloride (Na4Cl4); Sodium chloride (NaCl); Sodium chloride brine, purified; Sodium chloride, hypertonic; Sodium chloride, isotonic; Sodium monochloride; SS Salt; Sterling; Table salt; TOP FLAKE; USP sodium chloride; Trisodium trichloride; White crystal
|
| 7647145 |
NaCl+ |
sodium chloride cation |
InChI=1S/ClH.Na/h1H;/q;+2/p-1 |
[Na+]Cl |
 |
|
| 7447418 |
LiCl- |
lithium chloride anion |
InChI=1S/ClH.Li/h1H;/p-1 |
[Li][Cl-] |
 |
|
| 7447418 |
LiCl |
lithium chloride |
InChI=1/ClH.Li/h1H;/q;+1/p-1 |
[Li]Cl |
 |
Chlorku litu; Chlorure de lithium; Lithium chloride; Lithium chloride (LiCl)
|
| 7447418 |
LiCl+ |
lithium chloride cation |
InChI=1S/ClH.Li/h1H;/q;+2/p-1 |
[Li][Cl+] |
 |
|
| 13595818 |
AlCl- |
aluminum monochloride anion |
InChI=1S/Al.ClH/h;1H/p-1 |
[Al][Cl-] |
 |
|
| 13595818 |
AlCl |
Aluminum monochloride |
InChI=1/Al.ClH/h;1H/q+1;/p-1 |
[Al]Cl |
 |
Aluminum chloride; Aluminum monochloride; aluminum(I) chloride
|
| 13595818 |
AlCl+ |
aluminum monochloride cation |
InChI=1S/Al.ClH/h;1H/q+2;/p-1 |
[Al+]Cl |
 |
|
| 12190759 |
NCl- |
nitrogen monochloride anion |
InChI=1S/ClN/c1-2/q-1 |
[N-]Cl |
 |
|
| 12190759 |
NCl |
nitrogen monochloride |
InChI=1S/ClN/c1-2 |
[N]Cl |
 |
|
| 12190759 |
NCl+ |
nitrogen monochloride cation |
InChI=1S/ClN/c1-2/q+1 |
[N]=[Cl+] |
 |
|
| 13814501 |
BeCl- |
beryllium monochloride anion |
InChI=1S/Be.ClH/h;1H/p-1 |
[Be][Cl-] |
 |
|
| 13814501 |
BeCl |
beryllium chloride |
InChI=1/Be.ClH/h;1H/q+1;/p-1 |
[Be]Cl |
 |
Beryllium chloride
|
| 13814501 |
BeCl+ |
beryllium monochloride cation |
InChI=1S/Be.ClH/h;1H/q+2;/p-1 |
[Be+]Cl |
 |
|
| 7790898 |
ClF- |
clorine monofluoride anion |
InChI=1S/ClF/c1-2/q-1 |
Cl[F-] |
 |
|
| 7790898 |
ClF |
Chlorine monofluoride |
InChI=1/ClF/c1-2 |
ClF |
 |
Chlorine fluoride; Chlorine monofluoride; Chlorofluoride; Fluorine chloride
|
| 7790898 |
ClF+ |
clorine monofluoride cation |
InChI=1S/ClF/c1-2/q+1 |
Cl[F+] |
 |
|
| 7790923 |
HOCl |
hypochlorous acid |
InChI=1/ClHO/c1-2/h2H |
ClO |
 |
Hypochlorous acid
|
| 13770224 |
DOCl |
Hypochlorous acid-d |
InChI=1/ClHO/c1-2/h2H/i2D |
O(Cl)[2H] |
 |
DOCl; Hypochlorous acid-D
|
| 10599903 |
NH2Cl |
chloramine |
InChI=1S/ClH2N/c1-2/h2H2 |
NCl |
 |
Chloramide; Chloroamine; Monochloramide; Monochloramine; Monochloroamine; Monochloroammonia
|
| 13465786 |
SiH3Cl |
chlorosilane |
InChI=1/ClH3Si/c1-2/h2H3 |
[SiH3]Cl |
 |
Chlorosilane; Silane, chloro-
|
| 74873 |
CH3Cl |
Methyl chloride |
InChI=1/CH3Cl/c1-2/h1H3 |
CCl |
 |
Artic; Chloor-methaan; Chlor-methan; Chloromethane; Chlorure de methyle; Clorometano; Cloruro di metile; Freon 40; Methane, chloro-; Methyl chloride; Methylchlorid; Metylu chlorek; Monochloromethane; R 40; Rcra waste number U045; UN 1063
|
| 12030830 |
LiK |
Lithium Potassium |
InChI=1S/K.Li |
[Li][K] |
 |
|
| 12056290 |
NaK |
Sodium Potassium |
InChI=1S/K.Na |
[Na][K] |
 |
|
| 7789233 |
KF |
Potassium Fluoride |
InChI=1/K.F |
[K]F |
 |
|
| 7447407 |
KCl |
Potassium Chloride |
InChI=1/K.Cl |
[K]Cl |
 |
|
| 1305788 |
CaO |
Calcium monoxide |
InChI=1/Ca.O |
[Ca]=O |
 |
Calcium oxide; Lime; Calcia; Calx
|
| 12177672 |
CaOH |
Calcium monohydroxide |
InChI=1S/Ca.H2O/h;1H2/q+1;/p-1 |
[Ca]O |
 |
|
| 13827264 |
CaF |
Calcuium monofluoride |
InChI=1S/Ca.FH/h;1H/q+1;/p-1 |
[Ca]F |
 |
|
| 15606710 |
CaCl |
calcium monochloride |
InChI=1S/Ca.ClH/h;1H/q+1;/p-1 |
[Ca]Cl |
 |
|
| 12190704 |
Cu2 |
Copper dimer |
InChI=1S/2Cu |
[Cu][Cu] |
 |
|
| 9000231 |
CuCH3 |
monomethyl copper |
InChI=1/CH3.Cu/h1H3;/rCH3Cu/c1-2/h1H3 |
[Cu]C |
 |
|
| 1317380 |
CuO |
Copper Monoxide |
InChI=1/Cu.O |
[Cu]=O |
 |
Copper monooxide; Copper(ii) oxide; Cupric oxide; Copper oxide; Copper(II) oxide
|
| 13478416 |
CuF |
Copper monofluoride |
InChI=1/Cu.FH/h;1H/q+1;/p-1 |
[Cu]F |
 |
Copper fluoride; copper(I) fluoride
|
| 7758896 |
CuCl |
Copper monochloride |
InChI=1/ClH.Cu/h1H;/q;+1/p-1 |
[Cu]Cl |
 |
Cuprous chloride; Copper(I) chloride; Copper chloride
|
| 115410770 |
ZnCH2 |
Zinc methylene |
InChI=1S/CH2.Zn/h1H2; |
C=[Zn] |
 |
|
| 42217981 |
ZnCH3 |
Zinc monomethyl |
InChI=1S/CH3.Zn/h1H3; |
[Zn]C |
 |
|
| 1314132 |
ZnO |
zinc monoxide |
InChI=1/O.Zn |
[Zn]=O |
 |
Zinc oxide; zinc(II) oxide
|
| 1314983 |
ZnS |
Zinc sulfide |
InChI=1S/S.Zn |
[Zn][S] |
 |
|
| 9000151 |
ZnCl |
Zinc monochloride |
InChI=1S/ClH.Zn/h1H;/q;+1/p-1 |
[Zn]Cl |
 |
|
| 9000139 |
ZnF- |
Zinc monofluoride anion |
InChI=1S/FH.Zn/h1H;/p-1 |
[Zn][F-] |
 |
|
| 9000139 |
ZnF |
Zinc monofluoride |
InChI=1S/FH.Zn/h1H;/q;+1/p-1 |
[Zn]F |
 |
|
| 9000139 |
ZnF+ |
Zinc monofluoride cation |
InChI=1S/FH.Zn/h1H;/q;+2/p-1 |
[Zn+]F |
 |
|
| 12596053 |
Ge2 |
Germanium dimer |
InChI=1S/Ge2/c1-2 |
[Ge][Ge] |
 |
|
| 1449656 |
GeH3CH3 |
methyl germane |
InChI=1S/CH6Ge/c1-2/h1-2H3 |
[GeH3]C |
 |
|
| 20619163 |
GeO |
Germanium monoxide |
InChI=1S/GeO/c1-2 |
[Ge][O] |
 |
germanium(II) oxide
|
| 23878468 |
As2 |
Arsenic diatomic |
InChI=1S/As2/c1-2 |
[As]#[As] |
 |
|
| 12005991 |
AsO |
Arsenic monoxide |
InChI=1S/AsO/c1-2 |
[As]=O |
 |
|
| 15120135 |
AsF |
Arsenic monofluoride |
InChI=1S/AsF/c1-2 |
[As]F |
 |
|
| 16674183 |
CSe- |
Carbon monoselenide anion |
InChI=1S/CSe/c1-2/q-1 |
[C-]=[Se] |
 |
|
| 16674183 |
CSe |
Carbon monoselenide |
InChI=1S/CSe/c1-2 |
[C]=[Se] |
 |
|
| 16674183 |
CSe+ |
Carbon monoselenide cation |
InChI=1S/CSe/c1-2/q+1 |
[C+]=[Se] |
 |
|
| 12185170 |
Se2- |
selenium dimer anion |
InChI=1S/Se2/c1-2/q-1 |
[Se-]=[Se] |
 |
|
| 12185170 |
Se2 |
Selenium diatomic |
InChI=1/Se2/c1-2 |
[Se]=[Se] |
 |
|
| 12185170 |
Se2+ |
selenium dimer cation |
InChI=1S/Se2/c1-2/q+1 |
[Se+]=[Se] |
 |
|
| 12640890 |
SeO- |
selenium monoxide anion |
InChI=1S/OSe/c1-2/q-1 |
[Se][O-] |
 |
|
| 12640890 |
SeO |
Selenium monoxide |
InChI=1/OSe/c1-2 |
[Se]=O |
 |
|
| 12640890 |
SeO+ |
selenium monoxide cation |
InChI=1S/OSe/c1-2/q+1 |
[Se+]=O |
 |
|
| 7446346 |
SeS- |
selenium monosulfide anion |
InChI=1S/SSe/c1-2/q-1 |
[Se-][S] |
 |
|
| 7446346 |
SeS |
Selenium monosulfide |
InChI=1S/SSe/c1-2 |
[Se]=S |
 |
Selenium sulphide; Sulfur selenide; selenium monosulfide
|
| 7446346 |
SeS+ |
selenium monosulfide cation |
InChI=1S/SSe/c1-2/q+1 |
[Se][S+] |
 |
|
| 204 |
CH3SeH |
Methane selenol |
InChI=1/CH4Se/c1-2/h2H,1H3 |
C[Se] |
 |
|
| 7550358 |
LiBr- |
lithium bromide cation |
InChI=1S/BrH.Li/h1H;/p-1 |
[Li][Br-] |
 |
|
| 7550358 |
LiBr |
Lithium Bromide |
InChI=1/BrH.Li/h1H;/q;+1/p-1 |
[Li]Br |
 |
|
| 7550358 |
LiBr+ |
lithium bromide anion |
InChI=1S/BrH.Li/h1H;/q;+2/p-1 |
[Li+]Br |
 |
|
| 7647156 |
NaBr- |
sodium bromide anion |
InChI=1S/BrH.Na/h1H;/p-1 |
[Na][Br-] |
 |
|
| 7647156 |
NaBr |
Sodium Bromide |
InChI=1/BrH.Na/h1H;/q;+1/p-1 |
[Na]Br |
 |
|
| 7647156 |
NaBr+ |
sodium bromide cation |
InChI=1S/BrH.Na/h1H;/q;+2/p-1 |
[Na+]Br |
 |
|
| 7726956 |
Br2- |
bromine diatomic anion |
InChI=1S/Br2/c1-2/q-1 |
[Br-]Br |
 |
|
| 7726956 |
Br2 |
Bromine diatomic |
InChI=1/Br2/c1-2 |
BrBr |
 |
UN 1744; Dibromine; Broom; Brome; Bromo; Brom
|
| 7726956 |
Br2+ |
bromine diatomic cation |
InChI=1S/Br2/c1-2/q+1 |
[Br+]Br |
 |
|
| 7758023 |
KBr |
Potassium Bromide |
InChI=1/K.Br |
[K]Br |
 |
|
| 15656196 |
BrO |
Bromine monoxide |
InChI=1S/BrO/c1-2 |
Br[O] |
 |
|
| 13863417 |
BrCl- |
bromine chloride anion |
InChI=1S/BrCl/c1-2/q-1 |
Br[Cl-] |
 |
|
| 13863417 |
BrCl |
Bromine monochloride |
InChI=1/BrCl/c1-2 |
BrCl |
 |
Bromine chloride; Bromochloride
|
| 13863417 |
BrCl+ |
bromine chloride cation |
InChI=1S/BrCl/c1-2/q+1 |
Br[Cl+] |
 |
|
| 13863597 |
BrF- |
bromine fluoride anion |
InChI=1S/BrF/c1-2/q-1 |
Br[F-] |
 |
|
| 13863597 |
BrF |
Bromine monofluoride |
InChI=1/BrF/c1-2 |
BrF |
 |
Bromine fluoride
|
| 13863597 |
BrF+ |
bromine fluoride cation |
InChI=1S/BrF/c1-2/q+1 |
[Br+]F |
 |
|
| 13517118 |
HOBr |
Hypobromous acid |
InChI=1/BrHO/c1-2/h2H |
BrO |
 |
|
| 6806866 |
CH2Cl |
chloromethyl radical |
InChI=1S/CH2Cl/c1-2/h1H2 |
[CH2]Cl |
 |
|
| 74839 |
CH3Br |
methyl bromide |
InChI=1/CH3Br/c1-2/h1H3 |
CBr |
 |
Embafume; Halon 1001; Methane, bromo-; Curafume; Monobromomethane; Methylbromid; Bromomethane
|
| 7553562 |
I2 |
Iodine diatomic |
InChI=1/I2/c1-2 |
II |
 |
|
| 74884 |
CH3I |
methyl iodide |
InChI=1/CH3I/c1-2/h1H3 |
CI |
 |
Methane, iodo-; Iodomethane; Halon 10001; UN 2644; Monoiodomethane
|
| 12075353 |
C3 |
carbon trimer |
InChI=1/C3/c1-3-2 |
[C]=C=[C] |
 |
|
| 12075353 |
C3+ |
carbon trimer cation |
InChI=1S/C3/c1-3-2/q+1 |
[C]=[C+]=[C] |
 |
|
| 9000220 |
C3H3+ |
cyclopropenyl cation |
InChI=1S/C3H3/c1-2-3-1/h1-3H/q+1 |
C1=C[CH+]1 |
 |
|
| 2932787 |
C3H3- |
Propargyl anion |
InChI=1S/C3H3/c1-3-2/h1H,2H2/q-1 |
C#C[CH2-] |
 |
|
| 2932787 |
C3H3 |
Propargyl radical |
InChI=1/C3H3/c1-3-2/h1H,2H2 |
C#C[CH2] |
 |
Prop-1-yn-3-yl radical; Propargyl radical; propargyl
|
| 2932787 |
C3H3+ |
Propargyl cation |
InChI=1S/C3H3/c1-3-2/h1H,2H2/q+1 |
C#C[CH2+] |
 |
|
| 2781853 |
C3H4 |
cyclopropene |
InChI=1/C3H4/c1-2-3-1/h1-2H,3H2 |
C1=CC1 |
 |
Cyclopropene
|
| 74997 |
CH3CCH |
propyne |
InChI=1/C3H4/c1-3-2/h1H,2H3 |
CC#C |
 |
1-Propyne; Acetylene, methyl-; Allylene; Methylacetylene; Propine; Propyne; prop-1-yne
|
| 463490 |
CH2CCH2 |
allene |
InChI=1/C3H4/c1-3-2/h1-2H2 |
C=C=C |
 |
1,2-Propadiene; Allene; Dimethylenemethane; Propa-1,2-diene; Propadiene; Propadiene, inhibited; sym-Allylene; UN 2200
|
| 1981802 |
C3H5 |
Allyl radical |
InChI=1/C3H5/c1-3-2/h3H,1-2H2 |
C=C[CH2] |
 |
Allyl radical; allyl
|
| 1981802 |
C3H5+ |
Allyl cation |
InChI=1S/C3H5/c1-3-2/h3H,1-2H2/q+1 |
C=C[CH2+] |
 |
|
| 75194 |
C3H6 |
Cyclopropane |
InChI=1/C3H6/c1-2-3-1/h1-3H2 |
C1CC1 |
 |
Cyclopropane; UN 1027; Trimethylene; Trimethylene (cyclic)
|
| 115071 |
CH2CHCH3 |
Propene |
InChI=1/C3H6/c1-3-2/h3H,1H2,2H3 |
C=CC |
 |
1-Propene; 1-Propylene; Methylethene; Methylethylene; NCI-C50077; Propene; Propylene; UN 1077; UN 1075; prop-1-ene
|
| 2025550 |
C3H7 |
Isopropyl radical |
InChI=1/C3H7/c1-3-2/h3H,1-2H3 |
C[CH]C |
 |
iso-C3H7; Isopropyl radical; propyl; propan-2-yl
|
| 2143615 |
C3H7 |
n-Propyl radical |
InChI=1/C3H7/c1-3-2/h1,3H2,2H3 |
[CH2]CC |
 |
n-C3H7; n-Propyl radical; propyl; propan-1-yl
|
| 74986 |
C3H8 |
Propane |
InChI=1/C3H8/c1-3-2/h3H2,1-2H3 |
CCC |
 |
Dimethylmethane; Freon 290; Liquefied petroleum gas; Lpg; n-Propane; Propane; Propyl hydride; R 290; UN 1075; UN 1978
|
| 12596600 |
N3- |
azide anion |
InChI=1S/N3/c1-3-2/q-1 |
[N][N-][N] |
 |
azide
|
| 12596600 |
N3 |
azide radical |
InChI=1S/N3/c1-3-2 |
[N]=[N+]=[N-] |
 |
|
| 7782798 |
HN3 |
hydrogen azide |
InChI=1/HN3/c1-3-2/h1H |
N=[N+]=[N-] |
 |
hydrozoic acid; azoimide; diazoimide; triazoic acid; hydronitric acid; hydrogen azide
|
| 151519 |
HNCNH |
diiminomethane |
InChI=1S/CH2N2/c2-1-3/h2-3H |
N=C=N |
 |
|
| 157222 |
CH2NN |
diazirine |
InChI=1S/CH2N2/c1-2-3-1/h1H2 |
N1N=C1 |
 |
3H-Diazirine
|
| 420042 |
NH2CN |
cyanamide |
InChI=1/CH2N2/c2-1-3/h2H2 |
NC#N |
 |
carbamonitrile; Amidocyanogen; Carbimide; Cyanoamine; Cyanogen nitride; Cyanogenamide; Hydrogen cyanamide; cyanamide
|
| 334883 |
CH2NN |
diazomethane |
InChI=1/CH2N2/c1-3-2/h1H2 |
C=[N+]=[N-] |
 |
|
| 593759 |
CH3NC |
methyl isocyanide |
InChI=1/C2H3N/c1-3-2/h1H3 |
C[N+]#[C-] |
 |
Methane, isocyano-; isocyanomethane; Methyl isonitrile
|
| 75058 |
CH3CN- |
acetonitrile anion |
InChI=1S/C2H3N/c1-2-3/h1H3/q-1 |
[CH3-]C#N |
 |
|
| 75058 |
CH3CN |
Acetonitrile |
InChI=1/C2H3N/c1-2-3/h1H3 |
CC#N |
 |
Acetonitril; Acetonitrile; Cyanomethane; Cyanure de methyl; Ethanenitrile; Ethyl nitrile; Methane, cyano-; Methanecarbonitrile; Methyl cyanide; Methylkyanid; NA 1648; NCI-C60822; Rcra waste number U003; USAF ek-488; UN 1648
|
| 75058 |
CH3CN+ |
Acetonitrile cation |
InChI=1S/C2H3N/c1-2-3/h1H3/q+1 |
C[C]#[N+] |
 |
|
| 10000 |
NHCHNH2 |
aminomethanimine |
InChI=1/CH4N2/c2-1-3/h1H,(H3,2,3) |
NC=N |
 |
|
| 151564 |
C2H5N |
Aziridine |
InChI=1/C2H5N/c1-2-3-1/h3H,1-2H2 |
N1CC1 |
 |
1H-Azirine, dihydro-; Aethylenimin; Aminoethylene; Azacyclopropane; Aziran; Azirane; Aziridin; Aziridine; Dihydro-1H-azirine; Dihydroazirene; Dimethyleneimine; Dimethylenimine; EI; ENT-50324; Ethirydine; Ethyleenimine; Ethylene imine, inhibited; Ethyleneimine; Ethylenimine; Ethylimine; Etilenimina; Rcra waste number P054; TL 337; UN 1185
|
| 593679 |
CH2CHNH2 |
aminoethene |
InChI=1S/C2H5N/c1-2-3/h2H,1,3H2 |
C=CN |
 |
Vinylamine; Aminoethylene; Ethenamine; Ethylenamine; Ethyleneamine
|
| 1761677 |
CH2NCH3 |
N-methylmethanimine |
InChI=1S/C2H5N/c1-3-2/h1H2,2H3 |
C=NC |
 |
2-Azapropene; N-methylenemethanamine
|
| 20729413 |
CH3CHNH |
ethanimine |
InChI=1S/C2H5N/c1-2-3/h2-3H,1H3 |
CC=N |
 |
Acetaldimine; ethanimine
|
| 124403 |
CH3NHCH3 |
Dimethylamine |
InChI=1/C2H7N/c1-3-2/h3H,1-2H3 |
CNC |
 |
Dimethylamine; DMA; Methanamine, N-methyl-; N-Methylmethanamine; Rcra waste number U092; UN 1032; UN 1160; N-Methylmethanamine
|
| 75047 |
CH3CH2NH2 |
Ethylamine |
InChI=1/C2H7N/c1-2-3/h2-3H2,1H3 |
CCN |
 |
1-Aminoethane; Aethylamine; Aminoethane; Ethanamine; Ethylamine; Etilamina; Etyloamina; Monoethylamine; UN 1036; UN 2270
|
| 124389 |
CO2- |
Carbon dioxide anion |
InChI=1S/CO2/c2-1-3/q-1 |
O=[C-][O] |
 |
|
| 124389 |
CO2 |
Carbon dioxide |
InChI=1/CO2/c2-1-3 |
O=C=O |
 |
Anhydride carbonique; Carbon dioxide; Carbon oxide (CO2); Carbonic acid, gas; Carbonic anhydride; Carbonice; Dry ice; Kohlendioxyd; Kohlensaure; UN 2187; UN 1013; UN 1845
|
| 124389 |
CO2+ |
Carbon dioxide cation |
InChI=1S/CO2/c2-1-3/q+1 |
[O][C+]=O |
 |
|
| 13840885 |
BO2- |
Boron dioxide anion |
InChI=1S/BO2/c2-1-3/q-1 |
O=[B-]=O |
 |
|
| 13840885 |
BO2 |
Boron dioxide |
InChI=1/BO2/c2-1-3 |
O=B=O |
 |
Boron oxide
|
| 13840885 |
BO2+ |
Boron dioxide cation |
InChI=1S/BO2/c2-1-3/q+1 |
[O][B+][O] |
 |
|
| 10028156 |
O3- |
Ozone anion |
InChI=1S/HO3/c1-3-2/h1H/p-1 |
[O]O[O-] |
 |
|
| 10028156 |
O3 |
Ozone |
InChI=1/O3/c1-3-2 |
O=[O+][O-] |
 |
Ozon; Ozone; Triatomic oxygen; trioxidane
|
| 10028156 |
O3+ |
Ozone cation |
InChI=1S/O3/c1-3-2/q+1 |
[O][O+]=O |
 |
|
| 10024972 |
N2O- |
Nitrous oxide anion |
InChI=1S/N2O/c1-2-3/q-1 |
[N-]N=O |
 |
|
| 10024972 |
N2O |
Nitrous oxide |
InChI=1/N2O/c1-2-3 |
[N]N=O |
 |
Dinitrogen monoxide; Dinitrogen oxide; Factitious air; Hyponitrous acid anhydride; Laughing gas; Nitrogen Monoxide; Nitrogen oxide; Nitrogen oxide (N2O); Nitrous Oxide; UN 1070; UN 2201
|
| 10024972 |
N2O+ |
Nitrous oxide cation |
InChI=1S/N2O/c1-2-3/q+1 |
[N]=[N+]=O |
 |
|
| 12057248 |
Li2O |
dilithium oxide |
InChI=1/2Li.O |
[Li]O[Li] |
 |
lithium oxide
|
| 12071237 |
CCO |
Dicarbon monoxide |
InChI=1S/C2O/c1-2-3 |
[C]=C=O |
 |
|
| 10102440 |
NO2- |
Nitrogen dioxide anion |
InChI=1S/HNO2/c2-1-3/h(H,2,3)/p-1 |
[O-]N=O |
 |
|
| 10102440 |
NO2 |
Nitrogen dioxide |
InChI=1/NO2/c2-1-3 |
O=N=O |
 |
Azote; Azoto; NA 1067; Nitrito; Nitro; Nitrogen dioxide; Nitrogen oxide; Nitrogen oxide (NO2); Nitrogen peroxide; Rcra waste number P078; Stickstoffdioxid; Stikstofdioxyde; UN 1067
|
| 10102440 |
NO2+ |
Nitrogen dioxide cation |
InChI=1S/NO2/c2-1-3/q+1 |
O=[N+]=O |
 |
|
| 22400266 |
NCO- |
cyanate |
InChI=1S/CHNO/c2-1-3/h3H/p-1 |
N#C[O-] |
 |
cyanate; isocyanate; cyanato anion; isocyanato anion
|
| 22400266 |
NCO |
isocyanato radical |
InChI=1S/CNO/c2-1-3 |
[N]=C=O |
 |
|
| 82267150 |
CNO- |
fulminate |
InChI=1S/CNO/c1-2-3/q-1 |
[O-][N+]#[C-] |
 |
|
| 51095159 |
HCCO |
ketenyl radical |
InChI=1/C2HO/c1-2-3/h1H |
[CH]=C=O |
 |
Ethynyloxy radical
|
| 12311976 |
HCO2- |
formate anion |
InChI=1S/CH2O2/c2-1-3/h1H,(H,2,3)/p-1 |
O=C[O-] |
 |
|
| 7782776 |
HNO2 |
Nitrous acid |
InChI=1/HNO2/c2-1-3/h(H,2,3) |
ON=O |
 |
Kyselina dusite; Nitrosyl hydroxide; Nitrous acid; Nitrous acid, trans
|
| 7782776 |
HNO2+ |
nitrous acid cation |
InChI=1S/HNO2/c2-1-3/h1H/q+1 |
[O][NH+][O] |
 |
|
| 2564865 |
HOCO |
Hydrocarboxyl radical |
InChI=1/CHO2/c2-1-3/h(H,2,3) |
O[C]=O |
 |
|
| 2564865 |
HOCO+ |
Hydrocarboxyl cation |
InChI=1S/CHO2/c2-1-3/h2H/q+1 |
O[C+]=O |
 |
protonated carbon dioxide; hydroxy(oxo)methylium
|
| 2564865 |
HOCO |
Hydrocarboxyl radical |
InChI=1/CHO2/c2-1-3/h(H,2,3) |
O[C]=O |
 |
|
| 75138 |
HNCO |
Isocyanic acid |
InChI=1/CHNO/c2-1-3/h2H |
N=C=O |
 |
Carbimide; Hydrogen isocyanate; Isocyanic acid; nitrosyl hydride
|
| 506854 |
HCNO |
fulminic acid |
InChI=1/CHNO/c1-2-3/h1H |
O[N+]#[C-] |
 |
Hydrogen cyanide N-oxide
|
| 420053 |
HOCN |
cyanic acid |
InChI=1/CHNO/c2-1-3/h3H |
OC#N |
 |
|
| 463514 |
CH2CO |
Ketene |
InChI=1/C2H2O/c1-2-3/h1H2 |
C=C=O |
 |
Carbomethene; Ethenone; Ketene; Keto-ethylene; Methylene ketene
|
| 463514 |
CH2CO+ |
Ketene cation |
InChI=1S/C2H2O/c1-2-3/h1H2/q+1 |
C=C=[O+] |
 |
|
| 64186 |
HCOOH |
Formic acid |
InChI=1/CH2O2/c2-1-3/h1H,(H,2,3) |
OC=O |
 |
Acide formique; Acido formico; Add-F; Ameisensaeure; Aminic acid; Bilorin; Collo-Bueglatt; Collo-Didax; Formic acid; Formic acid, solution; Formira; Formisoton; Formylic acid; Hydrogen carboxylic acid; Kwas metaniowy; Kyselina mravenci; Methanoic acid; Mierenzuur; Myrmicyl; Rcra waste number U123; UN 1779
|
| 157266 |
CH2O2 |
Dioxirane |
InChI=1S/CH2O2/c1-2-3-1/h1H2 |
O1OC1 |
 |
|
| 157186 |
C2H2O |
Oxirene |
InChI=1S/C2H2O/c1-2-3-1/h1-2H |
O1C=C1 |
 |
|
| 32038792 |
HCCOH |
ethynol |
InChI=1/C2H2O/c1-2-3/h1,3H |
C#CO |
 |
|
| 75127 |
CHONH2 |
formamide |
InChI=1/CH3NO/c2-1-3/h1H,(H2,2,3) |
NC=O |
 |
Amid kyseliny mravenci; Formimidic acid; formamide; Formimidic acid; Methanamide; Amid kyseliny mravenci; Methanamide; Carbamaldehyde; Carbamaldehyde
|
| 2143580 |
CH3OO- |
methylperoxy anion |
InChI=1S/CH4O2/c1-3-2/h2H,1H3/p-1 |
CO[O-] |
 |
|
| 2143580 |
CH3OO |
methylperoxy radical |
InChI=1/CH3O2/c1-3-2/h1H3 |
CO[O] |
 |
peroxymethyl; methylperoxy
|
| 2143580 |
CH3OO+ |
methylperoxy cation |
InChI=1S/CH3O2/c1-3-2/h1H3/q+1 |
C[O+]=O |
 |
|
| 3170692 |
CH3CO- |
Acetyl anion |
InChI=1S/C2H3O/c1-2-3/h1H3/q-1 |
C[C-][O] |
 |
|
| 3170692 |
CH3CO |
Acetyl radical |
InChI=1/C2H3O/c1-2-3/h1H3 |
O=[C]C |
 |
Acetyl radical; acetyl
|
| 3170692 |
CH3CO+ |
acetyl cation |
InChI=1S/C2H3O/c1-2-3/h1H3/q+1 |
O=[C+]C |
 |
|
| 4400015 |
CH2CHO |
Vinyloxy radical |
InChI=1S/C2H3O/c1-2-3/h2H,1H2 |
[CH2]C=O |
 |
|
| 9000344 |
CH2OOH |
CH2OOH |
InChI=1S/CH3O2/c1-3-2/h2H,1H2 |
[CH2]C=O |
 |
|
| 3031730 |
CH3OOH |
Methyl peroxide |
InChI=1/CH4O2/c1-3-2/h2H,1H3 |
OOC |
 |
Hydroperoxide, methyl; methyl Hydroperoxide; hydroperoxymethane
|
| 557755 |
CH2CHOH |
ethenol |
InChI=1/C2H4O/c1-2-3/h2-3H,1H2 |
C=CO |
 |
Vinyl alcohol; Hydroxyethylene; ethenol
|
| 75218 |
C2H4O |
Ethylene oxide |
InChI=1/C2H4O/c1-2-3-1/h1-2H2 |
C1CO1 |
 |
α,β-Oxidoethane; 1,2-Epoxyaethan; 1,2-Epoxyethane; Aethylenoxid; Amprolene; Anprolene; Anproline; Dihydrooxirene; Dimethylene oxide; E.O.; ENT-26263; Epoxyethane; Ethene oxide; Ethox; Ethyleenoxide; Ethylene oxide; ETO; Etylenu tlenek; FEMA No. 2433; Merpol; NCI-C50088; Oxacyclopropane; Oxane; Oxidoethane; Oxiraan; Oxiran; Oxirane; Oxirene, Dihydro-; Oxyfume; Oxyfume 12; Rcra waste number U115; Sterilizing gas ethylene oxide 100%; T-Gas; UN 1040; alpha,beta-Oxidoethane
|
| 75070 |
CH3CHO |
Acetaldehyde |
InChI=1/C2H4O/c1-2-3/h2H,1H3 |
CC=O |
 |
Acetaldehyd; Acetaldehyde; Acetaldeyde; Acetic aldehyde; Acetylaldehyde; Aldehyde acetique; Aldeide acetica; Ethanal; Ethyl aldehyde; NCI-C56326; Octowy aldehyd; Rcra waste number U001; UN 1089
|
| 55 |
H2OH2CO |
water formaldehyde dimer |
InChI=1S/CH3O.H2O/c1-2;/h2H,1H2;1H2 |
O.C=O |
 |
|
| 2154509 |
CH3CH2O |
Ethoxy radical |
InChI=1/C2H5O/c1-2-3/h2H2,1H3 |
CC[O] |
 |
|
| 4422542 |
CH2CH2OH |
2-hydroxy ethyl radical |
InChI=1S/C2H5O/c1-2-3/h3H,1-2H2 |
OC[CH2] |
 |
ethanol-2-yl
|
| 16520040 |
CH3OCH2 |
methoxymethyl radical |
InChI=1S/C2H5O/c1-3-2/h1H2,2H3 |
CO[CH2] |
 |
|
| 77 |
H2OCH3OH |
water methanol dimer |
InChI=1S/CH4O.H2O/c1-2;/h2H,1H3;1H2 |
OC.O |
 |
|
| 88 |
CH3OHH2O |
methanol water dimer |
InChI=1S/CH4O.H2O/c1-2;/h2H,1H3;1H2 |
OC.O |
 |
|
| 64175 |
CH3CH2OH |
Ethanol |
InChI=1/C2H6O/c1-2-3/h3H,2H2,1H3 |
CCO |
 |
Absolute ethanol; Aethanol; Aethylalkohol; Alcare Hand Degermer; Alcohol; Alcohol anhydrous; Alcohol, dehydrated; Alcohol, diluted; Alcohols; Alcool ethylique; Alcool etilico; Algrain; Alkohol; Alkoholu etylowego; Anhydrol; Cologne spirit; Cologne spirits; Denatured alcohol CD-10; Denatured alcohol CD-5; Denatured alcohol CD-5a; Denatured alcohol SD-1; Denatured alcohol SD-13a; Denatured alcohol SD-17; Denatured alcohol SD-23a; Denatured alcohol SD-28; Denatured alcohol SD-30; Denatured alcohol SD-39b; Denatured alcohol SD-39c; Denatured alcohol SD-3a; Denatured alcohol SD-40m; Denatured ethanol; Etanolo; Ethanol; Ethanol 200 proof; Ethanol, solution; Ethyl alc; Ethyl alcohol; Ethyl alcohol anhydrous; Ethyl hydrate; Ethyl hydroxide; EtOH; Etylowy alkohol; Fermentation alcohol; Grain alcohol; Jaysol; Jaysol S; Methylcarbinol; Molasses alcohol; NCI-C03134; Potato alcohol; SD Alchol 23-hydrogen; SD alcohol 23-hydrogen; Spirits of wine; Spirt; Tecsol; Tecsol C; Thanol; UN 1170
|
| 115106 |
CH3OCH3 |
Dimethyl ether |
InChI=1/C2H6O/c1-3-2/h1-2H3 |
COC |
 |
Dimethyl ether; Dimethyl oxide; Dymel A; Ether, dimethyl; Ether, methyl; Methane, oxybis-; Methoxymethane; Methyl ether; Oxybismethane; ether; Wood ether; UN 1033
|
| 2154598 |
CF2- |
Difluoromethylene anion |
InChI=1S/CF2/c2-1-3/q-1 |
F[C-]F |
 |
|
| 2154598 |
CF2 |
Difluoromethylene |
InChI=1/CF2/c2-1-3 |
F[C]F |
 |
Difluoromethylene
|
| 2154598 |
CF2+ |
Difluoromethylene cation |
InChI=1S/CF2/c2-1-3/q+1 |
F[C+]F |
 |
|
| 1495507 |
FCN |
Cyanogen fluoride |
InChI=1/CFN/c2-1-3 |
FC#N |
 |
|
| 3744078 |
NF2 |
Difluoroamino radical |
InChI=1/F2N/c1-3-2 |
F[N]F |
 |
Difluoroamidogen; Difluoroamino radical
|
| 3744078 |
NF2+ |
Difluoroamino cation |
InChI=1S/F2N/c1-3-2/q+1 |
F[N+]F |
 |
|
| 7783417 |
F2O |
Difluorine monoxide |
InChI=1/F2O/c1-3-2 |
FOF |
 |
Difluorine monooxide; Difluorine monoxide; Fluorine monoxide; Fluorine oxide; Oxydifluoride; Oxygen difluoride; Oxygen fluoride; Oxygen fluoride (OF2); UN 2190; hypofluorous anhydride
|
| 7789255 |
FNO |
Nitrosyl fluoride |
InChI=1/FNO/c1-2-3 |
O=NF |
 |
Nitrogen oxide fluoride; Nitrogen oxyfluoride; Nitrosyl fluoride
|
| 15499237 |
FO2 |
Dioxygen monofluoride |
InChI=1/FO2/c1-3-2 |
FO[O] |
 |
Oxygen fluoride
|
| 13709836 |
BHF2 |
Difluoroborane |
InChI=1/BF2H/c2-1-3/h1H |
FBF |
 |
Difluoroborane
|
| 2713099 |
HCCF |
Fluoroacetylene |
InChI=1/C2HF/c1-2-3/h1H |
C#CF |
 |
Ethyne, fluoro-; Fluoroethyne; Monofluoroacetylene; Acetylene, fluoro-
|
| 2713099 |
HCCF+ |
fluoroacetylene cation |
InChI=1S/C2HF/c1-2-3/h1H/q+1 |
F[C]=[CH+] |
 |
|
| 1493023 |
HFCO |
formyl fluoride |
InChI=1/CHFO/c2-1-3/h1H |
O=CF |
 |
|
| 75105 |
CH2F2 |
Methane, difluoro- |
InChI=1/CH2F2/c2-1-3/h1H2 |
FCF |
 |
Carbon fluoride hydride (CF2H2); Difluoromethane; Freon 32; Genetron 32; Methane, difluoro-; Methylene difluoride; Methylene fluoride; R 32
|
| 75025 |
CH2CHF |
Ethene, fluoro- |
InChI=1/C2H3F/c1-2-3/h2H,1H2 |
FC=C |
 |
Ethene, fluoro-; Ethylene, fluoro-; Fluoroethene; Fluoroethylene; Monofluoroethylene; UN 1860; Vinyl fluoride, inhibited; Vinyl fluoride
|
| 75025 |
CH2CHF+ |
fluoroethene cation |
InChI=1S/C2H3F/c1-2-3/h2H,1H2/q+1 |
[CH2][CH+]F |
 |
|
| 353366 |
C2H5F |
fluoroethane |
InChI=1/C2H5F/c1-2-3/h2H2,1H3 |
CCF |
 |
Ethyl fluoride; Ethane, fluoro-; Monofluoroethane; fluoroethane
|
| 1313593 |
