Computational Chemistry Comparison and Benchmark DataBase Release 22 (May 2022) Standard Reference Database 101 National Institute of Standards and Technology | |
You are here: Experimental > One molecule all properties |
Other names |
---|
Acetyl fluoride; Fluorid kyseliny octove; Methylcarbonyl fluoride; |
INChI | INChIKey | SMILES | IUPAC name |
---|---|---|---|
InChI=1S/C2H3FO/c1-2(3)4/h1H3 | JUCMRTZQCZRJDC-UHFFFAOYSA-N | O=C(F)C | Acetyl fluoride |
State | Conformation |
---|---|
1A' | NULL |
Property | Value | Uncertainty | units | Reference | Comment |
---|---|---|---|---|---|
Hfg(298.15K) | -442.10 | kJ mol-1 | TRC | ||
Hfg(0K) | -432.40 | kJ mol-1 | TRC | ||
Entropy (298.15K) | 283.11 | J K-1 mol-1 | TRC | ||
Integrated Heat Capacity (0 to 298.15K) | 13.83 | kJ mol-1 | TRC |
Mode Number | Symmetry | Frequency | Intensity | Comment | Description | ||||
---|---|---|---|---|---|---|---|---|---|
Fundamental(cm-1) | Harmonic(cm-1) | Reference | (km mol-1) | unc. | Reference | ||||
1 | A' | 3043 | webbook | ||||||
2 | A' | 2955 | webbook | ||||||
3 | A' | 1870 | webbook | ||||||
4 | A' | 1440 | webbook | ||||||
5 | A' | 1378 | webbook | ||||||
6 | A' | 1188 | webbook | ||||||
7 | A' | 1000 | webbook | ||||||
8 | A' | 826 | webbook | ||||||
9 | A' | 598 | webbook | ||||||
10 | A' | 420 | webbook | ||||||
11 | A" | 3004 | webbook | ||||||
12 | A" | 1437 | webbook | ||||||
13 | A" | 1054 | webbook | ||||||
14 | A" | 567 | webbook | ||||||
15 | A" | 123 | webbook |
A | B | C | reference | comment |
---|---|---|---|---|
0.36823 | 0.32308 | 0.17752 | 1959Pie/Kri:875 |
Product of moments of inertia | ||||
---|---|---|---|---|
226831.4 | amu3Å6 | 1.03865472948581E-114 | gm3 cm6 |
Point Group Cs
Description | Value | unc. | Connectivity | Reference | Comment | |||
---|---|---|---|---|---|---|---|---|
Atom 1 | Atom 2 | Atom 3 | Atom 4 | |||||
rCC | 1.503 | 1 | 2 | 1959Pie/Kri:875 | ||||
rCF | 1.348 | 1 | 4 | 1959Pie/Kri:875 | ||||
rCO | 1.181 | 1 | 3 | 1959Pie/Kri:875 | ||||
rCH | 1.084 | 2 | 5 | 1959Pie/Kri:875 | ||||
aCCF | 110.3 | 2 | 1 | 4 | 1959Pie/Kri:875 | |||
aCCO | 128.35 | 2 | 1 | 3 | 1959Pie/Kri:875 | |||
aHCC | 110.4 | 1 | 2 | 5 | 1959Pie/Kri:875 | |||
aHCH | 110.85 | 5 | 2 | 6 | 1959Pie/Kri:875 |
Atom | x (Å) | y (Å) | z (Å) |
---|---|---|---|
C1 | 0.0000 | 0.1904 | 0.0000 |
C2 | 0.9884 | -0.9419 | 0.0000 |
O3 | 0.2158 | 1.3515 | 0.0000 |
F4 | -1.2600 | -0.2887 | 0.0000 |
H5 | 2.0023 | -0.5584 | 0.0000 |
H6 | 0.8401 | -1.5729 | 0.8688 |
H7 | 0.8401 | -1.5729 | -0.8688 |
C1 | C2 | O3 | F4 | H5 | H6 | H7 | |
---|---|---|---|---|---|---|---|
