|
|
I.B.3. (II.A.2.) |
| Other names |
|---|
| 2-Oxetanone, 4-methylene-; 3-Butenoic acid, 3-hydroxy-, β-lactone; 4-Methylene-2-oxetanone; Diketen; Diketene; Ethenone, dimer; Ketene dimer; Vinylaceto-β-lactone; 4-methyleneoxetan-2-one; |
| INChI |
|---|
| InChI=1/C4H4O2/c1-3-2-4(5)6-3/h1-2H2 |
| Property | Experiment | Calculated | Comparison | |
|---|---|---|---|---|
| Energies Entropies |
Enthalpy 298.15K ![]() |
x | ||
Enthalpy 0K ![]() |
||||
| Energy 0K | 174 | |||
| Energy 298.15K | 164 | |||
| Atomization Enthalpy 298.15K | x | 159 | x | |
| Atomization Enthalpy 0K | 160 | |||
Entropy (298.15K) ![]() |
150 | |||
| Entropy at any temperature | 150 | |||
Integrated Heat Capacity ![]() |
150 | |||
Heat Capacity (Cp) ![]() |
x | 150 | x | |
| Nuclear Repulsion Energy | 168 | |||
HOMO-LUMO Energies ![]() |
160 | |||
Barriers to Internal Rotation ![]() |
0 | |||
| Geometries | Cartesians | 142 | ||
Internal Coordinates ![]() |
142 | |||
Products of moments of inertia ![]() |
160 | |||
Rotational Constants ![]() |
164 | |||
| Point Group | 164 | |||
| Vibrations | Vibrational Frequencies ![]() |
162 | ||
| Vibrational Intensities | 161 | |||
| Zero-point energies | 162 | |||
| Vibrational scaling factors | ||||
| Anharmonic frequencies and constants | 3 | |||
| Electronic States | Electronic states | x | 0 | |
| Electrostatics | Atom charges | 145 | ||
Dipole ![]() |
147 | |||
Quadrupole ![]() |
144 | |||
Polarizability ![]() |
128 | |||
| Other results | Spin | 0 | ||
| Number of basis functions | 22 | |||
| Diagnostics | 3 | |||
| Conformations | 1 | |||