|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for ClCOClCO (Oxalyl chloride)
1AG C2H
1910171554
InChI=1S/C2Cl2O2/c3-1(5)2(4)6 INChIKey=CTSLXHKWHWQRSH-UHFFFAOYSA-N
G4
This model chemistry uses a geometry from
B3LYP/6-31G(2df,p)
Point group is C2h
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.1793 |
0.7563 |
0.0000 |
|
0.7412 |
0.2342 |
0.0000 |
| C2 |
0.1793 |
-0.7563 |
0.0000 |
|
-0.7412 |
-0.2342 |
0.0000 |
| O3 |
-1.2770 |
1.1900 |
0.0000 |
|
1.6766 |
-0.4856 |
0.0000 |
| O4 |
1.2770 |
-1.1900 |
0.0000 |
|
-1.6766 |
0.4856 |
0.0000 |
| Cl5 |
1.2770 |
1.7627 |
0.0000 |
|
0.8578 |
2.0005 |
0.0000 |
| Cl6 |
-1.2770 |
-1.7627 |
0.0000 |
|
-0.8578 |
-2.0005 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
O3 |
O4 |
Cl5 |
Cl6 |
| C1 |
|
1.5545 |
1.1803 |
2.4308 |
1.7702 |
2.7479 |
| C2 |
1.5545 |
| 2.4308 |
1.1803 |
2.7479 |
1.7702 |
| O3 |
1.1803 |
2.4308 |
| 3.4910 |
2.6175 |
2.9527 |
| O4 |
2.4308 |
1.1803 |
3.4910 |
| 2.9527 |
2.6175 |
| Cl5 |
1.7702 |
2.7479 |
2.6175 |
2.9527 |
| 4.3534 |
| Cl6 |
2.7479 |
1.7702 |
2.9527 |
2.6175 |
4.3534 |
|
Maximum atom distance is 4.3534Å
between atoms Cl5 and Cl6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
O4 |
124.344 |
|
C1 |
C2 |
Cl6 |
111.650 |
|
C2 |
C1 |
O3 |
124.344 |
|
C2 |
C1 |
Cl5 |
111.650 |
|
O3 |
C1 |
Cl5 |
124.007 |
|
O4 |
C2 |
Cl6 |
124.007 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.