C1 | 1.5030 | 1.1810 | 1.3480 | 2.1377 | 2.1377 | 2.1377 | |
C2 | 1.5030 | 2.4200 | 2.3414 | 1.0840 | 1.0840 | 1.0840 | |
O3 | 1.1810 | 2.4200 | 2.2064 | 2.6152 | 3.1140 | 3.1140 | |
F4 | 1.3480 | 2.3414 | 2.2064 | 3.2734 | 2.6104 | 2.6104 | |
H5 | 2.1377 | 1.0840 | 2.6152 | 3.2734 | 1.7705 | 1.7705 | |
H6 | 2.1377 | 1.0840 | 3.1140 | 2.6104 | 1.7705 | 1.7377 | |
H7 | 2.1377 | 1.0840 | 3.1140 | 2.6104 | 1.7705 | 1.7377 |
Experimental Bond Angles (degrees) from cartesians
atom1 | atom2 | atom3 | angle | atom1 | atom2 | atom3 | angle | |
---|---|---|---|---|---|---|---|---|
C1 | C2 | H5 | 110.400 | C1 | C2 | H6 | 110.400 | |
C1 | C2 | H7 | 110.400 | C2 | C1 | O3 | 128.350 | |
C2 | C1 | F4 | 110.300 | O3 | C1 | F4 | 121.350 | |
H5 | C2 | H6 | 109.506 | H5 | C2 | H7 | 109.506 | |
H6 | C2 | H7 | 106.549 |
Bond descriptions
Bond Type | Count |
---|---|
C-C | 1 |
C-F | 1 |
C=O | 1 |
H-C | 3 |
Atom 1 | Atom 2 |
---|---|
C1 | C2 |
C1 | O3 |
C1 | F4 |
C2 | H5 |
C2 | H6 |
C2 | H7 |
Energy (cm-1) | Degeneracy | reference | description |
---|---|---|---|
0 | 1 | 1A' |
Ionization Energy | I.E. unc. | vertical I.E. | v.I.E. unc. | reference |
---|---|---|---|---|
11.510 | 0.020 | webbook |
State | Config | State description | Conf description | Exp. min. | Dipole (Debye) | Reference | comment | Point Group | Components | ||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|
x | y | z | total | dipole | quadrupole | ||||||||
1 | 1 | 1A' | NULL | True | 2.960 | NSRDS-NBS10 | MW | Cs | 2 | 3 |
State | Config | State description | Conf description | Exp. min. | Quadrupole (D Å) | Reference | comment | Point Group | Components | |||
---|---|---|---|---|---|---|---|---|---|---|---|---|
xx | yy | zz | dipole | quadrupole | ||||||||
1 | 1 | 1A' | NULL | True | Cs | 2 | 3 |
squib | reference | DOI |
---|---|---|
1959Pie/Kri:875 | Pierce, Krisher, Microwave Spectrum, Internal Barrier, Structure, Conformation, and Dipole Moment of Acetyl Fluoride, J. Chem. Phys., Vol. 31, #4, pgs. 875-882 | 10.1063/1.1730542 |
NSRDS-NBS10 | R. D. Nelson Jr., D. R. Lide, A. A. Maryott "Selected Values of electric dipole moments for molecules in the gas phase" NSRDS-NBS10, 1967 | 10.6028/NBS.NSRDS.10 |
TRC | Frenkel, M; Marsh, K.N.; Wilhoit, R.C.; Kabo, G.J.; Roganov, G.N.,Thermodynamics of Organic Compounds in the Gas State,Thermodynamics Research Center, College Station, TX, 1994 | |
webbook | NIST Chemistry Webbook (http://webbook.nist.gov/chemistry) | 10.18434/T4D303 |
Got a better number? Please email us at
cccbdb@nist.gov
Browse | |
---|---|
Previous | Next |