|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHOCH(CH3)CH3 (Propanal, 2-methyl-)
1A' CS
1910171554
InChI=1S/C4H8O/c1-4(2)3-5/h3-4H,1-2H3 INChIKey=AMIMRNSIRUDHCM-UHFFFAOYSA-N
G4
This model chemistry uses a geometry from
B3LYP/6-31G(2df,p)
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| H1 |
-0.2237 |
0.6103 |
2.1750 |
|
2.1850 |
-0.0807 |
0.6103 |
| H2 |
-0.2237 |
0.6103 |
-2.1750 |
|
-2.1557 |
-0.3656 |
0.6103 |
| H3 |
-1.6931 |
0.0963 |
-1.3284 |
|
-1.2147 |
-1.7765 |
0.0963 |
| H4 |
-1.6931 |
0.0963 |
1.3284 |
|
1.4364 |
-1.6025 |
0.0963 |
| H5 |
-1.1891 |
1.7899 |
1.2718 |
|
1.3470 |
-1.1033 |
1.7899 |
| H6 |
-1.1891 |
1.7899 |
-1.2718 |
|
-1.1912 |
-1.2699 |
1.7899 |
| C7 |
-0.8219 |
0.7591 |
-1.2712 |
|
-1.2146 |
-0.9034 |
0.7591 |
| C8 |
-0.8219 |
0.7591 |
1.2712 |
|
1.3223 |
-0.7369 |
0.7591 |
| H9 |
0.9027 |
1.1050 |
0.0000 |
|
-0.0591 |
0.9008 |
1.1050 |
| C10 |
0.0000 |
0.4854 |
0.0000 |
|
0.0000 |
0.0000 |
0.4854 |
| C11 |
0.4575 |
-0.9601 |
0.0000 |
|
-0.0300 |
0.4565 |
-0.9601 |
| H12 |
-0.3853 |
-1.6952 |
0.0000 |
|
0.0252 |
-0.3844 |
-1.6952 |
| O13 |
1.6015 |
-1.3330 |
0.0000 |
|
-0.1049 |
1.5981 |
-1.3330 |
Atom - Atom Distances (Å)
| |
H1 |
H2 |
H3 |
H4 |
H5 |
H6 |
C7 |
C8 |
H9 |
C10 |
C11 |
H12 |
O13 |
| H1 |
| 4.3500 |
3.8337 |
1.7721 |
1.7718 |
3.7689 |
3.5009 |
1.0940 |
2.4988 |
2.1900 |
2.7678 |
3.1736 |
3.4407 |
| H2 |
4.3500 |
| 1.7721 |
3.8337 |
3.7689 |
1.7718 |
1.0940 |
3.5009 |
2.4988 |
2.1900 |
2.7678 |
3.1736 |
3.4407 |
| H3 |
3.8337 |
1.7721 |
| 2.6568 |
3.1438 |
1.7680 |
1.0962 |
2.8207 |
3.0856 |
2.1869 |
2.7396 |
2.5854 |
3.8291 |
| H4 |
1.7721 |
3.8337 |
2.6568 |
| 1.7680 |
3.1438 |
2.8207 |
1.0962 |
3.0856 |
2.1869 |
2.7396 |
2.5854 |
3.8291 |
| H5 |
1.7718 |
3.7689 |
3.1438 |
1.7680 |
| 2.5437 |
2.7685 |
1.0943 |
2.5421 |
2.1757 |
3.4484 |
3.7960 |
4.3770 |
| H6 |
3.7689 |
1.7718 |
1.7680 |
3.1438 |
2.5437 |
|
1.0943 |
2.7685 |
2.5421 |
2.1757 |
3.4484 |
3.7960 |
4.3770 |
| C7 |
3.5009 |
1.0940 |
1.0962 |
2.8207 |
2.7685 |
1.0943 |
| 2.5424 |
2.1702 |
1.5383 |
2.4917 |
2.7983 |
3.4447 |
| C8 |
1.0940 |
3.5009 |
2.8207 |
1.0962 |
1.0943 |
2.7685 |
2.5424 |
| 2.1702 |
1.5383 |
2.4917 |
2.7983 |
3.4447 |
| H9 |
2.4988 |
2.4988 |
3.0856 |
3.0856 |
2.5421 |
2.5421 |
2.1702 |
2.1702 |
|
1.0949 |
2.1126 |
3.0822 |
2.5362 |
| C10 |
2.1900 |
2.1900 |
2.1869 |
2.1869 |
2.1757 |
2.1757 |
1.5383 |
1.5383 |
1.0949 |
|
1.5161 |
2.2143 |
2.4231 |
| C11 |
2.7678 |
2.7678 |
2.7396 |
2.7396 |
3.4484 |
3.4484 |
2.4917 |
2.4917 |
2.1126 |
1.5161 |
|
1.1183 |
1.2033 |
| H12 |
3.1736 |
3.1736 |
2.5854 |
2.5854 |
3.7960 |
3.7960 |
2.7983 |
2.7983 |
3.0822 |
2.2143 |
1.1183 |
| 2.0195 |
| O13 |
3.4407 |
3.4407 |
3.8291 |
3.8291 |
4.3770 |
4.3770 |
3.4447 |
3.4447 |
2.5362 |
2.4231 |
1.2033 |
2.0195 |
|
Maximum atom distance is 4.3770Å
between atoms H5 and O13.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C7 |
C10 |
C8 |
111.433 |
|
C7 |
C10 |
C11 |
109.504 |
|
C8 |
C10 |
C11 |
109.504 |
|
C10 |
C11 |
O13 |
125.429 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
H1 |
C8 |
H4 |
108.036 |
|
H1 |
C8 |
H5 |
108.059 |
|
H1 |
C8 |
C10 |
111.469 |
|
H2 |
C7 |
H3 |
108.036 |
|
H2 |
C7 |
H6 |
108.059 |
|
H2 |
C7 |
C10 |
111.469 |
|
H3 |
C7 |
H6 |
107.668 |
|
H3 |
C7 |
C10 |
111.127 |
|
H4 |
C8 |
H5 |
107.668 |
|
H4 |
C8 |
C10 |
111.127 |
|
H5 |
C8 |
C10 |
110.340 |
|
H6 |
C7 |
C10 |
110.340 |
|
C7 |
C10 |
H9 |
109.809 |
|
C8 |
C10 |
H9 |
109.809 |
|
H9 |
C10 |
C11 |
106.665 |
|
C10 |
C11 |
H12 |
113.605 |
|
H12 |
C11 |
O13 |
120.966 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.