Na2O |
disodium monoxide |
InChI=1S/2Na.O |
[Na]O[Na] |
 |
Sodium oxide; Disodium oxide
|
| 1111746 |
SiH2(CH3)2 |
dimethylsilane |
InChI=1/C2H8Si/c1-3-2/h3H2,1-2H3 |
C[SiH2]C |
 |
|
| 7631869 |
SiO2 |
silicon dioxide |
InChI=1/O2Si/c1-3-2 |
O=[Si]=O |
 |
Amorphous silica gel; Silica; Silicic anhydride; Silicon dioxide; Silicon oxide; Silicon(IV) oxide
|
| 1396660 |
SiF2 |
Silicon difluoride |
InChI=1S/F2Si/c1-3-2 |
F[Si]F |
 |
Difluorosilylene; Silicon difluoride
|
| 12164975 |
PO2- |
Phosphorus dioxide anion |
InChI=1S/HO2P/c1-3-2/h(H,1,2)/p-1 |
[O-]P=O |
 |
|
| 12164975 |
PO2 |
Phosphorus dioxide |
InChI=1/O2P/c1-3-2 |
O=[P]=O |
 |
|
| 12164975 |
PO2+ |
Phosphorus dioxide cation |
InChI=1S/O2P/c1-3-2/q+1 |
O=[P+]=O |
 |
|
| 12597034 |
S3- |
Sulfur trimer anion |
InChI=1S/HS3/c1-3-2/h1H/p-1 |
[S]S[S-] |
 |
|
| 12597034 |
S3 |
Sulfur trimer |
InChI=1/S3/c1-3-2 |
S=S=S |
 |
|
| 7446095 |
SO2- |
Sulfur dioxide anion |
InChI=1S/O2S/c1-3-2/q-1 |
[O][S-][O] |
 |
|
| 7446095 |
SO2 |
Sulfur dioxide |
InChI=1/O2S/c1-3-2 |
O=S=O |
 |
Bisulfite; Fermenicide liquid; Fermenicide powder; Fermenticide liquid; Schwefeldioxyd; Siarki dwutlenek; Sulfur dioxide; Sulfur oxide; Sulfur oxide (SO2); Sulfurous acid anhydride; Sulfurous anhydride; Sulfurous oxide; Sulphur dioxide; UN 1079
|
| 7446095 |
SO2+ |
Sulfur dioxide cation |
InChI=1S/O2S/c1-3-2/q+1 |
[O][S+][O] |
 |
|
| 463581 |
OCS |
Carbonyl sulfide |
InChI=1/COS/c2-1-3 |
O=C=S |
 |
Carbon oxide sulfide; Carbon oxide sulfide (COS); Carbon oxysulfide; Carbonyl sulfide; Oxycarbon sulfide; UN 2204
|
| 463581 |
OCS+ |
Carbonyl sulfide cation |
InChI=1S/COS/c2-1-3/q+1 |
S=[C+]=O |
 |
|
| 75150 |
CS2 |
Carbon disulfide |
InChI=1/CS2/c2-1-3 |
S=C=S |
 |
Carbon bisulfide; Carbon bisulphide; Carbon disulfide; Carbon sulfide; Carbon sulfide (CS2); Carbon sulphide; Carbon-disulphide-; Carbone; Carbonio; Dithiocarbonic anhydride; Kohlendisulfid; Koolstofdisulfide; NCI-C04591; Rcra waste number P022; Schwefelkohlenstoff; Solfuro di carbonio; Sulphocarbonic anhydride; UN 1131; Weeviltox; Wegla dwusiarczek
|
| 75150 |
CS2+ |
Carbon disulfide cation |
InChI=1S/CS2/c2-1-3/q+1 |
S=C=[S+] |
 |
|
| 15941772 |
SCN- |
thiocyanide anion |
InChI=1S/CNS/c2-1-3/q-1 |
S=C=[N-] |
 |
|
| 15941772 |
SCN |
thiocyanato radical |
InChI=1/CNS/c2-1-3 |
[N]=C=S |
 |
|
| 20901217 |
SSO |
Disulfur monoxide |
InChI=1/OS2/c1-3-2 |
S=S=O |
 |
Sulfur oxide; sulfur oxide sulfide
|
| 420122 |
C2H4S |
Thiirane |
InChI=1/C2H4S/c1-2-3-1/h1-2H2 |
S1CC1 |
 |
2,3-Dihydrothiirene; Ethylene episulfide; Ethylene episulphide; Ethylene sulfide; Ethylene sulphide; Sulfurane; Thiacyclopropane; Thiirane; Thiirene, 2,3-dihydro-
|
| 6851930 |
CH3CHS |
Thioacetaldehyde |
InChI=1/C2H4S/c1-2-3/h2H,1H3 |
CC=S |
 |
Thioacetaldehyde; ethanethial
|
| 75183 |
CH3SCH3 |
Dimethyl sulfide |
InChI=1/C2H6S/c1-3-2/h1-2H3 |
CSC |
 |
2-Thiapropane; 2-Thiopropane; Dimethyl monosulfide; Dimethyl sulfide; Dimethyl sulphide; Dimethyl thioether; Dimethylsulfid; DMS; Exact-S; Methane, thiobis-; Methyl Monosulfide; Methyl sulfide; Methyl sulphide; Methylthiomethane; Sulfure de methyle; Thiobismethane; UN 1164; dimethylsulfane
|
| 75081 |
CH3CH2SH |
ethanethiol |
InChI=1/C2H6S/c1-2-3/h3H,2H2,1H3 |
CCS |
 |
1-Mercaptoethane; Aethanethiol; Aethylmercaptan; Etantiolo; Ethaanthiol; Ethanethiol; Ethyl hydrosulfide; Ethyl mercaptan; Ethyl sulfhydrate; Ethyl thioalcohol; Ethylmercaptaan; Ethylmerkaptan; Etilmercaptano; LPG ethyl mercaptan 1010; Mercaptoethane; Thioethanol; Thioethyl alcohol; UN 2363
|
| 13814250 |
SF2- |
sulfur difluoride anion |
InChI=1S/F2S/c1-3-2/q-1 |
F[S-]F |
 |
|
| 13814250 |
SF2 |
sulfur difluoride |
InChI=1/F2S/c1-3-2 |
FSF |
 |
|
| 13814250 |
SF2+ |
sulfur difluoride cation |
InChI=1S/F2S/c1-3-2/q+1 |
F[S+]F |
 |
|
| 13569329 |
SiCl2 |
Dichlorosilylene |
InChI=1/Cl2Si/c1-3-2 |
Cl[Si]Cl |
 |
Dichlorosilylene; silicon dichloride
|
| 10049044 |
OClO- |
Chlorine dioxide anion |
InChI=1S/ClO2/c2-1-3/q-1 |
[O-]Cl[O] |
 |
|
| 10049044 |
OClO |
Chlorine dioxide |
InChI=1/ClO2/c2-1-3 |
O=Cl[O] |
 |
Alcide; Anthium dioxcide; Chlorine dioxide; Chlorine oxide; Chlorine oxide (ClO2); Chlorine peroxide; Chlorine(IV) oxide; Chloroperoxyl; Chloryl radical; Doxcide 50
|
| 10049044 |
OClO+ |
Chlorine dioxide cation |
InChI=1S/ClO2/c2-1-3/q+1 |
[O][Cl+][O] |
 |
|
| 10545990 |
SCl2 |
Sulfur dichloride |
InChI=1/Cl2S/c1-3-2 |
ClSCl |
 |
Sulfur chloride; Chlorine sulfide; Dichlorosulfane; Monosulfur dichloride; Sulfur(II) chloride; Chloride of sulfur; Chlorine sulfide; UN 1828; hypochlorous thioanhydride
|
| 7791211 |
Cl2O |
Dichlorine monoxide |
InChI=1/Cl2O/c1-3-2 |
ClOCl |
 |
Chlorine monooxide; Chlorine monoxide; Chlorine monoxide (Cl2O); Chlorine oxide; Chlorine oxide (Cl2O); Chlorine(I) oxide; Dichlorine monoxide; Dichloromonoxide; Dichloroxide; Hypochlorous anhydride
|
| 2696926 |
ClNO |
Nitrosyl chloride |
InChI=1/ClNO/c1-2-3 |
O=NCl |
 |
Nitrogen chloride oxide (NOCl); Nitrogen oxide chloride (NOCl); Nitrogen oxychloride; Nitrogen oxychloride (NOCl); Nitrosyl chloride; Nitrosyl chloride ((NO)Cl); UN 1069
|
| 7786303 |
MgCl2 |
Magnesium dichloride |
InChI=1/2ClH.Mg/h2*1H;/q;;+2/p-2 |
Cl[Mg]Cl |
 |
Magnesium chloride
|
| 506774 |
ClCN |
chlorocyanogen |
InChI=1/CClN/c2-1-3 |
N#CCl |
 |
Chlorcyan; Chlorine cyanide; Chlorocyan; Chlorocyanide; Chlorocyanogen; Chlorure de cyanogene; CK; Cyanochloride; Cyanogen chloride; Cyanogen chloride ((CN)Cl); Cyanogen chloride, inhibited; Rcra waste number P033; UN 1589; cyanic chloride
|
| 1605727 |
CCl2- |
dichloromethylene anion |
InChI=1S/CCl2/c2-1-3/q-1 |
Cl[C]Cl |
 |
|
| 1605727 |
CCl2 |
dichloromethylene |
InChI=1/CCl2/c2-1-3 |
Cl[C]Cl |
 |
|
| 1605727 |
CCl2+ |
dichloromethylene cation |
InChI=1S/CCl2/c2-1-3/q+1 |
Cl[C+]Cl |
 |
|
| 17376099 |
ClOO |
chloroperoxy radical |
InChI=1/ClO2/c1-3-2 |
ClO[O] |
 |
|
| 17376099 |
ClOO+ |
chloroperoxy cation |
InChI=1S/ClO2/c1-3-2/q+1 |
Cl[O+]=O |
 |
|
| 39594917 |
ClS2 |
Sulfur chloride |
InChI=1S/ClS2/c1-3-2 |
ClS[S] |
 |
Sulfur chloride
|
| 2565302 |
COHCl |
Formyl chloride |
InChI=1S/CHClO/c2-1-3/h1H |
O=CCl |
 |
|
| 10325390 |
BHCl2 |
Borane, dichloro- |
InChI=1/BCl2H/c2-1-3/h1H |
ClBCl |
 |
Borane, dichloro-; Dichloroborane
|
| 4109960 |
SiH2Cl2 |
dichlorosilane |
InChI=1/Cl2H2Si/c1-3-2/h3H2 |
Cl[SiH2]Cl |
 |
|
| 593704 |
CH2FCl |
fluorochloromethane |
InChI=1/CH2ClF/c2-1-3/h1H2 |
ClCF |
 |
Methane, chlorofluoro-; Chlorofluoromethane; Freon 31; Monochloromonofluoromethane; R 31
|
| 75092 |
CH2Cl2 |
Methylene chloride |
InChI=1/CH2Cl2/c2-1-3/h1H2 |
ClCCl |
 |
Aerothene MM; Chlorure de methylene; DCM; Dichloromethane; Freon 30; Methane dichloride; Methane, dichloro-; Methylene bichloride; Methylene Chloride; Methylene dichloride; Metylenu chlorek; Narkotil; NCI-C50102; R 30; Rcra waste number U080; Solaesthin; Solmethine; UN 1593
|
| 75014 |
CH2CHCl |
Ethene, chloro- |
InChI=1/C2H3Cl/c1-2-3/h2H,1H2 |
ClC=C |
 |
Chlorethene; Chlorethylene; Chloroethene; Chloroethylene; Chlorure de vinyle; Cloruro di vinile; Ethene, chloro-; Ethylene monochloride; Ethylene, chloro-; Monochloroethene; Monochloroethylene; Rcra waste number U043; Vinyl chloride monomer; Vinylchlorid; Winylu chlorek; VC; Vinyl C monomer; Vinyl chloride; Vinyl chloride, inhibited; Trovidur; Vinyle(chlorure de); UN 1086; VCM; Vinile
|
| 593782 |
CH3OCl |
methyl hypochlorite |
InChI=1S/CH3ClO/c1-3-2/h1H3 |
COCl |
 |
|
| 75003 |
CH3CH2Cl |
Ethyl chloride |
InChI=1/C2H5Cl/c1-2-3/h2H2,1H3 |
CCCl |
 |
Aethylchlorid; Aethylis; Aethylis chloridum; Anodynon; Chelen; Chloorethaan; Chlorene; Chlorethyl; Chloridum; Chloroaethan; Chloroethane; Chlorure D'ethyle; Chloryl; Chloryl anesthetic; Cloretilo; Cloroetano; Cloruro di etile; Dublofix; Ethane, chloro-; Ether chloratus; Ether hydrochloric; Ether muriatic; Ethyl Chloride; Etylu chlorek; Hydrochloric ether; Kelene; Monochlorethane; Monochloroethane; Muriatic ether; Narcotile; NCI-C06224; UN 1037
|
| 7789755 |
CaF2 |
Calcium difluoride |
InChI=1/Ca.2FH/h;2*1H/q+2;;/p-2 |
F[Ca]F |
 |
Fluorite; Calcium fluoride; Acid-spar; Fluorspar
|
| 13463677 |
TiO2 |
Titanium dioxide |
InChI=1S/2O.Ti |
O=[Ti]=O |
 |
|
| 544978 |
Zn(CH3)2 |
dimethyl zinc |
InChI=1/2CH3.Zn/h2*1H3; |
C[Zn]C |
 |
|
| 9000140 |
ZnCN |
Zinc monocyanide |
InChI=1S/CN.Zn/c1-2; |
[Zn]C#N |
 |
|
| 7783495 |
ZnF2 |
Zinc difluoride |
InChI=1S/2FH.Zn/h2*1H;/q;;+2/p-2 |
F[Zn]F |
 |
|
| 7646857 |
ZnCl2 |
Zinc dichloride |
InChI=1S/2ClH.Zn/h2*1H;/q;;+2/p-2 |
Cl[Zn]Cl |
 |
Zinc chloride; zinc(II) chloride
|
| 1310538 |
GeO2 |
Germanium dioxide |
InChI=1S/GeO2/c2-1-3 |
[O][Ge][O] |
 |
|
| 10060114 |
GeCl2 |
Germanium dichloride |
InChI=1S/Cl2Ge/c1-3-2 |
Cl[Ge]Cl |
 |
|
| 7446084 |
SeO2 |
Selenium dioxide |
InChI=1/O2Se/c1-3-2 |
O=[Se]=O |
 |
Selenium(IV) oxide; Selenium oxide; selenium dioxide
|
| 1603845 |
OCSe |
Carbonyl selenide |
InChI=1/COSe/c2-1-3 |
O=C=[Se] |
 |
|
| 506683 |
BrCN |
Cyanogen bromide |
InChI=1/CBrN/c2-1-3 |
N#CBr |
 |
Bromine cyanide; Bromocyan; Bromocyanide; Bromocyanogen; Cyanobromide; Cyanogen monobromide; Bromine monocyanide; Cyanic bromide
|
| 9000328 |
BrOCl |
BrOCl |
InChI=1S/BrClO/c1-3-2 |
BrOCl |
 |
|
| 13444876 |
BrNO |
Nitrosyl bromide |
InChI=1S/BrNO/c1-2-3 |
BrN=O |
 |
|
| 21255834 |
OBrO |
OBrO |
InChI=1S/BrO2/c2-1-3 |
[O]Br[O] |
 |
|
| 21308805 |
BrOBr |
Bromine oxide |
InChI=1S/Br2O/c1-3-2 |
BrOBr |
 |
|
| 7726116 |
COHBr |
COHBr |
InChI=1S/CHBrO/c2-1-3/h1H |
O=CBr |
 |
|
| 74975 |
CH2ClBr |
Methane, bromochloro- |
InChI=1S/CH2BrCl/c2-1-3/h1H2 |
ClCBr |
 |
Bromochloromethane; Chlorobromomethane; Monochloromonobromomethane; Methylene chlorobromide
|
| 74953 |
CH2Br2 |
dibromomethane |
InChI=1/CH2Br2/c2-1-3/h1H2 |
BrCBr |
 |
Methylene dibromide; Dibromomethane; Methane, dibromo-; Methylene bromide
|
| 593602 |
C2H3Br |
vinyl bromide |
InChI=1/C2H3Br/c1-2-3/h2H,1H2 |
C=CBr |
 |
Ethene, bromo-; Vinylbromid; UN 1085; Bromoethene; Ethylene, bromo-; Bromoethylene; Bromure de vinyle; NCI-C50373
|
| 74964 |
C2H5Br |
Ethyl bromide |
InChI=1/C2H5Br/c1-2-3/h2H2,1H3 |
CCBr |
 |
Halon 2001; Hydrobromic ether; Bromure d'ethyle; Monobromoethane; Bromoethane; NCI-C55481; Ethane, bromo-; Bromic ether; 1-Bromoethane; UN 1891
|
| 12184804 |
C4 |
Carbon tetramer |
InChI=1/C4/c1-2-4-3-1 |
[C]=C=C=[C] |
 |
|
| 12184804 |
C4+ |
Carbon tetramer cation |
InChI=1S/C4/c1-3-4-2/q+1 |
[C]=C=C=[C+] |
 |
|
| 460128 |
C4H2 |
Diacetylene |
InChI=1/C4H2/c1-3-4-2/h1-2H |
C#CC#C |
 |
Biethynyl; Biacetylene; 1,3-Butadiyne; Butadiyne; buta-1,3-diyne
|
| 460128 |
C4H2+ |
diacetlyene cation |
InChI=1S/C4H2/c1-3-4-2/h1-2H/q+1 |
[CH+]=[C]C#C |
 |
|
| 1120532 |
C4H4 |
cyclobutadiene |
InChI=1S/C4H4/c1-2-4-3-1/h1-4H |
C1=CC=C1 |
 |
|
| 689974 |
C2H3CCH |
1-Buten-3-yne |
InChI=1/C4H4/c1-3-4-2/h1,4H,2H2 |
C=CC#C |
 |
Ethene, ethynyl-; Vinylacetylene; Buten-3-yne; But-1-en-3-yne; Ethynylethene; Monovinylacetylene; 1-Butyn-3-ene; 1-Butene-3-yne; Butenyne; 1-Butenyne; 3-Buten-1-yne
|
| 2873509 |
H2CCCCH2 |
Butatriene |
InChI=1/C4H4/c1-3-4-2/h1-2H2 |
C=C=C=C |
 |
|
| 3100047 |
C4H6 |
1-Methylcyclopropene |
InChI=1/C4H6/c1-4-2-3-4/h2H,3H2,1H3 |
CC1=CC1 |
 |
1-Methylcyclopropene; Cyclopropene, 1-methyl-; 1-methylcycloprop-1-ene
|
| 6142730 |
C4H6 |
Methylenecyclopropane |
InChI=1/C4H6/c1-4-2-3-4/h1-3H2 |
C=C1CC1 |
 |
|
| 822355 |
C4H6 |
Cyclobutene |
InChI=1/C4H6/c1-2-4-3-1/h1-2H,3-4H2 |
C1=CCC1 |
 |
Cyclobutene
|
| 503173 |
CH3CCCH3 |
2-Butyne |
InChI=1/C4H6/c1-3-4-2/h1-2H3 |
CC#CC |
 |
2-Butyne; But-2-yne; Crotonylene; Dimethylacetylene; UN 1144; butyne
|
| 590192 |
CH2CCHCH3 |
1,2-Butadiene |
InChI=1/C4H6/c1-3-4-2/h4H,1H2,2H3 |
C=C=CC |
 |
1,2-Butadiene; Allene, methyl-; Methylallene; buta-1,2-diene
|
| 106990 |
CH2CHCHCH2 |
1,3-Butadiene |
InChI=1/C4H6/c1-3-4-2/h3-4H,1-2H2 |
C=CC=C |
 |
α,γ-Butadiene; 1,3-Butadiene; (E)-CH2=CHCH=CH2; Biethylene; Bivinyl; Buta-1,3-dieen; Buta-1,3-dien; Buta-1,3-diene; Butadieen; Butadien; Butadiene; Divinyl; Erythrene; NCI-C50602; Pyrrolylene; trans-Butadiene; Vinylethylene; alpha,gamma-Butadiene; 1,3butadiene
|
| 107006 |
CHCCH2CH3 |
1-Butyne |
InChI=1/C4H6/c1-3-4-2/h1H,4H2,2H3 |
C#CCC |
 |
1-Butyne; Butyne-1; Ethyl acetylene, inhibited; Ethylacetylene; Ethylethyne; UN 2452; butyne; but-1-yne
|
| 106989 |
CH2CHCH2CH3 |
1-Butene |
InChI=1/C4H8/c1-3-4-2/h3H,1,4H2,2H3 |
C=CCC |
 |
α-Butene; α-Butylene; 1-Butene; 1-Butylene; 1-C4H8; But-1-ene; Butene-1; Ethylethylene; butene; alpha-Butene; alpha-Butylene
|
| 115117 |
CH2C(CH3)CH3 |
1-Propene, 2-methyl- |
InChI=1/C4H8/c1-4(2)3/h1H2,2-3H3 |
C=C(C)C |
 |
1-Propene, 2-methyl-; γ-Butylene; 1,1-Dimethylethylene; 2-Methyl-1-propene; 2-Methylpropene; 2-Methylpropene-isobutylene; Isobutene; Isobutylene; iso-C4H8; Isopropylidenemethylene; Liquefied petroleum gas; Methylpropene; Propene, 2-methyl-; UN 1055; UN 1075; gamma-Butylene; 2-methylprop-1-ene
|
| 590181 |
CH3CHCHCH3 |
2-Butene, (Z)- |
InChI=1/C4H8/c1-3-4-2/h3-4H,1-2H3/b4-3- |
C/C=C\C |
 |
2-Butene, (Z)-; (Z)-2-Butene; (Z)-2-C4H8; cis-1,2-Dimethylethylene; cis-2-Butene; cis-Butene; cis-Butylene; Dimethylethylene; butene; 2-butene; (Z)-but-2-ene
|
| 624646 |
CH3CHCHCH3 |
2-Butene, (E)- |
InChI=1/C4H8/c1-3-4-2/h3-4H,1-2H3/b4-3+ |
C/C=C/C |
 |
2-Butene, (E)-; (E)-2-Butene; (E)-2-C4H8; 2-trans-Butene; trans-1,2-Dimethylethylene; trans-2-Butene; trans-Butene; butene; 2-butene; (E)-but-2-ene
|
| 1605738 |
C(CH3)3 |
Tert-butyl radical |
InChI=1/C4H9/c1-4(2)3/h1-3H3 |
C[C](C)C |
 |
tert-Butyl radical; tert-C4H9; 2-Methylpropan-2-yl
|
| 4630459 |
CH2CH(CH3)2 |
Isobutyl radical |
InChI=1/C4H9/c1-4(2)3/h4H,1H2,2-3H3 |
[CH2]C(C)C |
 |
1-Propyl radical, 2-methyl-; Isobutyl radical; iso-C4H9; 2-Methylpropan-1-yl
|
| 2348552 |
CH3CHCH2CH3 |
2-Butyl radical |
InChI=1/C4H9/c1-3-4-2/h3H,4H2,1-2H3 |
C[CH]CC |
 |
2-Butyl radical; sec-Butyl radical; sec-C4H9; butan-2-yl
|
| 106978 |
CH3CH2CH2CH3 |
Butane |
InChI=1/C4H10/c1-3-4-2/h3-4H2,1-2H3 |
CCCC |
 |
Butane; Butanen; Butani; Diethyl; Freon 600; Liquefied petroleum gas; LPG; Methylethylmethane; n-Butane; n-C4H10; UN 1011; UN 1075
|
| 75285 |
CH3CH(CH3)CH3 |
Isobutane |
InChI=1/C4H10/c1-4(2)3/h4H,1-3H3 |
CC(C)C |
 |
1,1-Dimethylethane; 2-Methylpropane; A 31; i-Butane; Isobutane; Isobutane mixtures; iso-C4H10; Liquefied petroleum gas; Propane, 2-methyl-; R 600a; tert-Butane; UN 1969; UN 1075; Trimethylmethane
|
| 157335 |
C4H6 |
Bicyclo[1.1.0]butane |
InChI=1/C4H6/c1-3-2-4(1)3/h3-4H,1-2H2 |
[C@@H]12C[C@@H]1C2 |
 |
Bicyclo[1.1.0]butane
|
| 287230 |
C4H8 |
cyclobutane |
InChI=1/C4H8/c1-2-4-3-1/h1-4H2 |
C1CCC1 |
 |
Cyclobutane; Tetramethylene; UN 2601
|
| 460195 |
C2N2 |
Cyanogen |
InChI=1/C2N2/c3-1-2-4 |
N#CC#N |
 |
Carbon nitride; Carbon nitride (C2N2); Cyanogen; Cyanogen (C2N2); Cyanogen gas; Cyanogene; Dicyan; Dicyanogen; Ethanedinitrile; NCCN; Nitriloacetonitrile; Oxalic acid dinitrile; Oxalic nitrile; Oxalonitrile; Oxalyl cyanide; Prussite; Rcra waste number P031; UN 1026
|
| 460195 |
C2N2+ |
Cyanogen cation |
InChI=1S/C2N2/c3-1-2-4/q+1 |
N#[C+]C#N |
 |
|
| 1070719 |
HCCCN |
Cyanoacetylene |
InChI=1/C3HN/c1-2-3-4/h1H |
C#CC#N |
 |
Propiolonitrile; Cyanaethylene; Cyanoethyne; Propynenitrile; 2-Propynenitrile
|
| 1070719 |
HCCCN+ |
Cyanoacetylene cation |
InChI=1S/C3HN/c1-2-3-4/h1H/q+1 |
[CH+]=C=C=[N] |
 |
|
| 107131 |
C3H3N |
acrylonitrile |
InChI=1/C3H3N/c1-2-3-4/h2H,1H2 |
C=CC#N |
 |
2-Propenenitrile; Acritet; Acrylnitril; Acrylon; Acrylonitrile; Acrylonitrile monomer; Acrylonitrile, inhibited; Akrylonitril; Akrylonitryl; Carbacryl; Cianuro di vinile; Cyanoethene; Cyanoethylene; Cyanure de vinyle; ENT 54; Fumigrain; Miller's fumigrain; Nitrile acrilico; Nitrile acrylique; Propenenitrile; Rcra waste number U009; TL 314; VCN; Ventox; Vinylkyanid; UN 1093; Vinyl cyanide
|
| 107131 |
C3H3N+ |
acrylonitrile cation |
InChI=1S/C3H3N/c1-2-3-4/h2H,1H2/q+1 |
[CH2][CH+]C#N |
 |
|
| 107120 |
C2H5CN |
ethyl cyanide |
InChI=1S/C3H5N/c1-2-3-4/h2H2,1H3 |
CCC#N |
 |
Propanenitrile; Propionitrile; Cyanoethane; Ether cyanatus; Ethyl cyanide; Hydrocyanic ether; Propionic nitrile; Propiononitrile; Propylnitrile; UN 2404
|
| 765300 |
C3H7N |
Cyclopropylamine |
InChI=1/C3H7N/c4-3-1-2-3/h3H,1-2,4H2 |
NC1CC1 |
 |
Aminocyclopropane; Cyclopropanamine; Cyclopropylamine
|
| 540738 |
CH3NHNHCH3 |
dimethyl hydrazine |
InChI=1S/C2H8N2/c1-3-4-2/h3-4H,1-2H3 |
CNNC |
 |
Hydrazine, 1,2-dimethyl-; s-Dimethylhydrazine; DMH; N,N'-Dimethylhydrazine; 1,2-Dimethylhydrazine; sym-Dimethylhydrazine; Dimethylhydrazine
|
| 107153 |
C2H8N2 |
Ethylenediamine |
InChI=1/C2H8N2/c3-1-2-4/h1-4H2 |
NCCN |
 |
β-Aminoethylamine; 1,2-Diaminoaethan; 1,2-Diamino-ethaan; 1,2-Diaminoethane; 1,2-Diamino-ethano; 1,2-Ethanediamine; 1,2-Ethylenediamine; Aethaldiamin; Aethylenediamin; Diaminoethane; Dimethylenediamine; Ethane-1,2-diamine; Ethyleendiamine; Ethylendiamine; Ethylenediamine; NCI-C60402; UN 1604; beta-Aminoethylamine; en
|
| 107108 |
NH2CH2CH2CH3 |
1-Propanamine |
InChI=1/C3H9N/c1-2-3-4/h2-4H2,1H3 |
CCCN |
 |
1-Propanamine; 1-Propylamine; 1-Aminopropane; Mono-n-propylamine; Monopropylamine; n-C3H7NH2; n-Propylamine; Propanamine; Propylamine; Rcra waste number U194; UN 1277; propan-1-amine
|
| 75310 |
CH3CH(NH2)CH3 |
2-Propanamine |
InChI=1/C3H9N/c1-3(2)4/h3H,4H2,1-2H3 |
CC(C)N |
 |
1-Methylethylamine; 2-Amino-propaan; 2-Aminopropan; 2-Aminopropane; 2-Amino-propano; 2-Propanamine; 2-Propylamine; iso-C3H7NH2; Isopropilamina; Isopropylamine; MIPA; Monoisopropylamine; Propane, 2-amino-; Propylamine mono; sec-Propylamine; UN 1221; propan-2-amine
|
| 75503 |
N(CH3)3 |
Trimethylamine |
InChI=1/C3H9N/c1-4(2)3/h1-3H3 |
CN(C)C |
 |
Methanamine, N,N-dimethyl-; Methylamine, N,N-dimethyl-; TMA; Trimethylamine; UN 1083; UN 1297
|
| 12144057 |
CO3-2 |
carbonate |
InChI=1S/CH2O3/c2-1(3)4/h(H2,2,3,4)/p-2 |
[O-]C([O-])=O |
 |
|
| 12033497 |
NO3- |
nitrate anion |
InChI=1S/NO3/c2-1(3)4/q-1 |
[O][N-]([O])[O] |
 |
nitrate
|
| 12033497 |
NO3 |
Nitrogen trioxide |
InChI=1/NO3/c2-1(3)4 |
[O]N(=O)=O |
 |
Nitrogen oxide; Nitrogen trioxide
|
| 12033497 |
NO3+ |
nitrogen trioxide cation |
InChI=1S/NO3/c2-1(3)4/q+1 |
[O][N+]([O])=O |
 |
|
| 13766284 |
B2O2 |
Diboron dioxide |
InChI=1/B2O2/c3-1-2-4 |
O=BB=O |
 |
Boron oxide; Diboron dioxide; diboron(III) dioxide
|
| 57932566 |
ONNO |
NO dimer |
InChI=1S/N2O2/c3-1-2-4 |
O=NN=O |
 |
|
| 7697372 |
HNO3 |
Nitric acid |
InChI=1/HNO3/c2-1(3)4/h(H,2,3,4) |
O=N(O)=O |
 |
Acide nitrique; Acido nitrico; Aqua fortis; Azotic acid; Azotowy kwas; Hydrogen nitrate; Kyselina dusicne; NA 1760; Nitric Acid; Nitric acid fuming; Salpetersaure; Salpeterzuuroplossingen; UN 2031
|
| 71523 |
HCO3- |
bicarbonate anion |
InChI=1S/CH2O3/c2-1(3)4/h(H2,2,3,4)/p-1 |
OC([O-])=O |
 |
|
| 107222 |
C2H2O2 |
Ethanedial |
InChI=1/C2H2O2/c3-1-2-4/h1-2H |
O=CC=O |
 |
1,2-Ethanedione; Biformal; Biformyl; Diformal; Diformyl; Ethandial; Ethane-1,2-dione; Ethanedial; Ethanedione; Glyoxal; Glyoxal aldehyde; Glyoxylaldehyde; Oxal; Oxalaldehyde
|
| 107222 |
C2H2O2+ |
Ethanedial cation |
InChI=1S/C2H2O2/c3-1-2-4/h1-2H/q+1 |
[O][CH+]C=O |
 |
|
| 463796 |
H2CO3 |
Carbonic acid |
InChI=1S/CH2O3/c2-1(3)4/h(H2,2,3,4) |
O=C(O)O |
 |
|
| 624919 |
CH3ONO |
Methyl nitrite |
InChI=1/CH3NO2/c1-4-2-3/h1H3 |
O=NOC |
 |
Methyl ester of nitrous acid; Methyl nitrite; Methylester kyseliny dusite; Nitrous acid, methyl ester
|
| 71501 |
CH3COO- |
acetate anion |
InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/p-1 |
CC([O-])=O |
 |
acetate
|
| 75525 |
CH3NO2 |
Methane, nitro- |
InChI=1/CH3NO2/c1-2(3)4/h1H3 |
C[N](=O)=O |
 |
Methane, nitro-; Nitrocarbol; Nitrometan; Nitromethane; UN 1261
|
| 10043353 |
H3BO3 |
Boric acid |
InChI=1S/BH3O3/c2-1(3)4/h2-4H |
OB(O)O |
 |
Orthoboric acid; Boracic acid; Boron hydroxide; Boron trihydroxide; boric acid
|
| 9000071 |
C3H4O |
allenol |
InChI=1/C3H4O/c1-2-3-4/h3-4H,1H2 |
C=C=CO |
 |
1,2-propadiene-1-ol; 1,2-propadiene-3-ol; propadienol; propa-1,2-dien-1-ol
|
| 5009278 |
C3H4O |
Cyclopropanone |
InChI=1/C3H4O/c4-3-1-2-3/h1-2H2 |
O=C1CC1 |
 |
Cyclopropanone
|
| 6004440 |
C3H4O |
Methylketene |
InChI=1/C3H4O/c1-2-3-4/h2H,1H3 |
O=C=CC |
 |
|
| 64197 |
CH3COOH |
Acetic acid |
InChI=1/C2H4O2/c1-2(3)4/h1H3,(H,3,4) |
CC(O)=O |
 |
Acetasol; Acetic acid; Acetic acid, glacial; Acide acetique; Acido acetico; Azijnzuur; component of Aci-Jel; Essigsaeure; Ethanoic acid; Ethylic acid; Glacial acetic acid; Kyselina octova; Methanecarboxylic acid; Octowy kwas; Vinegar acid; UN 2789; UN 2790
|
| 57136 |
NH2CONH2 |
Urea |
InChI=1/CH4N2O/c2-1(3)4/h(H4,2,3,4) |
NC(N)=O |
 |
Alphadrate; Aqua Care; Aquacare HP; Aquadrate; Benural 70; B-I-K; Calmurid; Carbaderm; Carbamide; Carbamide resin; Carbamimidic acid; Carbonyl Diamine; Carbonyldiamide; component of Artra Ashy Skin Cream; Isourea; Keratinamin; Mocovina; NCI-C02119; Pastaron; Prespersion, 75 urea; Pseudourea; Supercel 3000; Ureaphil; Urevert; Urea; Varioform ii; Ultra Mide; UR; Urepearl; Urea-13C; Ureophil
|
| 57136 |
NH2CONH2+ |
Urea cation |
InChI=1S/CH4N2O/c2-1(3)4/h2-3H2/q+1 |
NC(N)=[O+] |
 |
|
| 99 |
HCOOHH2O |
Formic acid water dimer |
InChI=1/CH4O3/c2-1-4-5-3/h1H,3H2 |
OC=O.O |
 |
|
| 102 |
H2OHCOOH |
Water formic acid dimer 1 |
InChI=1/CH4O3/c2-1-4-5-3/h1,3-4H |
OC=O.O |
 |
|
| 113 |
H2OHCOOH |
Water formic acid dimer 2 |
InChI=1/CH4O3/c2-1-4-5-3/h1-3H |
OC=O.O |
 |
|
| 107197 |
C3H4O |
2-Propyn-1-ol |
InChI=1/C3H4O/c1-2-3-4/h1,4H,3H2 |
C#CCO |
 |
1-propyne-3-ol; propyne-3-ol; prop-2-yn-1-ol
|
| 107313 |
CH3OCHO |
methyl formate |
InChI=1/C2H4O2/c1-4-2-3/h2H,1H3 |
O=COC |
 |
Formiate de methyle; Formic acid, methyl ester; Methyl ester of formic acid; Methyl formate; Methyl methanoate; Methylester kyseliny mravenci; Methylformiaat; Methylformiat; Metil; Mravencan methylnaty; UN 1243
|
| 107028 |
CH2CHCHO |
Acrolein |
InChI=1/C3H4O/c1-2-3-4/h2-3H,1H2 |
O=CC=C |
 |
2-Propenal; trans-Acrolein; Acrylaldehyde; Acrylic Aldehyde; Allyl aldehyde; Aqualin; Prop-2-En-1-al; Acroleine; Propenal; Propen-1-one; Akrolein
|
| 141468 |
CHOCH2OH |
hydroxy acetaldehyde |
InChI=1/C2H4O2/c3-1-2-4/h1,4H,2H2 |
O=CCO |
 |
Glycolaldehyde; Glycolic aldehyde; Hydroxyacetaldehyde; Acetaldehyde, hydroxy-; Methylol formaldehyde; Monomethylolformaldehyde; Diose; 2-hydroxyacetaldehyde
|
| 61233190 |
C2H4O2 |
1,3-dioxetane |
InChI=1S/C2H4O2/c1-3-2-4-1/h1-2H2 |
O1COC1 |
 |
formaldehyde dimer; 1,3-dioxetane
|
| 15932895 |
HOCH2OOH |
hydroxy methyl peroxide |
InChI=1S/CH4O3/c2-1-4-3/h2-3H,1H2 |
OCOO |
 |
|
| 107299 |
CH3CHNOH |
Acetaldoxime |
InChI=1/C2H5NO/c1-2-3-4/h2,4H,1H3/b3-2+ |
C/C=N/O |
 |
(E)-CH3CH=NOH; Acetaldehyde oxime; Acetaldoxime; Acetaldoxime,syn & anti; Aldoxime; Ethanal oxime; Ethylidenehydroxylamine; UN 2332; USAF am-5; (E)-acetaldehyde oxime
|
| 60355 |
CH3CONH2 |
Acetamide |
InChI=1/C2H5NO/c1-2(3)4/h1H3,(H2,3,4) |
CC(N)=O |
 |
Acetamide; Acetic acid amide; Acetimidic acid; Amid kyseliny octove; Ethanamide; Methanecarboxamide; NCI-C02108
|
| 3170614 |
C2H5OO |
ethylperoxy radical |
InChI=1S/C2H5O2/c1-2-4-3/h2H2,1H3 |
CCO[O] |
 |
|
| 67641 |
CH3COCH3 |
Acetone |
InChI=1/C3H6O/c1-3(2)4/h1-2H3 |
CC(C)=O |
 |
