|
|
I.B.3. (II.A.2.) |
| Other names |
|---|
| 1,4-Diazabicyclo[2.2.2]octane; Bicyclo[2.2.2]-1,4-diazaoctane; Dabco; Dabco 33LV; N,N'-endo-Ethylenepiperazine; 1,4-Diaza[2.2.2]bicyclooctane; 1,4-Ethylenepiperazine; ,4-Diazabicyclo[2,2,2] octane; Bicyclo[2.2.2]octane, 1,4-diaza-; 1,4-Diazobicyclo(2.2.2)octane; Bicyclo(2,2,2)-1,4-diazaoctane; |
| INChI |
|---|
| InChI=1S/C6H12N2/c1-2-8-5-3-7(1)4-6-8/h1-6H2 |
| Property | Experiment | Calculated | Comparison | |
|---|---|---|---|---|
| Energies Entropies |
Enthalpy 298.15K ![]() |
x | ||
Enthalpy 0K ![]() |
||||
| Energy 0K | 200 | |||
| Energy 298.15K | 8 | |||
| Atomization Enthalpy 298.15K | 6 | |||
| Atomization Enthalpy 0K | 170 | |||
Entropy (298.15K) ![]() |
0 | |||
| Entropy at any temperature | 0 | |||
Integrated Heat Capacity ![]() |
0 | |||
Heat Capacity (Cp) ![]() |
0 | |||
| Nuclear Repulsion Energy | 195 | |||
HOMO-LUMO Energies ![]() |
193 | |||
Barriers to Internal Rotation ![]() |
0 | |||
| Geometries | Cartesians | 193 | ||
Internal Coordinates ![]() |
0 | |||
Products of moments of inertia ![]() |
179 | |||
Rotational Constants ![]() |
186 | |||
| Point Group | 196 | |||
| Vibrations | Vibrational Frequencies ![]() |
195 | ||
| Vibrational Intensities | 194 | |||
| Zero-point energies | 195 | |||
| Vibrational scaling factors | ||||
| Anharmonic frequencies and constants | ||||
| Electronic States | Electronic states | 0 | ||
| Electrostatics | Atom charges | 125 | ||
Dipole ![]() |
125 | |||
Quadrupole ![]() |
125 | |||
Polarizability ![]() |
126 | |||
| Other results | Spin | 0 | ||
| Number of basis functions | 28 | |||
| Diagnostics | 0 | |||
| Conformations | 2 | x | ||