|
|
I.B.3. (II.A.2.) |
| Other names |
|---|
| 2,3-Butadione; 2,3-Butanedione; 2,3-Diketobutane; 2,3-Dioxobutane; Biacetyl; Butadione; Butane-2,3-dione; Butanedione; Diacetyl; Dimethyl diketone; Dimethyl glyoxal; Glyoxal, dimethyl-; UN 2346; |
| INChI |
|---|
| InChI=1/C4H6O2/c1-3(5)4(2)6/h1-2H3 |
| Property | Experiment | Calculated | Comparison | |
|---|---|---|---|---|
| Energies Entropies |
Enthalpy 298.15K ![]() |
x | ||
Enthalpy 0K ![]() |
||||
| Energy 0K | 226 | |||
| Energy 298.15K | 16 | |||
| Atomization Enthalpy 298.15K | x | 12 | x | |
| Atomization Enthalpy 0K | 200 | |||
Entropy (298.15K) ![]() |
0 | |||
| Entropy at any temperature | 0 | |||
Integrated Heat Capacity ![]() |
0 | |||
Heat Capacity (Cp) ![]() |
0 | |||
| Nuclear Repulsion Energy | 229 | |||
HOMO-LUMO Energies ![]() |
222 | |||
Barriers to Internal Rotation ![]() |
0 | |||
| Geometries | Cartesians | 229 | ||
Internal Coordinates ![]() |
x | 229 | x | |
Products of moments of inertia ![]() |
216 | |||
Rotational Constants ![]() |
229 | |||
| Point Group | 230 | |||
| Vibrations | Vibrational Frequencies ![]() |
x | 239 | x |
| Vibrational Intensities | 239 | |||
| Zero-point energies | 239 | |||
| Vibrational scaling factors | ||||
| Anharmonic frequencies and constants | 1 | |||
| Electronic States | Electronic states | x | 0 | |
| Electrostatics | Atom charges | 154 | ||
Dipole ![]() |
154 | |||
Quadrupole ![]() |
154 | |||
Polarizability ![]() |
155 | |||
| Other results | Spin | 0 | ||
| Number of basis functions | 30 | |||
| Diagnostics | 3 | |||
| Conformations | 3 | x | ||