|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for (nitrogen trioxide cation)
1A1 C2V
1910171554
InChI=1S/NO3/c2-1(3)4/q+1 INChIKey=MGUAMNYNQZUFET-UHFFFAOYSA-N
wB97X-D/6-31G*
Point group is C2v
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| N1 |
0.0000 |
0.0000 |
0.2449 |
|
0.2449 |
0.0000 |
0.0000 |
| O2 |
0.0000 |
0.0000 |
1.3785 |
|
1.3785 |
0.0000 |
0.0000 |
| O3 |
0.0000 |
0.7789 |
-0.7964 |
|
-0.7964 |
0.7789 |
0.0000 |
| O4 |
0.0000 |
-0.7789 |
-0.7964 |
|
-0.7964 |
-0.7789 |
0.0000 |
Atom - Atom Distances (Å)
| |
N1 |
O2 |
O3 |
O4 |
| N1 |
|
1.1336 |
1.3003 |
1.3003 |
| O2 |
1.1336 |
| 2.3101 |
2.3101 |
| O3 |
1.3003 |
2.3101 |
|
1.5578 |
| O4 |
1.3003 |
2.3101 |
1.5578 |
|
Maximum atom distance is 2.3101Å
between atoms O2 and O3.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
O2 |
N1 |
O3 |
143.201 |
|
O2 |
N1 |
O4 |
143.201 |
|
O3 |
N1 |
O4 |
73.598 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.