|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C6H6 (Dewar Benzene)
1A1 C2V
1910171554
InChI=1S/C6H6/c1-2-6-4-3-5(1)6/h1-6H INChIKey=CTLSARLLLBZBRV-UHFFFAOYSA-N
B97D3/6-31G*
Point group is C2v
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.7899 |
0.5222 |
|
0.0000 |
0.7899 |
0.5222 |
| C2 |
0.0000 |
-0.7899 |
0.5222 |
|
0.0000 |
-0.7899 |
0.5222 |
| H3 |
0.0000 |
1.3524 |
1.4652 |
|
0.0000 |
1.3524 |
1.4652 |
| H4 |
0.0000 |
-1.3524 |
1.4652 |
|
0.0000 |
-1.3524 |
1.4652 |
| C5 |
-1.3116 |
0.6737 |
-0.2642 |
|
-1.3116 |
0.6737 |
-0.2642 |
| C6 |
1.3116 |
0.6737 |
-0.2642 |
|
1.3116 |
0.6737 |
-0.2642 |
| C7 |
1.3116 |
-0.6737 |
-0.2642 |
|
1.3116 |
-0.6737 |
-0.2642 |
| C8 |
-1.3116 |
-0.6737 |
-0.2642 |
|
-1.3116 |
-0.6737 |
-0.2642 |
| H9 |
-1.9567 |
1.4301 |
-0.7142 |
|
-1.9567 |
1.4301 |
-0.7142 |
| H10 |
1.9567 |
1.4301 |
-0.7142 |
|
1.9567 |
1.4301 |
-0.7142 |
| H11 |
1.9567 |
-1.4301 |
-0.7142 |
|
1.9567 |
-1.4301 |
-0.7142 |
| H12 |
-1.9567 |
-1.4301 |
-0.7142 |
|
-1.9567 |
-1.4301 |
-0.7142 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
H3 |
H4 |
C5 |
C6 |
C7 |
C8 |
H9 |
H10 |
H11 |
H12 |
| C1 |
|
1.5798 |
1.0980 |
2.3406 |
1.5337 |
1.5337 |
2.1168 |
2.1168 |
2.4015 |
2.4015 |
3.2071 |
3.2071 |
| C2 |
1.5798 |
| 2.3406 |
1.0980 |
2.1168 |
2.1168 |
1.5337 |
1.5337 |
3.2071 |
3.2071 |
2.4015 |
2.4015 |
| H3 |
1.0980 |
2.3406 |
| 2.7049 |
2.2741 |
2.2741 |
2.9692 |
2.9692 |
2.9299 |
2.9299 |
4.0399 |
4.0399 |
| H4 |
2.3406 |
1.0980 |
2.7049 |
| 2.9692 |
2.9692 |
2.2741 |
2.2741 |
4.0399 |
4.0399 |
2.9299 |
2.9299 |
| C5 |
1.5337 |
2.1168 |
2.2741 |
2.9692 |
| 2.6231 |
2.9490 |
1.3475 |
1.0912 |
3.3847 |
3.9128 |
2.2461 |
| C6 |
1.5337 |
2.1168 |
2.2741 |
2.9692 |
2.6231 |
|
1.3475 |
2.9490 |
3.3847 |
1.0912 |
2.2461 |
3.9128 |
| C7 |
2.1168 |
1.5337 |
2.9692 |
2.2741 |
2.9490 |
1.3475 |
| 2.6231 |
3.9128 |
2.2461 |
1.0912 |
3.3847 |
| C8 |
2.1168 |
1.5337 |
2.9692 |
2.2741 |
1.3475 |
2.9490 |
2.6231 |
| 2.2461 |
3.9128 |
3.3847 |
1.0912 |
| H9 |
2.4015 |
3.2071 |
2.9299 |
4.0399 |
1.0912 |
3.3847 |
3.9128 |
2.2461 |
| 3.9135 |
4.8472 |
2.8601 |
| H10 |
2.4015 |
3.2071 |
2.9299 |
4.0399 |
3.3847 |
1.0912 |
2.2461 |
3.9128 |
3.9135 |
| 2.8601 |
4.8472 |
| H11 |
3.2071 |
2.4015 |
4.0399 |
2.9299 |
3.9128 |
2.2461 |
1.0912 |
3.3847 |
4.8472 |
2.8601 |
| 3.9135 |
| H12 |
3.2071 |
2.4015 |
4.0399 |
2.9299 |
2.2461 |
3.9128 |
3.3847 |
1.0912 |
2.8601 |
4.8472 |
3.9135 |
|
Maximum atom distance is 4.8472Å
between atoms H9 and H11.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
C4 |
120.820 |
|
C2 |
C1 |
C3 |
120.820 |
|
C2 |
C1 |
C5 |
85.657 |
|
C2 |
C1 |
C6 |
85.657 |
|
C3 |
C1 |
C5 |
118.630 |
|
C3 |
C1 |
C6 |
118.630 |
|
C5 |
C1 |
C6 |
117.559 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
H7 |
85.657 |
|
C1 |
C2 |
H8 |
85.657 |
|
C1 |
C5 |
H8 |
94.343 |
|
C1 |
C5 |
H9 |
131.651 |
|
C1 |
C6 |
H7 |
94.343 |
|
C1 |
C6 |
H10 |
131.651 |
|
C2 |
H7 |
C6 |
94.343 |
|
C2 |
H7 |
H11 |
131.651 |
|
C2 |
H8 |
C5 |
94.343 |
|
C2 |
H8 |
H12 |
131.651 |
|
C4 |
C2 |
H7 |
118.630 |
|
C4 |
C2 |
H8 |
118.630 |
|
C5 |
H8 |
H12 |
133.875 |
|
C6 |
H7 |
H11 |
133.875 |
|
H7 |
C6 |
H10 |
133.875 |
|
H8 |
C5 |
H9 |
133.875 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.