|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C4H6O2 (2,3-Butanedione)
1Ag C2H
1910171554
InChI=1S/C4H6O2/c1-3(5)4(2)6/h1-2H3 INChIKey=QSJXEFYPDANLFS-UHFFFAOYSA-N
G3MP2
This model chemistry uses a geometry from
MP2=FULL/6-31G*
Point group is C2h
| Atom |
Internal |
| x (Å) |
y (Å) |
z (Å) |
| C1 |
-0.0733 |
0.7634 |
0.0000 |
| C2 |
0.0733 |
-0.7634 |
0.0000 |
| C3 |
1.1982 |
1.5613 |
0.0000 |
| C4 |
-1.1982 |
-1.5613 |
0.0000 |
| O5 |
-1.1982 |
1.2569 |
0.0000 |
| O6 |
1.1982 |
-1.2569 |
0.0000 |
| H7 |
0.9573 |
2.6242 |
0.0000 |
| H8 |
-0.9573 |
-2.6242 |
0.0000 |
| H9 |
1.7997 |
1.3074 |
0.8768 |
| H10 |
1.7997 |
1.3074 |
-0.8768 |
| H11 |
-1.7997 |
-1.3074 |
0.8768 |
| H12 |
-1.7997 |
-1.3074 |
-0.8768 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
C3 |
C4 |
O5 |
O6 |
H7 |
H8 |
H9 |
H10 |
H11 |
H12 |
| C1 |
|
1.5337 |
1.5011 |
2.5826 |
1.2285 |
2.3871 |
2.1272 |
3.5010 |
2.1384 |
2.1384 |
2.8350 |
2.8350 |
| C2 |
1.5337 |
| 2.5826 |
1.5011 |
2.3871 |
1.2285 |
3.5010 |
2.1272 |
2.8350 |
2.8350 |
2.1384 |
2.1384 |
| C3 |
1.5011 |
2.5826 |
| 3.9362 |
2.4157 |
2.8182 |
1.0898 |
4.7079 |
1.0932 |
1.0932 |
4.2410 |
4.2410 |
| C4 |
2.5826 |
1.5011 |
3.9362 |
| 2.8182 |
2.4157 |
4.7079 |
1.0898 |
4.2410 |
4.2410 |
1.0932 |
1.0932 |
| O5 |
1.2285 |
2.3871 |
2.4157 |
2.8182 |
| 3.4731 |
2.5526 |
3.8886 |
3.1239 |
3.1239 |
2.7760 |
2.7760 |
| O6 |
2.3871 |
1.2285 |
2.8182 |
2.4157 |
3.4731 |
| 3.8886 |
2.5526 |
2.7760 |
2.7760 |
3.1239 |
3.1239 |
| H7 |
2.1272 |
3.5010 |
1.0898 |
4.7079 |
2.5526 |
3.8886 |
| 5.5867 |
1.7923 |
1.7923 |
4.8813 |
4.8813 |
| H8 |
3.5010 |
2.1272 |
4.7079 |
1.0898 |
3.8886 |
2.5526 |
5.5867 |
| 4.8813 |
4.8813 |
1.7923 |
1.7923 |
| H9 |
2.1384 |
2.8350 |
1.0932 |
4.2410 |
3.1239 |
2.7760 |
1.7923 |
4.8813 |
| 1.7537 |
4.4489 |
4.7820 |
| H10 |
2.1384 |
2.8350 |
1.0932 |
4.2410 |
3.1239 |
2.7760 |
1.7923 |
4.8813 |
1.7537 |
| 4.7820 |
4.4489 |
| H11 |
2.8350 |
2.1384 |
4.2410 |
1.0932 |
2.7760 |
3.1239 |
4.8813 |
1.7923 |
4.4489 |
4.7820 |
| 1.7537 |
| H12 |
2.8350 |
2.1384 |
4.2410 |
1.0932 |
2.7760 |
3.1239 |
4.8813 |
1.7923 |
4.7820 |
4.4489 |
1.7537 |
|
Maximum atom distance is 5.5867Å
between atoms H7 and H8.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.