|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3NO2 (Methane, nitro-)
1A' CS Os out of place
1910171554
InChI=1S/CH3NO2/c1-2(3)4/h1H3 INChIKey=LYGJENNIWJXYER-UHFFFAOYSA-N
B2PLYP/aug-cc-pVTZ
Point group is Cs
Atom |
Internal |
|
Principal |
x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
C1 |
0.0216 |
-1.3155 |
0.0000 |
|
0.0000 |
0.0216 |
-1.3155 |
N2 |
-0.0952 |
0.1775 |
0.0000 |
|
-0.0002 |
-0.0952 |
0.1775 |
H3 |
1.0817 |
-1.5523 |
0.0000 |
|
0.0020 |
1.0817 |
-1.5523 |
H4 |
-0.4450 |
-1.6908 |
0.9016 |
|
0.9008 |
-0.4466 |
-1.6908 |
H5 |
-0.4450 |
-1.6908 |
-0.9016 |
|
-0.9024 |
-0.4434 |
-1.6908 |
O6 |
0.0216 |
0.7240 |
-1.0814 |
|
-1.0813 |
0.0235 |
0.7240 |
O7 |
0.0216 |
0.7240 |
1.0814 |
|
1.0814 |
0.0196 |
0.7240 |
Atom - Atom Distances (Å)
|
C1 |
N2 |
H3 |
H4 |
H5 |
O6 |
O7 |
C1 |
|
1.4976 |
1.0863 |
1.0823 |
1.0823 |
2.3085 |
2.3085 |
N2 |
1.4976 |
| 2.0922 |
2.1038 |
2.1038 |
1.2172 |
1.2172 |
H3 |
1.0863 |
2.0922 |
| 1.7785 |
1.7785 |
2.7340 |
2.7340 |
H4 |
1.0823 |
2.1038 |
1.7785 |
| 1.8032 |
3.1593 |
2.4660 |
H5 |
1.0823 |
2.1038 |
1.7785 |
1.8032 |
| 2.4660 |
3.1593 |
O6 |
2.3085 |
1.2172 |
2.7340 |
3.1593 |
2.4660 |
| 2.1628 |
O7 |
2.3085 |
1.2172 |
2.7340 |
2.4660 |
3.1593 |
2.1628 |
|
Maximum atom distance is 3.1593Å
between atoms H4 and O6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
C1 |
N2 |
O6 |
116.110 |
|
C1 |
N2 |
O7 |
116.110 |
O6 |
N2 |
O7 |
125.346 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
N2 |
C1 |
H3 |
107.060 |
|
N2 |
C1 |
H4 |
108.186 |
N2 |
C1 |
H5 |
108.186 |
|
H3 |
C1 |
H4 |
110.189 |
H3 |
C1 |
H5 |
110.189 |
|
H4 |
C1 |
H5 |
112.823 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.