|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH2CCl2 (Ethene, 1,1-dichloro-)
1A1 C2V
1910171554
InChI=1S/C2H2Cl2/c1-2(3)4/h1H2 INChIKey=LGXVIGDEPROXKC-UHFFFAOYSA-N
PBEPBE/cc-pVDZ
Point group is C2v
Atom |
Internal |
|
Principal |
x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
C1 |
0.0000 |
0.0000 |
1.7660 |
|
1.7660 |
0.0000 |
0.0000 |
C2 |
0.0000 |
0.0000 |
0.4244 |
|
0.4244 |
0.0000 |
0.0000 |
H3 |
0.0000 |
0.9490 |
2.3170 |
|
2.3170 |
0.0000 |
0.9490 |
H4 |
0.0000 |
-0.9490 |
2.3170 |
|
2.3170 |
0.0000 |
-0.9490 |
Cl5 |
0.0000 |
1.4657 |
-0.5228 |
|
-0.5228 |
0.0000 |
1.4657 |
Cl6 |
0.0000 |
-1.4657 |
-0.5228 |
|
-0.5228 |
0.0000 |
-1.4657 |
Atom - Atom Distances (Å)
|
C1 |
C2 |
H3 |
H4 |
Cl5 |
Cl6 |
C1 |
|
1.3416 |
1.0974 |
1.0974 |
2.7178 |
2.7178 |
C2 |
1.3416 |
| 2.1172 |
2.1172 |
1.7451 |
1.7451 |
H3 |
1.0974 |
2.1172 |
| 1.8980 |
2.8865 |
3.7276 |
H4 |
1.0974 |
2.1172 |
1.8980 |
| 3.7276 |
2.8865 |
Cl5 |
2.7178 |
1.7451 |
2.8865 |
3.7276 |
| 2.9313 |
Cl6 |
2.7178 |
1.7451 |
3.7276 |
2.8865 |
2.9313 |
|
Maximum atom distance is 3.7276Å
between atoms H3 and Cl6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
C1 |
C2 |
Cl5 |
122.874 |
|
C1 |
C2 |
Cl6 |
122.874 |
Cl5 |
C2 |
Cl6 |
114.252 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
C2 |
C1 |
H3 |
120.143 |
|
C2 |
C1 |
H4 |
120.143 |
H3 |
C1 |
H4 |
119.714 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.