β-Ketopropane; 2-Propanone; Acetone; Acetone oil; Allylic alcohol; Chevron acetone; Dimethyl ketone; Dimethylformaldehyde; Dimethylketal; Ketone propane; Ketone, dimethyl-; Methyl ketone; Propanone; Pyroacetic ether; Rcra waste number U002; UN 1091; UN 1090; beta-Ketopropane; propan-2-one
|
| 75569 |
C3H6O |
Propylene oxide |
InChI=1/C3H6O/c1-3-2-4-3/h3H,2H2,1H3 |
CC1CO1 |
 |
1,2-Epoxypropane; 1,2-Propylene oxide; 2-Methyl oxirane; 2,3-Epoxypropane; 2-Methyloxiran; 3-Methyl-1,2-epoxypropane; AD 6; Epoxypropane; Ethylene oxide, methyl-; Methylethylene oxide; Methyloxirane; NCI-C50099; Oxirane, methyl-; Oxyde de propylene; Propane, 1,2-epoxy-; Propane, epoxy-; Propene oxide; Propylene epoxide; Propylene oxide; UN 1280; 2-methyloxirane
|
| 107211 |
C2H6O2 |
1,2-Ethanediol |
InChI=1/C2H6O2/c3-1-2-4/h3-4H,1-2H2 |
OCCO |
 |
1,2-Dihydroxyethane; 1,2-Ethandiol; 1,2-Ethanediol; 2-Hydroxyethanol; Athylenglykol; Dihydroxyethane; Dowtherm SR 1; Ethane-1,2-diol; Ethanediol; Ethylene alcohol; Ethylene dihydrate; Ethylene glycol; Ethylene gycol; Fridex; Glycol; Glycol alcohol; Glygen; Lutrol 9; M.e.g.; Macrogol 400 BPC; Monoethylene glycol; Norkool; Ramp; Tescol; Ucar 17; Zerex
|
| 107186 |
C3H6O |
2-Propen-1-ol |
InChI=1/C3H6O/c1-2-3-4/h2,4H,1,3H2 |
C=CCO |
 |
1-Propen-3-ol; 1-Propenol-3; 2-Propen-1-ol; 2-Propene-1-ol; 2-Propenol; 2-Propenyl alcohol; 3-Hydroxy-1-propene; 3-Hydroxypropene; AA; Aaalcool allilco; Alcool allilco; Alcool allylique; Allilowy alkohol; Allyl al; Allyl alcohol; Allylalkohol; Allylic alcohol; Orvinylcarbinol; Propen-1-ol-3; Propenol; Propenyl alcohol; Rcra waste number P005; Shell unkrautted A; Shell Unkrauttod A; UN 1098; Vinylcarbinol; Weed drench; prop-2-en-1-ol
|
| 123386 |
CH3CH2CHO |
Propanal |
InChI=1/C3H6O/c1-2-3-4/h3H,2H2,1H3 |
CCC=O |
 |
1-Propanal; 1-Propanone; Aldehyde propionique; Methylacetaldehyde; NCI-C61029; n-Propanal; n-Propionaldehyde; n-Propylal; Propaldehyde; Propanal; Propanalaldehyde; Propanaldehyde; Propional; Propionaldehyde; Propionic aldehyde; Propylaldehyde; Propylic aldehyde; UN 1275
|
| 690028 |
CH3OOCH3 |
dimethylperoxide |
InChI=1S/C2H6O2/c1-3-4-2/h1-2H3 |
COOC |
 |
Peroxide, dimethyl; Methyl peroxide; (Methylperoxy)methane
|
| 503300 |
C3H6O |
Oxetane |
InChI=1/C3H6O/c1-2-4-3-1/h1-3H2 |
O1CCC1 |
 |
1,3-Epoxypropane; 1,3-Propylene oxide; 1,3-Trimethylene oxide; α,γ-Propane oxide; Cyclooxabutane; Oxacyclobutane; Oxetan; Oxetane; Propane, 1,3-epoxy-; Trimethylenoxid; Trimethylene oxide; alpha,gamma-Propane oxide
|
| 540670 |
CH3OC2H5 |
Ethane, methoxy- |
InChI=1/C3H8O/c1-3-4-2/h3H2,1-2H3 |
CCOC |
 |
Ethane, methoxy-; Ether, ethyl methyl; Ethyl methyl ether; Methane, ethoxy-; Methoxyethane; Methyl ethyl ether; ether; UN 1039
|
| 71238 |
C3H7OH |
1-Propanol |
InChI=1/C3H8O/c1-2-3-4/h4H,2-3H2,1H3 |
CCCO |
 |
1-Propanol; 1-Propyl alcohol; 1-Hydroxypropane; Alcool propilico; Alcool propylique; Ethylcarbinol; n-C3H7OH; n-Propan-1-ol; n-Propanol; n-Propyl alcohol; n-Propyl alkohol; Optal; Osmosol extra; Propan-1-ol; Propanol; Propanol-1; Propanole; Propanolen; Propanoli; Propyl alcohol; Propylic alcohol; Propylowy alkohol; UN 1274
|
| 67630 |
CH3CHOHCH3 |
Isopropyl alcohol |
InChI=1/C3H8O/c1-3(2)4/h3-4H,1-2H3 |
CC(C)O |
 |
1-Methylethyl Alcohol; 2-Hydroxypropane; 2-Propanol; 2-Propyl alcohol; Alcohol, rubbing; Alcojel; Alcolo; Alcool isopropilico; Alcool isopropylique; Alcosolve; Alcosolve 2; Alkolave; Arquad DMCB; Avantin; Avantine; Chromar; Combi-Schutz; Dimethylcarbinol; Hartosol; Imsol A; IPA; i-Propanol; i-Propylalkohol; iso-C3H7OH; Isohol; Isopropanol; Isopropenol; Isopropyl Alcohol; Isopropyl alcohol, rubbing; iso-Propylalkohol; Lavacol; Lutosol; n-Propan-2-ol; Petrohol; PRO; Propan-2-ol; Propane, 2-hydroxy-; Propol; sec-Propanol; sec-Propyl Alcohol; Spectrar; Sterisol hand disinfectant; Takineocol; UN 1219; Visco 1152
|
| 124 |
H2OCH3OCH3 |
water dimethylether dimer |
InChI=1/C2H8O2/c1-4(2)5-3/h3H,1-2H3 |
COC.O |
 |
|
| 353504 |
CF2O |
Carbonic difluoride |
InChI=1/CF2O/c2-1(3)4 |
O=C(F)F |
 |
Carbon difluoride oxide; Carbon fluoride oxide; Carbon fluoride oxide (COF2); Carbon oxyfluoride; Carbonic difluoride; Carbonyl difluoride; Carbonyl fluoride; Difluoroformaldehyde; Difluorooxomethane; Difluorophosgene; Fluophosgene; Fluoroformyl fluoride; Fluorophosgene; Rcra waste number U033; UN 2417
|
| 689996 |
C2F2 |
difluoroacetylene |
InChI=1/C2F2/c3-1-2-4 |
FC#CF |
 |
Acetylene, difluoro-; Ethyne, difluoro-; Difluoroethyne; 1,2-Difluoroacetylene; 1,2-difluoroethyne
|
| 2264213 |
CF3- |
Trifluoromethyl anion |
InChI=1S/CF3/c2-1(3)4/q-1 |
F[C-](F)F |
 |
|
| 2264213 |
CF3 |
Trifluoromethyl radical |
InChI=1/CF3/c2-1(3)4 |
F[C](F)F |
 |
Trifluoromethyl; Trifluoromethyl radical
|
| 2264213 |
CF3+ |
Trifluoromethyl cation |
InChI=1S/CF3/c2-1(3)4/q+1 |
F[C+](F)F |
 |
|
| 7783542 |
NF3- |
Nitrogen trifluoride anion |
InChI=1S/F3N/c1-4(2)3/q-1 |
F[N-](F)F |
 |
|
| 7783542 |
NF3 |
Nitrogen trifluoride |
InChI=1/F3N/c1-4(2)3 |
FN(F)F |
 |
Nitrogen fluoride; Nitrogen fluoride (NF3); Nitrogen trifluoride; Perfluoroammonia; Trifluoroamine; Trifluoroammonia; UN 2451
|
| 7783542 |
NF3+ |
Nitrogen trifluoride cation |
InChI=1S/F3N/c1-4(2)3/q+1 |
F[N+](F)F |
 |
|
| 7783440 |
FOOF |
Perfluoroperoxide |
InChI=1S/F2O2/c1-3-4-2 |
FOOF |
 |
|
| 7637072 |
BF3- |
Borane, trifluoro- anion |
InChI=1S/BF3/c2-1(3)4/q-1 |
F[B-](F)F |
 |
|
| 7637072 |
BF3 |
Borane, trifluoro- |
InChI=1/BF3/c2-1(3)4 |
FB(F)F |
 |
Borane, trifluoro-; Boron fluoride; Boron fluoride (BF3); Boron trifluoride; Fluorure de bore; Trifluoroboron; UN 1008; Trifluoroborane
|
| 7637072 |
BF3+ |
boron trifluoride cation |
InChI=1S/BF3/c2-1(3)4/q+1 |
F[B+](F)F |
 |
|
| 13812436 |
N2F2 |
(Z)-Difluorodiazene |
InChI=1/F2N2/c1-3-4-2/b4-3- |
F/N=N\F |
 |
(Z)-Difluorodiazene; cis-1,2-Difluorodiimide; cis-Difluorodiazene; FNNF; Nitrogen fluoride (N2F2), (Z)-; Nitrogen fluoride, cis; (Z)-1,2-difluorodiazene
|
| 13776620 |
N2F2 |
Dinitrogen difluoride, (E)- |
InChI=1/F2N2/c1-3-4-2/b4-3+ |
F/N=N/F |
 |
(E)-Difluorodiazene; (E)-N2F2; Difluorodiazene, (E)-; Dinitrogen difluoride, (E)-; FNNF; Nitrogen fluoride (N2F2), (E)-; Nitrogen fluoride, trans; trans-1,2-Difluorodiazene; trans-1,2-Difluorodiimide; trans-Difluorodiazene; (E)-1,2-difluorodiazene
|
| 75467 |
CHF3 |
Methane, trifluoro- |
InChI=1/CHF3/c2-1(3)4/h1H |
FC(F)F |
 |
Arcton; Arcton 1; Carbon trifluoride; Fluoroform; Fluoryl; Freon 23; Freon F-23; Genetron 23; Halocarbon 23; Methane, trifluoro-; Methyl trifluoride; R 23; Trifluoromethane; UN 1984
|
| 75387 |
CH2CF2 |
Ethene, 1,1-difluoro- |
InChI=1/C2H2F2/c1-2(3)4/h1H2 |
FC(F)=C |
 |
1,1-Difluoroethene; 1,1-Difluoroethylene; Ethene, 1,1-difluoro-; Ethylene, 1,1-difluoro-; Genetron 1132a; Halocarbon 1132A; NCI-C60208; UN 1959; Vinylidene difluoride; Vinylidene fluoride; VDF
|
| 1630779 |
C2H2F2 |
Ethene, 1,2-difluoro-, (Z)- |
InChI=1/C2H2F2/c3-1-2-4/h1-2H/b2-1- |
F/C=C\F |
 |
1,2-Difluoroethylene, (Z)-; Ethylene, 1,2-difluoro-(Z)-; Z-1,2-Difluoroethene; (Z)-1,2-difluoroethene
|
| 1630780 |
C2H2F2 |
Ethene, 1,2-difluoro-, (E)- |
InChI=1/C2H2F2/c3-1-2-4/h1-2H/b2-1+ |
F/C=C/F |
 |
Ethylene, 1,2-difluoro-, (E)-; E-1,2-Difluoroethene; 1,2-Difluoroethylene, (E)-; (E)-1,2-difluoroethene
|
| 557993 |
CH3COF |
Acetyl fluoride |
InChI=1/C2H3FO/c1-2(3)4/h1H3 |
O=C(F)C |
 |
Acetyl fluoride; Fluorid kyseliny octove; Methylcarbonyl fluoride
|
| 624726 |
C2H4F2 |
1,2-difluoroethane |
InChI=1/C2H4F2/c3-1-2-4/h1-2H2 |
FCCF |
 |
Ethylene difluoride; Ethane, 1,2-difluoro-; FC143; Freon 152; 1,2-difluoroethane
|
| 75376 |
CH3CHF2 |
Ethane, 1,1-difluoro- |
InChI=1/C2H4F2/c1-2(3)4/h2H,1H3 |
CC(F)F |
 |
1,1-Difluoroethane; Algofrene Type 67; Difluoroethane; Dymel 152; Ethane, 1,1-difluoro-; Ethylene fluoride; Ethylidene difluoride; Ethylidene fluoride; FC 152a; Freon 152; Freon 152a; GENETRON 100; Genetron 152a; Halocarbon 152A; Propellant 152a; R 152a; UN 1030
|
| 75241 |
Al(CH3)3 |
trimethyl aluminum |
InChI=1S/3CH3.Al/h3*1H3; |
C[Al](C)C |
 |
|
| 7784181 |
AlF3 |
Aluminum trifluoride |
InChI=1/Al.3FH/h;3*1H/q+3;;;/p-3 |
F[Al](F)F |
 |
Aluminium fluorure; Aluminum fluoride; Aluminum fluoride (AlF3); Aluminum trifluoride; Fluorid hlinity
|
| 993077 |
SiH(CH3)3 |
trimethylsilane |
InChI=1/C3H10Si/c1-4(2)3/h4H,1-3H3 |
C[SiH](C)C |
 |
|
| 12185103 |
P4 |
Phosphorus tetramer |
InChI=1/P4/c1-2-3(1)4(1)2 |
P12P3P1P23 |
 |
Phosphorus; Phosphorus tetramer; tricyclo[1.1.0.02,4]tetraphosphine
|
| 7783553 |
PF3 |
Phosphorus trifluoride |
InChI=1/F3P/c1-4(2)3 |
FP(F)F |
 |
Phosphorous fluoride; Phosphorous-trifluoride-; Phosphorus fluoride; Phosphorus trifluoride; Phosphorus(III) fluoride; TL 75; Trifluorophosphine
|
| 7446119 |
SO3- |
Sulfur trioxide anion |
InChI=1S/O3S/c1-4(2)3/q-1 |
[O-][S]([O])[O] |
 |
|
| 7446119 |
SO3 |
Sulfur trioxide |
InChI=1/O3S/c1-4(2)3 |
O=S(=O)=O |
 |
Sulfan; Sulfur oxide (SO3); Sulfur trioxide; Sulfur trioxide, stabilized; Sulfuric anhydride; Sulfuric oxide; UN 1829
|
| 7446119 |
SO3+ |
Sulfur trioxide cation |
InChI=1S/O3S/c1-4(2)3/q+1 |
[O][S+]([O])[O] |
 |
|
| 104267223 |
HSO3 |
HOSO2 |
InChI=1S/HO3S/c1-4(2)3/h(H,1,2) |
O[S@]([O])=O |
 |
|
| 62566 |
NH2CSNH2 |
Thiourea |
InChI=1/CH4N2S/c2-1(3)4/h(H4,2,3,4) |
NC(N)=S |
 |
β-Thiopseudourea; 2-Thiopseudourea; 2-Thiourea; Isothiourea; Pseudothiourea; Pseudourea, 2-thio-; Rcra waste number U219; Sulourea; Thiocarbamide; Thiocarbonic acid diamide; Thiomocovina; Thiourea; Thiuronium; THU; Urea, 2-thio-; USAF ek-497; Tsizp 34; UN 2877; Urea, thio-; beta-Thiopseudourea
|
| 67685 |
CH3SOCH3 |
Dimethyl sulfoxide |
InChI=1/C2H6OS/c1-4(2)3/h1-2H3 |
C[S](C)=O |
 |
A 10846; Deltan; Demasorb; Demavet; Demeso; Demsodrox; Dermasorb; Dimethyl Sulfoxide; Dimethyl sulfoxixde; Dimethyl Sulphoxide; Dimethyl sulpoxide; Dimexide; Dipirartril-tropico; DMS 70; DMS 90; DMSO; Dolicur; Doligur; Domoso; Dromisol; Durasorb; Gamasol 90; Hyadur; Infiltrina; M 176; Methane, sulfinylbis-; Methyl sulfoxide; Methylsulfinylmethane; NSC-763; Rimso 50; Somipront; SQ 9453; SQ 9453 roxyethane; Sulfinylbis[Methane]; Syntexan; Topsym; (methylsulfinyl)methane
|
| 1072431 |
C3H6S |
Thiirane, methyl- |
InChI=1/C3H6S/c1-3-2-4-3/h3H,2H2,1H3 |
C[C@@H]1SC1 |
 |
1,2-Epithiopropane; 2-Methylthiacyclopropane; 2-Methylthiirane; Methylthiirane; Propane, 1,2-epithio-; Propene sulfide; Propylene episulfide; Propylene sulfide; Propylene sulphide; Thiirane, 2-methyl-; Thiirane, methyl-
|
| 624920 |
CH3SSCH3 |
Disulfide, dimethyl |
InChI=1/C2H6S2/c1-3-4-2/h1-2H3 |
CSSC |
 |
2,3-Dithiabutane; (Methyldithio)methane; Dimethyl disulfide; Dimethyl disulphide; Disulfide, dimethyl; Methyl disulfide; UN 2381; 1,2-dimethyldisulfane
|
| 540636 |
CH2SHCH2SH |
1,2-Ethanedithiol |
InChI=1/C2H6S2/c3-1-2-4/h3-4H,1-2H2 |
SCCS |
 |
α-Ethylene dimercaptan; 1,2-Dimercaptoethane; 1,2-Ethanedithiol; 1,2-Ethanethiol; A-ethylene dimercaptan; Dithioethyleneglycol; Dithioglycol; Ethanedithiol; Ethyl hydropersulfide; Ethylene dithioglycol; Ethylene glycol, dithio-; Ethylenedimercaptan; Ethylenedithiol; s-Ethylene dimercaptan; alpha-Ethylene dimercaptan; ethane-1,2-dithiol
|
| 287274 |
C3H6S |
Thietane |
InChI=1/C3H6S/c1-2-4-3-1/h1-3H2 |
S1CCC1 |
 |
Propane, 1,3-epithio-; Thiacyclobutane; Thietane; Trimethylene sulfide
|
| 624895 |
CH3SCH2CH3 |
Ethane, (methylthio)- |
InChI=1/C3H8S/c1-3-4-2/h3H2,1-2H3 |
CCSC |
 |
(Methylthio)ethane; 2-Thiabutane; Ethane, (methylthio)-; Ethyl methyl sulfide; Ethyl methyl sulphide; Methyl ethyl sulfide; Sulfide, ethyl methyl; ethyl(methyl)sulfane
|
| 75332 |
CH3CHSHCH3 |
2-Propanethiol |
InChI=1/C3H8S/c1-3(2)4/h3-4H,1-2H3 |
CC(C)S |
 |
1-Methylethanethiol; 2-Isopropyl-6-methylphenyl isocyanate; 2-Mercaptopropane; 2-Propanethiol; 2-Propylmercaptan; iso-C3H7SH; Isopropanethiol; Isopropyl mercaptan; Isopropylthiol; Propanethiol-(2); UN 2402; propane-2-thiol
|
| 107039 |
C3H7SH |
1-Propanethiol |
InChI=1/C3H8S/c1-2-3-4/h4H,2-3H2,1H3 |
CCCS |
 |
1-Propanethiol; 1-Propanethoil; 1-Propyl mercaptan; 3-Mercaptopropanol; n-C3H7SH; n-Propyl mercaptan; Propane-1-thiol; Propanethiol; Propyl mercaptan; UN 2402
|
| 13709358 |
FSSF |
Difluorodisulfane |
InChI=1S/F2S2/c1-3-4-2 |
FSSF |
 |
|
| 16860994 |
S2F2 |
Thio-thionyl fluoride |
InChI=1S/F2S2/c1-3-4-2 |
FSSF |
 |
|
| 19165345 |
SiCl3 |
trichlorosilyl radical |
InChI=1S/Cl3Si/c1-4(2)3 |
Cl[Si](Cl)Cl |
 |
|
| 19165345 |
SiCl3+ |
trichlorosilyl cation |
InChI=1S/Cl3Si/c1-4(2)3/q+1 |
Cl[Si+](Cl)Cl |
 |
|
| 23594889 |
ClO3- |
chlorate anion |
InChI=1S/ClHO3/c2-1(3)4/h(H,2,3,4)/p-1 |
O=Cl([O-])=O |
 |
|
| 13814658 |
AlF2Cl |
Aluminum chloride difluoride |
InChI=1/Al.ClH.2FH/h;3*1H/q+3;;;/p-3 |
F[Al](Cl)F |
 |
Aluminum chloride fluoride
|
| 13444901 |
ClNO2 |
Nitryl chloride |
InChI=1/ClNO2/c1-2(3)4 |
ClN(=O)=O |
 |
Nitryl chloride
|
| 12258989 |
Na2Cl2 |
Disodium dichloride |
InChI=1/2Cl.2Na |
[Na]1Cl[Na]Cl1 |
 |
Sodium chloride; Sodium chloride dimer
|
| 13497966 |
AlFCl2 |
Aluminum dichloride fluoride |
InChI=1/Al.2ClH.FH/h;3*1H/q+3;;;/p-3 |
F[Al](Cl)Cl |
 |
Aluminum chloride fluoride; aluminum dichloride fluoride
|
| 12292238 |
ClOOCl |
Dichlorine dioxide |
InChI=1S/Cl2O2/c1-3-4-2 |
ClOOCl |
 |
|
| 10294345 |
BCl3 |
Borane, trichloro- |
InChI=1/BCl3/c2-1(3)4 |
ClB(Cl)Cl |
 |
Borane, trichloro-; Boron chloride; Boron chloride (BCl3); Boron trichloride; Chlorure de bore; Trichloroboron; Trichloroborane; UN 1741
|
| 7790912 |
ClF3 |
Chlorine trifluoride |
InChI=1/ClF3/c2-1(3)4 |
FCl(F)F |
 |
Chlorine fluoride; Chlorine fluoride (ClF3); Chlorine trifluoride; Chlorotrifluoride; Trifluorure de chlore; UN 1749
|
| 10025679 |
S2Cl2 |
Disulfur dichloride |
InChI=1/Cl2S2/c1-3-4-2 |
ClSSCl |
 |
Sulfur chloride; Thiosulfurous dichloride; Chlorschwefel; Sulfur subchloride; Chlorosulfane; hypochlorous dithioperoxyanhydride
|
| 10025851 |
NCl3 |
nitrogen trichloride |
InChI=1/Cl3N/c1-4(2)3 |
ClN(Cl)Cl |
 |
Nitrogen chloride; Agene; Chlorine nitride; Trichloramine; Trichlorine nitride; Nitrogen trichloride
|
| 7446700 |
AlCl3 |
Aluminum trichloride |
InChI=1/Al.3ClH/h;3*1H/q+3;;;/p-3 |
Cl[Al](Cl)Cl |
 |
Alluminio(cloruro di); Aluminium trichloride; Aluminium, (chlorure d'); Aluminiumchlorid; Aluminum chloride; Aluminum chloride (1:3); Aluminum chloride (AlCl3); Aluminum trichloride; Chlorure d'aluminium; Drysol; NSC 143016; PAC (salt); Pearsall; Trichloroaluminum; UN 1726; UN 2581
|
| 7572294 |
C2Cl2 |
dichloroacetylene |
InChI=1/C2Cl2/c3-1-2-4 |
ClC#CCl |
 |
|
| 7572294 |
C2Cl2+ |
dichloroacetylene cation |
InChI=1S/C2Cl2/c3-1-2-4/q+1 |
ClC#[C+]Cl |
 |
|
| 7719097 |
SOCl2 |
thionyl chloride |
InChI=1/Cl2OS/c1-4(2)3 |
O=S(Cl)Cl |
 |
Sulfinyl chloride; Sulfur chloride oxide; Sulfurous dichloride; Sulfurous oxychloride; Thionyl dichloride; Sulfinyl dichloride; Sulfur oxychloride
|
| 7719122 |
PCl3 |
Phosphorus trichloride |
InChI=1/Cl3P/c1-4(2)3 |
ClP(Cl)Cl |
 |
Chloride of phosphorus; Fosforo(tricloruro di); Fosfortrichloride; Phosphore(trichlorure de); Phosphorous chloride; Phosphorous trichloride; Phosphortrichlorid; Phosphorus chloride; Phosphorus trichloride; Phosphorus(III) chloride; Trojchlorek fosforu; UN 1809; trichlorophosphine
|
| 3170807 |
CCl3- |
Trichloromethyl anion |
InChI=1S/CCl3/c2-1(3)4/q-1 |
Cl[C-](Cl)Cl |
 |
|
| 3170807 |
CCl3 |
Trichloromethyl radical |
InChI=1/CCl3/c2-1(3)4 |
Cl[C](Cl)Cl |
 |
Trichloromethyl; Trichloromethyl radical
|
| 3170807 |
CCl3+ |
Trichloromethyl cation |
InChI=1S/CCl3/c2-1(3)4/q+1 |
Cl[C+](Cl)Cl |
 |
|
| 75445 |
CCl2O |
Phosgene |
InChI=1/CCl2O/c2-1(3)4 |
ClC(Cl)=O |
 |
Carbon dichloride oxide; Carbon oxychloride; Carbone; Carbonic chloride; Carbonic dichloride; Carbonio; Carbonyl chloride; Carbonyl dichloride; Carbonylchlorid; CG; Chloroformyl chloride; Fosgeen; Fosgen; Fosgene; Koolstofoxychloride; NCI-C60219; Phosgen; Phosgene; Rcra waste number P095; UN 1076
|
| 353491 |
COFCl |
Carbonic chloride fluoride |
InChI=1S/CClFO/c2-1(3)4 |
O=C(Cl)F |
 |
Carbonyl chloride fluoride; Carbonyl chlorofluoride; carbonic chloride fluoride
|
| 75456 |
CHF2Cl |
difluorochloromethane |
InChI=1/CHClF2/c2-1(3)4/h1H |
FC(F)Cl |
 |
Methane, chlorodifluoro-; Chlorodifluoromethane; Difluoromonochloromethane; Freon 22; Genetron 22; Monochlorodifluoromethane; R 22
|
| 75434 |
CHFCl2 |
fluorodichloromethane |
InChI=1/CHCl2F/c2-1(3)4/h1H |
FC(Cl)Cl |
 |
Methane, dichlorofluoro-; Dichlorofluoromethane; Dichloromonofluoromethane; Freon 21; Genetron 21; Monofluorodichloromethane; R 21; UN 1029
|
| 67663 |
CHCl3 |
Chloroform |
InChI=1/CHCl3/c2-1(3)4/h1H |
ClC(Cl)Cl |
 |
Chloroform; Chloroforme; Cloroformio; Formyl trichloride; Freon 20; Methane trichloride; Methane, trichloro-; Methenyl trichloride; Methyl trichloride; NCI-C02686; R 20; R 20 (refrigerant); Rcra waste number U044; TCM; Trichloormethaan; Trichloromethane; Trichlormethan; Trichloroform; Triclorometano; UN 1888
|
| 10025782 |
SiHCl3 |
Trichlorosilane |
InChI=1/Cl3HSi/c1-4(2)3/h4H |
Cl[SiH](Cl)Cl |
 |
Silane, trichloro-; Silici-chloroforme; Siliciumchloroform; Silicochloroform; Trichloorsilaan; Trichloromonosilane; Trichlorosilane; Triclorosilano; Trichlorsilan; UN 1295
|
| 7790934 |
HClO3 |
Chloric Acid |
InChI=1S/ClHO3/c2-1(3)4/h2H |
OCl([O])[O] |
 |
|
| 75354 |
CH2CCl2 |
Ethene, 1,1-dichloro- |
InChI=1/C2H2Cl2/c1-2(3)4/h1H2 |
ClC(Cl)=C |
 |
1,1-DCE; 1,1-Dichloroethene; 1,1-Dichloroethylene; Chlorure de vinylidene; Ethene, 1,1-dichloro-; Ethylene, 1,1-dichloro-; NCI-C54262; Rcra waste number U078; Sconatex; VDC; Vinylidine chloride; Vinylidene dichloride; Vinylidene chloride
|
| 156592 |
CHClCHCl |
Ethene, 1,2-dichloro-, (Z)- |
InChI=1/C2H2Cl2/c3-1-2-4/h1-2H/b2-1- |
Cl/C=C\Cl |
 |
1,cis-2-Dichloroethene; 1,2-cis-Dichloroethene; 1,2-cis-Dichloroethylene; (Z)-1,2-Dichloroethene; (Z)-1,2-Dichloroethylene; (Z)-CHCl=CHCl; Acetylene dichloride, cis-; cis-1,2-Dichloroethene; cis-1,2-Dichloroethylene; cis-Di-1,2-Chloroethylene; cis-Dichloroethylene; cis-Dichloromethylene; Dichloroethylene, cis-; Ethene, 1,2-dichloro-, (Z)-; Ethylene, 1,2-dichloro-, (Z)-; 1,2-dichloroethylene
|
| 156605 |
CHClCHCl |
Ethene, 1,2-dichloro-, (E)- |
InChI=1/C2H2Cl2/c3-1-2-4/h1-2H/b2-1+ |
Cl/C=C/Cl |
 |
1,trans-2-Dichloroethene; 1,2-trans-Dichloroethene; 1,2-trans-Dichloroethylene; (E)-1,2-Dichloroethene; (E)-1,2-Dichloroethylene; (E)-CHCl=CHCl; Acetylene dichloride, trans-; Dichloroethylene, trans-; Ethene, 1,2-dichloro-, (E)-; Ethylene, 1,2-dichloro-, (E)-; Rcra waste number U079; trans-1,2-Dichloroethene; trans-1,2-Dichloroethylene; trans-Acetylene dichloride; trans-Di-1,2-Chloroethylene; trans-Dichloroethylene; 1,2-dichloroethylene
|
| 107200 |
CH2ClCHO |
chloroacetaldehyde |
InChI=1S/C2H3ClO/c3-1-2-4/h2H,1H2 |
O=CCCl |
 |
Acetaldehyde, chloro-; Monochloroacetaldehyde; 2-Chloro-1-ethanal; 2-Chloroacetaldehyde; Chloroethanal; 2-Chloroethanal; UN 2232
|
| 75365 |
CH3COCl |
Acetyl Chloride |
InChI=1/C2H3ClO/c1-2(3)4/h1H3 |
CC(Cl)=O |
 |
Acetic acid chloride; Acetic chloride; Acetyl chloride; Ethanoyl chloride; Rcra waste number U006; UN 1717
|
| 75343 |
CH3CHCl2 |
Ethane, 1,1-dichloro- |
InChI=1/C2H4Cl2/c1-2(3)4/h2H,1H3 |
CC(Cl)Cl |
 |
1,1-Dichloorethaan; 1,1-Dichloraethan; 1,1-Dichlorethane; 1,1-Dichloroethane; 1,1-Dicloroetano; Aethylidenchlorid; Assymmetrical Dichloroethane; Chlorinated hydrochloric ether; Chlorure D'ethylidene; Cloruro di etilidene; Dichloromethylmethane; Ethane, 1,1-dichloro-; Ethylidene chloride; Ethylidene dichloride; NCI-C04535; Rcra waste number U076; UN 2362
|
| 107062 |
CH2ClCH2Cl |
Ethane, 1,2-dichloro- |
InChI=1/C2H4Cl2/c3-1-2-4/h1-2H2 |
ClCCCl |
 |
α,β-Dichloroethane; 1,2-Bichloroethane; 1,2-DCE; 1,2-Dichloorethaan; 1,2-Dichlor-aethan; 1,2-Dichlorethane; 1,2-Dichloroethane; 1,2-Dicloroetano; 1,2-Ethylene dichloride; Aethylenchlorid; Bichlorure D'ethylene; Borer sol; Brocide; Chlorure D'ethylene; Cloruro di ethene; Destruxol borer-sol; Dichloremulsion; Di-chlor-mulsion; Dichloro-1,2-ethane; Dichloroethylene; Dutch liquid; Dutch oil; EDC; ENT 1,656; Ethane dichloride; Ethane, 1,2-dichloro-; Ethyleendichloride; Ethylene chloride; Ethylene dichloride; Freon 150; Glycol dichloride; NCI-C00511; Rcra waste number U077; s-Dichloroethane; sym-Dichloroethane; UN 1184; alpha,beta-Dichloroethane
|
| 1615754 |
CH3CHFCl |
Ethane, 1-chloro-1-fluoro- |
InChI=1/C2H4ClF/c1-2(3)4/h2H,1H3 |
C[C@H](Cl)F |
 |
1-Chloro-1-fluoroethane; 1-Chlorofluoroethane; Ethane, 1-chloro-1-fluoro-; Freon 151; Monochloromonofluoroethane
|
| 107051 |
C3H5Cl |
1-Propene, 3-chloro- |
InChI=1/C3H5Cl/c1-2-3-4/h2H,1,3H2 |
C=CCCl |
 |
Allyl chloride; Propene, 3-chloro-; 1-Chloro-2-propene; 2-Propenyl chloride; 3-Chloro-1-propene; 3-Chloropropene; 3-Chloropropylene; Chloroallylene; 3-Chloroprene; Allylchlorid; Chlorallylene; 3-Chloro-1-propylene; 1-Chloropropene-2; 3-Chloropropene-1; Chloropropene
3-Chlorpropen; 3-chloroprop-1-ene
|
| 16136848 |
C3H5Cl |
1-chloro-1-propene(Z) |
InChI=1/C3H5Cl/c1-2-3-4/h2-3H,1H3/b3-2- |
C/C=C\Cl |
 |
1-Propene, 1-chloro-, (Z)-; cis-1-Chloropropene; Propene, 1-chloro-, (Z)-; cis-1-Chloro-1-Propene; 1-Chloro-propene; (Z)-1-Chloro-1-propene; (Z)-1-chloroprop-1-ene
|
| 16136859 |
C3H5Cl |
1-chloro-1-propene(E) |
InChI=1/C3H5Cl/c1-2-3-4/h2-3H,1H3/b3-2+ |
C/C=C/Cl |
 |
1-Propene, 1-chloro-, (E)-; trans-1-Chloropropene; Propene, 1-chloro-, (E)-; (E)-1-Chloro-1-propene; trans-1-Chloro-1-Propene; trans-1-Propenyl chloride; (E)-1-chloroprop-1-ene
|
| 75296 |
CH3CHClCH3 |
Propane, 2-chloro- |
InChI=1/C3H7Cl/c1-3(2)4/h3H,1-2H3 |
CC(C)Cl |
 |
2-Chloropropane; 2-Propyl chloride; Chlorodimethylmethane; iso-C3H7Cl; Isoprid; Isopropyl chloride; Narcosop; Propane, 2-chloro-; sec-Propyl chloride; UN 2356
|
| 540545 |
CH2ClCH2CH3 |
Propane, 1-chloro- |
InChI=1/C3H7Cl/c1-2-3-4/h2-3H2,1H3 |
CCCCl |
 |
1-Chloropropane; Chloropropane; n-C3H7Cl; n-Propyl chloride; Propane, 1-chloro-; Propyl chloride; UN 1278
|
| 593884 |
As(CH3)3 |
trimethyl arsine |
InChI=1S/C3H9As/c1-4(2)3/h1-3H3 |
C[As](C)C |
 |
|
| 7784352 |
AsF3 |
Arsenic trifluoride |
InChI=1S/AsF3/c2-1(3)4 |
F[As](F)F |
 |
Arsenous fluoride; Arsenic fluoride; Trifluoroarsine; Arsenious fluoride; Arsenic(III) fluoride
|
| 7791233 |
SeOCl2 |
selenium oxychloride |
InChI=1S/Cl2OSe/c1-4(2)3 |
[O][Se](Cl)Cl |
 |
|
| 7787715 |
BrF3 |
Bromine trifluoride |
InChI=1/BrF3/c2-1(3)4 |
FBr(F)F |
 |
Bromine fluoride; Bromine trifluoride
|
| 593953 |
COBr2 |
Carbonic dibromide |
InChI=1S/CBr2O/c2-1(3)4 |
O=C(Br)Br |
 |
|
| 96607022 |
BrONO |
Bromine nitrite |
InChI=1S/BrNO2/c1-4-2-3 |
O=NOBr |
 |
|
| 1511622 |
CHBrF2 |
Methane, bromodifluoro- |
InChI=1S/CHBrF2/c2-1(3)4/h1H |
BrC(F)F |
 |
Bromodifluoromethane; Difluorobromomethane
|
| 75274 |
CHBrCl2 |
Methane, bromodichloro- |
InChI=1S/CHBrCl2/c2-1(3)4/h1H |
ClC(Br)Cl |
 |
Bromodichloromethane; Dichlorobromomethane; Dichloromonobromomethane; Monobromodichloromethane
|
| 75252 |
CHBr3 |
bromoform |
InChI=1/CHBr3/c2-1(3)4/h1H |
BrC(Br)Br |
 |
Methenyl tribromide; Methane, tribromo-; Bromoforme; Tribromomethane; Tribromometan; bromoform
|
| 124481 |
CHClBr2 |
Methane, dibromochloro- |
InChI=1S/CHBr2Cl/c2-1(3)4/h1H |
BrC(Br)Cl |
 |
Chlorodibromomethane; Dibromochloromethane; Methane, chlorodibromo-; Monochlorodibromomethane; Dibromomonochloromethane; Chlorobromoform
|
| 106934 |
CH2BrCH2Br |
Ethane, 1,2-dibromo- |
