|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for NH2CH2CH2COOH (β–alanine)
1A C1
1910171554
InChI=1S/C3H7NO2/c4-2-1-3(5)6/h1-2,4H2,(H,5,6) INChIKey=UCMIRNVEIXFBKS-UHFFFAOYSA-N
PM3
Point group is C1
| Atom |
Internal |
| x (Å) |
y (Å) |
z (Å) |
| N1 |
1.8508 |
0.6619 |
0.1099 |
| C2 |
1.3966 |
-0.6766 |
-0.3505 |
| C3 |
0.0728 |
-1.0366 |
0.3151 |
| C4 |
-1.0297 |
-0.0294 |
0.0374 |
| O5 |
-0.7826 |
1.2927 |
-0.0108 |
| O6 |
-2.2050 |
-0.2844 |
-0.1356 |
| H7 |
2.5714 |
0.9974 |
-0.4938 |
| H8 |
2.2100 |
0.5941 |
1.0401 |
| H9 |
2.1415 |
-1.4757 |
-0.1507 |
| H10 |
1.2726 |
-0.6404 |
-1.4520 |
| H11 |
-0.2496 |
-2.0396 |
-0.0286 |
| H12 |
0.1914 |
-1.1205 |
1.4148 |
| H13 |
0.1701 |
1.4409 |
0.0600 |
Atom - Atom Distances (Å)
| |
N1 |
C2 |
C3 |
C4 |
O5 |
O6 |
H7 |
H8 |
H9 |
H10 |
H11 |
H12 |
H13 |
| N1 |
|
1.4866 |
2.4675 |
2.9632 |
2.7106 |
4.1720 |
0.9981 |
0.9994 |
2.1730 |
2.1142 |
3.4247 |
2.7629 |
1.8531 |
| C2 |
1.4866 |
|
1.5248 |
2.5409 |
2.9568 |
3.6293 |
2.0501 |
2.0518 |
1.1105 |
1.1090 |
2.1613 |
2.1830 |
2.4813 |
| C3 |
2.4675 |
1.5248 |
|
1.5189 |
2.5027 |
2.4407 |
3.3218 |
2.7844 |
2.1655 |
2.1723 |
1.1081 |
1.1093 |
2.4925 |
| C4 |
2.9632 |
2.5409 |
1.5189 |
|
1.3459 |
1.2150 |
3.7821 |
3.4482 |
3.4905 |
2.8092 |
2.1572 |
2.1399 |
1.8979 |
| O5 |
2.7106 |
2.9568 |
2.5027 |
1.3459 |
| 2.1274 |
3.4014 |
3.2478 |
4.0291 |
3.1682 |
3.3747 |
2.9673 |
0.9668 |
| O6 |
4.1720 |
3.6293 |
2.4407 |
1.2150 |
2.1274 |
| 4.9583 |
4.6526 |
4.5068 |
3.7354 |
2.6298 |
2.9742 |
2.9421 |
| H7 |
0.9981 |
2.0501 |
3.3218 |
3.7821 |
3.4014 |
4.9583 |
| 1.6266 |
2.5334 |
2.2994 |
4.1710 |
3.7138 |
2.5039 |
| H8 |
0.9994 |
2.0518 |
2.7844 |
3.4482 |
3.2478 |
4.6526 |
1.6266 |
| 2.3888 |
2.9348 |
3.7587 |
2.6749 |
2.4164 |
| H9 |
2.1730 |
1.1105 |
2.1655 |
3.4905 |
4.0291 |
4.5068 |
2.5334 |
2.3888 |
| 1.7737 |
2.4597 |
2.5258 |
3.5267 |
| H10 |
2.1142 |
1.1090 |
2.1723 |
2.8092 |
3.1682 |
3.7354 |
2.2994 |
2.9348 |
1.7737 |
| 2.5101 |
3.1012 |
2.7989 |
| H11 |
3.4247 |
2.1613 |
1.1081 |
2.1572 |
3.3747 |
2.6298 |
4.1710 |
3.7587 |
2.4597 |
2.5101 |
| 1.7670 |
3.5068 |
| H12 |
2.7629 |
2.1830 |
1.1093 |
2.1399 |
2.9673 |
2.9742 |
3.7138 |
2.6749 |
2.5258 |
3.1012 |
1.7670 |
| 2.8978 |
| H13 |
1.8531 |
2.4813 |
2.4925 |
1.8979 |
0.9668 |
2.9421 |
2.5039 |
2.4164 |
3.5267 |
2.7989 |
3.5068 |
2.8978 |
|
Maximum atom distance is 4.9583Å
between atoms O6 and H7.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.