|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3NO3 (Methyl nitrate)
1A' CS
1910171554
InChI=1S/CH3NO3/c1-5-2(3)4/h1H3 INChIKey=LRMHVVPPGGOAJQ-UHFFFAOYSA-N
PM3
Point group is Cs
| Atom |
Internal |
| x (Å) |
y (Å) |
z (Å) |
| N1 |
0.0000 |
0.6827 |
0.0000 |
| O2 |
-1.1933 |
0.7418 |
0.0000 |
| O3 |
0.8575 |
1.5035 |
0.0000 |
| O4 |
0.6410 |
-0.6963 |
0.0000 |
| C5 |
-0.2114 |
-1.8061 |
0.0000 |
| H6 |
0.5049 |
-2.6332 |
0.0000 |
| H7 |
-0.8391 |
-1.8505 |
0.8973 |
| H8 |
-0.8391 |
-1.8505 |
-0.8973 |
Atom - Atom Distances (Å)
| |
N1 |
O2 |
O3 |
O4 |
C5 |
H6 |
H7 |
H8 |
| N1 |
|
1.1948 |
1.1870 |
1.5208 |
2.4978 |
3.3542 |
2.8154 |
2.8154 |
| O2 |
1.1948 |
| 2.1877 |
2.3308 |
2.7305 |
3.7782 |
2.7660 |
2.7660 |
| O3 |
1.1870 |
2.1877 |
| 2.2104 |
3.4779 |
4.1517 |
3.8643 |
3.8643 |
| O4 |
1.5208 |
2.3308 |
2.2104 |
|
1.3993 |
1.9417 |
2.0803 |
2.0803 |
| C5 |
2.4978 |
2.7305 |
3.4779 |
1.3993 |
|
1.0942 |
1.0959 |
1.0959 |
| H6 |
3.3542 |
3.7782 |
4.1517 |
1.9417 |
1.0942 |
| 1.7956 |
1.7956 |
| H7 |
2.8154 |
2.7660 |
3.8643 |
2.0803 |
1.0959 |
1.7956 |
| 1.7946 |
| H8 |
2.8154 |
2.7660 |
3.8643 |
2.0803 |
1.0959 |
1.7956 |
1.7946 |
|
Maximum atom distance is 4.1517Å
between atoms O3 and H6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.