InChI=1S/C2H4Br2/c3-1-2-4/h1-2H2 |
BrCCBr |
 |
a,ß-Dibromoethane; sym-Dibromoethane; Ethylene bromide; Ethylene dibromide; 1,2-Dibromoethane; Dibromoethane; NCI-C00522; Rcra waste number U067; UN 1605
|
| 106945 |
CH3CH2CH2Br |
n-propyl bromide |
InChI=1S/C3H7Br/c1-2-3-4/h2-3H2,1H3 |
CCCBr |
 |
|
| 75263 |
CH3CHBrCH3 |
i-propyl bromide |
InChI=1S/C3H7Br/c1-3(2)4/h3H,1-2H3 |
CC(C)Br |
 |
Isopropyl bromide; Propane, 2-bromo-; 2-Bromopropane; sec-Propyl bromide; UN 2344
|
| 2143535 |
C5H5 |
cyclopentadienyl radical |
InChI=1S/C5H5/c1-2-4-5-3-1/h1-5H |
[CH]1C=CC=C1 |
 |
|
| 12127832 |
C5H5- |
cylopentadienyl anion |
InChI=1S/C5H5/c1-2-4-5-3-1/h1-5H/q-1 |
C1=CC=C[CH-]1 |
 |
cyclopentadienide anion; cyclopentadienide; cyclopenta-2,4-dien-1-ide
|
| 5164352 |
C5H6 |
Bicyclo[2.1.0]pent-2-ene |
InChI=1/C5H6/c1-2-5-3-4(1)5/h1-2,4-5H,3H2 |
[C@@H]12C=C[C@@H]1C2 |
 |
Bicyclo[2.1.0]pent-2-ene
|
| 6746947 |
C5H6 |
Cyclopropylacetylene |
InChI=1/C5H6/c1-2-5-3-4-5/h1,5H,3-4H2 |
C#CC1CC1 |
 |
Cyclopropane,ethynyl-; Cyclopropylacetylene; ethynylcyclopropane
|
| 2004695 |
C5H6 |
3-Penten-1-yne, (E)- |
InChI=1/C5H6/c1-3-5-4-2/h1,4-5H,2H3/b5-4+ |
C#C/C=C/C |
 |
(E)-3-Penten-1-yne; (E)-CH3CH=CHC#CH; 3-Penten-1-yne, (E)-; 3-Pentene-1-yne, (E)-; Pent-1-yn-3-ene, (E)-; trans-2-Penten-4-Yne; trans-3-Penten-1-Yne; (E)-pent-3-en-1-yne
|
| 1574409 |
C5H6 |
3-Penten-1-yne, (Z)- |
InChI=1/C5H6/c1-3-5-4-2/h1,4-5H,2H3/b5-4- |
C#C/C=C\C |
 |
(Z)-CH3CH=CHC#CH; 3-Penten-1-yne, (Z)-; 3-Pentene-1-yne, (Z)-; cis-2-Penten-4-yne; cis-3-Penten-1-yne; cis-Penten-1-yne; Pent-1-yn-3-ene, (Z)-; Z-3-Penten-1-yne; (Z)-pent-3-en-1-yne
|
| 542927 |
C5H6 |
1,3-Cyclopentadiene |
InChI=1/C5H6/c1-2-4-5-3-1/h1-4H,5H2 |
C1=CC=CC1 |
 |
1,3-Cyclopentadiene; Cyclopentadiene; Pentole; Pyropentylene; R-Pentine; cyclopenta-1,3-diene
|
| 78808 |
C5H6 |
1-Buten-3-yne, 2-methyl- |
InChI=1/C5H6/c1-4-5(2)3/h1H,2H2,3H3 |
C=C(C)C#C |
 |
1-Buten-3-yne, 2-methyl-; 1-Butene-3-yne, 2-methyl-; 2-Methyl-1-buten-3-yne; 2-Methyl-1-butenyne; 2-Methylbut-1-en-3-yne; 2-Methylbutenyne; 3-Methyl-3-buten-1-yne; Isopropenylacetylene; Valylene
|
| 10577658 |
C5H7 |
cyclopentenyl radical |
InChI=1S/C5H7/c1-2-4-5-3-1/h1-3H,4-5H2 |
[CH]1[CH]CC[CH]1 |
 |
|
| 14362084 |
C5H7 |
1,3-pentadienyl radical |
InChI=1S/C5H7/c1-3-5-4-2/h3-5H,1-2H2 |
C=C[CH]C=C |
 |
1,4-Pentadien-3-yl radical
|
| 78795 |
C5H8 |
1,3-Butadiene, 2-methyl- |
InChI=1/C5H8/c1-4-5(2)3/h4H,1-2H2,3H3 |
C=C(C)C=C |
 |
1,3-Butadiene, 2-methyl-; β-Methylbivinyl; 2-Methyl-1,3-butadiene; 2-Methylbuta-1,3-diene; 2-Methylbutadiene; Isopentadiene; Isoprene; Isoprene, inhibited; UN 1218; beta-Methylbivinyl
|
| 142290 |
C5H8 |
Cyclopentene |
InChI=1/C5H8/c1-2-4-5-3-1/h1-2H,3-5H2 |
C1=CCCC1 |
 |
Cyclopentene
|
| 591935 |
C5H8 |
1,4-Pentadiene |
InChI=1/C5H8/c1-3-5-4-2/h3-4H,1-2,5H2 |
C=CCC=C |
 |
1,4-Pentadiene; Penta-1,4-diene; pentadiene
|
| 591957 |
C5H8 |
1,2-Pentadiene |
InChI=1/C5H8/c1-3-5-4-2/h5H,1,4H2,2H3 |
C=C=CCC |
 |
1-Methyl-2,3-butadiene; 1,2-Pentadiene; Ethylallene; pentadiene; penta-1,2-diene
|
| 591968 |
C5H8 |
2,3-Pentadiene |
InChI=1/C5H8/c1-3-5-4-2/h3-4H,1-2H3 |
CC=C=CC |
 |
1,3-Dimethylallene; 2,3-Pentadiene; pentadiene; penta-2,3-diene
|
| 598254 |
C5H8 |
1,2-Butadiene, 3-methyl- |
InChI=1/C5H8/c1-4-5(2)3/h1H2,2-3H3 |
C=C=C(C)C |
 |
1,1-Dimethylallene; 1,1-Dimethylallylene; 1,2-Butadiene, 3-methyl-; 2-Methyl-2,3-butadiene; 3,3-Dimethylallene; 3-Methyl-1,2-butadiene; 3-methylbuta-1,2-diene
|
| 1574410 |
C5H8 |
1,3-Pentadiene, (Z)- |
InChI=1/C5H8/c1-3-5-4-2/h3-5H,1H2,2H3/b5-4- |
C=C/C=C\C |
 |
1,3-Pentadiene, (Z)-; 1,cis-3-Pentadiene; (Z)-1,3-Pentadiene; (Z)-CH2=CHCH=CHCH3; cis-1,3-Pentadiene; cis-1-Methylbutadiene; cis-Piperylene; pentadiene; 1,3-pentadiene
|
| 2004708 |
C5H8 |
1,3-Pentadiene, (E)- |
InChI=1/C5H8/c1-3-5-4-2/h3-5H,1H2,2H3/b5-4+ |
C=C/C=C/C |
 |
1,3-Pentadiene, (E)-; 1,trans-3-Pentadiene; (E)-1,3-Pentadiene; (E)-CH2=CHCH=CHCH3; trans-1,3-Pentadiene; trans-1-Methylbutadiene; trans-Piperylene; pentadiene; 1,3-pentadiene; (E)-penta-1,3-diene
|
| 627190 |
C5H8 |
1-pentyne |
InChI=1S/C5H8/c1-3-5-4-2/h1H,4-5H2,2H3 |
C#CCCC |
 |
Acetylene, propyl-; Propylacetylene; pent-1-yne
|
| 693867 |
C5H8 |
Ethenylcyclopropane |
InChI=1/C5H8/c1-2-5-3-4-5/h2,5H,1,3-4H2 |
C=CC1CC1 |
 |
Cyclopropane,ethenyl-; Cyclopropylethylene; Ethenylcyclopropane; Vinylcyclopropane
|
| 1120565 |
C5H8 |
Cyclobutane, methylene- |
InChI=1/C5H8/c1-5-3-2-4-5/h1-4H2 |
C=C1CCC1 |
 |
Cyclobutane, methylene-; Methylenecyclobutane
|
| 646048 |
C5H10 |
2-Pentene, (E)- |
InChI=1/C5H10/c1-3-5-4-2/h3,5H,4H2,1-2H3/b5-3+ |
C/C=C/CC |
 |
2-(E)-C5H10; (E)-2-Pentene; 2-Pentene, (E)-; 2-trans-Pentene; trans-β-Amylene; trans-2-Pentene; (E)-pent-2-ene
|
| 627203 |
C5H10 |
2-Pentene, (Z)- |
InChI=1/C5H10/c1-3-5-4-2/h3,5H,4H2,1-2H3/b5-3- |
C/C=C\CC |
 |
2-(Z)-C5H10; (Z)-2-Pentene; 2-Pentene, (Z)-; cis-β-Amylene; cis-2-Pentene; cis-Pentene; (Z)-pent-2-ene
|
| 1630940 |
C5H10 |
Cyclopropane, 1,1-dimethyl- |
InChI=1/C5H10/c1-5(2)3-4-5/h3-4H2,1-2H3 |
CC1(C)CC1 |
 |
1,1-Dimethylcyclopropane; Cyclopropane, 1,1-dimethyl-; Gem-Dimethylcyclopropane
|
| 563462 |
C5H10 |
1-Butene, 2-methyl- |
InChI=1/C5H10/c1-4-5(2)3/h2,4H2,1,3H3 |
C=C(C)CC |
 |
γ-Isoamylene; 1-Butene, 2-methyl-; 1-Isoamylene; 2-Methyl-1-butene; 2-Methylbutene-1; Isopentene; UN 2459; UN 2371; gamma-Isoamylene; 2-methylbut-1-ene
|
| 513359 |
C5H10 |
2-Butene, 2-methyl- |
InChI=1/C5H10/c1-4-5(2)3/h4H,1-3H3 |
CC(C)=CC |
 |
α,η-amylene; β-Isoamylene; 1,1,2-Trimethylethylene; 2-Methyl-2-butene; 2-Methylbut-2-ene; 2-Butene, 2-methyl-; 3-Methyl-2-butene; Amylene; Ethylene, trimethyl-; Isopentene; Methyl butene; n-Amylene; UN 2371; UN 2460; Trimethylethylene; alpha,eta-amylene; beta-Isoamylene
|
| 287923 |
C5H10 |
Cyclopentane |
InChI=1/C5H10/c1-2-4-5-3-1/h1-5H2 |
C1CCCC1 |
 |
Cyclopentane; Pentamethylene; UN 1146
|
| 109671 |
CH2CHCH2CH2CH3 |
1-pentene |
InChI=1/C5H10/c1-3-5-4-2/h3H,1,4-5H2,2H3 |
C=CCCC |
 |
pentene; α-n-Amylene; Propylethylene; Pent-1-ene
|
| 4348350 |
C5H11 |
2-Methylbut-2-yl radical |
InChI=1/C5H11/c1-4-5(2)3/h4H2,1-3H3 |
C[C](C)CC |
 |
2-Methylbut-2-yl radical; 2-Butyl radical, 2-methyl-; 2-Methylbutan-2-yl
|
| 109660 |
C5H12 |
Pentane |
InChI=1/C5H12/c1-3-5-4-2/h3-5H2,1-2H3 |
CCCCC |
 |
n-C5H12; n-Pentane; Pentan; Pentane; Pentanen; Pentani; Skellysolve A; UN 1265
|
| 78784 |
C5H12 |
Butane, 2-methyl- |
InChI=1/C5H12/c1-4-5(2)3/h5H,4H2,1-3H3 |
CC(C)CC |
 |
1,1,2-Trimethylethane; 2-Methylbutane; Butane, 2-methyl-; Ethyldimethylmethane; Isoamylhydride; iso-C5H12; iso-Pentane; isopentane
|
| 463821 |
C5H12 |
Propane, 2,2-dimethyl- |
InChI=1/C5H12/c1-5(2,3)4/h1-4H3 |
CC(C)(C)C |
 |
2,2-Dimethylpropane; 1,1,1-Trimethylethane; Neo-C5H12; Neopentane; Propane, 2,2-dimethyl-; tert-Pentane; Tetramethylcarbon; Tetramethylmethane; UN 1265; UN 2044
|
| 157404 |
C5H8 |
Spiropentane |
InChI=1/C5H8/c1-2-5(1)3-4-5/h1-4H2 |
C1CC12CC2 |
 |
Spiro[2.2]pentane; Spiropentane
|
| 185944 |
C5H8 |
Bicyclo[2.1.0]pentane |
InChI=1/C5H8/c1-2-5-3-4(1)5/h4-5H,1-3H2 |
[C@@H]12CC[C@@H]1C2 |
 |
Bicyclo[2.1.0]pentane
|
| 109773 |
C3H2N2 |
Malononitrile |
InChI=1/C3H2N2/c4-2-1-3-5/h1H2 |
N#CCC#N |
 |
Cyanoacetonitrile; Dicyanomethane; Dwumetylosulfotlenku; Malonic acid dinitrile; Malonic dinitrile; Malonitrile; Malonodinitrile; Malononitrile; Methane, dicyano-; Methylene cyanide; Methylenedinitrile; Nitril kyseliny malonove; Propanedinitrile; Propanedinitrite; Rcra waste number U149; UN 2647; USAF KF-19; USAF a-4600
|
| 288948 |
CH2N4 |
1H-Tetrazole |
InChI=1/CH2N4/c1-2-4-5-3-1/h1H,(H,2,3,4,5) |
N1N=NN=C1 |
 |
1H-Tetrazole; 2H-Tetrazole; Tetraazacyclopentadiene; Tetrazole
|
| 288880 |
C2H3N3 |
1H-1,2,4-Triazole |
InChI=1/C2H3N3/c1-3-2-5-4-1/h1-2H,(H,3,4,5) |
N1=CN=CN1 |
 |
1,2,4-Triazole; 1H-1,2,4-Triazole; s-Triazole; triazole
|
| 288324 |
C3H4N2 |
1H-Imidazole |
InChI=1/C3H4N2/c1-2-5-3-4-1/h1-3H,(H,4,5) |
C1=NC=CN1 |
 |
1,3-Diaza-2,4-cyclopentadiene; 1,3-Diazole; 1H-Imidazole; Formamidine, N,N'-vinylene-; Glyoxalin; Glyoxaline; IMD; Imidazol; Imidazole; Iminazole; Imutex; Methanimidamide, N,N'-1,2-ethenediyl-; Miazole; Pyrro(b)monazole; USAF ek-4733
|
| 288131 |
C3H4N2 |
1H-Pyrazole |
InChI=1/C3H4N2/c1-2-4-5-3-1/h1-3H,(H,4,5) |
N1N=CC=C1 |
 |
1,2-Diazole; 1H-Pyrazole; Pyrazole
|
| 9000162 |
C3H4N2 |
4H-Imidazole |
InChI=1S/C3H4N2/c1-2-5-3-4-1/h1,3H,2H2 |
C1=NCC=N1 |
 |
|
| 9000173 |
C3H4N2 |
2H-Imidazole |
InChI=1S/C3H4N2/c1-2-5-3-4-1/h1-2H,3H2 |
C1N=CC=N1 |
 |
|
| 9000366 |
C4H5N |
3H-pyrrole |
InChI=1S/C4H5N/c1-2-4-5-3-1/h1,3-4H,2H2 |
N1=CCC=C1 |
 |
|
| 9000377 |
C4H5N |
2H-pyrrole |
InChI=1S/C4H5N/c1-2-4-5-3-1/h1-3H,4H2 |
N1=CC=CC1 |
 |
|
| 5500210 |
C4H5N |
Cyclopropanecarbonitrile |
InChI=1/C4H5N/c5-3-4-1-2-4/h4H,1-2H2 |
N#CC1CC1 |
 |
Cyanocyclopropane; Cyclopropanecarbonitrile; Cyclopropanecarboxylic acid nitrile; Cyclopropanenitrile; Cyclopropyl cyanide; Cyclopropylnitrile
|
| 627269 |
C4H5N |
(E)-2-Butenenitrile |
InChI=1/C4H5N/c1-2-3-4-5/h2-3H,1H3/b3-2+ |
C/C=C/C#N |
 |
2-Butenenitrile, (E)-; (E)-2-Butenenitrile; (E)-CH3CH=CHCN; (E)-but-2-enenitrile
|
| 1190767 |
C4H5N |
(Z)-2-Butenenitrile |
InChI=1/C4H5N/c1-2-3-4-5/h2-3H,1H3/b3-2- |
C/C=C\C#N |
 |
(Z)-2-Butenenitrile; (Z)-CH3CH=CHCN; (Z)-but-2-enenitrile
|
| 109977 |
C4H5N |
Pyrrole |
InChI=1/C4H5N/c1-2-4-5-3-1/h1-5H |
N1C=CC=C1 |
 |
1-Aza-2,4-cyclopentadiene; 1H-Pyrrole; Azole; Divinyleneimine; Divinylenimine; Imidole; Monopyrrole; Parzate; Pyrrol; Pyrrole
|
| 151188 |
C3H6N2 |
3-Aminopropionitrile |
InChI=1/C3H6N2/c4-2-1-3-5/h1-2,4H2 |
N#CCCN |
 |
β-Alaminenitrile; β-Alaninenitrile; β-Aminoethyl cyanide; β-Aminopropionitrile; β-Cyanoethylamine; 2-Cyanoethylamine; 3-Aminopropanenitrile; 3-Aminopropionitrile; Aminopropionitrile; BAPN; Propanenitrile, 3-amino-; Propionitrile, 3-amino-; beta-Alaminenitrile; beta-Alaninenitrile; beta-Aminoethyl cyanide; beta-Aminopropionitrile; beta-Cyanoethylamine; 3-aminopropanenitrile
|
| 109740 |
CH3CH2CH2CN |
Butanenitrile |
InChI=1/C4H7N/c1-2-3-4-5/h2-3H2,1H3 |
CCCC#N |
 |
1-Cyanopropane; Butanenitrile; Butyric acid nitrile; Butyronitrile; Butyrylonitrile; n-Butanenitrile; n-Butanitrile; n-Butyronitrile; n-C3H7CN; Propyl cyanide; Propylkyanid; UN 2411
|
| 78820 |
CH3CH(CH3)CN |
Propanenitrile, 2-methyl- |
InChI=1/C4H7N/c1-4(2)3-5/h4H,1-2H3 |
CC(C)C#N |
 |
α-Methylpropanenitrile; 1-Cyano-1-methylethane; 2-Cyanopropane; 2-Methylpropanenitrile; 2-Methylpropionitrile; Dimethylacetonitrile; Isobutyronitrile; iso-C3H7CN; Isopropyl cyanide; Isopropylkyanid; Isopropylnitrile; Propanenitrile, 2-methyl-; UN 2284; alpha-Methylpropanenitrile
|
| 123751 |
C4H9N |
Pyrrolidine |
InChI=1/C4H9N/c1-2-4-5-3-1/h5H,1-4H2 |
N1CCCC1 |
 |
Azacyclopentane; Azolidine; Butylenimine; Perhydropyrrole; Prolamine; Pyrrole, tetrahydro-; Pyrrolidene; Pyrrolidine; Tetrahydropyrrole; Tetramethylenimine; UN 1922
|
| 2516349 |
C4H9N |
Cyclobutylamine |
InChI=1/C4H9N/c5-4-2-1-3-4/h4H,1-3,5H2 |
NC1CCC1 |
 |
Aminocyclobutane; Cyclobutanamine; Cyclobutylamine
|
| 78900 |
C3H10N2 |
1,2-Diaminopropane |
InChI=1/C3H10N2/c1-3(5)2-4/h3H,2,4-5H2,1H3 |
C[C@@H](N)CN |
 |
1,2-Diaminopropane; 1,2-Propanediamine; 1,2-Propylenediamine; Propylenediamine; UN 2258; propane-1,2-diamine
|
| 78819 |
C(NH2)H2C(CH3)HCH3 |
1-Propanamine, 2-methyl- |
InChI=1/C4H11N/c1-4(2)3-5/h4H,3,5H2,1-2H3 |
CC(C)CN |
 |
1-Propanamine, 2-methyl-; 1-Amino-2-methylpropane; 2-Methyl-1-Aminopropane; 2-Methyl-1-propanamine; 2-Methylpropylamine; 3-Methyl-2-propylamine; IBA; i-Butylamine; Isobutylamine; iso-C4H9NH2; Monoisobutylamine; UN 1214; Valamine; 2-methylpropan-1-amine
|
| 75649 |
C(CH3)3NH2 |
2-Propanamine, 2-methyl- |
InChI=1/C4H11N/c1-4(2,3)5/h5H2,1-3H3 |
CC(N)(C)C |
 |
1,1-Dimethylethylamine; 2-Methyl-2-aminopropane; 2-Methyl-2-propanamine; 2-Methyl-2-propylamine; 2-Amino-2-Methylpropane; 2-Aminoisobutane; 2-Propanamine, 2-methyl-; Butylamine, tert; Butylamine, tertiary; t-Butylamine; tert-Butylamine; tert-C4H9NH2; Trimethylaminomethane; 2-methylpropan-2-amine
|
| 109739 |
C(NH2)H2CH2CH2CH3 |
1-Butanamine |
InChI=1/C4H11N/c1-2-3-4-5/h2-5H2,1H3 |
CCCCN |
 |
1-Amino-butaan; 1-Aminobutan; 1-Aminobutane; 1-Butanamine; 1-Butanaminen-butilamina; 1-Butylamine; Butylamine; Butylamine, n; Monobutilamina; Monobutylamine; Mono-n-butylamine; n-Butilamina; N-Butylamin; n-Butylamine; n-C4H9NH2; Norvalamine; UN 1125; butan-1-amine
|
| 13952846 |
CH3C(NH2)HCH2CH3 |
2-Butanamine |
InChI=1/C4H11N/c1-3-4(2)5/h4H,3,5H2,1-2H3 |
C[C@H](N)CC |
 |
1-Methylpropanamine; 1-Methylpropylamine; 2-AB; 2-Aminobutane; 2-Aminobutane base; 2-Butanamine; 2-Butylamine; (Rs)-2-aminobutane; (Rs)-sec-butylamine; Butafume; Deccotane; Frucote; Propylamine, 1-Methyl-; sec-Butanamine; sec-Butylamine; sec-C4H9NH2; Secondary butylamine; Tutane; butan-2-amine
|
| 10544737 |
N2O3 |
Dinitrogen trioxide |
InChI=1/N2O3/c3-1-2(4)5 |
O=N(N=O)=O |
 |
Dinitrogen trioxide; Nitrogen oxide; Nitrogen oxide (N2O3); Nitrogen trioxide
|
| 504643 |
C3O2 |
Carbon suboxide |
InChI=1/C3O2/c4-2-1-3-5 |
O=C=C=C=O |
 |
1,2-Propadiene-1,3-dione; Carbon oxide (C3O2); Carbon suboxide; propa-1,2-diene-1,3-dione
|
| 504643 |
C3O2+ |
Carbon suboxide cation |
InChI=1S/C3O2/c4-2-1-3-5/q+1 |
O=C=[C+]=C=O |
 |
|
| 298124 |
CHOCOOH |
oxo acetic acid |
InChI=1S/C2H2O3/c3-1-2(4)5/h1H,(H,4,5) |
O=CC(O)=O |
 |
Glyoxylic acid; a-Ketoacetic acid; Formic acid, formyl-; Formylformic acid; Glyoxalic acid; Oxalaldehydic acid; Oxoacetic acid; Oxoethanoic acid; Acetic acid, oxo-; 2-oxoacetic acid
|
| 288142 |
C3H3NO |
Isoxazole |
InChI=1/C3H3NO/c1-2-4-5-3-1/h1-3H |
O1N=CC=C1 |
 |
1-Oxa-2-azacyclopentadiene; Isooxazole; Isoxazole
|
| 288426 |
C3H3NO |
Oxazole |
InChI=1/C3H3NO/c1-2-5-3-4-1/h1-3H |
O1C=NC=C1 |
 |
1,3-Oxazole; Oxazole
|
| 598583 |
CH3NO3 |
Methyl nitrate |
InChI=1/CH3NO3/c1-5-2(3)4/h1H3 |
O=[N+]([O-])OC |
 |
Methyl nitrate; Methylester kyseliny dusicne; Nitric acid, methyl ester
|
| 36709101 |
CH3C(O)OO |
acetyl peroxy radical |
InChI=1S/C2H3O3/c1-2(3)5-4/h1H3 |
CC(O[O])=O |
 |
|
| 542789 |
C3H4O2 |
propanedial |
InChI=1/C3H4O2/c4-2-1-3-5/h2-3H,1H2 |
O=CCC=O |
 |
|
| 289145 |
C2H4O3 |
trioxolane124 |
InChI=1S/C2H4O3/c1-3-2-5-4-1/h1-2H2 |
O1OCOC1 |
 |
|
| 110009 |
C4H4O |
Furan |
InChI=1/C4H4O/c1-2-4-5-3-1/h1-4H |
O1C=CC=C1 |
 |
Divinylene oxide; Furan; Furane; Furfuran; Furfurane; NCI-C56202; Oxacyclopentadiene; Oxole; Rcra waste number U124; Tetrole; UN 2389
|
| 79107 |
C3H4O2 |
2-Propenoic acid |
InChI=1/C3H4O2/c1-2-3(4)5/h2H,1H2,(H,4,5) |
C=CC(O)=O |
 |
2-Propenoic acid; Acroleic acid; Acrylic acid; Acrylic acid, glacial; Acrylic acid, inhibited; Ethylenecarboxylic acid; Glacial acrylic acid; Kyselina akrylova; Propene acid; Propenoic acid; Rcra waste number U008; UN 2218; Vinylformic acid
|
| 79141 |
HOCH2COOH |
Hydroxyacetic acid |
InChI=1S/C2H4O3/c3-1-2(4)5/h3H,1H2,(H,4,5) |
OC(CO)=O |
 |
Acetic acid, hydroxy-; Glycolic acid; a-Hydroxyacetic acid; Glycollic acid; Hydroxyethanoic acid; 2-Hydroxyacetic acid
|
| 57578 |
C3H4O2 |
β–Propiolactone |
InChI=1/C3H4O2/c4-3-1-2-5-3/h1-2H2 |
O=C1CCO1 |
 |
1,3-Propiolactone; β-lactone hydracrylic acid; β-Propanoic acid lactone; β-Propiolactone; β-Propiolakton; β-Propionolactone; β-Propriolactone; β-Proprolactone; 2-Oxacyclobutanone; 2-Oxetanone; 2-Oxooxetane; 3-Hydroxypropionic acid, lactone; 3-Propanolide; 3-Propiolactone; Betaprone; Bpl; Hydracrylic acid β-lactone; Propanoic acid, 3-hydroxy-, β-lactone; Propanolide; Propiolactone; Propiolactone β-; Propionic acid, 3-hydroxy-, β-lactone; beta-lactone hydracrylic acid; beta-Propanoic acid lactone; beta-Propiolactone; beta-Propiolakton; beta-Propionolactone; beta-Propriolactone; beta-Proprolactone; oxetan-2-one
|
| 9000128 |
C3H4O2 |
propenalol |
InChI=1/C3H4O2/c4-2-1-3-5/h1-4H/b2-1- |
O\C=C/C=O |
 |
|
| 56406 |
H2NCH2COOH |
Glycine |
InChI=1/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5) |
NCC(O)=O |
 |
Gly; Glicoamin; Glycosthene; Amitone; glycine; Aminoacetic acid; Aminoethanoic acid; Glycocoll; Glycolixir; 2-aminoacetic acid
|
| 79061 |
CH2CHCONH2 |
Acrylamide |
InChI=1/C3H5NO/c1-2-3(4)5/h2H,1H2,(H2,4,5) |
C=CC(N)=O |
 |
2-Propenamide; Acrylamide; Acrylic amide; Akrylamid; Amid kyseliny akrylove; Ethylenecarboxamide; Propenamide; Rcra waste number U007; Vinyl amide; UN 2074
|
| 1738369 |
CH3OCH2CN |
Methoxyacetonitrile |
InChI=1/C3H5NO/c1-5-3-2-4/h3H2,1H3 |
N#CCOC |
 |
Acetonitrile, methoxy-; Methoxyacetonitrile; NCCH2OCH3; 2-methoxyacetonitrile
|
| 1708298 |
C4H6O |
Furan, 2,5-dihydro- |
InChI=1/C4H6O/c1-2-4-5-3-1/h1-2H,3-4H2 |
O1CC=CC1 |
 |
1-Oxa-3-cyclopentene; 3-Oxolene; 2,5-dihydrofuran
|
| 1191953 |
C4H6O |
Cyclobutanone |
InChI=1/C4H6O/c5-4-2-1-3-4/h1-3H2 |
O=C1CCC1 |
 |
Cyclobutanone
|
| 1191997 |
C4H6O |
Furan, 2,3-dihydro- |
InChI=1/C4H6O/c1-2-4-5-3-1/h1,3H,2,4H2 |
O1CCC=C1 |
 |
2,3-Dihydrofuran; 4,5-Dihydrofuran; Furan, 2,3-dihydro-
|
| 646060 |
C3H6O2 |
1,3-Dioxolane |
InChI=1/C3H6O2/c1-2-5-3-4-1/h1-3H2 |
O1COCC1 |
 |
1,3-Dioxacyclopentane; 1,3-Dioxolan; 1,3-Dioxolane; 1,3-Dioxole, dihydro-; Dioxolan; Dioxolane; Ethylene glycol, formal; Formal glycol; Glycolformal
|
| 598505 |
C2H6N2O |
Urea, methyl- |
InChI=1/C2H6N2O/c1-4-2(3)5/h1H3,(H3,3,4,5) |
O=C(N)NC |
 |
1-Methylurea; Methylmocovina; Methylurea; Monomethylurea; N-Methylurea; Urea, methyl-
|
| 79209 |
CH3COOCH3 |
methyl acetate |
InChI=1/C3H6O2/c1-3(4)5-2/h1-2H3 |
CC(OC)=O |
 |
Acetate de methyle; Acetic acid, methyl ester; Devoton; Ethyl ester of monoacetic acid; Methyl acetate; Methyl acetic ester; Methyl ester of acetic acid; Methyl ethanoate; Methylacetaat; Methylacetat; Methyle (acetate de); Methylester kiseliny octove; Metile; Metile (acetato di); Octan metylu; Tereton; UN 1231
|
| 109933 |
CH2CHOCHCH2 |
Vinyl ether |
InChI=1/C4H6O/c1-3-5-4-2/h3-4H,1-2H2 |
C=COC=C |
 |
1,1'-Oxybisethene; Divinyl ether; Divinyl ether, inhibited; Divinyl oxide; Ethene, 1,1'-oxybis-; Ethenyloxyethene; Ether, divinyl; UN 1167; Vinyl Ether; Vinether; Vinidyl; Vinydan; Vinethen; Vinethene; Vinesthene; Vinesthesin; ether; (vinyloxy)ethene
|
| 109944 |
HCOOC2H5 |
Ethyl formate |
InChI=1/C3H6O2/c1-2-5-3-4/h3H,2H2,1H3 |
O=COCC |
 |
Aethylformiat; Areginal; Ethyl ester of formic acid; Ethyl formate; Ethyl methanoate; Ethyle; Ethyle(formiate d'); Ethylester kyseliny mravenci; Ethylformiaat; Ethylformic ester; Etile; Etile(formiato di); Formic acid, ethyl ester; Formic ether; Mrowczan etylu; UN 1190
|
| 4170303 |
CHOCHCHCH3 |
2-Butenal |
InChI=1/C4H6O/c1-2-3-4-5/h2-4H,1H3 |
C/C=C/C=O |
 |
β-Methyl acrolein; 2-Butenal; Crotonal; Crotonaldehyde; Crotonaldehyde, inhibited; Crotonic aldehyde; Crotylaldehyde; Krotonaldehyd; Propylene aldehyde; Rcra waste number U053; UN 1143; beta-Methyl acrolein; (E)-but-2-enal
|
| 15798648 |
C4H6O |
cis-2-butenal |
InChI=1/C4H6O/c1-2-3-4-5/h2-4H,1H3/b3-2- |
C/C=C\C=O |
 |
|
| 79050 |
C3H7NO |
Propanamide |
InChI=1/C3H7NO/c1-2-3(4)5/h2H2,1H3,(H2,4,5) |
CCC(N)=O |
 |
Amid kyseliny propionove; Propanamide; Propanimidic acid; Propionamide; Propionic acid amide; Propionic amide; Propionimidic acid; propionamide
|
| 68122 |
C3H7NO |
dimethylformamide |
InChI=1/C3H7NO/c1-4(2)3-5/h3H,1-2H3 |
CN(C)C=O |
 |
Formamide, N,N-dimethyl-; DMFA; N-Formyldimethylamine; N,N-Dimethylformamide; Formyldimethylamine; Dimethylforamide; NSC-5356; U-4224; NCI-C60913; UN 2265; DMF
|
| 57556 |
C3H8O2 |
Propylene glycol |
InChI=1/C3H8O2/c1-3(5)2-4/h3-5H,2H2,1H3 |
CC(O)CO |
 |
α-Propylene glycol; 1,2-Dihydroxypropane; 1,2-Propanediol; 1,2-Propylene Glycol; 1,2-Propylenglykol; 2-Hydroxypropanol; 2,3-Propanediol; Dowfrost; Isopropylene glycol; Methyl glycol; Methylethyl glycol; Methylethylene glycol; Monopropylene glycol; PG 12; Propane-1,2-diol; Propylene Glycol; Propylene glycol usp; Sentry Propylene Glycol; Sirlene; Solar winter ban; Solargard P; Trimethyl glycol; Ucar 35; alpha-Propylene glycol
|
| 78933 |
CH3COCH2CH3 |
2-Butanone |
InChI=1/C4H8O/c1-3-4(2)5/h3H2,1-2H3 |
CC(CC)=O |
 |
2-Butanone; 3-Butanone; Acetone, methyl-; Aethylmethylketon; Butan-2-one; Butanone; Butanone 2; Ethyl methyl cetone; Ethyl methyl ketone; Ethylmethylketon; Ketone, ethyl methyl; Ketone, methyl ethyl; Meetco; MEK; Methyl acetone; Methyl ethyl ketone; Metiletilchetone; Metyloetyloketon; Rcra waste number U159; UN 1232; UN 1193
|
| 78842 |
CHOCH(CH3)CH3 |
Propanal, 2-methyl- |
InChI=1/C4H8O/c1-4(2)3-5/h3-4H,1-2H3 |
CC(C)C=O |
 |
α-Methylpropionaldehyde; 2-Methyl-1-propanal; 2-Methylpropanal; 2-Methylpropionaldehyde; Isobutaldehyde; Isobutanal; Isobutylaldehyde; Isobutyral; Isobutyraldehyd; Isobutyraldehyde; Isobutyric aldehyde; Isobutyryl aldehyde; iso-C3H7CHO; Isopropylaldehyde; Isopropylformaldehyde; Methyl propanal; NCI-C60968; Propanal, 2-methyl-; Propionaldehyde, 2-methyl-; UN 2045; Valine aldehyde; alpha-Methylpropionaldehyde
|
| 109999 |
C4H8O |
Furan, tetrahydro- |
InChI=1/C4H8O/c1-2-4-5-3-1/h1-4H2 |
O1CCCC1 |
 |
Butane α,δ-oxide; Butane, 1,4-epoxy-; Butylene Oxide; Cyclotetramethylene oxide; Diethylene oxide; Furan, tetrahydro-; Furanidine; Hydrofuran; NCI-C60560; Oxacyclopentane; Oxolane; Rcra waste number U213; Tetrahydrofuraan; Tetrahydrofuran; Tetrahydrofuranne; Tetraidrofurano; Tetramethylene oxide; THF; UN 2056
|
| 109875 |
C3H8O2 |
Methane, dimethoxy- |
InChI=1/C3H8O2/c1-4-3-5-2/h3H2,1-2H3 |
COCOC |
 |
2,4-Dioxapentane; Anesthenyl; Dimethoxymethane; Dimethyl formal; Formal; Formaldehyde dimethyl; Formaldehyde dimethyl acetal; Formaldehyde methyl ketal; Methane, dimethoxy-; Methoxymethyl methyl ether; Methyl formal; Methylal; Methylene dimethyl ether; Methylene glycol dimethylether; Methylenedioxydimethane; Metylal; UN 1234; ether
|
| 109922 |
C2H3OC2H5 |
Ethene, ethoxy- |
InChI=1/C4H8O/c1-3-5-4-2/h3H,1,4H2,2H3 |
C=COCC |
 |
1-Ethoxyethene; 1-Ethoxyethylene; Ethene, ethoxy-; Ether, ethyl vinyl; Ether, ethyl vinyl (inhibited); Ether, vinyl ethyl; Ethoxyethene; Ethoxyethylene; Ethyl ethenyl ether; Ethyl vinyl ether; Ethyloxyethene; EVE; ether; UN 1302; Vinyl ethyl ether, inhibited; Vinamar; Vinyl Ethyl ether
|
| 116110 |
CH2C(CH3)OCH3 |
1-Propene, 2-methoxy- |
InChI=1/C4H8O/c1-4(2)5-3/h1H2,2-3H3 |
C=C(OC)C |
 |
1-Propene, 2-methoxy-; 2-Methoxy-1-propene; 2-Methoxypropene; Ether, isopropenyl methyl; Isopropenyl methyl ether; Methyl isopropenyl ether; ether; 2-methoxyprop-1-ene
|
| 123728 |
CHOCH2CH2CH3 |
Butanal |
InChI=1/C4H8O/c1-2-3-4-5/h4H,2-3H2,1H3 |
CCCC=O |
 |
Aldehyde butyrique; Aldeide butirrica; Butal; Butaldehyde; Butalyde; Butanal; Butanaldehyde; Butyl aldehyde; Butyral; Butyraldehyd; Butyraldehyde; Butyric aldehyde; Butyrylaldehyde; n-Butanal; n-Butyl aldehyde; n-Butyraldehyde; n-C3H7CHO; NCI-C56291; UN 1129
|
| 504632 |
C3H8O2 |
1,3-Propanediol |
InChI=1/C3H8O2/c4-2-1-3-5/h4-5H,1-3H2 |
OCCCO |
 |
1,3-Dihydroxypropane; 1,3-Propanediol; 1,3-Propylene glycol; 1,3-Propylenediol; 2-(Hydroxymethyl)ethanol; β-Propylene glycol; ω-Propanediol; 2-Deoxyglycerol; NSC 65426; PG; Propane-1,3-diol; Propanediol-(1,3)-(1,3-propylene glycol); Propylene glycol; Trimethylene Glycol; beta-Propylene glycol; omega-Propanediol
|
| 3031752 |
C3H8O2 |
Hydroperoxide, 1-methylethyl |
InChI=1/C3H8O2/c1-3(2)5-4/h3-4H,1-2H3 |
CC(OO)C |
 |
