|
|
I.B.3. (II.A.2.) |
| Other names |
|---|
| 1-Propene, 2-methyl-; γ-Butylene; 1,1-Dimethylethylene; 2-Methyl-1-propene; 2-Methylpropene; 2-Methylpropene-isobutylene; Isobutene; Isobutylene; iso-C4H8; Isopropylidenemethylene; Liquefied petroleum gas; Methylpropene; Propene, 2-methyl-; UN 1055; UN 1075; gamma-Butylene; 2-methylprop-1-ene; |
| INChI |
|---|
| InChI=1/C4H8/c1-4(2)3/h1H2,2-3H3 |
| Property | Experiment | Calculated | Comparison | |
|---|---|---|---|---|
| Energies Entropies |
Enthalpy 298.15K ![]() |
x | ||
Enthalpy 0K ![]() |
x | |||
| Energy 0K | 233 | |||
| Energy 298.15K | 221 | |||
| Atomization Enthalpy 298.15K | x | 215 | x | |
| Atomization Enthalpy 0K | x | 216 | x | |
Entropy (298.15K) ![]() |
x | 191 | x | |
| Entropy at any temperature | 191 | |||
Integrated Heat Capacity ![]() |
x | 190 | x | |
Heat Capacity (Cp) ![]() |
x | 190 | x | |
| Nuclear Repulsion Energy | 196 | |||
HOMO-LUMO Energies ![]() |
188 | |||
Barriers to Internal Rotation ![]() |
12 | |||
| Geometries | Cartesians | 168 | ||
Internal Coordinates ![]() |
x | 168 | x | |
Products of moments of inertia ![]() |
x | 183 | x | |
Rotational Constants ![]() |
x | 187 | x | |
| Point Group | 188 | |||
| Vibrations | Vibrational Frequencies ![]() |
x | 186 | x |
| Vibrational Intensities | 183 | |||
| Zero-point energies | 186 | |||
| Vibrational scaling factors | ||||
| Anharmonic frequencies and constants | 3 | |||
| Electronic States | Electronic states | x | 0 | |
| Electrostatics | Atom charges | 157 | ||
Dipole ![]() |
x | 155 | x | |
Quadrupole ![]() |
149 | |||
Polarizability ![]() |
133 | |||
| Other results | Spin | 0 | ||
| Number of basis functions | 27 | |||
| Diagnostics | 5 | |||
| Conformations | 1 | |||