|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3NO2 (Methane, nitro-)
1A' CS Os out of place
1910171554
InChI=1S/CH3NO2/c1-2(3)4/h1H3 INChIKey=LYGJENNIWJXYER-UHFFFAOYSA-N
CCD/6-31G*
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0239 |
-1.3118 |
0.0000 |
|
0.0002 |
0.0239 |
-1.3118 |
| N2 |
-0.1030 |
0.1764 |
0.0000 |
|
-0.0007 |
-0.1030 |
0.1764 |
| H3 |
1.0914 |
-1.5491 |
0.0000 |
|
0.0070 |
1.0913 |
-1.5491 |
| H4 |
-0.4483 |
-1.6868 |
0.9071 |
|
0.9042 |
-0.4542 |
-1.6868 |
| H5 |
-0.4483 |
-1.6868 |
-0.9071 |
|
-0.9100 |
-0.4425 |
-1.6868 |
| O6 |
0.0239 |
0.7224 |
-1.0839 |
|
-1.0837 |
0.0309 |
0.7224 |
| O7 |
0.0239 |
0.7224 |
1.0839 |
|
1.0840 |
0.0169 |
0.7224 |
Atom - Atom Distances (Å)
| |
C1 |
N2 |
H3 |
H4 |
H5 |
O6 |
O7 |
| C1 |
|
1.4936 |
1.0935 |
1.0893 |
1.0893 |
2.3050 |
2.3050 |
| N2 |
1.4936 |
| 2.0985 |
2.1008 |
2.1008 |
1.2203 |
1.2203 |
| H3 |
1.0935 |
2.0985 |
| 1.7924 |
1.7924 |
2.7339 |
2.7339 |
| H4 |
1.0893 |
2.1008 |
1.7924 |
| 1.8142 |
3.1609 |
2.4614 |
| H5 |
1.0893 |
2.1008 |
1.7924 |
1.8142 |
| 2.4614 |
3.1609 |
| O6 |
2.3050 |
1.2203 |
2.7339 |
3.1609 |
2.4614 |
| 2.1678 |
| O7 |
2.3050 |
1.2203 |
2.7339 |
2.4614 |
3.1609 |
2.1678 |
|
Maximum atom distance is 3.1609Å
between atoms H4 and O6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
N2 |
O6 |
115.913 |
|
C1 |
N2 |
O7 |
115.913 |
|
O6 |
N2 |
O7 |
125.305 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
N2 |
C1 |
H3 |
107.410 |
|
N2 |
C1 |
H4 |
107.829 |
|
N2 |
C1 |
H5 |
107.829 |
|
H3 |
C1 |
H4 |
110.396 |
|
H3 |
C1 |
H5 |
110.396 |
|
H4 |
C1 |
H5 |
112.769 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.