Hydroperoxide, 1-methylethyl; Isopropyl hydroperoxide; 2-hydroperoxypropane
|
| 2919235 |
C4H8O |
Cyclobutanol |
InChI=1/C4H8O/c5-4-2-1-3-4/h4-5H,1-3H2 |
OC1CCC1 |
 |
Cyclobutanol; Cyclobutyl hydroxide
|
| 598538 |
C4H10O |
Propane, 2-methoxy- |
InChI=1/C4H10O/c1-4(2)5-3/h4H,1-3H3 |
CC(OC)C |
 |
2-Methoxypropane; Ether, isopropyl methyl; i-C3H7OCH3; Isopropyl methyl ether; Isopryl; Methyl isopropyl ether; Propane, 2-methoxy-; ether
|
| 557175 |
C4H10O |
Methyl propyl ether |
InChI=1/C4H10O/c1-3-4-5-2/h3-4H2,1-2H3 |
CCCOC |
 |
1-Methoxypropane; α-Methoxy propane; Ether, methyl propyl; Methyl n-propyl ether; Methyl propyl ether; Metopryl; n-C3H7OCH3; Neothyl; Propane, 1-methoxy-; UN 2612; ether; alpha-Methoxy propane
|
| 78831 |
C4H10O |
1-Propanol, 2-methyl- |
InChI=1/C4H10O/c1-4(2)3-5/h4-5H,3H2,1-2H3 |
CC(C)CO |
 |
1-Propanol, 2-methyl-; 1-Hydroxymethylpropane; 2-Methyl-1-propanol; 2-Methylpropan-1-ol; 2-Methylpropanol; 2-Methylpropanol-1; 2-Methylpropyl alcohol; Alcool isobutylique; Butanol-iso; Fermentation butyl alcohol; Isobutanol; Isobutyl alcohol; Isobutylalkohol; iso-C4H9OH; Isopropylcarbinol; Rcra waste number U140; UN 1212
|
| 75650 |
C4H10O |
Ethanol, 1,1-dimethyl- |
InChI=1/C4H10O/c1-4(2,3)5/h5H,1-3H3 |
CC(C)(O)C |
 |
1,1-Dimethylethanol; 2-Methyl-2-propanol; 2-Methylpropan-2-ol; 2-Methylpropanol-2; 2-Propanol, 2-methyl-; Alcool butylique tertiaire; Butanol tertiaire; Ethanol, 1,1-Dimethyl-; Methanol, trimethyl-; NCI-C55367; t-Butanol; t-Butyl alchohol; t-Butyl hydroxide; tert-Butanol; tert-Butyl Alcohol; tert-Butyl hydroxide; tert-C4H9OH; Trimethylmethanol; Trimethylcarbinol; UN 1120
|
| 60297 |
C4H10O |
Ethoxy ethane |
InChI=1/C4H10O/c1-3-5-4-2/h3-4H2,1-2H3 |
CCOCC |
 |
1,1'-Oxybisethane; 3-Oxapentane; Aether; Anaesthetic ether; Anesthesia ether; Anesthetic ether; Diaethylaether; Diethyl ether; Diethyl oxide; Dwuetylowy eter; Etere etilico; Ethane, 1,1'-oxybis-; Ether ethylique; Ether, ethyl; Ethoxyethane; Ethyl ether; Ethyl ether, tech.; Ethyl oxide; Oxyde d'ethyle; Pronarcol; Rcra waste number U117; Solvent ether; UN 1155; ether
|
| 71363 |
C4H10O |
1-Butanol |
InChI=1/C4H10O/c1-2-3-4-5/h5H,2-4H2,1H3 |
CCCCO |
 |
1-Butanol; 1-Butyl alcohol; 1-Hydroxybutane; Alcool butylique; Butan-1-ol; Butanol; Butanolen; Butanolo; Butyl alcohol; Butyl hydroxide; Butylowy alkohol; Butyric alcohol; CCS 203; Hemostyp; Methylolpropane; NA 1120; NBA; n-Butan-1-ol; n-Butanol; n-Butanolbutanolen; n-Butyl alcohol; n-C4H9OH; Propylcarbinol; Propylmethanol; Rcra waste number U031; UN 1120
|
| 15892236 |
C4H10O |
2-Butanol, (.+/-.)- |
InChI=1/C4H10O/c1-3-4(2)5/h4-5H,3H2,1-2H3 |
C[C@H](O)CC |
 |
.+/-.-2-Butanol; 2-Butanol, (.+/-.)-; butan-2-ol; sec-Butyl Alcohol; sec-Butanol; Ethyl Methyl carbinol; Methyl ethyl carbinol; 1-Methyl-1-propanol; 1-Methylpropyl alcohol; 2-Hydroxybutane; sec-C4H9OH; Butane, 2-hydroxy-; Butanol-2; Butan-2-ol; 2-Butyl alcohol; s-Butyl alcohol; s-Butanol
|
| 14874705 |
BF4- |
tetrafluoroboron anion |
InChI=1S/BF4/c2-1(3,4)5/q-1 |
F[B-](F)(F)F |
 |
|
| 75730 |
CF4 |
Carbon tetrafluoride |
InChI=1/CF4/c2-1(3,4)5 |
FC(F)(F)F |
 |
Arcton 0; Carbon fluoride; Carbon fluoride (CF4); Carbon tetrafluoride; F 14; FC 14; Freon 14; Halocarbon 14; Halon 14; Methane, tetrafluoro-; Perfluoromethane; R 14; Refrigerant 14; Tetrafluoromethane; UN 1982
|
| 7789266 |
FNO3 |
Fluorine nitrate |
InChI=1/FNO3/c1-5-2(3)4 |
ON(=O)=O |
 |
Fluorine nitrate; FONO2; hypofluorous nitric anhydride
|
| 13847659 |
F3NO |
Nitrogen trifluoride oxide |
InChI=1/F3NO/c1-4(2,3)5 |
FN(F)(F)=O |
 |
AMOX; Nitrogen fluoride oxide; Nitrogen Fluoride oxide (F3NO); Nitrogen fluoride oxide (NF3O); Nitrogen trifluoride oxide; Trifluoramine oxide; Trifluoroamine oxide
|
| 359115 |
C2HF3 |
Trifluoroethylene |
InChI=1/C2HF3/c3-1-2(4)5/h1H |
FC(F)=CF |
 |
Ethene, trifluoro-; Ethylene, trifluoro-; Ethylene trifluoride; Trifluoroethene; 1,1,2-Trifluoroethylene; 1,1,2-trifluoroethene
|
| 359115 |
C2HF3+ |
Trifluoroethylene cation |
InChI=1S/C2HF3/c3-1-2(4)5/h1H/q+1 |
F[CH+][C](F)F |
 |
|
| 420462 |
CH3CF3 |
Ethane, 1,1,1-trifluoro- |
InChI=1/C2H3F3/c1-2(3,4)5/h1H3 |
CC(F)(F)F |
 |
1,1,1-Trifluoroethane; 1,1,1-Trifluoroform; Ethane, 1,1,1-trifluoro-; FC143a; Fluorocarbon fc143a; FREON 143; Methylfluoroform; R 143a
|
| 75763 |
Si(CH3)4 |
tetramethylsilane |
InChI=1/C4H12Si/c1-5(2,3)4/h1-4H3 |
C[Si](C)(C)C |
 |
tms; Silane, tetramethyl-; Silicon, tetramethyl-; Tetramethylsilicane; tetramethylsilane
|
| 7783611 |
SiF4 |
Silicon tetrafluoride |
InChI=1/F4Si/c1-5(2,3)4 |
F[Si](F)(F)F |
 |
Silane, tetrafluoro-; Silicon fluoride; Silicon fluoride (SiF4); Silicon tetrafluoride; Tetrafluorosilane; UN 1859; perfluorosilane
|
| 14265442 |
PO4-3 |
phosphate |
InChI=1S/H3O4P/c1-5(2,3)4/h(H3,1,2,3,4)/p-3 |
O=P([O-])([O-])[O-] |
 |
|
| 7664382 |
H3PO4 |
Phosphoric Acid |
InChI=1S/H3O4P/c1-5(2,3)4/h1-3H |
[O][P](O)(O)O |
 |
|
| 13478201 |
F3PO |
Phosphoryl fluoride |
InChI=1/F3OP/c1-5(2,3)4 |
O=P(F)(F)F |
 |
Phosphorus oxyfluoride; Phosphoryl fluoride; Phosphoryl trifluoride; Trifluorophosphorus oxide; Trifluorophosphine oxide
|
| 14808798 |
SO4-2 |
sulfate |
InChI=1S/H2O4S/c1-5(2,3)4/h(H2,1,2,3,4)/p-2 |
O=S([O-])([O-])=O |
 |
sulfate anion; sulfate
|
| 14996022 |
HSO4- |
bisulfate anion |
InChI=1/H2O4S/c1-5(2,3)4/h(H2,1,2,3,4)/p-1 |
[O-]S(=O)(=O)O |
 |
|
| 7664939 |
H2SO4 |
Sulfuric acid |
InChI=1/H2O4S/c1-5(2,3)4/h(H2,1,2,3,4) |
OS(=O)(O)=O |
 |
Acide sulfurique; Acido solforico; BOV; Dipping acid; Hydgogen sulfate; Hydrogen sulfate; Matting acid; Nordhausen acid; Oil of vitriol; Schwefelsaeureloesungen; Spent sulfuric acid; Sulfuric Acid; Sulfuric acid, spent; Sulphuric acid; Vitriol brown oil; UN 2796; Vitriol, oil of; UN 1830; UN 1832; Zwavelzuuroplossingen
|
| 110021 |
C4H4S |
Thiophene |
InChI=1/C4H4S/c1-2-4-5-3-1/h1-4H |
C1=CC=CS1 |
 |
CP 34; Divinylene sulfide; Furan, Thio-; Huile H50; Huile HSO; Thiacyclopentadiene; Thiaphene; Thiofen; Thiofuram; Thiofuran; Thiofurfuran; Thiole; Thiophen; Thiophene; Thiotetrole; USAF ek-1860; UN 2414
|
| 79196 |
CH5N3S |
Hydrazinecarbothioamide |
InChI=1/CH5N3S/c2-1(5)4-3/h3H2,(H3,2,4,5) |
NNC(N)=S |
 |
1-Amino-2-Thiourea; 1-Aminothiourea; 2-Thiosemicarbazide; Hydrazinecarbothioamide; Isothiosemicarbazide; N-Aminothiourea; Rcra waste number P116; Semicarbazide, 3-thio-; Semicarbazide, thio-; Thiocarbamoylhydrazine; Thiocarbamylhydrazine; Thiosemicarbazide; TSC; TSZ; USAF ek-1275
|
| 67710 |
C2H6O2S |
Dimethyl sulfone |
InChI=1/C2H6O2S/c1-5(2,3)4/h1-2H3 |
C[S](C)(=O)=O |
 |
Dimethyl sulfone; Dimethyl sulphone; Methane, sulfonylbis-; Methyl sulfone; Methylsulfonylmethane; Sulphonylbismethane; (methylsulfonyl)methane
|
| 627510 |
CH2CHSCHCH2 |
Divinyl sulfide |
InChI=1/C4H6S/c1-3-5-4-2/h3-4H,1-2H2 |
C=CSC=C |
 |
Divinyl sulfide; Divinyl thioether; Ethene, 1,1'-thiobis-; Vinyl sulfide; divinylsulfane
|
| 1120598 |
C4H6S |
Thiophene, 2,3-dihydro- |
InChI=1/C4H6S/c1-2-4-5-3-1/h1,3H,2,4H2 |
C1CC=CS1 |
 |
2,3-Dihydrothiophene; Thiophene, 2,3-dihydro-
|
| 1708323 |
C4H6S |
Thiophene, 2,5-dihydro- |
InChI=1/C4H6S/c1-2-4-5-3-1/h1-2H,3-4H2 |
C1C=CCS1 |
 |
2,5-Dihydrothiophene; Thiophene, 2,5-dihydro-
|
| 3658808 |
CH3SSSCH3 |
dimethyl trisulfide |
InChI=1/C2H6S3/c1-3-5-4-2/h1-2H3 |
CSSSC |
 |
Trisulfide, dimethyl; 2,3,4-Trithiapentane; 1,3-Dimethyltrisulfane
|
| 110010 |
C4H8S |
Thiophene, tetrahydro- |
InChI=1/C4H8S/c1-2-4-5-3-1/h1-4H2 |
C1CCCS1 |
 |
Tetrahydrothiofen; Tetrahydrothiophen; Tetrahydrothiophene; Tetramethylene sulfide; Tetramethylene sulphide; Thiacyclopentane; Thilane; Thiofan; Thiolan; Thiolane; Thiophane; Thiophene, tetrahydro-; THT; UN 2412
|
| 109808 |
C3H8S2 |
1,3-Propanedithiol |
InChI=1/C3H8S2/c4-2-1-3-5/h4-5H,1-3H2 |
SCCCS |
 |
1,3-Dimercaptopropane; 1,3-Propanedimercaptan; 1,3-Propanedithiol; Dithiotrimethyleneglycol; NDR-132; Trimethylenedithioglycol; Trimethylene dimercaptan; Trimethylenedithiol; propane-1,3-dithiol
|
| 75661 |
C(CH3)3SH |
2-Propanethiol, 2-methyl- |
InChI=1/C4H10S/c1-4(2,3)5/h5H,1-3H3 |
CC(S)(C)C |
 |
1,1-Dimethylethanethiol; 2-Isobutanethiol; 2-Methyl-2-Propanethiol; 2-Propanethiol, 2-methyl-; t-Butyl mercaptan; tert-Butanethiol; tert-Butylmercaptan; tert-Butylthiol; tert-C4H9SH; 2-methylpropane-2-thiol
|
| 1551219 |
CH3C(SCH3)HCH3 |
Propane, 2-(methylthio)- |
InChI=1/C4H10S/c1-4(2)5-3/h4H,1-3H3 |
CC(C)SC |
 |
2-(Methylthio)propane; 3-Methyl-2-thiabutane; Isopropyl methyl sulfide; Isopropyl methyl sulphide; Methyl isopropyl sulfide; Propane, 2-(methylthio)-; Sulfide, isopropyl methyl; isopropyl(methyl)sulfane
|
| 352932 |
C2H5SC2H5 |
Diethyl sulfide |
InChI=1/C4H10S/c1-3-5-4-2/h3-4H2,1-2H3 |
CCSCC |
 |
1,1'-Thiobisethane; 3-Thiapentane; Diethyl sulfide; Diethyl sulphide; Diethyl thioether; Diethylsulfid; Ethane, 1,1'-thiobis-; Ethyl monosulfide; Ethyl sulfide; Ethyl thioether; Ethylthioethane; Sulfodor; Thioethyl ether; UN 2375; diethylsulfane
|
| 513440 |
CH2(SH)CH(CH3)CH3 |
1-Propanethiol, 2-methyl- |
InChI=1/C4H10S/c1-4(2)3-5/h4-5H,3H2,1-2H3 |
CC(C)CS |
 |
1-Propanethiol, 2-methyl-; 1-Isobutanethiol; 2-Methyl-1-propanethiol; Isobutanethiol; Isobutyl mercaptan; iso-C4H9SH; 2-methylpropane-1-thiol
|
| 513531 |
CH3CH(SH)CH2CH3 |
2-Butanethiol |
InChI=1/C4H10S/c1-3-4(2)5/h4-5H,3H2,1-2H3 |
C[C@H](S)CC |
 |
1-Methyl-1-propanethiol; 2-Mercaptobutane; 2-Butanethiol; 2-Butyl mercaptan; sec-Butanethiol; sec-Butyl mercaptan; sec-Butyl mercaptan; sec-Butyl thioalcohol; sec-Butyl thiol; sec-C4H9SH; Secondary butylmercaptan; butane-2-thiol
|
| 2699798 |
SO2F2 |
Sulfuryl fluoride |
InChI=1S/F2O2S/c1-5(2,3)4 |
O=S(F)(F)=O |
 |
Sulfonyl fluoride; Sulfur dioxide difluoride; Sulfur fluoride oxide; Sulfuric oxyfluoride; Fluorure de sulfuryle; Sulphuryl fluoride; Sulfuryl difluoride; sulphuryl difluoride
|
| 7783600 |
SF4 |
Sulfur tetrafluoride |
InChI=1/F4S/c1-5(2,3)4 |
FS(F)(F)F |
 |
Tetrafluorosulfurane; UN 2418; Sulfur fluoride; Sulfur tetrafluoride
|
| 7789211 |
HSO3F |
Fluorosulfonic acid |
InChI=1/FHO3S/c1-5(2,3)4/h(H,2,3,4) |
FS(=O)(O)=O |
 |
Fluorosulfonic acid; Fluorosulfuric-acid-; Fluorosulphonic-acid-; Fluosulfonic acid; UN 1777; sulfurofluoridic acid
|
| 7791255 |
SO2Cl2 |
Sulfuryl chloride |
InChI=1/Cl2O2S/c1-5(2,3)4 |
O=S(Cl)(Cl)=O |
 |
Chlorosulfuric acid; Sulfonyl chloride; Sulfuric chloride; Sulfuric oxychloride; Sulfuryl chloride; Sulphuryl-chloride-; UN 1834; sulfuryl dichloride
|
| 10025873 |
Cl3PO |
Phosphoryl chloride |
InChI=1/Cl3OP/c1-5(2,3)4 |
O=P(Cl)(Cl)Cl |
 |
Fosforoxychlorid; Oxychlorid fosforecny; Phosphoric chloride; Phosphoric trichloride; Phosphorous oxychloride; Phosphorus chloride oxide (POCl3); Phosphorus oxide chloride; Phosphorus oxide trichloride; Phosphorus oxychloride; Phosphorus oxytrichloride; Phosphorus(V) trichloride oxide; Phosphoryl chloride; Phosphoryl trichloride; Trichlorophosphine oxide; Trichlorophosphorus oxide; UN 1810
|
| 10026047 |
SiCl4 |
Silane, tetrachloro- |
InChI=1/Cl4Si/c1-5(2,3)4 |
Cl[Si](Cl)(Cl)Cl |
 |
Chlorid kremicity; Extrema; Silane, tetrachloro-; Silicio(tetracloruro di); Silicium(tetrachlorure de); Siliciumtetrachlorid; Siliciumtetrachloride; Silicon chloride; Silicon chloride (SiCl4); Silicon tetrachloride; Silicon(IV) chloride; Tetrachlorosilane; Tetrachlorosilicon; Tetrachlorure de silicium; UN 1818; perchlorosilane
|
| 7616946 |
ClFO3 |
Perchloryl fluoride |
InChI=1/ClFO3/c2-1(3,4)5 |
O=Cl(=O)(F)=O |
 |
Chlorine fluoride oxide; Chlorine fluoride oxide (ClO3F); Chlorine oxyfluoride; Chlorine oxyfluoride (ClO3F); Perchloryl fluoride; Perchloryl fluoride ((ClO3)F); Trioxychlorofluoride; perchloric fluoride
|
| 75694 |
CFCl3 |
Trichloromonofluoromethane |
InChI=1/CCl3F/c2-1(3,4)5 |
ClC(Cl)(Cl)F |
 |
Algofrene Type 1; Arcton 11; Arcton 9; Chlorofluoromethane (CCl3F); Daiflon 11; Daiflon S 1; Electro-CF 11; F 11; F 11B; FC 11; FC 11, Halocarbon; FKW 11; Fluorocarbon 11; Fluorochloroform; Fluorotrichloromethane; Freon 11; Freon MF; Freon R 11; Frigen 11; Frigen 11A; Frigen S 11; Genetron 11; Halon 11; Isceon 131; Isotron 11; Kaltron 11; Khladon 11; Ledon 11; Methane, trichlorofluoro-; Monofluorotrichloromethane; Propellant 11; R 11; R 11, Halocarbon; Refrigerant 11; Refrigerant R11; Trichloromonofluoromethane; Trichlorofluoromethane; Triclorofluormethane
|
| 75718 |
CF2Cl2 |
difluorodichloromethane |
InChI=1/CCl2F2/c2-1(3,4)5 |
ClC(F)(F)Cl |
 |
Algofrene Type 2; Arcton 12; Arcton 6; Chlorofluoromethane (CCl2F2); Dichlorodifluoromethane; Difluorodichloromethane; Dwuchlorodwufluorometan; Electro-CF 12; Eskimon 12; F 12; FC 12; Fluorocarbon 12; Freon 12; Freon F-12; Frigen 12; Genetron 12; Halon; Halon 122; Isceon 122; Isotron 12; Kaiser chemicals 12; Ledon 12; Methane, dichlorodifluoro-; Propellant 12; R 12; R 12, Refrigerant; Rcra waste number U075; Refrigerant 12; Ucon 12; Ucon 12/halocarbon 12; UN 1028
|
| 75729 |
CF3Cl |
Methane, chlorotrifluoro- |
InChI=1/CClF3/c2-1(3,4)5 |
FC(F)(Cl)F |
 |
Arcton 3; Chlorotrifluoromethane; F 13; FC 13; Freon 13; Frigen 13; Genetron 13; Halocarbon 13/ucon 13; Methane, chlorotrifluoro-; Monochlorotrifluoromethane; R 13; Refrigerant 13; Trifluoromethyl Chloride; UN 1022; Trifluorochloromethane; Trifluoromonochlorocarbon
|
| 56235 |
CCl4 |
Carbon tetrachloride |
InChI=1/CCl4/c2-1(3,4)5 |
ClC(Cl)(Cl)Cl |
 |
Benzenoform; Benzinoform; Carbon chloride; Carbon chloride (CCl4); Carbon tet; Carbon Tetrachloride; Carbona; Chlorid uhlicity; Czterochlorek wegla; ENT 27164; ENT 4,705; Fasciolin; Flukoids; Freon 10; Halon 104; Methane tetrachloride; Methane, tetrachloro-; Necatorina; Necatorine; Perchloromethane; R 10; Rcra waste number U211; Tetrachloorkoolstof; Tetrachloormetaan; Tetrachlorkohlenstoff, tetra; Tetrachlormethan; Tetrachlorocarbon; Tetrachloromethane; Tetrachlorure de carbone; Tetraclorometano; Tetracloruro di carbonio; Tetrafinol; Tetraform; Tetrasol; UN 1846; Vermoestricid; Univerm
|
| 14545723 |
ClONO2 |
Chlorine nitrate |
InChI=1S/ClNO3/c1-5-2(3)4 |
ClO[N]([O])=O |
 |
|
| 14797730 |
ClO4- |
perchlorate anion |
InChI=1S/ClHO4/c2-1(3,4)5/h(H,2,3,4,5)/p-1 |
O=Cl(=O)([O-])=O |
 |
perchlorate
|
| 79016 |
CHClCCl2 |
Trichloroethylene |
InChI=1/C2HCl3/c3-1-2(4)5/h1H |
ClC(Cl)=CCl |
 |
1,1,2-Trichloroethene; 1,1,2-Trichloroethylene; 1,1-Dichloro-2-chloroethylene; 1,2,2-Trichloroethylene; 1-Chloro-2,2-dichloroethylene; Acetylene trichloride; Algylen; Anamenth; Benzinol; Blacosolv; Blancosolv; Cecolene; Chlorilen; Chlorylea; Chlorylen; Chorylen; Circosolv; Crawhaspol; Densinfluat; Dow-tri; Dukeron; Ethene, trichloro-; Ethinyl trichloride; Ethylene trichloride; Ethylene, trichloro-; Fleck-flip; Flock flip; Fluate; Gemalgene; Germalgene; Lanadin; Lethurin; Narcogen; Narkogen; Narkosoid; NCI-C04546; Nialk; Perm-A-chlor; Perm-A-clor; Petzinol; Philex; Rcra waste number U228; TCE; Threthylen; Threthylene; Trethylene; Tri; Triad; Trial; Triasol; Trichlooretheen; Trichloorethyleen, tri; Trichloraethylen, tri; Trichloroethene; Trichloroethylene; Tricloretene; Tricloroetilene; Trielin; Trielina; Trichloraethen; Trichloran; Trichloren; Trichlorethene; Trichlorethylene; Trichlorethylene, tri; Tri-Clene; Trielene; Trieline; Trimar; Westrosol; Triline; Triklone; Trilen; Trilene; Tri-plus; UN 1710; Vitran; Triol; Vestrol; Tri-plus M
|
| 7601903 |
HClO4 |
perchloric acid |
InChI=1S/ClHO4/c2-1(3,4)5/h2H |
O=Cl(=O)(O)=O |
 |
|
| 79027 |
CHCl2CHO |
dichloroacetaldehyde |
InChI=1S/C2H2Cl2O/c3-2(4)1-5/h1-2H |
O=CC(Cl)Cl |
 |
Acetaldehyde,dichloro-; 2,2-Dichloroacetaldehyde; Chloroaldehyde; Acetaldehyde, 2,2-dichloro-; Chloraldehyde; a,a-Dichloroacetaldehyde
|
| 79005 |
CH2ClCHCl2 |
1,1,2-trichloroethane |
InChI=1/C2H3Cl3/c3-1-2(4)5/h2H,1H2 |
ClCC(Cl)Cl |
 |
1,1,2-Trichlorethane; ethane trichloride; Ethane, 1,1,2-trichloro-; Trichloroethane; 1,1,2-Trichloroethane; CHCl2CH2Cl; 1,2,2-Trichloroethane
|
| 75683 |
CH3CF2Cl |
1-Chloro-1,1-Difluoroethane |
InChI=1S/C2H3ClF2/c1-2(3,4)5/h1H3 |
CC(F)(Cl)F |
 |
Ethane, 1-chloro-1,1-difluoro-; Freon 142; Freon 142b; FC 142b; R 142b; 1,1-Difluoro-1-chloroethane; CFC 142b; Chlorodifluoroethane; Difluoromonochloroethane; UN 2517; 1-chloro-1,1-difluoroethane
|
| 71556 |
CH3CCl3 |
Ethane, 1,1,1-trichloro- |
InChI=1/C2H3Cl3/c1-2(3,4)5/h1H3 |
CC(Cl)(Cl)Cl |
 |
α-T; α-Trichloroethane; 1,1,1-TCE; 1,1,1-Trichloorethaan; 1,1,1-Trichloraethan; 1,1,1-Trichloroethane; 1,1,1-Tricloroetano; Aerothene TT; Chloroetene; Chloroethene; Chloroethene NU; Chloroform, methyl-; Chlorotene; Chlorothane NU; Chlorothene; Chlorothene NU; Chlorothene sm; Chlorothene VG; Chlorothene, inhibited; Chlorten; Ethana nu; Ethane, 1,1,1-trichloro-; Ici-cf 2; Inhibisol; Methylchloroform; Methyltrichloromethane; NCI-C04626; Rcra waste number U226; Solvent 111; Strobane; Tafclean; Trichloro-1,1,1-ethane; Trichloromethylmethane; Tri-ethane; Trichloroethane; UN 2831; alpha-T; alpha-Trichloroethane
|
| 1717006 |
CH3CFCl2 |
1,1-Dichloro-1-fluoroethane |
InChI=1S/C2H3Cl2F/c1-2(3,4)5/h1H3 |
CC(F)(Cl)Cl |
 |
Ethane, 1,1-dichloro-1-fluoro-; Freon 141; Dichlorofluoroethane; Freon 141b; HCFC-141b; R 141b; 1,1-dichloro-1-fluoroethane
|
| 106898 |
C3H5ClO |
Oxirane, (chloromethyl)- |
InChI=1/C3H5ClO/c4-1-3-2-5-3/h3H,1-2H2 |
ClC[C@H]1OC1 |
 |
2-(Chloromethyl)oxirane; α-Epichlorohydrin; γ-Chloropropylene oxide; 1,2-Epoxy-3-chloropropane; 1-Chloor-2,3-epoxy-propaan; 1-Chlor-2,3-epoxy-propan; 1-Chloro-2,3-Epoxypropane; 1-Cloro-2,3-epossipropano; 2,3-Epoxypropyl chloride; (Chloromethyl)ethylene oxide; (Chloromethyl)oxirane; (DL)-α-Epichlorohydrin; 3-Chloro-1,2-epoxypropane; 3-Chloro-1,2-propylene oxide; 3-Chloropropene-1,2-oxide; 3-Chloropropylene oxide; Alyl chloride oxide; Chloropropylene oxide; ECH; Epichloorhydrine; Epichlorhydrin; Epichlorhydrine; Epichlorohydrin; Epichlorohydryna; Epichlorophydrin; Epicloridrina; Glycerol epichlorhydrin; Glycerol epichlorohydrin; Glycidyl chloride; Oxirane, (chloromethyl)-; Oxirane, 2-(chloromethyl); Propane, 1-chloro-2,3-epoxy-; Rcra waste number U041; SKEkhG; UN 2023; alpha-Epichlorohydrin; gamma-Chloropropylene oxide
|
| 78875 |
CH2ClCHClCH3 |
Propane, 1,2-dichloro- |
InChI=1/C3H6Cl2/c1-3(5)2-4/h3H,2H2,1H3 |
C[C@@H](Cl)CCl |
 |
α,β-dichloropropane; α,β-Propylene dichloride; 1,2-Dichloropropane; Bichlorure de propylene; Chlorinated C3 hydrocarbons; D-d Mixture; Dichloropropane; Dwuchloropropan; ENT 15,406; NCI-C55141; Nemex; Propane, 1,2-dichloro-; Propylene chloride; Propylene dichloride; Rcra waste number U083; Vidden D; alpha,beta-dichloropropane; alpha,beta-Propylene dichloride
|
| 594207 |
CH3CCl2CH3 |
Propane, 2,2-dichloro- |
InChI=1/C3H6Cl2/c1-3(2,4)5/h1-2H3 |
CC(Cl)(Cl)C |
 |
2,2-Dichloropropane; Dimethyldichloromethane; Propane, 2,2-dichloro-
|
| 591979 |
CH2ClCHCHCH3 |
2-Butene, 1-chloro- |
InChI=1/C4H7Cl/c1-2-3-4-5/h2-3H,4H2,1H3 |
C/C=C/CCl |
 |
α-Chloro-β-butylene; γ-Methallyl chloride; γ-Methylallyl chloride; 1-Chloro-2-butene; 2-Butene, 1-chloro-; 2-Butenyl chloride; Crotyl chloride; alpha-Chloro-beta-butylene; gamma-Methallyl chloride; gamma-Methylallyl chloride; (E)-1-chlorobut-2-ene
|
| 563520 |
CH2CHCHClCH3 |
1-Butene, 3-chloro- |
InChI=1/C4H7Cl/c1-3-4(2)5/h3-4H,1H2,2H3 |
C=C[C@H](Cl)C |
 |
1-Methylallyl chloride; α-Methallyl chloride; α-Methylallyl chloride; γ-Chloro-α-butylene; 1-Butene, 3-chloro-; 2-Chloro-3-butene; 3-Chloro-1-butene; alpha-Methallyl chloride; alpha-Methylallyl chloride; gamma-Chloro-alpha-butylene; 3-chlorobut-1-ene
|
| 927731 |
CH2CHCH2CH2Cl |
1-Butene, 4-chloro- |
InChI=1/C4H7Cl/c1-2-3-4-5/h2H,1,3-4H2 |
C=CCCCl |
 |
1-Butene, 4-chloro-; 4-chlorobut-1-ene
|
| 7611861 |
CHClCHCH2CH3 |
(Z)-1-Chloro-1-butene |
InChI=1/C4H7Cl/c1-2-3-4-5/h3-4H,2H2,1H3/b4-3- |
CC/C=C\Cl |
 |
1-Butene, 1-chloro-, (Z)-; (Z)-1-chlorobut-1-ene
|
| 7611872 |
CHClCHCH2CH3 |
(E)-1-Chloro-1-butene |
InChI=1/C4H7Cl/c1-2-3-4-5/h3-4H,2H2,1H3/b4-3+ |
CC/C=C/Cl |
 |
1-Butene, 1-chloro-, (E)-; (E)-1-chlorobut-1-ene
|
| 2211703 |
CH2CClCH2CH3 |
1-Butene, 2-chloro- |
InChI=1/C4H7Cl/c1-3-4(2)5/h2-3H2,1H3 |
C=C(Cl)CC |
 |
1-Butene, 2-chloro-; 2-chlorobut-1-ene
|
| 4628211 |
CH3CClCHCH3 |
2-Butene, 2-chloro-, (Z)- |
InChI=1/C4H7Cl/c1-2-3-4-5/h2-3H,4H2,1H3/b3-2- |
C/C(Cl)=C/C |
 |
2-Butene, 1-chloro-, (Z)-; (Z)-2-chlorobut-2-ene
|
| 4894615 |
CH3CClCHCH3 |
2-Butene, 2-chloro-, (E)- |
InChI=1/C4H7Cl/c1-2-3-4-5/h2-3H,4H2,1H3/b3-2+ |
C/C(Cl)=C\C |
 |
2-Butene, 1-chloro-, (E)-; (E)-2-chlorobut-2-ene
|
| 507200 |
CH3CCl(CH3)CH3 |
Propane, 2-chloro-2-methyl- |
InChI=1/C4H9Cl/c1-4(2,3)5/h1-3H3 |
CC(C)(Cl)C |
 |
2-Methyl-2-chloropropane; 2-Methyl-2-propyl chloride; 2-Chloro-2-methylpropane; 2-Chloroisobutane; Chlorotrimethylmethane; n-Propylcarbinyl chloride; Propane, 2-chloro-2-methyl-; tert-Butyl Chloride; tert-C4H9Cl; Tertiary-butyl chloride; Trimethylchloromethane
|
| 78864 |
CH3CHClCH2CH3 |
Butane, 2-chloro- |
InChI=1/C4H9Cl/c1-3-4(2)5/h4H,3H2,1-2H3 |
C[C@H](Cl)CC |
 |
1-Methylpropyl chloride; 2-Chlorobutane; Butane, 2-chloro-; sec-Butyl Chloride; sec-C4H9Cl; UN 1127
|
| 109693 |
CH2ClCH2CH2CH3 |
Butane, 1-chloro- |
InChI=1/C4H9Cl/c1-2-3-4-5/h2-4H2,1H3 |
CCCCCl |
 |
1-Chlorobutane; Butane, 1-chloro-; Butyl chloride; Chlorure de butyle; NBC wormer; n-Butyl chloride; n-C4H9Cl; NCI-C06155; n-Propylcarbinyl chloride; Sure Shot; UN 1127
|
| 471341 |
CaCO3 |
Calcium Carbonate |
InChI=1S/CH2O3.Ca/c2-1(3)4;/h(H2,2,3,4);/q;+2/p-2 |
O=C1O[Ca]O1 |
 |
|
| 7550450 |
TiCl4 |
Titanium tetrachloride |
InChI=1/4ClH.Ti/h4*1H;/q;;;;+4/p-4 |
Cl[Ti](Cl)(Cl)Cl |
 |
Titanium chloride; Titanium(IV) chloride; Titanic chloride; Tetrachlorotitanium; Titantetrachlorid; Tetrachlorure de titane
|
| 7783586 |
GeF4 |
Germanium tetrafluoride |
InChI=1S/F4Ge/c1-5(2,3)4 |
F[Ge](F)(F)F |
 |
tetrafluorogermane; perfluorogermane
|
| 353593 |
CBrClF2 |
Methane, bromochlorodifluoro- |
InChI=1S/CBrClF2/c2-1(3,4)5 |
FC(Br)(Cl)F |
 |
Bromochlorodifluoromethane; Difluorochlorobromomethane; Chlorodifluoromonobromomethane; Chlorodifluorobromomethane; Chlorobromodifluoromethane
|
| 558134 |
CBr4 |
Carbon tetrabromide |
InChI=1/CBr4/c2-1(3,4)5 |
BrC(Br)(Br)Br |
 |
Tetrabromomethane; Methane, tetrabromo-; Methane tetrabromide; Carbon bromide; perbromomethane
|
| 75616 |
CBr2F2 |
Methane, dibromodifluoro- |
InChI=1S/CBr2F2/c2-1(3,4)5 |
FC(Br)(Br)F |
 |
Dibromodifluoromethane; Difluorodibromomethane
|
| 75627 |
CBrCl3 |
Methane, bromotrichloro- |
InChI=1S/CBrCl3/c2-1(3,4)5 |
ClC(Cl)(Br)Cl |
 |
Bromotrichloromethane; Carbon bromotrichloride; Monobromotrichloromethane; Trichlorobromomethane; Carbon trichlorobromide; Trichloromethyl bromide
|
| 75638 |
CF3Br |
Bromotrifluoromethane |
InChI=1S/CBrF3/c2-1(3,4)5 |
FC(Br)(F)F |
 |
Methane, bromotrifluoro-; Monobromotrifluoromethane; Halon 1301; Trifluorobromomethane; Trifluoromethyl Bromide; Trifluoromonobromomethane; Refrigerant 13b1; F 13B1; Fluorocarbon 1301; Freon 13B1; UN 1009; bromotrifluoromethane
|
| 40423141 |
BrONO2 |
Bromine nitrate |
InChI=1S/BrNO3/c1-5-2(3)4 |
[O]N([O])OBr |
 |
|
| 359080 |
CHBrCF2 |
1-Bromo-2,2-difluoroethylene |
InChI=1S/C2HBrF2/c3-1-2(4)5/h1H |
BrC=C(F)F |
 |
Ethene, 2-bromo-1,1-difluoro-; 2-Bromo-1,1-difluoroethene; 2-Bromo-1,1-difluoroethylene
|
| 3161997 |
C6H2 |
hexatriyne |
InChI=1S/C6H2/c1-3-5-6-4-2/h1-2H |
C#CC#CC#C |
 |
