|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C6H5COOH (benzoic acid)
1A' CS
1910171554
InChI=1S/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9) INChIKey=WPYMKLBDIGXBTP-UHFFFAOYSA-N
G2
This model chemistry uses a geometry from
MP2=FULL/6-31G*
Point group is Cs
| Atom |
Internal |
| x (Å) |
y (Å) |
z (Å) |
| C1 |
0.0000 |
0.2200 |
0.0000 |
| C2 |
1.2768 |
-0.3507 |
0.0000 |
| C3 |
1.4138 |
-1.7355 |
0.0000 |
| C4 |
0.2809 |
-2.5514 |
0.0000 |
| C5 |
-0.9914 |
-1.9779 |
0.0000 |
| C6 |
-1.1388 |
-0.5927 |
0.0000 |
| C7 |
-0.0921 |
1.7002 |
0.0000 |
| O8 |
0.8612 |
2.4624 |
0.0000 |
| O9 |
-1.3771 |
2.1462 |
0.0000 |
| H10 |
2.1437 |
0.3036 |
0.0000 |
| H11 |
2.4053 |
-2.1808 |
0.0000 |
| H12 |
0.3894 |
-3.6331 |
0.0000 |
| H13 |
-1.8734 |
-2.6131 |
0.0000 |
| H14 |
-2.1256 |
-0.1412 |
0.0000 |
| H15 |
-1.3071 |
3.1232 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
C3 |
C4 |
C5 |
C6 |
C7 |
O8 |
O9 |
H10 |
H11 |
H12 |
H13 |
H14 |
H15 |
| C1 |
|
1.3985 |
2.4130 |
2.7855 |
2.4111 |
1.3990 |
1.4831 |
2.4022 |
2.3679 |
2.1453 |
3.3984 |
3.8727 |
3.3964 |
2.1560 |
3.1839 |
| C2 |
1.3985 |
|
1.3916 |
2.4155 |
2.7915 |
2.4277 |
2.4658 |
2.8437 |
3.6439 |
1.0861 |
2.1500 |
3.4002 |
3.8784 |
3.4088 |
4.3295 |
| C3 |
2.4130 |
1.3916 |
|
1.3961 |
2.4174 |
2.7968 |
3.7513 |
4.2342 |
4.7809 |
2.1658 |
1.0869 |
2.1564 |
3.4023 |
3.8819 |
5.5687 |
| C4 |
2.7855 |
2.4155 |
1.3961 |
|
1.3956 |
2.4191 |
4.2679 |
5.0473 |
4.9816 |
3.4090 |
2.1565 |
1.0871 |
2.1551 |
3.4059 |
5.8926 |
| C5 |
2.4111 |
2.7915 |
2.4174 |
1.3956 |
|
1.3930 |
3.7864 |
4.8113 |
4.1421 |
3.8774 |
3.4028 |
2.1555 |
1.0869 |
2.1586 |
5.1109 |
| C6 |
1.3990 |
2.4277 |
2.7968 |
2.4191 |
1.3930 |
| 2.5204 |
3.6515 |
2.7492 |
3.4026 |
3.8836 |
3.4029 |
2.1498 |
1.0851 |
3.7197 |
| C7 |
1.4831 |
2.4658 |
3.7513 |
4.2679 |
3.7864 |
2.5204 |
|
1.2206 |
1.3602 |
2.6361 |
4.6151 |
5.3550 |
4.6666 |
2.7433 |
1.8711 |
| O8 |
2.4022 |
2.8437 |
4.2342 |
5.0473 |
4.8113 |
3.6515 |
1.2206 |
| 2.2606 |
2.5110 |
4.8932 |
6.1138 |
5.7653 |
3.9623 |
2.2668 |
| O9 |
2.3679 |
3.6439 |
4.7809 |
4.9816 |
4.1421 |
2.7492 |
1.3602 |
2.2606 |
| 3.9738 |
5.7471 |
6.0432 |
4.7851 |
2.4068 |
0.9795 |
| H10 |
2.1453 |
1.0861 |
2.1658 |
3.4090 |
3.8774 |
3.4026 |
2.6361 |
2.5110 |
3.9738 |
| 2.4981 |
4.3099 |
4.9643 |
4.2924 |
4.4562 |
| H11 |
3.3984 |
2.1500 |
1.0869 |
2.1565 |
3.4028 |
3.8836 |
4.6151 |
4.8932 |
5.7471 |
2.4981 |
| 2.4846 |
4.3004 |
4.9687 |
6.4741 |
| H12 |
3.8727 |
3.4002 |
2.1564 |
1.0871 |
2.1555 |
3.4029 |
5.3550 |
6.1138 |
6.0432 |
4.3099 |
2.4846 |
| 2.4820 |
4.3032 |
6.9660 |
| H13 |
3.3964 |
3.8784 |
3.4023 |
2.1551 |
1.0869 |
2.1498 |
4.6666 |
5.7653 |
4.7851 |
4.9643 |
4.3004 |
2.4820 |
| 2.4847 |
5.7642 |
| H14 |
2.1560 |
3.4088 |
3.8819 |
3.4059 |
2.1586 |
1.0851 |
2.7433 |
3.9623 |
2.4068 |
4.2924 |
4.9687 |
4.3032 |
2.4847 |
| 3.3655 |
| H15 |
3.1839 |
4.3295 |
5.5687 |
5.8926 |
5.1109 |
3.7197 |
1.8711 |
2.2668 |
0.9795 |
4.4562 |
6.4741 |
6.9660 |
5.7642 |
3.3655 |
|
Maximum atom distance is 6.9660Å
between atoms H12 and H15.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.