|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for HO2CCHNH2CH2OH (Serine)
1A C1
1910171554
InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/t2-/m0/s1 INChIKey=MTCFGRXMJLQNBG-UWTATZPHSA-N
CCD/6-31G*
Point group is C1
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.7810 |
-0.5431 |
0.0048 |
|
0.7813 |
-0.5426 |
-0.0089 |
| O2 |
2.0614 |
-0.3370 |
-0.3660 |
|
2.0586 |
-0.3308 |
-0.3869 |
| O3 |
0.4076 |
-1.5620 |
0.5487 |
|
0.4127 |
-1.5691 |
0.5240 |
| C4 |
-0.0905 |
0.6713 |
-0.3091 |
|
-0.0933 |
0.6754 |
-0.2991 |
| C5 |
-1.5156 |
0.4440 |
0.1953 |
|
-1.5142 |
0.4404 |
0.2134 |
| O6 |
-2.1157 |
-0.6930 |
-0.3884 |
|
-2.1184 |
-0.6889 |
-0.3811 |
| N7 |
0.4374 |
1.9222 |
0.2273 |
|
0.4382 |
1.9192 |
0.2502 |
| H8 |
2.5631 |
-1.1388 |
-0.1321 |
|
2.5625 |
-1.1354 |
-0.1680 |
| H9 |
-0.1300 |
0.7587 |
-1.4034 |
|
-0.1415 |
0.7778 |
-1.3918 |
| H10 |
-1.5045 |
0.3858 |
1.2966 |
|
-1.4943 |
0.3670 |
1.3137 |
| H11 |
-2.1120 |
1.3167 |
-0.0867 |
|
-2.1132 |
1.3165 |
-0.0519 |
| H12 |
-1.6640 |
-1.4671 |
-0.0186 |
|
-1.6634 |
-1.4677 |
-0.0256 |
| H13 |
1.3426 |
2.1381 |
-0.1832 |
|
1.3400 |
2.1412 |
-0.1645 |
| H14 |
0.5671 |
1.8538 |
1.2354 |
|
0.5760 |
1.8370 |
1.2562 |
Atom - Atom Distances (Å)
| |
C1 |
O2 |
O3 |
C4 |
C5 |
O6 |
N7 |
H8 |
H9 |
H10 |
H11 |
H12 |
H13 |
H14 |
| C1 |
|
1.3488 |
1.2138 |
1.5273 |
2.5070 |
2.9271 |
2.4991 |
1.8840 |
2.1231 |
2.7848 |
3.4404 |
2.6139 |
2.7458 |
2.7028 |
| O2 |
1.3488 |
| 2.2521 |
2.3771 |
3.7041 |
4.1923 |
2.8450 |
0.9743 |
2.6607 |
4.0003 |
4.4978 |
3.9085 |
2.5839 |
3.0979 |
| O3 |
1.2138 |
2.2521 |
| 2.4436 |
2.8013 |
2.8285 |
3.4991 |
2.2997 |
3.0798 |
2.8300 |
3.8780 |
2.1500 |
3.8859 |
3.4877 |
| C4 |
1.5273 |
2.3771 |
2.4436 |
|
1.5287 |
2.4432 |
1.4599 |
3.2170 |
1.0985 |
2.1585 |
2.1336 |
2.6708 |
2.0545 |
2.0534 |
| C5 |
2.5070 |
3.7041 |
2.8013 |
1.5287 |
|
1.4120 |
2.4495 |
4.3873 |
2.1389 |
1.1029 |
1.0940 |
1.9288 |
3.3440 |
2.7216 |
| O6 |
2.9271 |
4.1923 |
2.8285 |
2.4432 |
1.4120 |
| 3.7063 |
4.7070 |
2.6610 |
2.0920 |
2.0322 |
0.9696 |
4.4740 |
4.0399 |
| N7 |
2.4991 |
2.8450 |
3.4991 |
1.4599 |
2.4495 |
3.7063 |
| 3.7440 |
2.0821 |
2.6972 |
2.6390 |
3.9955 |
1.0171 |
1.0187 |
| H8 |
1.8840 |
0.9743 |
2.2997 |
3.2170 |
4.3873 |
4.7070 |
3.7440 |
| 3.5312 |
4.5728 |
5.2809 |
4.2413 |
3.4972 |
3.8483 |
| H9 |
2.1231 |
2.6607 |
3.0798 |
1.0985 |
2.1389 |
2.6610 |
2.0821 |
3.5312 |
| 3.0526 |
2.4440 |
3.0373 |
2.3579 |
2.9408 |
| H10 |
2.7848 |
4.0003 |
2.8300 |
2.1585 |
1.1029 |
2.0920 |
2.6972 |
4.5728 |
3.0526 |
| 1.7746 |
2.2778 |
3.6560 |
2.5398 |
| H11 |
3.4404 |
4.4978 |
3.8780 |
2.1336 |
1.0940 |
2.0322 |
2.6390 |
5.2809 |
2.4440 |
1.7746 |
| 2.8204 |
3.5522 |
3.0355 |
| H12 |
2.6139 |
3.9085 |
2.1500 |
2.6708 |
1.9288 |
0.9696 |
3.9955 |
4.2413 |
3.0373 |
2.2778 |
2.8204 |
| 4.6973 |
4.1927 |
| H13 |
2.7458 |
2.5839 |
3.8859 |
2.0545 |
3.3440 |
4.4740 |
1.0171 |
3.4972 |
2.3579 |
3.6560 |
3.5522 |
4.6973 |
| 1.6415 |
| H14 |
2.7028 |
3.0979 |
3.4877 |
2.0534 |
2.7216 |
4.0399 |
1.0187 |
3.8483 |
2.9408 |
2.5398 |
3.0355 |
4.1927 |
1.6415 |
|
Maximum atom distance is 5.2809Å
between atoms H8 and H11.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C4 |
C5 |
110.239 |
|
C1 |
C4 |
N7 |
113.543 |
|
O2 |
C1 |
O3 |
122.915 |
|
O2 |
C1 |
C4 |
111.330 |
|
O3 |
C1 |
C4 |
125.728 |
|
C4 |
C5 |
O6 |
112.304 |
|
C5 |
C4 |
N7 |
110.072 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
O2 |
H8 |
107.284 |
|
C1 |
C4 |
H9 |
106.771 |
|
C4 |
C5 |
H10 |
109.145 |
|
C4 |
C5 |
H11 |
107.732 |
|
C4 |
N7 |
H13 |
110.814 |
|
C4 |
N7 |
H14 |
110.616 |
|
C5 |
C4 |
H9 |
107.882 |
|
C5 |
O6 |
H12 |
106.694 |
|
O6 |
C5 |
H10 |
111.996 |
|
O6 |
C5 |
H11 |
107.702 |
|
N7 |
C4 |
H9 |
108.109 |
|
H10 |
C5 |
H11 |
107.762 |
|
H13 |
N7 |
H14 |
107.477 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.