|
| 462806 |
C6H4 |
Benzyne |
InChI=1S/C6H4/c1-2-4-6-5-3-1/h1-4H |
C1=CC#CC=C1 |
 |
1,3-Cyclohexadien-5-yne; cyclohexa-1,3-dien-5-yne
|
| 16668670 |
C6H4 |
(Z)-Hexa-1,5-diyne-3-ene |
InChI=1/C6H4/c1-3-5-6-4-2/h1-2,5-6H/b6-5- |
C#C/C=C\C#C |
 |
(Z)-HC#CCH=CHC#CH; (Z)-Hexa-1,5-diyne-3-ene; 3-Hexene-1,5-diyne, (Z)-; (Z)-hexa-3-en-1,5-diyne
|
| 16668681 |
C6H4 |
(E)-Hexa-1,5-diyne-3-ene |
InChI=1/C6H4/c1-3-5-6-4-2/h1-2,5-6H/b6-5+ |
C#C/C=C/C#C |
 |
(E)-HC#CCH=CHC#CH; (E)-Hexa-1,5-diyne-3-ene; 3-Hexene-1,5-diyne, (E)-; (E)-hexa-3-en-1,5-diyne
|
| 2396012 |
C6H5 |
phenyl |
InChI=1/C6H5/c1-2-4-6-5-3-1/h1-5H |
[C]1=CC=CC=C1 |
 |
phenyl
|
| 2809690 |
C6H6 |
2,4-Hexadiyne |
InChI=1/C6H6/c1-3-5-6-4-2/h1-2H3 |
CC#CC#CC |
 |
2,4-Hexadiyne; Dimethylbutadiyne; Dimethyldiacetylene; Hexa-2,4-diyne
|
| 71432 |
C6H6 |
Benzene |
InChI=1/C6H6/c1-2-4-6-5-3-1/h1-6H |
C1=CC=CC=C1 |
 |
[6]Annulene; Benzeen; Benzen; Benzene; Benzin; Benzine; Benzol; Benzole; Benzolene; Benzolo; Bicarburet of hydrogen; Carbon oil; Coal naphtha; Cyclohexatriene; Fenzen; Mineral naphtha; Motor benzol; NCI-C55276; Nitration benzene; Phene; Phenyl hydride; Pyrobenzol; Pyrobenzole; Rcra waste number U019; UN 1114
|
| 592574 |
C6H8 |
1,3-Cyclohexadiene |
InChI=1/C6H8/c1-2-4-6-5-3-1/h1-4H,5-6H2 |
C1=CC=CCC1 |
 |
1,3-Cyclohexadiene; Cyclohexa-1,3-diene; cyclohexadiene
|
| 821078 |
C6H8 |
1,3,5-Hexatriene, (E)- |
InChI=1/C6H8/c1-3-5-6-4-2/h3-6H,1-2H2/b6-5+ |
C=C/C=C/C=C |
 |
1,3,5-Hexatriene, (E)-; 1,3,5-Hexatriene, trans-; (E)-1,3,5-Hexatriene; (E)-CH2=CHCH=CHCH=CH2; trans-1,3,5-Hexatriene; trans-Hexatriene; trans-trans-Hexatriene; hexatriene; (E)-hexa-1,3,5-triene
|
| 822413 |
C6H8 |
Bicyclo[2.1.1]hex-2-ene |
InChI=1/C6H8/c1-2-6-3-5(1)4-6/h1-2,5-6H,3-4H2 |
[C@@H]1(C2)C=C[C@H]2C1 |
 |
|
| 930267 |
C6H8 |
3-Methylenecyclopentene |
InChI=1/C6H8/c1-6-4-2-3-5-6/h2,4H,1,3,5H2 |
C=C1C=CCC1 |
 |
3-Methylenecyclopentene; Cyclopentene,3-methylene-; 3-methylenecyclopent-1-ene
|
| 628411 |
C6H8 |
1,4-Cyclohexadiene |
InChI=1/C6H8/c1-2-4-6-5-3-1/h1-2,5-6H,3-4H2 |
C1=CCC=CC1 |
 |
1,4-Cyclohexadiene; 1,4-Dihydrobenzene; Cyclohexa-1,4-diene; cyclohexadiene
|
| 694019 |
C6H8 |
Bicyclo[3.1.0]hex-2-ene |
InChI=1/C6H8/c1-2-5-4-6(5)3-1/h1-2,5-6H,3-4H2 |
[C@@H]12C=CC[C@@H]1C2 |
 |
Bicyclo(3.1.0)hex-2-ene; bicyclo[3.1.0]hex-2-ene
|
| 2612466 |
C6H8 |
1,3,5-Hexatriene, (Z)- |
InChI=1/C6H8/c1-3-5-6-4-2/h3-6H,1-2H2/b6-5- |
C=C/C=C\C=C |
 |
1,3,5-Hexatriene, (Z)-; 1,3,5-Hexatriene, cis-; (Z)-1,3,5-Hexatriene; (Z)-CH2=CHCH=CHCH=CH2; cis-1,3,5-Hexatriene; cis-Hexatriene; hexatriene; (Z)-hexa-1,3,5-triene
|
| 30830207 |
C6H8 |
Bicyclo[2.2.0]hex-1(4)-ene |
InChI=1/C6H8/c1-2-6-4-3-5(1)6/h1-4H2 |
C12=C(CC2)CC1 |
 |
Bicyclo[2.2.0]hex-1(4)-ene
|
| 59660649 |
C6H8 |
cis-2,3,4-Hexatriene |
InChI=1/C6H8/c1-3-5-6-4-2/h3-4H,1-2H3/b4-3- |
CC=C=C=CC |
 |
(Z)-CH3CH=C=C=CHCH3; hexatriene; (Z)-hexa-2,3,4-triene
|
| 59660650 |
C6H8 |
trans-2,3,4-Hexatriene |
InChI=1/C6H8/c1-3-5-6-4-2/h3-4H,1-2H3/b4-3+ |
CC=C=C=CC |
 |
2,3,4-Hexatriene, (E)-; (E)-CH3CH=C=C=CHCH3; hexatriene; (E)-hexa-2,3,4-triene
|
| 20237347 |
C6H10 |
1,3-Hexadiene, (E)- |
InChI=1/C6H10/c1-3-5-6-4-2/h3,5-6H,1,4H2,2H3/b6-5+ |
C=C/C=C/CC |
 |
1,3-Hexadiene, (E)-; (E)-1,3-Hexadiene; (E)-CH2=CHCH=CHC2H5; (E)-hexa-1,3-diene
|
| 14596920 |
C6H10 |
1,3-Hexadiene, (Z)- |
InChI=1/C6H10/c1-3-5-6-4-2/h3,5-6H,1,4H2,2H3/b6-5- |
C=C/C=C\CC |
 |
1,3-Hexadiene, (Z)-; Z-1,3-Hexadiene; (Z)-hexa-1,3-diene
|
| 6108618 |
C6H10 |
2,4-Hexadiene, (Z,Z)- |
InChI=1/C6H10/c1-3-5-6-4-2/h3-6H,1-2H3/b5-3-,6-4- |
C/C=C\C=C/C |
 |
2,4-Hexadiene, (Z,Z)-; (Z),(Z)-2,4-Hexadiene; (Z),(Z)-CH3CH=CHCH=CHCH3; cis,cis-2,4-Hexadiene; (2Z,4Z)-hexa-2,4-diene
|
| 7318674 |
C6H10 |
1,4-Hexadiene, (Z)- |
InChI=1/C6H10/c1-3-5-6-4-2/h3-4,6H,1,5H2,2H3/b6-4- |
C=CC/C=C\C |
 |
1,4-Hexadiene, (Z)-; (Z)-CH2=CHCH2CH=CHCH3; cis-1,4-Hexadiene; (Z)-hexa-1,4-diene
|
| 7319008 |
C6H10 |
1,4-Hexadiene, (E)- |
InChI=1/C6H10/c1-3-5-6-4-2/h3-4,6H,1,5H2,2H3/b6-4+ |
C=CC/C=C/C |
 |
1,4-Hexadiene, (E)-; (E)-CH2=CHCH2CH=CHCH3; trans-1,4-Hexadiene; (E)-hexa-1,4-diene
|
| 5194503 |
C6H10 |
2,4-Hexadiene, (E,Z)- |
InChI=1/C6H10/c1-3-5-6-4-2/h3-6H,1-2H3/b5-3-,6-4+ |
C/C=C/C=C\C |
 |
2,4-Hexadiene, (E,Z)-; (E),(Z)-CH3CH=CHCH=CHCH3; cis,trans-2,4-Hexadiene; (2Z,4E)-hexa-2,4-diene
|
| 5194514 |
C6H10 |
2,4-Hexadiene, (E,E)- |
InChI=1/C6H10/c1-3-5-6-4-2/h3-6H,1-2H3/b5-3+,6-4+ |
C/C=C/C=C/C |
 |
2,4-Hexadiene, (E,E)-; (E),(E)-CH3CH=CHCH=CHCH3; cis,cis-2,4-Hexadiene; trans,trans-2,4-Hexadiene; (2E,4E)-hexa-2,4-diene
|
| 764352 |
C6H10 |
2-Hexyne |
InChI=1/C6H10/c1-3-5-6-4-2/h3,5H2,1-2H3 |
CC#CCCC |
 |
1-Methyl-2-propylacetylene; 2-Hexyne; Hex-2-yne; Methyl(propyl)acetylene
|
| 693890 |
C6H10 |
Cyclopentene, 1-methyl- |
InChI=1/C6H10/c1-6-4-2-3-5-6/h4H,2-3,5H2,1H3 |
CC1=CCCC1 |
 |
1-Methyl-1-cyclopentane; 1-Methyl-1-cyclopentene; 1-Methylcyclopentene; Cyc1opentene,l-methyl-; Cyclopentene, 1-methyl-; 1-methylcyclopent-1-ene
|
| 693027 |
C6H10 |
1-Hexyne |
InChI=1/C6H10/c1-3-5-6-4-2/h1H,4-6H2,2H3 |
C#CCCCC |
 |
1-Hexyne; Butylacetylene; Hex-1-yne; n-Butylacetylene
|
| 1120623 |
C6H10 |
Cyclopentene, 3-methyl- |
InChI=1/C6H10/c1-6-4-2-3-5-6/h2,4,6H,3,5H2,1H3 |
C[C@@H]1C=CCC1 |
 |
3-Methylcyclopentene; Cyclopentene, 3-methyl-; 3-methylcyclopent-1-ene
|
| 928494 |
C6H10 |
3-Hexyne |
InChI=1/C6H10/c1-3-5-6-4-2/h3-4H2,1-2H3 |
CCC#CCC |
 |
3-Hexyne; Diethylacetylene; Hex-3-yne
|
| 917920 |
C6H10 |
1-Butyne, 3,3-dimethyl- |
InChI=1/C6H10/c1-5-6(2,3)4/h1H,2-4H3 |
C#CC(C)(C)C |
 |
1-Butyne, 3,3-dimethyl-; 3,3,3-Trimethylpropyne; 3,3-Dimethyl-1-Butyne; 3,3-Dimethylbutyne; 3,3-Dimethylbutyne-1; t-Butylacetylene; tert-Butylacetylene; 3,3-dimethylbut-1-yne
|
| 1759815 |
C6H10 |
Cyclopentene, 4-methyl- |
InChI=1/C6H10/c1-6-4-2-3-5-6/h2-3,6H,4-5H2,1H3 |
CC1CC=CC1 |
 |
1-Methyl-3-cyclopentene; 4-Methylcyclopentene; Cyclopentene, 4-methyl-; 4-methylcyclopent-1-ene
|
| 592427 |
C6H10 |
1,5-Hexadiene |
InChI=1/C6H10/c1-3-5-6-4-2/h3-4H,1-2,5-6H2 |
C=CCCC=C |
 |
1,5-Hexadiene; α,ω-Hexadiene; Biallyl; Diallyl; Hexa-1,5-diene; Hexadiene; alpha,omega;+B52-Hexadiene+B10
|
| 110838 |
C6H10 |
cyclohexene |
InChI=1/C6H10/c1-2-4-6-5-3-1/h1-2H,3-6H2 |
C1=CCCCC1 |
 |
Benzene tetrahydride; Cyclohex-1-ene; UN 2256; Cykloheksen; Benzene, tetrahydro-; 1,2,3,4-Tetrahydrobenzene; 1-Cyclohexene; Tetrahydrobenzene; Hexanaphthylene; cyclohexene
|
| 110827 |
C6H12 |
Cyclohexane |
InChI=1/C6H12/c1-2-4-6-5-3-1/h1-6H2 |
C1CCCCC1 |
 |
Benzene, hexahydro-; Cicloesano; Cyclohexane; Cykloheksan; Hexahydrobenzene; Hexamethylene; Hexanaphthene; Rcra waste number U056; UN 1145
|
| 96377 |
C6H12 |
Cyclopentane, methyl- |
InChI=1/C6H12/c1-6-4-2-3-5-6/h6H,2-5H2,1H3 |
CC1CCCC1 |
 |
Cyclopentane, methyl-; Methylcyclopentane; UN 2298
|
| 592416 |
C6H12 |
1-Hexene |
InChI=1/C6H12/c1-3-5-6-4-2/h3H,1,4-6H2,2H3 |
C=CCCCC |
 |
1-n-Hexene; 1-C6H12; 1-Hexene; Butylethylene; Hex-1-ene; Hexene; Hexene-1; UN 2370
|
| 616126 |
C6H12 |
2-Pentene, 3-methyl-, (E)- |
InChI=1/C6H12/c1-4-6(3)5-2/h4H,5H2,1-3H3/b6-4+ |
C/C=C(C)/CC |
 |
(E)-3-Methyl-2-pentene; (E)-CH3CH=C(CH3)C2H5; 2-Pentene, 3-methyl-, (E)-; 3-Methyl-trans-2-pentene; trans-3-Methyl-2-Pentene; (E)-3-methylpent-2-ene
|
| 563780 |
C6H12 |
1-Butene, 2,3-dimethyl- |
InChI=1/C6H12/c1-5(2)6(3)4/h6H,1H2,2-4H3 |
C=C(C)C(C)C |
 |
1-Butene, 2,3-dimethyl-; 2,3-Dimethyl-1-butene; 2,3-Dimethylbutene-1; Tetramethylethylene; 2,3-dimethylbut-1-ene
|
| 563791 |
C6H12 |
2-Butene, 2,3-dimethyl- |
InChI=1/C6H12/c1-5(2)6(3)4/h1-4H3 |
CC(C)=C(C)C |
 |
1,1,2,2-Tetramethylethylene; 2,3-Dimethyl-2-butene; 2,3-Dimethylbut-2-ene; 2,3-Dimethylbutene-2; 2-Butene, 2,3-dimethyl-; Tetramethylethene; Tetramethylethylene
|
| 922623 |
C6H12 |
2-Pentene, 3-methyl-, (Z)- |
InChI=1/C6H12/c1-4-6(3)5-2/h4H,5H2,1-3H3/b6-4- |
C/C=C(C)\CC |
 |
(Z)-3-Methyl-2-pentene; (Z)-CH3CH=C(CH3)C2H5; 2-Pentene, 3-methyl-, (Z)-; 3-Methyl-cis-2-pentene; cis-3-Methyl-2-pentene; (Z)-3-methylpent-2-ene
|
| 760214 |
C6H12 |
Pentane, 3-methylene- |
InChI=1/C6H12/c1-4-6(3)5-2/h3-5H2,1-2H3 |
CCC(CC)=C |
 |
1,1-Diethylethene; 1-Butene, 2-ethyl-; 2-Ethyl-1-butene; 3-Methylenepentane; Pentane, 3-methylene-
|
| 4806615 |
C6H12 |
Cyclobutane, ethyl- |
InChI=1/C6H12/c1-2-6-4-3-5-6/h6H,2-5H2,1H3 |
CCC1CCC1 |
 |
Cyclobutane, ethyl-; Ethylcyclobutane
|
| 4050457 |
C6H12 |
2-Hexene, (E)- |
InChI=1S/C6H12/c1-3-5-6-4-2/h3,5H,4,6H2,1-2H3/b5-3+ |
C/C=C/CCC |
 |
(E)-2-Hexene; trans-2-Hexene; (E)-2-C6H12; trans-hex-2-ene; (E)-hex-2-ene
|
| 2398096 |
C6H12 |
cis-1,3-dimethylcyclobutane |
InChI=1S/C6H12/c1-5-3-6(2)4-5/h5-6H,3-4H2,1-2H3/t5-,6+ |
C[C@@H]1C[C@H](C)C1 |
 |
|
| 2398109 |
C6H12 |
trans-1,3-dimethylcyclobutane |
InChI=1S/C6H12/c1-5-3-6(2)4-5/h5-6H,3-4H2,1-2H3/t5-,6- |
C[C@@H]1C[C@@H](C)C1 |
 |
|
| 7688213 |
C6H12 |
2-Hexene, (Z)- |
InChI=1S/C6H12/c1-3-5-6-4-2/h3,5H,4,6H2,1-2H3/b5-3- |
C/C=C\CCC |
 |
cis-2-Hexene; (Z)-2-Hexene; 2-Hexene, cis-; (Z)-hex-2-ene; cis-hex-2-ene
|
| 18931710 |
C4H6(CH3)2 |
dimethylcyclobutane |
InChI=1S/C6H12/c1-6(2)4-3-5-6/h3-5H2,1-2H3 |
CC1(C)CCC1 |
 |
Cyclobutane, 1,1-dimethyl-; 1,1-dimethylcyclobutane
|
| 15679013 |
C6H12 |
cis-1,2-dimethylcyclobutane |
InChI=1S/C6H12/c1-5-3-4-6(5)2/h5-6H,3-4H2,1-2H3/t5-,6+ |
C[C@H]1[C@@H](C)CC1 |
 |
|
| 15679024 |
C6H12 |
trans-1,2-dimethylcyclobutane |
InChI=1S/C6H12/c1-5-3-4-6(5)2/h5-6H,3-4H2,1-2H3/t5-,6-/m1/s1 |
C[C@H]1[C@H](C)CC1 |
 |
|
| 96140 |
C6H14 |
Pentane, 3-methyl- |
InChI=1/C6H14/c1-4-6(3)5-2/h6H,4-5H2,1-3H3 |
CCC(C)CC |
 |
3-Methylpentane; Pentane, 3-methyl-; UN 1208; UN 2462
|
| 79298 |
C6H14 |
Butane, 2,3-dimethyl- |
InChI=1/C6H14/c1-5(2)6(3)4/h5-6H,1-4H3 |
CC(C)C(C)C |
 |
2,3-Dimethylbutane; Biisopropyl; Butane, 2,3-dimethyl-; Diisopropyl; UN 2457
|
| 107835 |
C6H14 |
Pentane, 2-methyl- |
InChI=1/C6H14/c1-4-5-6(2)3/h6H,4-5H2,1-3H3 |
CC(C)CCC |
 |
2-Methylpentane; Isohexane; Methyl pentane; Pentane, 2-methyl-; UN 1208; UN 2462
|
| 110543 |
C6H14 |
Hexane |
InChI=1/C6H14/c1-3-5-6-4-2/h3-6H2,1-2H3 |
CCCCCC |
 |
Esani; Gettysolve-B; Heksan; Hexane; Hexanen; Hexyl hydride; n-C6H14; NCI-C60571; n-Hexane; Skellysolve B; UN 1208
|
| 75832 |
C6H14 |
Butane, 2,2-dimethyl- |
InChI=1/C6H14/c1-5-6(2,3)4/h5H2,1-4H3 |
CC(C)(C)CC |
 |
2,2-Dimethylbutane; Butane, 2,2-dimethyl-; Neohexane; UN 1208
|
| 497201 |
C6H6 |
Fulvene |
InChI=1/C6H6/c1-6-4-2-3-5-6/h2-5H,1H2 |
C=C1C=CC=C1 |
 |
1,3-Cyclopentadiene, 5-methylene-; Fulvene
|
| 285585 |
C6H10 |
Bicyclo[3.1.0]hexane |
InChI=1/C6H10/c1-2-5-4-6(5)3-1/h5-6H,1-4H2 |
[C@@H]12CCC[C@@H]1C2 |
 |
Bicyclo[3.1.0]hexane; Norsabinane; Northujane
|
| 1071983 |
C4N2 |
2-Butynedinitrile |
InChI=1/C4N2/c5-3-1-2-4-6 |
N#CC#CC#N |
 |
1,2-Dicyanoacetylene; 2-Butynedinitrile; Acetylenedicarbonitrile; Dicyanoacetylene; Dicyanoethyne; NCC#CCN; Sous-azote de carbone; but-2-ynedinitrile
|
| 764421 |
C4H2N2 |
Fumaronitrile |
InChI=1/C4H2N2/c5-3-1-2-4-6/h1-2H/b2-1+ |
N#C/C=C/C#N |
 |
2-Butenedinitrile, (E)-; (E)-Butenedinitrile; (E)-CH(CN)CH(CN); Fumaric Nitrile; Fumarodinitrile; Fumaronitrile; Furmaronitrile; trans-1,2-Dicyanoethylene
|
| 290960 |
C2H2N4 |
sym-tetrazine |
InChI=1S/C2H2N4/c1-3-5-2-6-4-1/h1-2H |
C1=NN=CN=N1 |
 |
1,2,4,5-Tetrazine; s-Tetrazine
|
| 290879 |
C3H3N3 |
1,3,5-Triazine |
InChI=1/C3H3N3/c1-4-2-6-3-5-1/h1-3H |
N1=CN=CN=C1 |
 |
1,3,5-Triazine; Cyanidine; s-Triazine; s-Triazine-(1,3,5); sym-Triazine; Vedita 250
|
| 4418615 |
CH3N5 |
5-Aminotetrazole |
InChI=1/CH3N5/c2-1-3-5-6-4-1/h(H3,2,3,4,5,6) |
NC1=NN=NN1 |
 |
1H-Tetrazol-5-amine; 1H-Tetrazole, 5-amino-; 5-Amino-1,2,3,4-tetrazole; 5-Amino-1H-tetrazole; 5-Aminotetrazole; Aminotetrazole
|
| 4076362 |
C2H4N4 |
1H-Tetrazole, 5-methyl- |
InChI=1/C2H4N4/c1-2-3-5-6-4-2/h1H3,(H,3,4,5,6) |
CC1=NN=NN1 |
 |
1H-Tetrazole, 5-methyl-; 5-Methyltetrazole; 5-methyl-1H-tetrazole
|
| 289805 |
C4H4N2 |
Pyridazine |
InChI=1/C4H4N2/c1-2-4-6-5-3-1/h1-4H |
C1=NN=CC=C1 |
 |
1,2-Diazabenzene; 1,2-Diazine; Orthodiazine; Pyridazine
|
| 289952 |
C4H4N2 |
1,3-Diazine |
InChI=1/C4H4N2/c1-2-5-4-6-3-1/h1-4H |
N1=CC=CN=C1 |
 |
1,3-Diazabenzene; 1,3-Diazine; m-Diazine; Metadiazine; Miazine; Pyrimidine
|
| 290379 |
C4H4N2 |
Pyrazine |
InChI=1/C4H4N2/c1-2-6-4-3-5-1/h1-4H |
C1=NC=CN=C1 |
 |
1,4-Diazabenzene; 1,4-Diazine; Paradiazine; p-Diazine; Piazine; Pyrazine
|
| 110612 |
C4H4N2 |
Succinonitrile |
InChI=1/C4H4N2/c5-3-1-2-4-6/h1-2H2 |
N#CCCC#N |
 |
1,4-Butanedinitrile; 1,2-Dicyanoethane; Butanedinitrile; Deprelin; Dician; Dinile; Disuxyl; Ethane, 1,2-dicyano-; Ethylene cyanide; Ethylene dicyanide; Evanex; NCCH2CH2CN; s-Dicyanoethane; Succinic acid dinitrile; Succinic acid nitrile; Succinic dinitrile; Succinil; Succinodinitrile; Succinonitrile; Sukcinonitril; Suxil; sym-Dicyanoethane; USAF a-9442
|
| 16681779 |
C2H4N4 |
1H-Tetrazole, 1-methyl- |
InChI=1/C2H4N4/c1-6-2-3-4-5-6/h2H,1H3 |
CN1N=NN=C1 |
 |
1-Methyl-1H-tetrazole; 1-Methyltetrazole; 1H-Tetrazole, 1-methyl-; N-Methyltetrazole
|
| 16681780 |
C2H4N4 |
2H-Tetrazole, 2-methyl- |
InChI=1/C2H4N4/c1-6-4-2-3-5-6/h2H,1H3 |
CN1N=CN=N1 |
 |
2H-Tetrazole, 2-methyl-; 2-Methyltetrazole; 2-methyl-2H-tetrazole
|
| 16955354 |
C5H5N |
Bicyclo[1.1.0]butane-1-carbonitrile |
InChI=1/C5H5N/c6-3-5-1-4(5)2-5/h4H,1-2H2 |
N#C[C@@]12C[C@@H]1C2 |
 |
1-Cyanobicyclo[1.1.0]butane; Bicyclo[1.1.0]butane-1-carbonitrile
|
| 110861 |
C5H5N |
Pyridine |
InChI=1/C5H5N/c1-2-4-6-5-3-1/h1-5H |
C1=NC=CC=C1 |
 |
Azabenzene; Azine; NCI-C55301; Piridina; Pirydyna; Pyridin; Pyridine; Rcra waste number U196; UN 1282; py
|
| 693981 |
C4H6N2 |
1H-Imidazole, 2-methyl- |
InChI=1/C4H6N2/c1-4-5-2-3-6-4/h2-3H,1H3,(H,5,6) |
CC1=NC=CN1 |
 |
1H-Imidazole, 2-methyl-; 2-Methylimidazole; Imidazole, 2-methyl-; 2-methyl-1H-imidazole
|
| 6569513 |
B3N3H6 |
borazine |
InChI=1S/B3H6N3/c1-4-2-6-3-5-1/h1-6H |
B1NBNBN1 |
 |
s-Triazaborane; s-Triazatriborine, hexahydro-; Borazole; Borazyne, cyclic trimer; Triborinetriamine; 1,3,5,2,4,6-Triazatriborine, hexahydro-; 1,3,5,2,4,6-triazatriborinane
|
| 4426113 |
C5H7N |
Cyclobutanecarbonitrile |
InChI=1/C5H7N/c6-4-5-2-1-3-5/h5H,1-3H2 |
N#CC1CCC1 |
 |
Cyanocyclobutane; Cyclobutanecarbonitrile; Cyclobutyl cyanide
|
| 96548 |
C5H7N |
1H-Pyrrole, 1-methyl- |
InChI=1/C5H7N/c1-6-4-2-3-5-6/h2-5H,1H3 |
CN1C=CC=C1 |
 |
1-Methyl-1H-pyrrole; 1-Methylpyrrole; 1H-Pyrrole, 1-methyl-; N-Methylpyrrol; N-Methylpyrrole; Pyrrole, 1-methyl-
|
| 16529661 |
C5H7N |
(E)-3-Pentenenitrile |
InChI=1/C5H7N/c1-2-3-4-5-6/h2-3H,4H2,1H3/b3-2+ |
C/C=C/CC#N |
 |
(E)-3-Pentenenitrile; (E)-pent-3-enenitrile
|
| 25899507 |
C5H7N |
(Z)-2-Pentenenitrile |
InChI=1/C5H7N/c1-2-3-4-5-6/h3-4H,2H2,1H3/b4-3- |
CC/C=C\C#N |
 |
(Z)-2-Pentenenitrile; 2-Pentenenitrile, (Z)-; (Z)-pent-3-enenitrile
|
| 26294984 |
C5H7N |
(E)-2-Pentenenitrile |
InChI=1/C5H7N/c1-2-3-4-5-6/h3-4H,2H2,1H3/b4-3+ |
CC/C=C/C#N |
 |
(E)-2-Pentenenitrile; 2-Pentenenitrile, (E)-; (E)-pent-2-enenitrile
|
| 18936179 |
C5H9N |
Butanenitrile, 2-methyl- |
InChI=1/C5H9N/c1-3-5(2)4-6/h5H,3H2,1-2H3 |
CC[C@@H](C)C#N |
 |
2-Methylbutanenitrile; 2-Methylbutyronitrile; 2-Cyanobutane; Butanenitrile, 2-methyl-; Butyronitrile, 2-methyl-
|
| 110598 |
C5H9N |
Pentanenitrile |
InChI=1/C5H9N/c1-2-3-4-5-6/h2-4H2,1H3 |
CCCCC#N |
 |
1-Butyl cyanide; 1-Cyanobutane; Butane, 1-cyano-; Butyl cyanide; n-Valeronitrile; Pentanenitrile; Pentanonitrile; Valeronitrile
|
| 694053 |
C5H9N |
1,2,3,6-Tetrahydropyridine |
InChI=1/C5H9N/c1-2-4-6-5-3-1/h1-2,6H,3-5H2 |
C1CC=CCN1 |
 |
δ(sup 3)-Piperidine; δ3-Piperidine; 1,2,3,6-Tetrahydropyridine; 1,2,5,6-Tetrahydropyridine; Pyridine, 1,2,3,6-tetrahydro-; UN 2410; delta3-Piperidine; delta3-Piperidine
|
| 630182 |
C5H9N |
Propanenitrile, 2,2-dimethyl- |
InChI=1/C5H9N/c1-5(2,3)4-6/h1-3H3 |
CC(C)(C)C#N |
 |
2,2-Dimethylpropanenitrile; 2,2-Dimethylpropionitrile; 2-Cyano-2-methylpropane; Pivalonitrile; Propanenitrile, 2,2-dimethyl-; tert-Butylcyanide; tert-Butylnitrile; Trimethylacetonitrile
|
| 1003038 |
C5H11N |
Cyclopentanamine |
InChI=1/C5H11N/c6-5-3-1-2-4-5/h5H,1-4,6H2 |
NC1CCCC1 |
 |
Amino cyclopentane; Cyclopentanamine; Cyclopentylamine
|
| 110894 |
C5H11N |
Piperidine |
InChI=1/C5H11N/c1-2-4-6-5-3-1/h6H,1-5H2 |
N1CCCCC1 |
 |
Azacyclohexane; Cyclopentimine; Cypentil; Hexahydropyridine; Hexazane; Pentamethyleneimine; Pentamethylenimine; Perhydropyridine; Piperidin; Piperidine; Pyridine, hexahydro-; UN 2401
|
| 811938 |
C4H12N2 |
2-Methyl-1,2-propanediamine |
InChI=1/C4H12N2/c1-4(2,6)3-5/h3,5-6H2,1-2H3 |
CC(N)(C)CN |
 |
1,2-Diamino-2-methylpropane; 1,2-Propanediamine, 2-methyl-; 2-Methyl-1,2-propanediamine; Methyl-2 propanediamine-1,2; 2-methylpropane-1,2-diamine
|
| 4426486 |
C4H12N2 |
1,2-Butanediamine |
InChI=1/C4H12N2/c1-2-4(6)3-5/h4H,2-3,5-6H2,1H3 |
CC[C@@H](N)CN |
 |
1,2-Butanediamine; butane-1,2-diamine
|
| 9000208 |
C2O4-2 |
oxalate anion |
InChI=1S/C2H2O4/c3-1(4)2(5)6/h(H,3,4)(H,5,6)/p-2 |
O=C([O-])C([O-])=O |
 |
|
| 10544726 |
N2O4 |
Dinitrogen tetroxide |
InChI=1/N2O4/c3-1(4)2(5)6 |
O=N(N(=O)=O)=O |
 |
Dinitrogen tetraoxide; Dinitrogen tetroxide; NA 1067; Nitrogen dioxide, di-; Nitrogen oxide; Nitrogen oxide (N2O4); Nitrogen peroxide; Nitrogen tetroxide; UN 1067
|
| 144627 |
C2H2O4 |
Oxalic Acid |
InChI=1S/C2H2O4/c3-1(4)2(5)6/h(H,3,4)(H,5,6) |
OC(C(O)=O)=O |
 |
Ethanedioic acid; Oxiric acid; Acide oxalique; Acido ossalico; NCI-C55209; Ethane-1,2-dioic acid; oxalic acid
|
| 471476 |
C2H3NO3 |
Oxamic acid |
InChI=1/C2H3NO3/c3-1(4)2(5)6/h(H2,3,4)(H,5,6) |
NC(C(O)=O)=O |
 |
Acetic acid, aminooxo-; Formic acid, (aminocarbonyl)-; Formic acid, carbamoyl-; Glycine, 2-oxo-; Glyoxylic acid, amino-; OA; Oxalamic acid; Oxalic acid monoamide; Oxamate; Oxamate, (aminocarbonyl)-; Oxamic acid; Oxamidic acid; 2-amino-2-oxoacetic acid
|
| 471465 |
C2H4N2O2 |
Oxalamide |
InChI=1/C2H4N2O2/c3-1(5)2(4)6/h(H2,3,5)(H2,4,6) |
O=C(N)C(N)=O |
 |
Amid kyseliny stavelove; Ethanediamide; Formimidic acid, 1-carbamoyl-; Oxalamide; Oxalic acid diamide; Oxamid; Oxamide; Oxamimidic acid
|
| 674828 |
C4H4O2 |
2-Oxetanone, 4-methylene- |
InChI=1/C4H4O2/c1-3-2-4(5)6-3/h1-2H2 |
O=C(C1)OC1=C |
 |
2-Oxetanone, 4-methylene-; 3-Butenoic acid, 3-hydroxy-, β-lactone; 4-Methylene-2-oxetanone; Diketen; Diketene; Ethenone, dimer; Ketene dimer; Vinylaceto-β-lactone; 4-methyleneoxetan-2-one
|
| 625581 |
C2H5NO3 |
Nitric acid, ethyl ester |
InChI=1/C2H5NO3/c1-2-6-3(4)5/h2H2,1H3 |
O=[N+]([O-])OCC |
 |
Ethyl nitrate; Ethylester kyseliny dusicne; NA 1993; Nitric acid, ethyl ester; Nitric ether
|
| 5765446 |
C4H5NO |
Isoxazole, 5-methyl- |
InChI=1/C4H5NO/c1-4-2-3-5-6-4/h2-3H,1H3 |
CC1=CC=NO1 |
 |
5-Methylisoxazole; Isoxazole, 5-methyl-; NSC 52269
|
| 30842901 |
C4H5NO |
3-Methylisoxazole |
InChI=1/C4H5NO/c1-4-2-3-6-5-4/h2-3H,1H3 |
CC1=NOC=C1 |
 |
3-Methylisoxazole; Isoxazole, 3-methyl-
|
| 37765154 |
C2H6N2O2 |
(E)-Azodioxymethane |
InChI=1/C2H6N2O2/c1-3(5)4(2)6/h1-2H3/b4-3+ |
CN(=N(C)=O)=O |
 |
(E)-(CH3NO)2; Diazene, dimethyl-, 1,2-dioxide, (E)-; (E)-1,2-dimethyldiazene 1,2-dioxide
|
| 4164287 |
C2H6N2O2 |
Dimethylnitroamine |
InChI=1/C2H6N2O2/c1-3(2)4(5)6/h1-2H3 |
O=[N+]([O-])N(C)C |
 |
Dimethylamine, N-nitro-; Dimethylnitramin; Dimethylnitramine; Methanamine, N-methyl-N-nitro-; Dmnm; DMNO; Methanamine, N-methyl-N-nitro-; N,N-Dimethylnitramine; N-Nitrodimethylamine; N-Nitro-dma; s-N,N-Dimethyl nitramine; N,N-dimethylnitramide
|
| 431038 |
C4H6O2 |
2,3-Butanedione |
InChI=1/C4H6O2/c1-3(5)4(2)6/h1-2H3 |
CC(C(C)=O)=O |
 |
2,3-Butadione; 2,3-Butanedione; 2,3-Diketobutane; 2,3-Dioxobutane; Biacetyl; Butadione; Butane-2,3-dione; Butanedione; Diacetyl; Dimethyl diketone; Dimethyl glyoxal; Glyoxal, dimethyl-; UN 2346
|
| 110883 |
C3H6O3 |
1,3,5-Trioxane |
InChI=1/C3H6O3/c1-4-2-6-3-5-1/h1-3H2 |
O1COCOC1 |
 |
1,3,5-Trioxacyclohexane; 1,3,5-Trioxan; 1,3,5-Trioxane; Aldeform; Formagene; Formaldehyde, trimer; Marvosan; Metaformaldehyde; Paraform; Paraformal; Paraformaldehyde; Polymerized formaldehyde; Polyoxymethylene; s-Trioxan; s-Trioxane; s-Trixane; sym-Trioxane; Trioxan; Triformol; Trioxymethylen; Trioxymethyleen; Trioxymethylene; Trioxane; Triossimetilene; Trioxin
|
| 96333 |
C4H6O2 |
2-Propenoic acid, methyl ester |
InChI=1/C4H6O2/c1-3-4(5)6-2/h3H,1H2,2H3 |
C=CC(OC)=O |
 |
2-Propenoic acid, methyl ester; Acrylate de methyle; Acrylic acid methyl ester; Acrylsaeuremethylester; Curithane 103; Methoxycarbonylethylene; Methyl 2-propenoate; Methyl acrylate; Methyl acrylate, inhibited; Methyl ester of 2-propenoic acid; Methyl prop-2-enoate; Methyl propenate; Methyl propenoate; Methylacrylaat; Methyl-acrylat; Methylester kyseliny akrylove; Metilacrilato; UN 1919
|
| 96480 |
C4H6O2 |
γ–Butyrolactone |
InChI=1/C4H6O2/c5-4-2-1-3-6-4/h1-3H2 |
O=C1OCCC1 |
 |
1,4-Butanolide; 1,4-Butyrolactone; 1-Oxacyclopentan-2-one; 2(3H)-Furanone, dihydro-; α-Butyrolactone; γ-6480; γ-BL; γ-Butanolactone; γ-Butyrolactone; γ-Hydroxybutyric Acid cyclic ester; γ-Hydroxybutyric acid lactone; γ-Hydroxybutyrolactone; 1,2-Butanolide; 6480; 2-Oxolanone; 2-Oxotetrahydrofuran; 4-Butanolide; 4-Butyrolactone; 4-Deoxytetronic acid; 4-Hydroxybutanoic acid lactone; 4-Hydroxybutanoic acid, γ-lactone; 4-Hydroxybutyric acid lactone; 4-Hydroxybutyric acid, γ-lactone; BLO; BLON; Butanoic acid, 4-hydroxy-, γ-lactone; Butyric acid lactone; Butyric acid, 4-hydroxy-, γ-lactone; Butyrolactone; Butyryl lactone; Butyrylactone; Dehydro-2(3H)-furanone; Dihydro-2(3H)-furanone; Dihydro-2-furanone; NCI-C55878; Tetrahydro-2-furanone; alpha-Butyrolactone; gamma-6480; gamma-BL; gamma-Butanolactone; gamma-Butyrolactone; gamma-Hydroxybutyric Acid cyclic ester; gamma-Hydroxybutyric acid lactone; gamma-Hydroxybutyrolactone; dihydrofuran-2(3H)-one
|
| 79390 |
C4H7NO |
Methacrylamide |
InChI=1/C4H7NO/c1-3(2)4(5)6/h1H2,2H3,(H2,5,6) |
CC(C(N)=O)=C |
 |
α-Methyl acrylic amide; 2-Methylacrylamide; 2-Methylpropenamide; 2-Propenamide, 2-methyl-; Amid kyseliny methakrylove; Methacryamide; Methacrylamide; Methacrylic acid amide; Methacrylic amide; Methylacrylic amide; Mhoromer bm801; USAF rh-1; alpha-Methyl acrylic amide
|
| 107959 |
NH2CH2CH2COOH |
β–alanine |
InChI=1/C3H7NO2/c4-2-1-3(5)6/h1-2,4H2,(H,5,6) |
OC(CCN)=O |
 |
β-Alanine; β-Aminopropionic acid; ω-Aminopropionic acid; 3-Aminopropanoic acid; 3-Aminopropionic acid; Abufene; ALANINE, β; b-Alanine; Propanoic acid, 3-amino-; beta-Alanine; beta-Aminopropionic acid; omega-Aminopropionic acid
|
| 107971 |
CH3NHCH2COOH |
Sarcosine |
InChI=1/C3H7NO2/c1-4-2-3(5)6/h4H,2H2,1H3,(H,5,6) |
CNCC(O)=O |
 |
(Methylamino)ethanoic acid; Acetic acid, (methylamino)-; Glycine, N-methyl-; Methylaminoacetic acid; Methylglycine; N-Methylaminoacetic acid; N-Methylglycine; Sarcosin; Sarcosine; Sarcosinic acid; 2-(methylamino)acetic acid
|
| 56417 |
CH3CH(NH2)COOH |
Alanine |
InChI=1/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/t2-/m0/s1 |
CC(N)C(O)=O |
 |
α-Alanine; α-Aminopropionic acid; (S)-2-Aminopropanoic acid; (S)-Alanine; Alanine; Alanine, L-; L-(+)-Alanine; L-α-Alanine; L-α-Aminopropionic acid; L-2-Aminopropanoic acid; L-2-Aminopropionic acid; L-Alanine; L-CH3CH(NH2)COOH; Propanoic acid, 2-amino-; Propanoic acid, 2-amino-, (S)-; Ala; alpha-Alanine; alpha-Aminopropionic acid; 2-aminopropanoic acid
|
| 51796 |
NH2COOC2H5 |
Urethane |
InChI=1/C3H7NO2/c1-2-6-3(4)5/h2H2,1H3,(H2,4,5) |
CCOC(N)=O |
