|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C4H6 (Bicyclo[1.1.0]butane)
1A1 C2V
1910171554
InChI=1S/C4H6/c1-3-2-4(1)3/h3-4H,1-2H2 INChIKey=LASLVGACQUUOEB-UHFFFAOYSA-N
HF/6-31G*
Point group is C2v
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.7335 |
0.0000 |
-0.3237 |
|
-0.3237 |
0.7335 |
0.0000 |
| C2 |
-0.7335 |
0.0000 |
-0.3237 |
|
-0.3237 |
-0.7335 |
0.0000 |
| C3 |
0.0000 |
1.1264 |
0.3152 |
|
0.3152 |
0.0000 |
1.1264 |
| C4 |
0.0000 |
-1.1264 |
0.3152 |
|
0.3152 |
0.0000 |
-1.1264 |
| H5 |
1.4355 |
0.0000 |
-1.1312 |
|
-1.1312 |
1.4355 |
0.0000 |
| H6 |
-1.4355 |
0.0000 |
-1.1312 |
|
-1.1312 |
-1.4355 |
0.0000 |
| H7 |
0.0000 |
2.0681 |
-0.2105 |
|
-0.2105 |
0.0000 |
2.0681 |
| H8 |
0.0000 |
-2.0681 |
-0.2105 |
|
-0.2105 |
0.0000 |
-2.0681 |
| H9 |
0.0000 |
1.2258 |
1.3928 |
|
1.3928 |
0.0000 |
1.2258 |
| H10 |
0.0000 |
-1.2258 |
1.3928 |
|
1.3928 |
0.0000 |
-1.2258 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
C3 |
C4 |
H5 |
H6 |
H7 |
H8 |
H9 |
H10 |
| C1 |
|
1.4670 |
1.4882 |
1.4882 |
1.0700 |
2.3144 |
2.1972 |
2.1972 |
2.2331 |
2.2331 |
| C2 |
1.4670 |
|
1.4882 |
1.4882 |
2.3144 |
1.0700 |
2.1972 |
2.1972 |
2.2331 |
2.2331 |
| C3 |
1.4882 |
1.4882 |
| 2.2527 |
2.3284 |
2.3284 |
1.0785 |
3.2374 |
1.0822 |
2.5872 |
| C4 |
1.4882 |
1.4882 |
2.2527 |
| 2.3284 |
2.3284 |
3.2374 |
1.0785 |
2.5872 |
1.0822 |
| H5 |
1.0700 |
2.3144 |
2.3284 |
2.3284 |
| 2.8710 |
2.6805 |
2.6805 |
3.1518 |
3.1518 |
| H6 |
2.3144 |
1.0700 |
2.3284 |
2.3284 |
2.8710 |
| 2.6805 |
2.6805 |
3.1518 |
3.1518 |
| H7 |
2.1972 |
2.1972 |
1.0785 |
3.2374 |
2.6805 |
2.6805 |
| 4.1362 |
1.8111 |
3.6633 |
| H8 |
2.1972 |
2.1972 |
3.2374 |
1.0785 |
2.6805 |
2.6805 |
4.1362 |
| 3.6633 |
1.8111 |
| H9 |
2.2331 |
2.2331 |
1.0822 |
2.5872 |
3.1518 |
3.1518 |
1.8111 |
3.6633 |
| 2.4515 |
| H10 |
2.2331 |
2.2331 |
2.5872 |
1.0822 |
3.1518 |
3.1518 |
3.6633 |
1.8111 |
2.4515 |
|
Maximum atom distance is 4.1362Å
between atoms H7 and H8.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
C3 |
60.470 |
|
C1 |
C2 |
C4 |
60.470 |
|
C1 |
C3 |
C2 |
59.059 |
|
C1 |
C4 |
C2 |
59.059 |
|
C2 |
C1 |
C3 |
60.470 |
|
C2 |
C1 |
C4 |
60.470 |
|
C3 |
C1 |
C4 |
98.374 |
|
C3 |
C2 |
C4 |
98.374 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
H6 |
131.000 |
|
C1 |
C3 |
H7 |
116.849 |
|
C1 |
C3 |
H9 |
119.799 |
|
C1 |
C4 |
H8 |
116.849 |
|
C1 |
C4 |
H10 |
119.799 |
|
C2 |
C1 |
H5 |
131.000 |
|
C2 |
C3 |
H7 |
116.849 |
|
C2 |
C3 |
H9 |
119.799 |
|
C2 |
C4 |
H8 |
116.849 |
|
C2 |
C4 |
H10 |
119.799 |
|
C3 |
C1 |
H5 |
130.339 |
|
C3 |
C2 |
H6 |
130.339 |
|
C4 |
C1 |
H5 |
130.339 |
|
C4 |
C2 |
H6 |
130.339 |
|
H7 |
C3 |
H9 |
113.900 |
|
H8 |
C4 |
H10 |
113.900 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.