|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH7N3 (triaminomethane)
1A C3
1910171554
InChI=1S/CH7N3/c2-1(3)4/h1H,2-4H2 INChIKey=
G4
This model chemistry uses a geometry from
B3LYP/6-31G(2df,p)
Point group is C3
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
0.3676 |
|
0.0000 |
-0.0000 |
0.3676 |
| H2 |
0.0000 |
0.0000 |
1.4657 |
|
0.0000 |
-0.0000 |
1.4657 |
| N3 |
0.0000 |
1.3993 |
-0.0534 |
|
-0.0369 |
1.3988 |
-0.0534 |
| N4 |
1.2118 |
-0.6996 |
-0.0534 |
|
-1.1929 |
-0.7314 |
-0.0534 |
| N5 |
-1.2118 |
-0.6996 |
-0.0534 |
|
1.2298 |
-0.6674 |
-0.0534 |
| H6 |
0.8829 |
1.8250 |
0.2208 |
|
-0.9308 |
1.8011 |
0.2208 |
| H7 |
1.1391 |
-1.6772 |
0.2208 |
|
-1.0944 |
-1.7066 |
0.2208 |
| H8 |
-2.0220 |
-0.1479 |
0.2208 |
|
2.0252 |
-0.0945 |
0.2208 |
| H9 |
-0.0323 |
1.4429 |
-1.0709 |
|
-0.0058 |
1.4433 |
-1.0709 |
| H10 |
1.2658 |
-0.6935 |
-1.0709 |
|
-1.2470 |
-0.7267 |
-1.0709 |
| H11 |
-1.2335 |
-0.7494 |
-1.0709 |
|
1.2528 |
-0.7166 |
-1.0709 |
Atom - Atom Distances (Å)
| |
C1 |
H2 |
N3 |
N4 |
N5 |
H6 |
H7 |
H8 |
H9 |
H10 |
H11 |
| C1 |
|
1.0980 |
1.4612 |
1.4612 |
1.4612 |
2.0327 |
2.0327 |
2.0327 |
2.0378 |
2.0378 |
2.0378 |
| H2 |
1.0980 |
| 2.0653 |
2.0653 |
2.0653 |
2.3791 |
2.3791 |
2.3791 |
2.9185 |
2.9185 |
2.9185 |
| N3 |
1.4612 |
2.0653 |
| 2.4236 |
2.4236 |
1.0179 |
3.2920 |
2.5607 |
1.0190 |
2.6490 |
2.6784 |
| N4 |
1.4612 |
2.0653 |
2.4236 |
| 2.4236 |
2.5607 |
1.0179 |
3.2920 |
2.6784 |
1.0190 |
2.6490 |
| N5 |
1.4612 |
2.0653 |
2.4236 |
2.4236 |
| 3.2920 |
2.5607 |
1.0179 |
2.6490 |
2.6784 |
1.0190 |
| H6 |
2.0327 |
2.3791 |
1.0179 |
2.5607 |
3.2920 |
| 3.5116 |
3.5116 |
1.6286 |
2.8563 |
3.5743 |
| H7 |
2.0327 |
2.3791 |
3.2920 |
1.0179 |
2.5607 |
3.5116 |
| 3.5116 |
3.5743 |
1.6286 |
2.8563 |
| H8 |
2.0327 |
2.3791 |
2.5607 |
3.2920 |
1.0179 |
3.5116 |
3.5116 |
| 2.8563 |
3.5743 |
1.6286 |
| H9 |
2.0378 |
2.9185 |
1.0190 |
2.6784 |
2.6490 |
1.6286 |
3.5743 |
2.8563 |
| 2.4998 |
2.4998 |
| H10 |
2.0378 |
2.9185 |
2.6490 |
1.0190 |
2.6784 |
2.8563 |
1.6286 |
3.5743 |
2.4998 |
| 2.4998 |
| H11 |
2.0378 |
2.9185 |
2.6784 |
2.6490 |
1.0190 |
3.5743 |
2.8563 |
1.6286 |
2.4998 |
2.4998 |
|
Maximum atom distance is 3.5743Å
between atoms H7 and H9.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
N3 |
C1 |
N4 |
112.096 |
|
N3 |
C1 |
N5 |
112.096 |
|
N4 |
C1 |
N5 |
112.096 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
N3 |
H6 |
108.805 |
|
C1 |
N3 |
H9 |
109.134 |
|
C1 |
N4 |
H7 |
108.806 |
|
C1 |
N4 |
H10 |
109.134 |
|
C1 |
N5 |
H8 |
108.805 |
|
C1 |
N5 |
H11 |
109.134 |
|
H2 |
C1 |
N3 |
106.698 |
|
H2 |
C1 |
N4 |
106.698 |
|
H2 |
C1 |
N5 |
106.698 |
|
H6 |
N3 |
H9 |
106.132 |
|
H7 |
N4 |
H10 |
106.132 |
|
H8 |
N5 |
H11 |
106.132 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.