 |
A 11032; Aethylcarbamat; Aethylurethan; Carbamic acid, ethyl ester; Carbamidsaeure-aethylester; Estane 5703; Ethyl carbamate; Ethyl ester of carbamic acid; Ethyl urethan; Ethyl urethane; Ethylester kyseliny karbaminove; Leucethane; Leucothane; NSC 746; O-Ethylurethane; Pracarbamin; Pracarbamine; Rcra waste number U238; U-Compound; Uretan; Urethane; X 41; Uretan etylowy; Urethan
|
| 135 |
HCONH2CN2H4 |
formamide aminomethanimine dimer |
InChI=1/C2H7N3O/c1-3-7-5-2-6-8-4-1/h1-5H/b3-1- |
NC=N.NC=O |
 |
|
| 543679 |
C3H7ONO |
Propyl nitrite |
InChI=1/C3H7NO2/c1-2-3-6-4-5/h2-3H2,1H3 |
O=NOCCC |
 |
n-C3H7ONO; Nitrous acid, n-propyl ester; Nitrous acid, propyl ester; n-Propyl nitrite; Propanol nitrite; Propyl nitrite
|
| 541424 |
CH3CH(CH3)ONO |
Iso-propyl nitrite |
InChI=1/C3H7NO2/c1-3(2)6-4-5/h3H,1-2H3 |
O=NOC(C)C |
 |
2-Propanol nitrite; i-C3H7ONO; iso-Propyl nitrite; Isopropylester kyseliny dusite; Nitrous acid, 1-methylethyl ester; Nitrous acid, isopropyl ester; isopropyl nitrite
|
| 616455 |
C4H7NO |
2-Pyrrolidinone |
InChI=1/C4H7NO/c6-4-2-1-3-5-4/h1-3H2,(H,5,6) |
O=C1NCCC1 |
 |
α-Pyrrolidinone; α-Pyrrolidone; γ-aminobutyric acid lactam; γ-Aminobutyric lactam; γ-Aminobutyrolactam; γ-Butyrolactam; 2-Oxopyrrolidine; 2-Oxypyrrolidine; 2-Pyrol; 2-Pyrol4-aminobutyric acid lactam; 2-Pyrrolidine; 2-Pyrrolidinone; 2-Pyrrolidone; 4-Aminobutyric acid lactam; Butanoic acid, 4-amino-; Butanoic acid, 4-amino-, lactam; Butyrolactam; Lactam; LAM; Pyrrolidon; Pyrrolidone; alpha-Pyrrolidinone; alpha-Pyrrolidone; gamma-aminobutyric acid lactam; gamma-Aminobutyric lactam; gamma-Aminobutyrolactam; gamma-Butyrolactam; pyrrolidin-2-one
|
| 1120645 |
C4H7NO |
Oxazole, 4,5-dihydro-2-methyl- |
InChI=1/C4H7NO/c1-4-5-2-3-6-4/h2-3H2,1H3 |
CC1=NCCO1 |
 |
2-Methyl-2-oxazoline; 2-Methyloxazoline; 2-Oxazoline, 2-methyl-; Oxazole, 4,5-dihydro-2-methyl-; 2-methyl-4,5-dihydrooxazole
|
| 62957602 |
C4H7NO |
Ethoxyacetonitrile |
InChI=1/C4H7NO/c1-2-6-4-3-5/h2,4H2,1H3 |
N#CCOCC |
 |
|
| 922690 |
C4H8O2 |
Ethene, 1,1-dimethoxy- |
InChI=1/C4H8O2/c1-4(5-2)6-3/h1H2,2-3H3 |
C=C(OC)OC |
 |
Ethene, 1,1-dimethoxy-; 1,1-dimethoxyethene
|
| 625525 |
NH2CONHC2H5 |
Urea, ethyl- |
InChI=1/C3H8N2O/c1-2-5-3(4)6/h2H2,1H3,(H3,4,5,6) |
O=C(N)NCC |
 |
1-Ethylurea; Ethylurea; N-Ethylurea; Urea, 1-ethyl-; Urea, ethyl-
|
| 765435 |
C5H8O |
Methyl cyclopropyl ketone |
InChI=1/C5H8O/c1-4(6)5-2-3-5/h5H,2-3H2,1H3 |
O=C(C)C1CC1 |
 |
1-Cyclopropylethanone; Acetylcyclopropane; Cyclopropyl methyl ketone; Cyclopropylethanone; Ethanone, 1-cyclopropyl-; Ketone, cyclopropyl methyl; Methyl cyclopropyl ketone
|
| 1487156 |
C5H8O |
Furan, 2,3-dihydro-5-methyl- |
InChI=1/C5H8O/c1-5-3-2-4-6-5/h3H,2,4H2,1H3 |
CC1=CCCO1 |
 |
2-Methyl-4,5-dihydrofuran; 2,3-Dihydro-5-methylfuran; 4,5-Dihydro-2-methylfuran; 4,5-Dihydrosylvan; 5-Methyl-2,3-dihydrofuran; Furan, 2,3-dihydro-5-methyl-
|
| 598947 |
N(CH3)2CONH2 |
Urea, N,N-dimethyl- |
InChI=1/C3H8N2O/c1-5(2)3(4)6/h1-2H3,(H2,4,6) |
O=C(N)N(C)C |
 |
1,1-Dimethylurea; 1,1-Dimethyurea; Asym-Dimethylurea; N,N-Dimethylurea; Urea, 1,1-dimethyl-; Urea, N,N-dimethyl-
|
| 505226 |
C4H8O2 |
1,3-Dioxane |
InChI=1/C4H8O2/c1-2-5-4-6-3-1/h1-4H2 |
O1COCCC1 |
 |
1,3-Dioxacyclohexane; 1,3-Dioxane; 1,3-Propanediol formal; m-Dioxane; m-Dioxin, dihydro-
|
| 497267 |
C4H8O2 |
1,3-Dioxolane, 2-methyl- |
InChI=1/C4H8O2/c1-4-5-2-3-6-4/h4H,2-3H2,1H3 |
CC1OCCO1 |
 |
1,3-Dioxolane, 2-methyl-; 2-Methyl-1,3-dioxacyclopentane; 2-Methyl-1,3-dioxolane; 2-Methyldioxolane; 2-Methyldioxole; Methyldioxolane
|
| 56815 |
C3H8O3 |
1,2,3-Propanetriol |
InChI=1/C3H8O3/c4-1-3(6)2-5/h3-6H,1-2H2 |
OCC(O)CO |
 |
1,2,3-Propanetriol; 1,2,3-Trihydroxypropane; 90 Technical glycerin; 90 Technical glycerine; Clyzerin, wasserfrei; Dagralax; Glycerin; Glycerin, anhydrous; Glycerin, synthetic; Glycerine; Glyceritol; Glycerol; Glycyl alcohol; Glyrol; Glysanin; Grocolene; Moon; Ophthalgan; Optim; Osmoglyn; Propanetriol; Star; Superol; Synthetic glycerin; Synthetic glycerine; Vitrosupos; Trihydroxypropane; propane-1,2,3-triol
|
| 96311 |
NH(CH3)CONH(CH3) |
Urea, N,N'-dimethyl- |
InChI=1/C3H8N2O/c1-4-3(6)5-2/h1-2H3,(H2,4,5,6) |
O=C(NC)NC |
 |
1,3-Dimethylurea; 1,1'-Dimethylurea; DMU; N,N'-Dimethylharnstoff; N,N'-Dimethylurea; sym-Dimethylurea; Symmetric dimethylurea; Urea, N,N'-dimethyl-; Urea, 1,3-dimethyl-
|
| 120923 |
C5H8O |
Cyclopentanone |
InChI=1/C5H8O/c6-5-3-1-2-4-5/h1-4H2 |
O=C1CCCC1 |
 |
Adipic ketone; Adipinketon; Cyclopentanone; Dumasin; Ketocyclopentane; Ketopentamethylene; UN 2245
|
| 123911 |
C4H8O2 |
1,4-Dioxane |
InChI=1/C4H8O2/c1-2-6-4-3-5-1/h1-4H2 |
O1CCOCC1 |
 |
1,4-Diethylene dioxide; 1,4-Dioxacyclohexane; 1,4-Dioxan; 1,4-Dioxane; 1,4-Dioxin, tetrahydro-; Di(ethylene oxide); Diethylene dioxide; Diethylene ether; Diokan; Dioksan; Diossano-1,4; Dioxaan-1,4; Dioxan; Dioxan-1,4; Dioxane; Dioxane-1,4; Dioxanne; Dioxyethylene ether; Glycol ethylene ether; NCI-C03689; p-Dioxan; p-Dioxane; p-Dioxin, tetrahydro-; Rcra waste number U108; Tetrahydro-1,4-dioxin; Tetrahydro-p-dioxin; UN 1165; 1,4Dioxane
|
| 141786 |
C4H8O2 |
Ethyl acetate |
InChI=1/C4H8O2/c1-3-6-4(2)5/h3H2,1-2H3 |
CC(OCC)=O |
 |
Acetic acid, ethyl ester; Acetic ester; Acetic ether; Acetidin; Acetoxyethane; Aethylacetat; Essigester; Ethyl Acetate; Ethyl acetic ester; Ethyl ester of acetic acid; Ethyl ethanoate; Ethylacetaat; Ethyle; Ethyle(acetate d'); Ethylester kyseliny octove; Etile; Etile(acetato di); Octan etylu; Rcra waste number U112; UN 1173; Vinegar naphtha
|
| 110872 |
C5H8O |
2H-Pyran, 3,4-dihydro- |
InChI=1/C5H8O/c1-2-4-6-5-3-1/h2,4H,1,3,5H2 |
C1CCC=CO1 |
 |
2,3-Dihydro-4H-pyran; δ(Sup2)-Dihydropyran; δ2-Dihydropyran; 2H-3,4-Dihydropyran; 2H-Pyran, 3,4-dihydro-; 2,3-Dihydropyran; 3,4-Dihdro-2H-pyrane; 3,4-Dihydro-1H-pyran; 3,4-Dihydro-2H-pyran; 3,4-Dihydro-2-pyran; 3,4-Dihydropyran; 5,6-Dihydro-4H-pyran; Dihydropyran; Pyran, dihydro-; delta 2-Dihydropyran; delta2-Dihydropyran
|
| 541355 |
C4H9NO |
Butanamide |
InChI=1/C4H9NO/c1-2-3-4(5)6/h2-3H2,1H3,(H2,5,6) |
CCCC(N)=O |
 |
Butanamide; Butanimidic acid; Butyramide; n-Butylamide; n-Butyramide; n-C3H7C(O)NH2
|
| 563837 |
C4H9NO |
Propanamide, 2-methyl- |
InChI=1/C4H9NO/c1-3(2)4(5)6/h3H,1-2H3,(H2,5,6) |
CC(C)C(N)=O |
 |
2-Methylpropanamide; 2-Methylpropionamide; Isobutylamide; Isobutyramide; Isobutyrimidic acid; Isopropylformamide; Propanamide, 2-methyl-
|
| 563804 |
C5H10O |
2-Butanone, 3-methyl- |
InChI=1/C5H10O/c1-4(2)5(3)6/h4H,1-3H3 |
CC(C(C)C)=O |
 |
2-Acetylpropane; 2-Butanone, 3-methyl-; 3-Methyl-2-butanone; 3-Methylbutan-2-one; iso-C3H7COCH3; Isopropyl methyl ketone; Ketone, isopropyl methyl; Methyl butanone-2; Methyl isopropyl ketone; Methyl propyl ketone; Methylbutanone; Mipk; UN 2397
|
| 534156 |
C4H10O2 |
1,1-Dimethoxyethane |
InChI=1/C4H10O2/c1-4(5-2)6-3/h4H,1-3H3 |
CC(OC)OC |
 |
1,1-Dimethoxyethane; 1,1'-Dimethoxyetiane; Acetaldehyde, dimethyl acetal; Dimethyl acetal; Dimethyl aldehyde; Ethane, 1,1-dimethoxy-; Ethylidene dimethyl ether; Methyl formyl; UN 2377
|
| 110714 |
C4H10O2 |
Ethane, 1,2-dimethoxy- |
InChI=1/C4H10O2/c1-5-3-4-6-2/h3-4H2,1-2H3 |
COCCOC |
 |
α,β-Dimethoxyethane; 1,2-Dimethoxyethane; 1,2-Ethanediol dimethyl ether; 2,5-Dioxahexane; Dimethoxyethane; Dimethyl cellosolve; Dimethyl cellosolve monoglyme; Egdme; Ethane, 1,2-dimethoxy-; Ethylene dimethyl ether; Ethylene glycol dimethyl ether; Glycol dimethyl ether; Glyme; Monoethylene glycol dimethyl ether; Monoglyme; UN 2252; alpha,beta-Dimethoxyethane
|
| 110623 |
C5H10O |
Pentanal |
InChI=1/C5H10O/c1-2-3-4-5-6/h5H,2-4H2,1H3 |
CCCCC=O |
 |
Valeraldehyde; n-Pentanal; n-Valeraldehyde; Valeral; Valerianic aldehyde; Valeric acid aldehyde; Valeric aldehyde; Valeryl aldehyde; Amyl aldehyde; Butyl formal; UN 2058; n-Valeric aldehyde; 1-pentanal; pentan-1-al; pentanal
|
| 110634 |
C4H10O2 |
1,4-Butanediol |
InChI=1/C4H10O2/c5-3-1-2-4-6/h5-6H,1-4H2 |
OCCCCO |
 |
1,4-BD; 1,4-Butanediol; 1,4-Butylene glycol; 1,4-Dihydroxybutane; 1,4-Tetramethylene glycol; Butane-1,4-diol; Butanediol; Diol 14B; Sucol B; Tetramethylene 1,4-diol; Tetramethylene glycol
|
| 142687 |
C5H10O |
2H-Pyran, tetrahydro- |
InChI=1/C5H10O/c1-2-4-6-5-3-1/h1-5H2 |
C1CCCCO1 |
 |
2H-Pyran, tetrahydro-; Oxacyclohexane; Oxane; Pentamethylene oxide; Tetrahydro-2H-pyran; Tetrahydropyran; THP
|
| 96220 |
C5H10O |
3-Pentanone |
InChI=1/C5H10O/c1-3-5(6)4-2/h3-4H2,1-2H3 |
CCC(CC)=O |
 |
3-Pentanone; DEK; Diethyl ketone; Diethylcetone; Dimethylacetone; Ethyl Ketone; Ethyl propionyl; Metacetone; Methacetone; Pentan-3-one; Pentanone-3; Propione; UN 1156
|
| 96413 |
C5H10O |
Cyclopentanol |
InChI=1/C5H10O/c6-5-3-1-2-4-5/h5-6H,1-4H2 |
OC1CCCC1 |
 |
Cyclopentanol; Cyclopentyl alcohol; Hydroxycyclopentane; UN 2244
|
| 107879 |
C5H10O |
2-Pentanone |
InChI=1/C5H10O/c1-3-4-5(2)6/h3-4H2,1-2H3 |
CC(CCC)=O |
 |
2-Pentanone; Ethyl acetone; Methyl n-propyl ketone; Methyl propyl ketone; Metylopropyloketon; MPK; n-C3H7COCH3; Pentan-2-one; Propyl methyl ketone; UN 1249; pentan-2-one
|
| 107880 |
C4H10O2 |
1,3-Butanediol |
InChI=1/C4H10O2/c1-4(6)2-3-5/h4-6H,2-3H2,1H3 |
C[C@@H](O)CCO |
 |
1,3-Butandiol; 1,3-Butanediol; 1,3-Butylene glycol; 1,3-Butylenglykol; 1,3-Dihydroxybutane; 1-Methyl-1,3-propanediol; β-Butylene glycol; Butane-1,3-diol; Methyltrimethylene glycol; beta-Butylene glycol
|
| 6921353 |
C5H10O |
Oxetane, 3,3-dimethyl- |
InChI=1/C5H10O/c1-5(2)3-6-4-5/h3-4H2,1-2H3 |
CC1(C)COC1 |
 |
1,3-Epoxy-2,2-dimethylpropane; β,β-Dimethyltrimethylene oxide; 3,3-Dimethyloxetane; 3,3-Dimethyltrimethylene oxide; Oxetane, 3,3-dimethyl-; Propane, 1,3-epoxy-2,2-dimethyl-; beta,beta-Dimethyltrimethylene oxide
|
| 3710847 |
C4H11NO |
Diethylhydroxylamine |
InChI=1/C4H11NO/c1-3-5(6)4-2/h6H,3-4H2,1-2H3 |
ON(CC)CC |
 |
DEHA; Diethylhydroxylamine; Ethanamine, N-ethyl-N-hydroxy-; Hydroxylamine, N,N-diethyl-; N,N-Diethylhydroxyamine; N,N-Diethylhydroxylamine; N-Hydroxydiethylamine
|
| 6032297 |
C5H12O |
2-Pentanol |
InChI=1/C5H12O/c1-3-4-5(2)6/h5-6H,3-4H2,1-2H3 |
C[C@H](O)CCC |
 |
1-Methyl-1-Butanol; 1-Methylbutanol; 2-Pentanol; 2-Pentyl alcohol; Isoamyl alcohol, secondary; Methylpropylcarbinol; n-C3H7CH(OH)CH3; Pentan-2-ol; Pentanol-2; sec-Amyl Alcohol; sec-n-Amyl alcohol; sec-Pentanol; sec-Pentyl alcohol; UN 1105
|
| 137326 |
C5H12O |
1-Butanol, 2-methyl- |
InChI=1/C5H12O/c1-3-5(2)4-6/h5-6H,3-4H2,1-2H3 |
CC[C@@H](C)CO |
 |
1-Butanol, 2-methyl-; 2-Methyl butanol-1; 2-Methyl-1-butanol; 2-Methylbutanol; 2-Methylbutyl alcohol; 2-Methyl-n-butanol; Active Amyl alcohol; Active primary amyl alcohol; Amyl alcohol; dl-2-Methyl-1-butanol; dl-sec-Butyl carbinol; L-2-Methyl-1-butanol; Primary active amyl alcohol; sec-Butylcarbinol; 2-methylbutan-1-ol
|
| 123513 |
C5H12O |
1-Butanol, 3-methyl- |
InChI=1/C5H12O/c1-5(2)3-4-6/h5-6H,3-4H2,1-2H3 |
CC(C)CCO |
 |
1-Butanol, 3-methyl-; 2-Methyl-4-butanol; 3-Methyl-1-butanol; 3-Methylbutan-1-ol; 3-Methylbutanol; 3-Metil-butanolo; Alcool amilico; Alcool isoamylique; Amylowy alkohol; Fermentation amyl alcohol; Fusel Oil; Fuseloel; Huile de fusel; Isoamyl alcohol; Isoamyl alcohol, primary; iso-amylalkohol; Isoamylol; Isobutyl carbinol; Isopentanol; Isopentyl alcohol; UN 1105
|
| 71410 |
C5H12O |
1-Pentanol |
InChI=1/C5H12O/c1-2-3-4-5-6/h6H,2-5H2,1H3 |
CCCCCO |
 |
1-Pentanol; 1-Pentyl alcohol; Alcool amylique; Amyl alcohol; Amyl alcohol, n-; Amyl alcohol, normal; Amylol; n-Amyl alcohol; n-Amylalkohol; n-Butylcarbinol; n-C5H11OH; n-Pentan-1-ol; n-Pentanol; n-Pentyl alcohol; Pentan-1-ol; Pentanol; Pentanol-1; Pentasol; Pentyl alcohol; Primary amyl alcohol; UN 1105
|
| 584021 |
C5H12O |
3-Pentanol |
InChI=1/C5H12O/c1-3-5(6)4-2/h5-6H,3-4H2,1-2H3 |
CCC(O)CC |
 |
Diethyl carbinol; 3-Pentyl alcohol; Pentan-3-ol; sec-Amyl alcohol; Pentanol-3; UN 2706
|
| 598754 |
C5H12O |
2-Butanol, 3-methyl- |
InChI=1/C5H12O/c1-4(2)5(3)6/h4-6H,1-3H3 |
C[C@H](O)C(C)C |
 |
2-Butanol, 3-methyl-; (+)-3-Methyl-2-butanol; 3-Methyl-2-butanol; Butan-2-ol, 3-methyl-; Methylisopropylcarbinol; sec-Isoamyl Alcohol; 3-methylbutan-2-ol
|
| 1634044 |
C5H12O |
Propane, 2-methoxy-2-methyl- |
InChI=1/C5H12O/c1-5(2,3)6-4/h1-4H3 |
CC(C)(OC)C |
 |
2-Methoxy-2-methylpropane; 2-Methyl-2-methoxypropane; Ether, tert-butyl methyl; Methyl 1,1-dimethylethyl ether; Methyl t-butyl ether; Methyl tert-butyl ether; MTBE; Propane, 2-methoxy-2-methyl-; tert-Butyl methyl ether; tert-C4H9OCH3; UN 2398; ether
|
| 628284 |
C5H12O |
Butane, 1-methoxy- |
InChI=1/C5H12O/c1-3-4-5-6-2/h3-5H2,1-2H3 |
CCCCOC |
 |
1-Methoxybutane; α-Methoxybutane; Butane, 1-methoxy-; Butyl methyl ether; Ether, butyl methyl; Methyl butyl ether; Methyl n-butyl ether; n-Butyl methyl ether; n-C4H9OCH3; UN 2350; ether; alpha-Methoxybutane
|
| 628320 |
C5H12O |
Propane, 1-ethoxy- |
InChI=1/C5H12O/c1-3-5-6-4-2/h3-5H2,1-2H3 |
CCCOCC |
 |
1-Ethoxypropane; Ether, ethyl propyl; Ethyl n-propyl ether; Ethyl propyl ether; n-C3H7OC2H5; Propane, 1-ethoxy-; Propyl ethyl ether; UN 2615; ether
|
| 373911 |
CF3OF |
Trifluoromethylhypofluorite |
InChI=1S/CF4O/c2-1(3,4)6-5 |
FOC(F)(F)F |
 |
Hypofluorous acid, trifluoromethyl ester; perfluoromethanol; trifluoromethyl hypofluorite
|
| 353855 |
CF3CN |
Acetonitrile, trifluoro- |
InChI=1/C2F3N/c3-2(4,5)1-6 |
N#CC(F)(F)F |
 |
Acetonitrile, trifluoro-; Cyanotrifluoromethane; Trifluoroacetonitrile; 2,2,2-trifluoroacetonitrile
|
| 116143 |
C2F4 |
Tetrafluoroethylene |
InChI=1/C2F4/c3-1(4)2(5)6 |
FC(F)=C(F)F |
 |
1,1,2,2-Tetrafluoroethylene; Ethene, tetrafluoro-; Ethylene, tetrafluoro-; Fluoroplast 4; Perfluoroethene; Perfluoroethylene; Tetrafluorethylene; Tetrafluoroethene; Ethane, tetrafluoro-; Tetrafluoroethylene, inhibited; TFE; UN 1081
|
| 13965736 |
B2F4 |
Diboron tetrafluoride |
InChI=1/B2F4/c3-1(4)2(5)6 |
FB(F)B(F)F |
 |
Diboron tetrafluoride; Difluoroborane; perfluorodiborane
|
| 75901 |
CF3CHO |
trifluoroacetaldehyde |
InChI=1S/C2HF3O/c3-2(4,5)1-6/h1H |
O=CC(F)(F)F |
 |
|
| 811972 |
CF3CH2F |
1,1,1,2-tetrafluoroethane |
InChI=1S/C2H2F4/c3-1-2(4,5)6/h1H2 |
FCC(F)(F)F |
 |
|
| 7647190 |
PF5 |
Phosphorus pentafluoride |
InChI=1/F5P/c1-6(2,3,4)5 |
FP(F)(F)(F)F |
 |
Phosphorane, pentafluoro-; Phosphorus fluoride; Phosphorus pentafluoride; Phosphorus(V) fluoride; UN 2198; pentafluorophosphorane
|
| 7285327 |
C3H4O2S |
2H-Thiete-1,1-dioxide |
InChI=1/C3H4O2S/c4-6(5)2-1-3-6/h1-2H,3H2 |
O=S1(CC=C1)=O |
 |
2H-Thiete-1,1-dioxide; Thiete 1,1-dioxide; Thiete sulfone
|
| 822388 |
C3H4S3 |
1,3-Dithiolane-2-thione |
InChI=1/C3H4S3/c4-3-5-1-2-6-3/h1-2H2 |
S=C1SCCS1 |
 |
1,3-Dithiacyclopentane-2-thial; 1,3-Dithiolan-2-thione; 1,3-Dithiolane-2-thione; Carbonic acid, trithio-, cyclic ethylene ester; Cyclic ethylene trithiocarbonate; Cylic ethylene trithiocarbonate; Ethylene trithiocarbonate; Trithiocarbonic acid, cyclic ethylene ester
|
| 79403 |
C2H4N2S2 |
Ethanedithioamide |
InChI=1/C2H4N2S2/c3-1(5)2(4)6/h(H2,3,5)(H2,4,6) |
S=C(N)C(N)=S |
 |
Dithiooxamide; Dithioxamide; Ethanedithioamide; Hydrorubeanic acid; Oxaldiimidic acid, dithio-; Oxamide, dithio-; Rubean; Rubeane; Rubeanic acid; RVK; USAF B-43; USAF ek-4394; USAF mk-6; ethanebis(thioamide)
|
| 693958 |
C4H5NS |
4-Methylthiazole |
InChI=1/C4H5NS/c1-4-2-6-3-5-4/h2-3H,1H3 |
CC1=CSC=N1 |
 |
4-Methylthiazole; Thiazole, 4-methyl-
|
| 1003049 |
C4H6OS |
Dihydro-3-(2H)-thiophenone |
InChI=1/C4H6OS/c5-4-1-2-6-3-4/h1-3H2 |
O=C1CSCC1 |
 |
3(2H)-Thiophenone, dihydro-; 3-Oxo-2,3,4,5-tetrahydrothiophene; 3-Oxotetrahydrothiophene; 3-Thiacyclopentanone; 3-Thiophanone; 4,5-Dihydro-3(2H)-thiophenone; Dihydro-3-(2H)-thiophenone; Tetrahydrothiophen-3-one; Tetrahydrothiophene-3-one; dihydrothiophen-3(2H)-one
|
| 1003107 |
C4H6OS |
Dihydro-2-(3H)-thiophenone |
InChI=1/C4H6OS/c5-4-2-1-3-6-4/h1-3H2 |
O=C1CCCS1 |
 |
2(3H)-Thiophenone, dihydro-; γ-Thiobutyrolactone; 2-Oxothiolane; 2-Thiophenone, tetrahydro-; 4,5-Dihydro-3(2H)-thiophenone; 4-Butyrothiolactone; 4-Thiobutyrolactone; Dihydro-2-(3H)-thiophenone; Tetrahydro-2-thiophenone; Thiacyclopentan-2-one; Thiacyclopentanone-2; Thiolan-2-one; gamma-Thiobutyrolactone; dihydrothiophen-2(3H)-one
|
| 1115157 |
C4H6OS |
Vinyl sulfoxide |
InChI=1/C4H6OS/c1-3-6(5)4-2/h3-4H,1-2H2 |
O=S(C=C)C=C |
 |
Divinyl sulfoxide; Ethene, 1,1-sulfinylbis-; TL 907; Vinyl sulfoxide; (vinylsulfinyl)ethene
|
| 616422 |
C2H6O3S |
Sulfurous acid, dimethyl ester |
InChI=1/C2H6O3S/c1-4-6(3)5-2/h1-2H3 |
O=S(OC)OC |
 |
Dimethoxy sulfoxide; Dimethyl ester of sulfurous acid; Dimethyl sulfite; Dimethyl sulphite; Methyl sulfite; Sulfurous acid, dimethyl ester; Sulphurous acid dimethyl ester
|
| 616444 |
C5H6S |
Thiophene, 3-methyl- |
InChI=1/C5H6S/c1-5-2-3-6-4-5/h2-4H,1H3 |
CC1=CSC=C1 |
 |
3-Methylthiophene; 3-Thiotolene; Methyl-3-thiophene; Thiophene, 3-methyl-
|
| 554143 |
C5H6S |
Thiophene, 2-methyl- |
InChI=1/C5H6S/c1-5-3-2-4-6-5/h2-4H,1H3 |
CC1=CC=CS1 |
 |
2-Methylthiophene; Thiophene, 2-methyl-
|
| 2314489 |
C3H6S3 |
Carbonotrithioic acid, dimethyl ester |
InChI=1/C3H6S3/c1-5-3(4)6-2/h1-2H3 |
S=C(SC)SC |
 |
Carbonic acid, trithio-, dimethyl ester; Carbonotrithioic acid, dimethyl ester; Dimethyl trithiocarbonate; Dimethylester kyseliny trithiouhlicite; Trithiocarbonic acid dimethyl ester; dimethyl carbonotrithioate
|
| 2231574 |
CH6N4S |
Carbonothioic dihydrazide |
InChI=1/CH6N4S/c2-4-1(6)5-3/h2-3H2,(H2,4,5,6) |
NNC(NN)=S |
 |
1,3-Diamino-2-Thiourea; Carbohydrazide, thio-; Carbonothioic dihydrazide; Hydrazinecarbohydrazonothioic acid; TCH; Thiocarbazide; Thiocarbohydrazide; Thiocarbonic dihydrazide; Thiocarbonohydrazide; USAF ek-7372; dihydrazinylmethanethial
|
| 9000082 |
C4H6OS |
4,5-dihydrothiophene-3-ol |
InChI=1/C4H6OS/c5-4-1-2-6-3-4/h3,5H,1-2H2 |
OC1=CSCC1 |
 |
3-hydroxy,2,3-dihydrothiophene; 4,5-dihydrothiophen-3-ol
|
| 9000093 |
C4H6OS |
2,5-dihydrothiophene-3-ol |
InChI=1/C4H6OS/c5-4-1-2-6-3-4/h1,5H,2-3H2 |
OC1=CCSC1 |
 |
|
| 9000106 |
C4H6OS |
4,5-dihydrothiophene-2-ol |
InChI=1/C4H6OS/c5-4-2-1-3-6-4/h2,5H,1,3H2 |
OC1=CCCS1 |
 |
|
| 9000117 |
C4H6OS |
2,3-dihydrothiophene-2-ol |
InChI=1/C4H6OS/c5-4-2-1-3-6-4/h1,3-5H,2H2 |
O[C@@H]1CC=CS1 |
 |
|
| 594434 |
C3H8O2S |
(Methylsulphonyl)ethane |
InChI=1/C3H8O2S/c1-3-6(2,4)5/h3H2,1-2H3 |
CCS(=O)(C)=O |
 |
(Methylsulphonyl)ethane; Ethyl methyl sulphone; Methyl ethyl sulfone; (methylsulfonyl)ethane
|
| 625605 |
C4H8OS |
s-Ethyl thioacetate |
InChI=1/C4H8OS/c1-3-6-4(2)5/h3H2,1-2H3 |
CC(SCC)=O |
 |
Acetic acid, thio-, S-ethyl ester; Ethanethioic acid S-ethyl ester; Ethyl thioacetate; Ethyl thiolacetate; S-Ethyl ethanethioate; S-Ethyl thioacetate; S-Ethyl thiolacetate; Thioacetic acid, ethyl ester
|
| 1191088 |
C4H10S2 |
1,4-Butanedithiol |
InChI=1/C4H10S2/c5-3-1-2-4-6/h5-6H,1-4H2 |
SCCCCS |
 |
1,4-Butanedithiol; 1,4-Dimercaptobutane; Tetramethylene dimercaptan; Tetramethylenedithiol; butane-1,4-dithiol
|
| 1679078 |
C5H10S |
Cyclopentanethiol |
InChI=1/C5H10S/c6-5-3-1-2-4-5/h5-6H,1-4H2 |
SC1CCCC1 |
 |
Cyclopentanethiol; Cyclopentyl mercaptan; Mercaptocyclopentane
|
| 1613510 |
C5H10S |
2H-Thiopyran, tetrahydro- |
InChI=1/C5H10S/c1-2-4-6-5-3-1/h1-5H2 |
C1CCCCS1 |
 |
2H-Thiopyran, tetrahydro-; Pentamethylene sulfide; Penthiophane; Tetrahydro-2H-thiopyran; Tetrahydrothiapyran; Tetrahydrothiopyran; Thiacyclohexane; Thiane
|
| 1795091 |
C5H10S |
Thiophene, tetrahydro-2-methyl- |
InChI=1/C5H10S/c1-5-3-2-4-6-5/h5H,2-4H2,1H3 |
C[C@@H]1CCCS1 |
 |
2-Methyltetrahydrothiophene; 2-Methylthiacyclopentane; 2-Methylthiolane; 2-Methylthiophane; 5-Methyltetrahydro-2-thenylamine; 5-Methyltetrahydro-2-thenylamined; Tetrahydro-2-methylthiophene; Thiophene, tetrahydro-2-methyl-
|
| 70291 |
C4H10OS |
Diethyl sulfoxide |
InChI=1/C4H10OS/c1-3-6(5)4-2/h3-4H2,1-2H3 |
CC[S](=O)CC |
 |
1,1'-Sulphinylbisethane; Deso; Diaethylsulfoxid; Diethyl sulfoxide; Diethyl sulphoxide; Ethane, 1,1'-sulfinylbis-; Ethyl sulfoxide; (ethylsulfinyl)ethane
|
| 4740005 |
C5H10S |
Thiophene, tetrahydro-3-methyl- |
InChI=1/C5H10S/c1-5-2-3-6-4-5/h5H,2-4H2,1H3 |
C[C@H]1CSCC1 |
 |
3-Methyltetrahydrothiophene; 3-Methylthiacyclopentane; 3-Methylthiolane; Tetrahydro-3-methylthiophene; Thiophene, tetrahydro-3-methyl-
|
| 5296628 |
C5H10S |
3-Ethylthio-1-propene |
InChI=1/C5H10S/c1-3-5-6-4-2/h3H,1,4-5H2,2H3 |
C=CCSCC |
 |
3-Ethylthio-1-propene; Allyl ethyl sulfide; allyl(ethyl)sulfane
|
| 5145993 |
C5H12S |
Propane, 2-(ethylthio)- |
InChI=1/C5H12S/c1-4-6-5(2)3/h5H,4H2,1-3H3 |
CC(SCC)C |
 |
2-(Ethylthio)propane; 2-Methyl-3-thiapentane; Ethyl isopropyl sulfide; Isopropyl ethyl sulfide; Isopropyl ethyl sulphide; Propane, 2-(ethylthio)-; Sulfide, ethyl isopropyl; ethyl(isopropyl)sulfane
|
| 4110503 |
C5H12S |
Ethyl propyl sulfide |
InChI=1/C5H12S/c1-3-5-6-4-2/h3-5H2,1-2H3 |
CCCSCC |
 |
1-(Ethylthio)propane; 3-Thiahexane; Ethyl n-propyl sulfide; sulfide, ethyl propyl; Ethyl propyl sulphide; Ethyl propyl thio ether; n-C3H7SC2H5; Propane, 1-(ethylthio)-; Propyl ethyl sulfide; Sulfide, ethyl propyl; ethyl(propyl)sulfane
|
| 6163640 |
C5H12S |
Propane, 2-methyl-2-(methylthio)- |
InChI=1/C5H12S/c1-5(2,3)6-4/h1-4H3 |
CC(SC)(C)C |
 |
2-Methyl-2-(methylthio)-propane; 3,3-Dimethyl-2-thiabutane; Methyl t-butyl sulfide; Methyl tert-butyl sulfide; Propane, 2-methyl-2-(methylthio)-; Sulfide, tert-butyl methyl; tert-Butyl Methyl sulfide; tert-Butyl methyl sulphide; tert-butyl(methyl)sulfane
|
| 110667 |
C5H12S |
1-Pentanethiol |
InChI=1/C5H12S/c1-2-3-4-5-6/h6H,2-5H2,1H3 |
CCCCCS |
 |
1-Mercaptopentane; 1-Pentanethiol; Amyl hydrosulfide; Amyl mercaptan; Amyl sulfhydrate; Amyl thioalcohol; Mercaptan amylique; n-Amyl mercaptan; n-Pentyl mercaptan; Pentalarm; Pentane-1-thiol; Pentanethiol; Pentyl mercaptan; UN 1111
|
| 1878188 |
C5H12S |
1-Butanethiol, 2-methyl- |
InChI=1/C5H12S/c1-3-5(2)4-6/h5-6H,3-4H2,1-2H3 |
CC[C@@H](C)CS |
 |
1-Butanethiol, 2-methyl-; 2-Methyl-1-butanethiol; 2-methylbutane-1-thiol
|
| 2084186 |
C5H12S |
2-Butanethiol, 3-methyl- |
InChI=1/C5H12S/c1-4(2)5(3)6/h4-6H,1-3H3 |
C[C@H](S)C(C)C |
 |
2-Butanethiol, 3-methyl-; 3-Methyl-2-butanethiol; 3-methylbutane-2-thiol
|
| 1679089 |
C5H12S |
1-Propanethiol, 2,2-dimethyl- |
InChI=1/C5H12S/c1-5(2,3)4-6/h6H,4H2,1-3H3 |
CC(C)(C)CS |
 |
1-Propanethiol, 2,2-dimethyl-; 2,2-Dimethyl-1-propanethiol; Neopentyl mercaptan; 2,2-dimethylpropane-1-thiol
|
| 1679090 |
C5H12S |
2-Butanethiol, 2-methyl- |
InChI=1/C5H12S/c1-4-5(2,3)6/h6H,4H2,1-3H3 |
CC(S)(C)CC |
 |
2-Methybutane-2-thiol; 2-Methyl-2-butanethiol; 2-Butanethiol, 2-methyl-; 2-tert-Pentyl mercaptan; tert-Amyl mercaptan; tert-Pentyl mercaptan
|
| 628295 |
C5H12S |
Butane, 1-(methylthio)- |
InChI=1/C5H12S/c1-3-4-5-6-2/h3-5H2,1-2H3 |
CCCCSC |
 |
1-(Methylthio)butane; 2-Thiahexane; Butane, 1-(methylthio)-; Butyl methyl sulfide; Butyl methyl sulphide; Butyl methyl thioether; Methyl butyl sulfide; Methyl-n-butyl sulfide; Sulfide, butyl methyl; butyl(methyl)sulfane
|
| 541311 |
C5H12S |
1-Butanethiol, 3-methyl- |
InChI=1/C5H12S/c1-5(2)3-4-6/h5-6H,3-4H2,1-2H3 |
CC(C)CCS |
 |
1-Butanethiol, 3-methyl-; 2-Methyl-4-butanethiol; 3-Methyl-1-butanethiol; 3-Methylbutanethiol; Isoamyl mercaptan; Isoamyl sulfhydrate; Isopentyl mercaptan; 3-methylbutane-1-thiol
|
| 127184 |
C2Cl4 |
Tetrachloroethylene |
InChI=1/C2Cl4/c3-1(4)2(5)6 |
ClC(Cl)=C(Cl)Cl |
 |
