|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for N2O4 (Dinitrogen tetroxide)
1Ag D2D
1910171554
InChI=1S/N2O4/c3-1(4)2(5)6 INChIKey=WFPZPJSADLPSON-UHFFFAOYSA-N
BLYP/3-21G
Point group is D2h
Atom |
Internal |
|
Principal |
x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
N1 |
0.0000 |
0.0000 |
0.9382 |
|
0.9382 |
0.0000 |
0.0000 |
N2 |
0.0000 |
0.0000 |
-0.9382 |
|
-0.9382 |
0.0000 |
0.0000 |
O3 |
0.0000 |
1.1684 |
1.4156 |
|
1.4156 |
1.1684 |
0.0000 |
O4 |
0.0000 |
-1.1684 |
1.4156 |
|
1.4156 |
-1.1684 |
0.0000 |
O5 |
0.0000 |
1.1684 |
-1.4156 |
|
-1.4156 |
1.1684 |
0.0000 |
O6 |
0.0000 |
-1.1684 |
-1.4156 |
|
-1.4156 |
-1.1684 |
0.0000 |
Atom - Atom Distances (Å)
|
N1 |
N2 |
O3 |
O4 |
O5 |
O6 |
N1 |
| 1.8763 |
1.2622 |
1.2622 |
2.6278 |
2.6278 |
N2 |
1.8763 |
| 2.6278 |
2.6278 |
1.2622 |
1.2622 |
O3 |
1.2622 |
2.6278 |
| 2.3369 |
2.8312 |
3.6711 |
O4 |
1.2622 |
2.6278 |
2.3369 |
| 3.6711 |
2.8312 |
O5 |
2.6278 |
1.2622 |
2.8312 |
3.6711 |
| 2.3369 |
O6 |
2.6278 |
1.2622 |
3.6711 |
2.8312 |
2.3369 |
|
Maximum atom distance is 3.6711Å
between atoms O3 and O6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
N1 |
N2 |
O5 |
112.226 |
|
N1 |
N2 |
O6 |
112.226 |
N2 |
N1 |
O3 |
112.226 |
|
N2 |
N1 |
O4 |
112.226 |
O3 |
N1 |
O4 |
135.547 |
|
O5 |
N2 |
O6 |
135.547 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.