|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHBr2F (dibromofluoromethane)
1A' CS
1910171554
InChI=1S/CHBr2F/c2-1(3)4/h1H INChIKey=LTUTVFXOEGMHMP-UHFFFAOYSA-N
CCSD/6-31G*
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.1044 |
0.7996 |
0.0000 |
|
-0.3506 |
0.7187 |
-0.1044 |
| H2 |
-1.0075 |
1.4054 |
0.0000 |
|
-0.6162 |
1.2631 |
-1.0075 |
| F3 |
0.9932 |
1.5943 |
0.0000 |
|
-0.6990 |
1.4329 |
0.9932 |
| Br4 |
-0.1044 |
-0.2936 |
1.6082 |
|
1.5741 |
0.4412 |
-0.1044 |
| Br5 |
-0.1044 |
-0.2936 |
-1.6082 |
|
-1.3167 |
-0.9690 |
-0.1044 |
Atom - Atom Distances (Å)
| |
C1 |
H2 |
F3 |
Br4 |
Br5 |
| C1 |
|
1.0875 |
1.3551 |
1.9446 |
1.9446 |
| H2 |
1.0875 |
| 2.0097 |
2.5077 |
2.5077 |
| F3 |
1.3551 |
2.0097 |
| 2.7121 |
2.7121 |
| Br4 |
1.9446 |
2.5077 |
2.7121 |
| 3.2164 |
| Br5 |
1.9446 |
2.5077 |
2.7121 |
3.2164 |
|
Maximum atom distance is 3.2164Å
between atoms Br4 and Br5.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
F3 |
C1 |
Br4 |
109.250 |
|
F3 |
C1 |
Br5 |
109.250 |
|
Br4 |
C1 |
Br5 |
111.585 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
H2 |
C1 |
F3 |
110.246 |
|
H2 |
C1 |
Br4 |
108.249 |
|
H2 |
C1 |
Br5 |
108.249 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.