|
|
I.B.3. (II.A.2.) |
| Other names |
|---|
| α-Alanine; α-Aminopropionic acid; (S)-2-Aminopropanoic acid; (S)-Alanine; Alanine; Alanine, L-; L-(+)-Alanine; L-α-Alanine; L-α-Aminopropionic acid; L-2-Aminopropanoic acid; L-2-Aminopropionic acid; L-Alanine; L-CH3CH(NH2)COOH; Propanoic acid, 2-amino-; Propanoic acid, 2-amino-, (S)-; Ala; alpha-Alanine; alpha-Aminopropionic acid; 2-aminopropanoic acid; |
| INChI |
|---|
| InChI=1/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/t2-/m0/s1 |
| Property | Experiment | Calculated | Comparison | |
|---|---|---|---|---|
| Energies Entropies |
Enthalpy 298.15K ![]() |
x | ||
Enthalpy 0K ![]() |
||||
| Energy 0K | 184 | |||
| Energy 298.15K | 171 | |||
| Atomization Enthalpy 298.15K | x | 158 | x | |
| Atomization Enthalpy 0K | 160 | |||
Entropy (298.15K) ![]() |
159 | |||
| Entropy at any temperature | 159 | |||
Integrated Heat Capacity ![]() |
159 | |||
Heat Capacity (Cp) ![]() |
159 | |||
| Nuclear Repulsion Energy | 183 | |||
HOMO-LUMO Energies ![]() |
180 | |||
Barriers to Internal Rotation ![]() |
0 | |||
| Geometries | Cartesians | 172 | ||
Internal Coordinates ![]() |
x | 0 | x | |
Products of moments of inertia ![]() |
x | 176 | x | |
Rotational Constants ![]() |
x | 183 | x | |
| Point Group | 184 | |||
| Vibrations | Vibrational Frequencies ![]() |
181 | ||
| Vibrational Intensities | 181 | |||
| Zero-point energies | 181 | |||
| Vibrational scaling factors | ||||
| Anharmonic frequencies and constants | 3 | |||
| Electronic States | Electronic states | x | 0 | |
| Electrostatics | Atom charges | 128 | ||
Dipole ![]() |
125 | |||
Quadrupole ![]() |
126 | |||
Polarizability ![]() |
126 | |||
| Other results | Spin | 0 | ||
| Number of basis functions | 26 | |||
| Diagnostics | 4 | |||
| Conformations | 1 | |||