|
|
I.B.3. (II.A.2.) |
| Other names |
|---|
| 1,3-Butadiene, 2-methyl-; β-Methylbivinyl; 2-Methyl-1,3-butadiene; 2-Methylbuta-1,3-diene; 2-Methylbutadiene; Isopentadiene; Isoprene; Isoprene, inhibited; UN 1218; beta-Methylbivinyl; |
| INChI |
|---|
| InChI=1/C5H8/c1-4-5(2)3/h4H,1-2H2,3H3 |
| Property | Experiment | Calculated | Comparison | |
|---|---|---|---|---|
| Energies Entropies |
Enthalpy 298.15K ![]() |
x | ||
Enthalpy 0K ![]() |
x | |||
| Energy 0K | 177 | |||
| Energy 298.15K | 166 | |||
| Atomization Enthalpy 298.15K | x | 161 | x | |
| Atomization Enthalpy 0K | x | 164 | x | |
Entropy (298.15K) ![]() |
x | 158 | x | |
| Entropy at any temperature | 158 | |||
Integrated Heat Capacity ![]() |
x | 157 | x | |
Heat Capacity (Cp) ![]() |
x | 156 | x | |
| Nuclear Repulsion Energy | 171 | |||
HOMO-LUMO Energies ![]() |
164 | |||
Barriers to Internal Rotation ![]() |
0 | |||
| Geometries | Cartesians | x | 144 | |
Internal Coordinates ![]() |
x | 144 | x | |
Products of moments of inertia ![]() |
x | 161 | x | |
Rotational Constants ![]() |
x | 164 | x | |
| Point Group | 164 | |||
| Vibrations | Vibrational Frequencies ![]() |
x | 167 | x |
| Vibrational Intensities | 167 | |||
| Zero-point energies | 167 | |||
| Vibrational scaling factors | ||||
| Anharmonic frequencies and constants | 2 | |||
| Electronic States | Electronic states | x | 0 | |
| Electrostatics | Atom charges | 144 | ||
Dipole ![]() |
x | 144 | x | |
Quadrupole ![]() |
x | 141 | x | |
Polarizability ![]() |
124 | |||
| Other results | Spin | 0 | ||
| Number of basis functions | 23 | |||
| Diagnostics | 4 | |||
| Conformations | 1 | |||