1,1,2,2-Tetrachloroethene; 1,1,2,2-Tetrachloroethylene; Ankilostin; Antisal 1; Antisol 1; Carbon bichloride; Carbon dichloride; Czterochloroetylen; Didakene; Dilatin PT; Dow-per; ENT 1,860; Ethene, tetrachloro-; Ethylene tetrachloride; Ethylene, tetrachloro-; Fedal-Un; Freon 1110; NCI-C04580; Nema; Nema, veterinary; PER; Perawin; PERC; Perchloorethyleen, per; Perchlor; Perchloraethylen, per; Perchlorethylene; Perchlorethylene, per; Perchloroethylene; Perclene; Perclene D; Percloroetilene; Percosolve; Perk; Perklone; PerSec; Rcra waste number U210; Tetlen; Tetracap; Tetrachlooretheen; Tetrachloraethen; Tetrachlorethylene; Tetrachloroethane; Tetrachloroethene; Tetrachloroethylene; Tetrachloroethylene mos; Tetracloroetene; Tetraguer; Tetraleno; Tetralex; Tetravec; Tetroguer; Tetropil; UN 1897; perchloroethene
|
| 10026138 |
PCl5 |
Phosphorus pentachloride |
InChI=1/Cl5P/c1-6(2,3,4)5 |
ClP(Cl)(Cl)(Cl)Cl |
 |
Fosforo(pentacloruro di); Fosforpentachloride; Phosphorane, pentachloro-; Phosphore(pentachlorure de); Phosphoric chloride; Phosphorous pentachloride; Phosphorpentachlorid; Phosphorus chloride; Phosphorus pentachloride; Phosphorus perchloride; Phosphorus(V) chloride; Pieciochlorek fosforu; UN 1806; pentachlorophosphorane
|
| 13637633 |
ClF5 |
chlorinepentafluoride |
InChI=1S/ClF5/c2-1(3,4,5)6 |
FCl(F)(F)(F)F |
 |
Chlorine fluoride; UN 2548; Chlorine pentafluoride
|
| 13701672 |
B2Cl4 |
Diboron tetrachloride |
InChI=1/B2Cl4/c3-1(4)2(5)6 |
ClB(Cl)B(Cl)Cl |
 |
Diboron tetrachloride; Dichloroborane; perchlorodiborane
|
| 75876 |
CCl3CHO |
trichloroacetaldehyde |
InChI=1S/C2HCl3O/c3-2(4,5)1-6/h1H |
O=CC(Cl)(Cl)Cl |
 |
Chloral; Acetaldehyde, trichloro-; Trichloroethanal; 2,2,2-Trichloroethanal; Cloralio; Rcra waste number U034; UN 2075; 2,2,2-Trichloroacetaldehyde
|
| 75887 |
CF3CH2Cl |
2,2,2-Trifluoroethyl chloride |
InChI=1S/C2H2ClF3/c3-1-2(4,5)6/h1H2 |
FC(F)(F)CCl |
 |
Ethane, 2-chloro-1,1,1-trifluoro-; Genetron 133a; R 133a; 1-Chloro-2,2,2-Trifluoroethane; 1,1,1-Trifluoro-2-chloroethane; 1,1,1-Trifluoroethyl chloride; CFC 133a; 2-Chloro-1,1,1-trifluoroethane; FC 133a; Freon 133a; 2,2,2-Trifluorochloroethane
|
| 96184 |
C3H5Cl3 |
Propane, 1,2,3-trichloro- |
InChI=1/C3H5Cl3/c4-1-3(6)2-5/h3H,1-2H2 |
ClCC(Cl)CCl |
 |
1,2,3-Trichloropropane; Allyl trichloride; Glycerol trichlorohydrin; Glyceryl trichlorohydrin; NCI-C60220; Propane, 1,2,3-trichloro-; Trichlorohydrin; Trichloropropane
|
| 541413 |
C3H5ClO2 |
Carbonochloridic acid, ethyl ester |
InChI=1/C3H5ClO2/c1-2-6-3(4)5/h2H2,1H3 |
O=C(Cl)OCC |
 |
Carbonochloridic acid, ethyl ester; Cathyl chloride; Chlorocarbonate D'ethyle; Chlorocarbonic acid, ethyl ester; Chloroformic acid, ethyl ester; Clhorameisensaeureaethylester; ECF; Ethoxycarbonyl chloride; Ethyl chlorocarbonate; Ethyl chloroformate; Ethylchloorformiaat; Ethyle, chloroformiat D'; Ethylester kyseliny chlormravenci; Etil clorocarbonato; Etil cloroformiato; Formic acid, chloro-, ethyl ester; TL 423; UN 1182; ethyl carbonochloridate
|
| 616217 |
C4H8Cl2 |
Butane, 1,2-dichloro- |
InChI=1/C4H8Cl2/c1-2-4(6)3-5/h4H,2-3H2,1H3 |
CC[C@@H](Cl)CCl |
 |
1,2-Dichlorobutane; Butane, 1,2-dichloro-
|
| 1190223 |
C4H8Cl2 |
Butane, 1,3-dichloro- |
InChI=1/C4H8Cl2/c1-4(6)2-3-5/h4H,2-3H2,1H3 |
C[C@@H](Cl)CCCl |
 |
1,3-Dichlorobutane; Butane, 1,3-dichloro-
|
| 2211678 |
C4H8Cl2 |
Butane, 2,3-dichloro-, (r*,r*)-(.+/-.)- |
InChI=1/C4H8Cl2/c1-3(5)4(2)6/h3-4H,1-2H3/t3-,4-/m1/s1 |
C[C@@H](Cl)[C@H](Cl)C |
 |
(.+-.)-2,3-Dichlorobutane; (.+/-.)-2,3-Dichlorobutane; Butane, 2,3-dichloro-, (.+-.)-; Butane, 2,3-dichloro-, (.+/-.)-; Butane, 2,3-dichloro-, (R*,R*)-(.+-.)-; Butane, 2,3-dichloro-, (R*,R*)-(.+/-.)-; DL-2,3-Dichlorobutane; racemic-2,3-Dichlorobutane; (2R,3R)-2,3-dichlorobutane
|
| 110565 |
C4H8Cl2 |
1,4-Dichlorobutane |
InChI=1/C4H8Cl2/c5-3-1-2-4-6/h1-4H2 |
ClCCCCCl |
 |
1,4-Dichlorobutane; Butane, 1,4-dichloro-; Tetramethylene chloride
|
| 4028562 |
C4H8Cl2 |
Butane, 2,3-dichloro-, (r*,s*)- |
InChI=1/C4H8Cl2/c1-3(5)4(2)6/h3-4H,1-2H3/t3-,4+ |
C[C@@H](Cl)[C@@H](Cl)C |
 |
Butane, 2,3-dichloro-, (R*,S*)-; Butane, 2,3-dichloro-, meso-; meso-2,3-Dichlorobutane; (2R,3S)-2,3-dichlorobutane
|
| 628342 |
C4H9ClO |
1-Chloro-2-ethoxyethane |
InChI=1/C4H9ClO/c1-2-6-4-3-5/h2-4H2,1H3 |
CCOCCCl |
 |
β-Chloroethyl ethyl ether; 1-Chloro-2-ethoxyethane; 2-Chlorodiethyl ether; 2-Chloroethoxyethane; 2-Chloroethyl ethyl ether; 2-Ethoxyethyl chloride; Ethane, 1-chloro-2-ethoxy-; Ether, 2-chloroethyl ethyl; Ethyl β-chloroethyl ether; beta-Chloroethyl ethyl ether
|
| 543599 |
C5H11Cl |
Pentane, 1-chloro- |
InChI=1/C5H11Cl/c1-2-3-4-5-6/h2-5H2,1H3 |
CCCCCCl |
 |
1-Chloropentane; Amyl chloride; n-Amyl chloride; n-Pentyl chloride; Pentane, 1-chloro-; Pentyl chloride; UN 1107
|
| 7784363 |
AsF5 |
Arsenic pentafluoride |
InChI=1S/AsF5/c2-1(3,4,5)6 |
F[As](F)(F)(F)F |
 |
|
| 7789302 |
BrF5 |
bromine pentafluoride |
InChI=1/BrF5/c2-1(3,4,5)6 |
FBr(F)(F)(F)F |
 |
Bromine fluoride; pentafluorobromine; Bromine pentafluoride
|
| 2154565 |
C6H5CH2 |
benzyl radical |
InChI=1/C7H7/c1-7-5-3-2-4-6-7/h2-6H,1H2 |
[CH2]C1=CC=CC=C1 |
 |
methylphenyl; methyl,phenyl-; benzyl
|
| 3551277 |
C7H7 |
cycloheptatrienyl radical |
InChI=1S/C7H7/c1-2-4-6-7-5-3-1/h1-7H |
C1=CC=CC=C[CH]1 |
 |
tropyl radical; tropyl
|
| 3551277 |
C7H7+ |
cycloheptatrienyl cation |
InChI=1S/C7H7/c1-2-4-6-7-5-3-1/h1-7H/q+1 |
C1=CC=CC=C[CH+]1 |
 |
tropylium; cyclohepta-2,4,6-trien-1-ylium
|
| 121460 |
C7H8 |
Norbornadiene |
InChI=1S/C7H8/c1-2-7-4-3-6(1)5-7/h1-4,6-7H,5H2 |
C1C2C=CC1C=C2 |
 |
2,5-Norbornadiene; Bicyclo[2.2.1]hepta-2,5-diene; Bicyclo[2.2.1]heptadiene; 3,6-Methano-1,4-cyclohexadiene; Dicycloheptadiene; Bicyclo[2.2.1]-2,5-heptadiene; Bicyclo[2,2,1]-2,5-heptadiene
|
| 108883 |
C6H5CH3 |
toluene |
InChI=1/C7H8/c1-7-5-3-2-4-6-7/h2-6H,1H3 |
CC1=CC=CC=C1 |
 |
Benzene,methyl; Methane,phenyl-; Toluolo; Methylbenzene; Methacide; Tolueen; Methylbenzol; Toluene; Toluen; Toluol; Phenylmethane; Antisal1a
|
| 279232 |
C7H12 |
Norbornane |
InChI=1/C7H12/c1-2-7-4-3-6(1)5-7/h6-7H,1-5H2 |
C1CC2CCC1C2 |
 |
Bicyclo[2.2.1]heptane; Cyclohexane, 1,4-endo-methylene-; Norbornylane; Norcamphane; Norfenchane; Norsantane; 1,4-Endomethylenecyclohexane
|
| 589344 |
C7H16 |
3-methylhexane |
InChI=1S/C7H16/c1-4-6-7(3)5-2/h7H,4-6H2,1-3H3 |
CC[C@H](C)CCC |
 |
Hexane, 3-methyl-; 2-Ethylpentane; 3-methylhexane
|
| 591764 |
C7H16 |
2-methylhexane |
InChI=1/C7H16/c1-4-5-6-7(2)3/h7H,4-6H2,1-3H3 |
CC(C)CCCC |
 |
Isoheptane
|
| 142825 |
C7H16 |
heptane |
InChI=1/C7H16/c1-3-5-7-6-4-2/h3-7H2,1-2H3 |
CCCCCCC |
 |
n-Heptane; Dipropylmethane; heptane
|
| 109068 |
C6H7N |
2-Methylpyridine |
InChI=1S/C6H7N/c1-6-4-2-3-5-7-6/h2-5H,1H3 |
CC1=CC=CC=N1 |
 |
2-Picoline; a-Methylpyridine; Pyridine, 2-methyl-; o-Picoline; Picoline; o-Methylpyridine; 2-methylpyridine
|
| 62533 |
C6H5NH2 |
aniline |
InChI=1/C6H7N/c7-6-4-2-1-3-5-6/h1-5H,7H2 |
NC1=CC=CC=C1 |
 |
Benzene, amino-; Benzene,amino-; NCI-C03736; AnilineOil; Phenylamine; Krystallin; Cyanol; Benzidam; Phenylamine; Anilina; BlueOil; Huile D'aniline; Aminobenzene; HuileD'aniline; Benzenamine; Benzidam; Anilina; Anilin; Aminophen; Aniline; Aminophen; Benzenamine; Krystallin; Anilin; Anyvim; Kyanol; Anyvim; Aminobenzene; Kyanol; Aniline Oil; Blue Oil; Cyanol
|
| 109057 |
C6H13N |
2-Methylpiperidine |
InChI=1S/C6H13N/c1-6-4-2-3-5-7-6/h6-7H,2-5H2,1H3/t6-/m1/s1 |
C[C@@H]1CCCCN1 |
 |
2-Pipecoline; a-Methylpiperidine; Pipicoline; Piperidine, 2-methyl-; a-Pipecolin; 2-Methylpiperidine
|
| 108918 |
C6H13N |
cyclohexanamine |
InChI=1S/C6H13N/c7-6-4-2-1-3-5-6/h6H,1-5,7H2 |
NC1CCCCC1 |
 |
Cyclohexylamine; Aminocyclohexane; Aminohexahydrobenzene; Benzenamine, hexahydro-; Hexahydrobenzenamine
Hexahydroaniline; Aniline, hexahydro-; CHA; UN 2357; 1-Aminocyclohexane; 1-Cyclohexylamine; cyclohexanamine
|
| 10102031 |
N2O5 |
Dinitrogen pentoxide |
InChI=1/N2O5/c3-1(4)7-2(5)6 |
O=N(ON(=O)=O)=O |
 |
Nitrogen pentoxide; nitric anhydride
|
| 10102031 |
N2O5 |
Dinitrogen pentoxide |
InChI=1/N2O5/c3-1(4)7-2(5)6 |
O=N(ON(=O)=O)=O |
 |
Nitrogen pentoxide; nitric anhydride
|
| 108316 |
C4H2O3 |
Maleic Anhydride |
InChI=1S/C4H2O3/c5-3-1-2-4(6)7-3/h1-2H |
O=C(C=C1)OC1=O |
 |
2,5-Furandione; cis-Butenedioic Anhydride; Dihydro-2,5-dioxofuran; Maleic acid anhydride; Toxilic anhydride; UN 2215; furan-2,5-dione
|
| 930609 |
C5H4O2 |
4-Cyclopentene-1,3-dione |
InChI=1S/C5H4O2/c6-4-1-2-5(7)3-4/h1-2H,3H2 |
O=C1CC(C=C1)=O |
 |
2-Cyclopentene-1,4-dione; 2-cyclopenten-1,4-dione; 4-Cyclopenten-1,3-dione; Cyclopent-2-en-1,4-dione; cyclopent-2-ene-1,4-dione; cyclopent-4-ene-1,3-dione
|
| 980101 |
C5H4O2 |
furfural |
InChI=1/C5H4O2/c6-4-5-2-1-3-7-5/h1-4H |
O=CC1=CC=CO1 |
 |
2-Furancarboxaldehyde; 2-Furaldehyde; a-Furole; Fural; Furaldehyde; Furale; Furancarbonal; Furfuraldehyde; Furfurylaldehyde; Furfurole; Furole; 2-Formylfuran; 2-Furanaldehyde; 2-Furancarbonal; 2-Furfural; 2-Furfuraldehyde; 2-Furylaldehyde; Furol; 2-Furylmethanal; UN 1199; furan-2-carbaldehyde
|
| 626642 |
C5H5NO |
4-Pyridinol |
InChI=1/C5H5NO/c7-5-1-3-6-4-2-5/h1-4H,(H,6,7) |
OC1=CC=NC=C1 |
 |
|
| 2122465 |
C6H5O |
phenoxy radical |
InChI=1S/C6H5O/c7-6-4-2-1-3-5-6/h1-5H |
[O]C1=CC=CC=C1 |
 |
|
| 109002 |
C5H5NO |
3-Pyridinol |
InChI=1/C5H5NO/c7-5-2-1-3-6-4-5/h1-4,7H |
OC1=CC=CN=C1 |
 |
3-Hydroxypyridine; ß-Hydroxypyridine; 3-Oxopyridine; 3-Pyridol; 3-Pyridone; pyridin-3-ol
|
| 109104 |
C5H5NO |
2-Pyridinol |
InChI=1/C5H5NO/c7-5-3-1-2-4-6-5/h1-4H,(H,6,7) |
OC1=NC=CC=C1 |
 |
|
| 9000004 |
C5H5NO |
3(2H)-Pyridinone |
InChI=1/C5H5NO/c7-5-2-1-3-6-4-5/h1-3H,4H2 |
O=C1CN=CC=C1 |
 |
|
| 9000015 |
C5H5NO |
3(6H)-Pyridinone |
InChI=1/C5H5NO/c7-5-2-1-3-6-4-5/h1-2,4H,3H2 |
O=C1C=NCC=C1 |
 |
|
| 9000026 |
C5H5NO |
3(4H)-Pyridinone |
InChI=1/C5H5NO/c7-5-2-1-3-6-4-5/h1,3-4H,2H2 |
O=C1C=NC=CC1 |
 |
|
| 9000037 |
C5H5NO |
2(5H)-Pyridinone |
InChI=1/C5H5NO/c7-5-3-1-2-4-6-5/h1,3-4H,2H2 |
O=C1C=CCC=N1 |
 |
|
| 9000048 |
C5H5NO |
2(3H)-Pyridinone |
InChI=1/C5H5NO/c7-5-3-1-2-4-6-5/h1-2,4H,3H2 |
O=C1CC=CC=N1 |
 |
|
| 9000059 |
C5H5NO |
4(3H)-Pryidinone |
InChI=1/C5H5NO/c7-5-1-3-6-4-2-5/h1,3-4H,2H2 |
O=C1CC=NC=C1 |
 |
|
| 9000060 |
C5H5NO |
4(1H)-Pryidinone |
InChI=1/C5H5NO/c7-5-1-3-6-4-2-5/h1-4H,(H,6,7) |
O=C1C=CNC=C1 |
 |
|
| 72762006 |
C5H5NO |
2(1H)-Pyridinone |
InChI=1/C5H5NO/c7-5-3-1-2-4-6-5/h1-4H,(H,6,7) |
O=C1C=CC=CN1 |
 |
|
| 24599573 |
C6H6O |
2,4-Cyclohexadienone |
InChI=1/C6H6O/c7-6-4-2-1-3-5-6/h1-4H,5H2 |
O=C1C=CC=CC1 |
 |
|
| 5664335 |
C6H6O |
2,5-Cyclohexadienone |
InChI=1/C6H6O/c7-6-4-2-1-3-5-6/h2-5H,1H2 |
O=C1C=CCC=C1 |
 |
|
| 108952 |
C6H5OH |
phenol |
InChI=1/C6H6O/c7-6-4-2-1-3-5-6/h1-5,7H |
OC1=CC=CC=C1 |
 |
Benzenol; Hydroxybenzene; Monophenol; Paoscle; Phenylhydroxide; Oxybenzene; Phenylicacid; PhOH; Fenolo; Phenole; Carbolsaure; Phenolalcohol; Benzophenol; Phenol; Carbolicacid; Fenol; Phenylhydrate; Phenylicalcohol; Monohydroxybenzene; Acidecarbolique; Phenylalcohol; Izal; Phenicacid; Benzene,hydroxy-
|
| 123546 |
C5H8O2 |
Acetylacetone |
InChI=1S/C5H8O2/c1-4(6)3-5(2)7/h3H2,1-2H3 |
CC(CC(C)=O)=O |
 |
2,4-Pentanedione; Acetoacetone; Diacetylmethane; Pentane-2,4-dione; 2-Propanone, acetyl-; 2,4-Dioxopentane; 2,4-Pentadione; Acetone, acetyl-; ACAC; Pentanedione; Pentanedione-2,4; Acetyl 2-propanone; UN 2310; pentan-2,4-dione; 2,4-Pentandione
|
| 108941 |
C6H10O |
cyclohexanone |
InChI=1/C6H10O/c7-6-4-2-1-3-5-6/h1-5H2 |
O=C1CCCCC1 |
 |
|
| 354347 |
CF3COF |
trifluoroacetyl fluoride |
InChI=1S/C2F4O/c3-1(7)2(4,5)6 |
O=C(F)C(F)(F)F |
 |
|
| 462066 |
C6H5F |
Fluorobenzene |
InChI=1/C6H5F/c7-6-4-2-1-3-5-6/h1-5H |
FC1=CC=CC=C1 |
 |
UN 2387; Phenyl fluoride; Benzene, fluoro-; Monofluorobenzene; fluorobenzene
|
| 2551624 |
SF6 |
Sulfur Hexafluoride |
InChI=1/F6S/c1-7(2,3,4,5)6 |
FS(F)(F)(F)(F)F |
 |
|
| 354325 |
CF3COCl |
trifluoroacetyl chloride |
InChI=1S/C2ClF3O/c3-1(7)2(4,5)6 |
O=C(Cl)C(F)(F)F |
 |
|
| 306832 |
CF3CHCl2 |
1,1-Dichloro-2,2,2-trifluoroethane |
InChI=1S/C2HCl2F3/c3-1(4)2(5,6)7/h1H |
FC(F)(F)C(Cl)Cl |
 |
Dichlorotrifluoromethylmethane; Ethane, 2,2-dichloro-1,1,1-trifluoro-; 1,1,1-Trifluoro-2,2-dichloroethane; 2,2-Dichloro-1,1,1-trifluoroethane; Dichlorotrifluoroethane; Freon 123; HCFC-123; R 123
|
| 2837890 |
CF3CHFCl |
1,1,1,2-tetrafluorochloroethane |
InChI=1S/C2HClF4/c3-1(4)2(5,6)7/h1H |
FC(F)(F)[CH](Cl)F |
 |
2-Chloro-1,1,1,2-tetrafluoroethane; Ethane, 2-chloro-1,1,1,2-tetrafluoro-; R 124; 1-chloro-1,2,2,2-tetrafluoroethane
|
| 108907 |
C6H5Cl |
chlorobenzene |
InChI=1/C6H5Cl/c7-6-4-2-1-3-5-6/h1-5H |
ClC1=CC=CC=C1 |
 |
Chlorobenzen; Monochlorobenzene; Chlorobenzene,mono-; Monochloorbenzeen; Chloorbenzeen; Chlorobenzene; Monochlorbenzol; Chlorbenzene; Benzenechloride; Chlorobenzenu; Clorobenzene; MCB; Monoclorobenzene; Monochlorbenzene; PhenylChloride; Benzene, chloro-; Chlorobenzol; Chlorbenzol
|
| 108861 |
C6H5Br |
bromobenzene |
InChI=1/C6H5Br/c7-6-4-2-1-3-5-6/h1-5H |
BrC1=CC=CC=C1 |
 |
Benzene, bromo-; Monobromobenzene; Phenyl bromide; NCI-C55492; UN 2514; bromobenzene
|
| 536743 |
C6H5CCH |
phenylacetylene |
InChI=1/C8H6/c1-2-8-6-4-3-5-7-8/h1,3-7H |
C#CC1=CC=CC=C1 |
 |
Phenylethyne; Ethynylbenzene
|
| 277101 |
C8H8 |
cubane |
InChI=1/C8H8/c1-2-5-3(1)7-4(1)6(2)8(5)7/h1-8H |
C12C3C4C1C5C4C3C25 |
 |
|
| 629209 |
C8H8 |
cyclooctatetraene |
InChI=1/C8H8/c1-2-4-6-8-7-5-3-1/h1-8H/b2-1-,3-1-,4-2-,5-3-,6-4-,7-5-,8-6-,8-7- |
C1=C\C=C/C=C\C=C/1 |
 |
1,3,5,7-Cyclooctatetraene; UN 2358; [8]Annulene; cot; (1Z,3Z,5Z,7Z)-cycloocta-1,3,5,7-tetraene
|
| 100425 |
C6H5CHCH2 |
Styrene |
InChI=1/C8H8/c1-2-8-6-4-3-5-7-8/h2-7H,1H2 |
C=CC1=CC=CC=C1 |
 |
Styreen; Styrolene; Benzene, vinyl-; Styron; Vinylbenzene; Styrol; Stirolo; Cinnaminol; Cinnamenol; Phenylethylene; Styrole; Vinylbenzen; Styrol; Vinylbenzol; Styren; Phenylethene; Phenethylene; NCI-C02200; Benzene, ethenyl-; Cinnamol; Cinnamene; Ethenylbenzene; Ethylene, phenyl-; styrene
|
| 106423 |
CH3C6H4CH3 |
paraXylene |
InChI=1S/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H,1-2H3 |
CC1=CC=C(C)C=C1 |
 |
Benzene, 1,4-dimethyl-; p-Xylene; p-Dimethylbenzene; p-Xylol; 1,4-Dimethylbenzene; 1,4-Xylene; p-Methyltoluene; para-Xylene; Chromar; Scintillar; UN 1307; 4-Methyltoluene; 1,4-dimethyl-benzene
|
| 100414 |
C6H5CH2CH3 |
Ethylbenzene |
InChI=1/C8H10/c1-2-8-6-4-3-5-7-8/h3-7H,2H2,1H3 |
CCC1=CC=CC=C1 |
 |
UN 1175; Ethylbenzeen; Etylobenzen; Etilbenzene; a-Methyltoluene; Aethylbenzol; NCI-C56393; Benzene, ethyl-; Phenylethane; Ethylbenzol; ethylbenzene
|
| 108383 |
CH3C6H4CH3 |
meta-xylene |
InChI=1S/C8H10/c1-7-4-3-5-8(2)6-7/h3-6H,1-2H3 |
CC1=CC(C)=CC=C1 |
 |
Benzene, 1,3-dimethyl-; m-Xylene; m-Dimethylbenzene; m-Xylol; 1,3-Dimethylbenzene; 1,3-Xylene; 2,4-Xylene; m-Methyltoluene; meta-Xylene; UN 1307
|
| 280331 |
C8H14 |
Bicyclo[2.2.2]octane |
InChI=1S/C8H14/c1-2-8-5-3-7(1)4-6-8/h7-8H,1-6H2/t7-,8+ |
C1(CC2)CCC2CC1 |
 |
1,4-Endoethylenecyclohexane; Cyclohexane, 1,4-endo-(1,2-ethanediyl)-; Bicyclo[2.2.2]octane
|
| 594821 |
(CH3)3CC(CH3)3 |
tetramethylbutane |
InChI=1S/C8H18/c1-7(2,3)8(4,5)6/h1-6H3 |
CC(C)(C)C(C)(C)C |
 |
Ethane, hexamethyl-; Hexamethylethane; 2,2,3,3-Tetramethylbutane; Butane, 2,2,3,3-tetramethyl-
|
| 111659 |
C8H18 |
Octane |
InChI=1S/C8H18/c1-3-5-7-8-6-4-2/h3-8H2,1-2H3 |
CCCCCCCC |
 |
n-Octane; n-C8H18; UN 1262; Oktan; Oktanen; Ottani; Octane
|
| 100470 |
C6H5CN |
phenyl cyanide |
InChI=1/C7H5N/c8-6-7-4-2-1-3-5-7/h1-5H |
N#CC1=CC=CC=C1 |
 |
Benzonitrile; Cyanobenzene; Benzene, cyano-; Benzenenitrile; Fenylkyanid; UN 2224
|
| 280579 |
C6H12N2 |
Triethylenediamine |
InChI=1S/C6H12N2/c1-2-8-5-3-7(1)4-6-8/h1-6H2 |
N1(CC2)CCN2CC1 |
 |
1,4-Diazabicyclo[2.2.2]octane; Bicyclo[2.2.2]-1,4-diazaoctane; Dabco; Dabco 33LV; N,N'-endo-Ethylenepiperazine; 1,4-Diaza[2.2.2]bicyclooctane; 1,4-Ethylenepiperazine; ,4-Diazabicyclo[2,2,2] octane; Bicyclo[2.2.2]octane, 1,4-diaza-; 1,4-Diazobicyclo(2.2.2)octane; Bicyclo(2,2,2)-1,4-diazaoctane
|
| 106514 |
C6H4O2 |
parabenzoquinone |
InChI=1S/C6H4O2/c7-5-1-2-6(8)4-3-5/h1-4H |
O=C(C=C1)C=CC1=O |
 |
2,5-Cyclohexadiene-1,4-dione; p-Quinone; Chinone; Quinone; 1,4-Benzoquinone; 1,4-Cyclohexadienedione; Benzoquinone
|
| 66228 |
C4H4N2O2 |
Uracil |
InChI=1S/C4H4N2O2/c7-3-1-2-5-4(8)6-3/h1-2H,(H2,5,6,7,8) |
O=C(N1)C=CNC1=O |
 |
2,4(1H,3H)-Pyrimidinedione; Pirod; Pyrod; Ura; 2,4-Dihydroxypyrimidine; 2,4-Dioxopyrimidine; 2,4-Pyrimidinediol; 2,4-Pyrimidinedione; 2,6-Dihydroxypyrimidine; 1H-Pyrimidine-2,4-dione; 2,(1H,3H)-Pyriminedione; 2,4-Dioxypyrimidine; 4-Hydroxy-2(1H)-pyrimidinone; pyrimidine-2,4(1H,3H)-dione
|
| 71307 |
C4H5N3O |
Cytosine |
InChI=1S/C4H4N3O/c5-3-1-2-6-4(8)7-3/h1-2H,(H2,5,6,7,8) |
O=C1=NC(N)=CC=N1 |
 |
2(1H)-Pyrimidinone, 4-amino-; Cyt; Cytosinimine; 4-Amino-2(1H)-pyrimidinone; 4-Amino-2-hydroxypyrimidine; 4-Amino-2(1H)pyrimidone; 4-Amino-2-oxypyrimidine; 4-aminopyrimidin-2(1H)-one
|
| 100527 |
C6H5CHO |
benzaldehyde |
InChI=1/C7H6O/c8-6-7-4-2-1-3-5-7/h1-6H |
O=CC1=CC=CC=C1 |
 |
Ethereal oil of bitter almonds; Benzene carbaldehyde; Benzenecarbonal; Benzene methylal; Phenylmethanal; benzaldehyde; Almond Oil; Benzoic aldehyde; Benzoyl hydride
|
| 100663 |
C6H5OCH3 |
Anisole |
InChI=1/C7H8O/c1-8-7-5-3-2-4-6-7/h2-6H,1H3 |
COC1=CC=CC=C1 |
 |
Methyl phenyl ether; Ether, methyl phenyl-; Phenyl methyl ether; Anizol; UN 2222; Anisol; Phenoxymethane; methoxybenzene; Benzene, methoxy-; anisole
|
| 142621 |
C6H12O2 |
Hexanoic acid |
InChI=1S/C6H12O2/c1-2-3-4-5-6(7)8/h2-5H2,1H3,(H,7,8) |
CCCCCC(O)=O |
 |
Caproic acid; n-Caproic acid; n-Hexanoic acid; n-Hexoic acid; n-Hexylic acid; Butylacetic acid; Capronic acid; Hexoic acid; Pentiformic acid; Pentylformic acid; 1-Pentanecarboxylic acid; Pentane-1-carboxylic acid; 1-Hexanoic acid; Pentanecarboxylic acid; Hexanoic acid
|
| 598981 |
C6H12O2 |
Methyl pivalate |
InChI=1S/C6H12O2/c1-6(2,3)5(7)8-4/h1-4H3 |
CC(C)(C)C(OC)=O |
 |
Propanoic acid, 2,2-dimethyl-, methyl ester; Methyl trimethylacetate; 2,2-Dimethylpropanoic acid methyl ester; tert-C4H9COOCH3; Methyl pivalate
|
| 76164 |
C2F6 |
hexafluoroethane |
InChI=1/C2F6/c3-1(4,5)2(6,7)8 |
FC(F)(C(F)(F)F)F |
 |
|
| 540363 |
C6H4F2 |
1,4-difluorobenzene |
InChI=1/C6H4F2/c7-5-1-2-6(8)4-3-5/h1-4H |
FC1=CC=C(F)C=C1 |
 |
Benzene, p-difluoro-; p-Difluorobenzene; Benzene, 1,4-difluoro-; para-Difluorobenzene; 1,4-difluorobenzene
|
| 367113 |
C6H4F2 |
orthodifluorobenzene |
InChI=1S/C6H4F2/c7-5-3-1-2-4-6(5)8/h1-4H |
FC1=CC=CC=C1F |
 |
Benzene, 1,2-difluoro-; Benzene, o-difluoro-; o-Difluorobenzene; 1,2-Difluorobenzene; ortho-Difluorobenzene
|
| 372189 |
C6H4F2 |
metadifluorobenzene |
InChI=1S/C6H4F2/c7-5-2-1-3-6(8)4-5/h1-4H |
FC1=CC=CC(F)=C1 |
 |
Benzene, 1,3-difluoro-; Benzene, m-difluoro-
Benzene, m-difluoro-; m-Difluorobenzene; 1,3-Difluorobenzene; meta-Difluorobenzene
|
| 10544500 |
S8 |
Octasulfur |
InChI=1/S8/c1-2-4-6-8-7-5-3-1 |
S1SSSSSSS1 |
 |
Cyclic octaatomic sulfur; Sulfur molecule; Cyclooctasulfur; Sulfur (S8); Sulfur; Octathiocane; Orthorhombic sulfur; Sulfur octamer; Cyclooctasulphur
|
| 374072 |
CF3CFCl2 |
1,1-Dichlorotetrafluoroethane |
InChI=1S/C2Cl2F4/c3-1(4,5)2(6,7)8 |
ClC(F)(Cl)C(F)(F)F |
 |
Ethane, 1,1-dichloro-1,2,2,2-tetrafluoro-; Ethane, 1,1-dichlorotetrafluoro-; Frigen 114A; 1,1-Dichloro-1,2,2,2-tetrafluoroethane; 1,1,1,2-Tetrafluoro-2,2-dichloroethane
|
| 76131 |
CF2ClCFCl2 |
Ethane, 1,1,2-trichloro-1,2,2-trifluoro- |
InChI=1S/C2Cl3F3/c3-1(4,6)2(5,7)8 |
FC(Cl)(Cl)C(F)(F)Cl |
 |
Freon 113; 1,1,2-Trichloro-1,2,2-Trifluoroethane; Freon TF; 1,1,2-trichlorotrifluoroethane; CFC-113
|
| 76142 |
CF2ClCF2Cl |
1,2-Dichloro-1,1,2,2-tetrafluoroethane |
InChI=1S/C2Cl2F4/c3-1(5,6)2(4,7)8 |
ClC(F)(F)C(F)(F)Cl |
 |
Ethane, 1,2-dichloro-1,1,2,2-tetrafluoro-; Dichlorotetrafluoroethane; Ethane, 1,2-dichlorotetrafluoro-; s-Dichlorotetrafluoroethane; Arcton 114; Fluorocarbon 114; Freon 114; CFC-114; Dichloro-1,1,2,2-tetrafluoroethane; Refrigerant R114; 1,2-dichloro-1,1,2,2-tetrafluoroethane
|
| 76153 |
CF3CF2Cl |
pentafluorochloroethane |
InChI=1S/C2ClF5/c3-1(4,5)2(6,7)8 |
FC(F)(F)C(F)(Cl)F |
 |
Ethane, chloropentafluoro-; Pentafluoroethyl chloride; F-115; Fluorocarbon 115; Freon 115; FC 115; R 115; 1-Chloro-1,1,2,2,2-Pentafluoroethane; Chloropentafluoroethane; Monochloropentafluoroethane; 1-chloro-1,1,2,2,2-pentafluoroethane
|
| 67721 |
C2Cl6 |
hexachloroethane |
InChI=1S/C2Cl6/c3-1(4,5)2(6,7)8 |
ClC(Cl)(Cl)C(Cl)(Cl)Cl |
 |
Avlothane; Distokal; Hexachlorethane; Mottenhexe; Perchloroethane; Phenohep; Ethane hexachloride; 1,1,1,2,2,2-Hexachloroethane; Hexachlor-aethan; NCI-C04604; NA 9037; Rcra waste number U131; Distopan; Egitol; Falkitol; Fasciolin
|
| 120730 |
C5H4N4 |
purine |
InChI=1S/C5H4N4/c1-4-5(8-2-6-1)9-3-7-4/h1-3H,(H,6,7,8,9) |
C12=C(N=CN2)C=NC=N1 |
 |
|
| 120729 |
C8H7N |
Indole |
InChI=1S/C8H7N/c1-2-4-8-7(3-1)5-6-9-8/h1-6,9H |
C12=C(C=CC=C2)C=CN1 |
 |
1H-Indole; Ketole; 1-Azaindene; 1-Benzazole; 2,3-Benzopyrrole; Benzopyrrole; Indol; 1-H-indol
|
| 98953 |
C6H5NO2 |
Nitrobenzene |
InChI=1/C6H5NO2/c8-7(9)6-4-2-1-3-5-6/h1-5H |
O=[N+]([O-])C1=CC=CC=C1 |
 |
Nitrobenzeen; Nitrobenzen; U169; Essence of Myrbane; UN 1662; Mirbane oil; Nitrobenzol; Oil of Myrbane; NCI-C60082; Oil of Mirbane; Essence of Mirbane; Benzene, nitro-; nitrobenzene
|
| 65850 |
C6H5COOH |
benzoic acid |
InChI=1/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9) |
OC(=O)C1=CC=CC=C1 |
 |
Benzenecarboxylic acid; Benzeneformic acid; Benzenemethanoic acid; Carboxybenzene; Phenylcarboxylic acid; benzoic acid
|
| 91203 |
C10H8 |
naphthalene |
InChI=1/C10H8/c1-2-6-10-8-4-3-7-9(10)5-1/h1-8H |
C12=CC=CC=C1C=CC=C2 |
 |
White tar; Camphor tar; Naftalen; Moth balls; NCI-C52904; Rcra waste number U165; UN 1334; UN 2304; Naphthaline; Tar camphor; Moth flakes; Naphthalin; Albocarbon; Naphthene; Dezodorator; naphthalene
|
| 275514 |
C10H8 |
Azulene |
InChI=1S/C10H8/c1-2-5-9-7-4-8-10(9)6-3-1/h1-8H |
C12=CC=CC=CC1=CC=C2 |
 |
Bicyclo[5.3.0]decapentaene; Cyclopentacycloheptene; Bicyclo(5.3.0)-1,3,5,7,9-decapentaene; azulene
|
| 281232 |
C10H16 |
adamantane |
InChI=1/C10H16/c1-7-2-9-4-8(1)5-10(3-7)6-9/h7-10H,1-6H2 |
C1(C2)CC3CC(CC2C3)C1 |
 |
Tricyclo[3.3.1.1(3,7)]decane; adamantane
|
| 373808 |
SF5CF3 |
Sulfur, pentafluoro(trifluoromethyl)- |
InChI=1S/CF8S/c2-1(3,4)10(5,6,7,8)9 |
FC(F)(F)S(F)(F)(F)(F)F |
 |
Pentafluoro(trifluoromethyl)sulfur; Trifluoromethylsulfur pentafluoride
|
| 76197 |
C3F8 |
perfluoropropane |
InChI=1S/C3F8/c4-1(5,2(6,7)8)3(9,10)11 |
FC(F)(F)C(F)(F)C(F)(F)F |
 |
Octafluoropropane; Propane, octafluoro-; Freon 218; Genetron 218; perfluoropropane
|
| 259790 |
C12H8 |
biphenylene |
InChI=1S/C12H8/c1-2-6-10-9(5-1)11-7-3-4-8-12(10)11/h1-8H |
C12=C(C=CC=C2)C3=CC=CC=C13 |
 |
Cyclobutadibenzene; Diphenylene; 1,1'-Biphenylene; Dibenzocyclobutadiene; biphenylene
|
| 92524 |
C12H10 |
biphenyl |
InChI=1/C12H10/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-10H |
C1(C2=CC=CC=C2)=CC=CC=C1 |
 |
Bibenzene; Diphenyl; Phenylbenzene; 1,1'-Biphenyl; Lemonene
|
| 392563 |
C6F6 |
hexafluorobenzene |
InChI=1S/C6F6/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
FC1=C(F)C(F)=C(F)C(F)=C1F |
 |
Benzene, hexafluoro-; perfluorobenzene
|
| 120127 |
C14H10 |
Anthracene |
InChI=1S/C14H10/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h1-10H |
C12=CC=CC=C1C=C3C(C=CC=C3)=C2 |
 |
Anthracin; Paranaphthalene; Anthracen; Anthracene
|