|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C3H2O2 (Propiolic acid)
1A' CS
1910171554
InChI=1S/C3H2O2/c1-2-3(4)5/h1H,(H,4,5) INChIKey=UORVCLMRJXCDCP-UHFFFAOYSA-N
CID/6-31G*
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.4931 |
0.0000 |
|
0.4813 |
-0.1075 |
0.0000 |
| C2 |
-0.2362 |
-0.9396 |
0.0000 |
|
-0.9685 |
-0.0258 |
0.0000 |
| C3 |
-0.4704 |
-2.1125 |
0.0000 |
|
-2.1642 |
0.0013 |
0.0000 |
| O4 |
1.3066 |
0.7746 |
0.0000 |
|
1.0408 |
1.1064 |
0.0000 |
| O5 |
-0.8655 |
1.3217 |
0.0000 |
|
1.1013 |
-1.1327 |
0.0000 |
| H6 |
-0.6762 |
-3.1549 |
0.0000 |
|
-3.2264 |
0.0276 |
0.0000 |
| H7 |
1.3869 |
1.7385 |
0.0000 |
|
1.9989 |
0.9747 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
C3 |
O4 |
O5 |
H6 |
H7 |
| C1 |
|
1.4521 |
2.6478 |
1.3366 |
1.1982 |
3.7102 |
1.8639 |
| C2 |
1.4521 |
|
1.1960 |
2.3063 |
2.3472 |
2.2586 |
3.1315 |
| C3 |
2.6478 |
1.1960 |
| 3.3902 |
3.4569 |
1.0625 |
4.2754 |
| O4 |
1.3366 |
2.3063 |
3.3902 |
| 2.2400 |
4.4015 |
0.9672 |
| O5 |
1.1982 |
2.3472 |
3.4569 |
2.2400 |
| 4.4806 |
2.2906 |
| H6 |
3.7102 |
2.2586 |
1.0625 |
4.4015 |
4.4806 |
| 5.3105 |
| H7 |
1.8639 |
3.1315 |
4.2754 |
0.9672 |
2.2906 |
5.3105 |
|
Maximum atom distance is 5.3105Å
between atoms H6 and H7.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
C3 |
178.073 |
|
C2 |
C1 |
O4 |
111.521 |
|
C2 |
C1 |
O5 |
124.388 |
|
O4 |
C1 |
O5 |
124.090 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
O4 |
H7 |
106.918 |
|
C2 |
C3 |
H6 |
179.879 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.