|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C3H6O (Acetone enol)
1A' CS
1910171554
InChI=1S/C3H6O/c1-3(2)4/h4H,1H2,2H3 INChIKey=NARVIWMVBMUEOG-UHFFFAOYSA-N
MP4/6-31G*
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.9497 |
-1.0634 |
0.0000 |
|
-1.3925 |
0.3060 |
0.0000 |
| C2 |
0.0000 |
0.0975 |
0.0000 |
|
0.0850 |
0.0478 |
0.0000 |
| C3 |
0.3493 |
1.3968 |
0.0000 |
|
1.0459 |
0.9895 |
0.0000 |
| O4 |
-1.3066 |
-0.3506 |
0.0000 |
|
0.3353 |
-1.3106 |
0.0000 |
| H5 |
1.9881 |
-0.7159 |
0.0000 |
|
-1.5990 |
1.3814 |
0.0000 |
| H6 |
0.7798 |
-1.6893 |
0.8858 |
|
-1.8546 |
-0.1490 |
0.8858 |
| H7 |
0.7798 |
-1.6893 |
-0.8858 |
|
-1.8546 |
-0.1490 |
-0.8858 |
| H8 |
1.3949 |
1.6888 |
0.0000 |
|
0.7875 |
2.0439 |
0.0000 |
| H9 |
-0.3908 |
2.1969 |
0.0000 |
|
2.1062 |
0.7370 |
0.0000 |
| H10 |
-1.8929 |
0.4288 |
0.0000 |
|
1.3021 |
-1.4393 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
C3 |
O4 |
H5 |
H6 |
H7 |
H8 |
H9 |
H10 |
| C1 |
|
1.4999 |
2.5324 |
2.3662 |
1.0950 |
1.0978 |
1.0978 |
2.7880 |
3.5252 |
3.2105 |
| C2 |
1.4999 |
|
1.3454 |
1.3813 |
2.1480 |
2.1413 |
2.1413 |
2.1161 |
2.1355 |
1.9217 |
| C3 |
2.5324 |
1.3454 |
| 2.4074 |
2.6738 |
3.2394 |
3.2394 |
1.0856 |
1.0899 |
2.4423 |
| O4 |
2.3662 |
1.3813 |
2.4074 |
| 3.3149 |
2.6324 |
2.6324 |
3.3848 |
2.7072 |
0.9753 |
| H5 |
1.0950 |
2.1480 |
2.6738 |
3.3149 |
| 1.7867 |
1.7867 |
2.4768 |
3.7608 |
4.0463 |
| H6 |
1.0978 |
2.1413 |
3.2394 |
2.6324 |
1.7867 |
| 1.7715 |
3.5461 |
4.1542 |
3.5234 |
| H7 |
1.0978 |
2.1413 |
3.2394 |
2.6324 |
1.7867 |
1.7715 |
| 3.5461 |
4.1542 |
3.5234 |
| H8 |
2.7880 |
2.1161 |
1.0856 |
3.3848 |
2.4768 |
3.5461 |
3.5461 |
| 1.8566 |
3.5210 |
| H9 |
3.5252 |
2.1355 |
1.0899 |
2.7072 |
3.7608 |
4.1542 |
4.1542 |
1.8566 |
| 2.3201 |
| H10 |
3.2105 |
1.9217 |
2.4423 |
0.9753 |
4.0463 |
3.5234 |
3.5234 |
3.5210 |
2.3201 |
|
Maximum atom distance is 4.1542Å
between atoms H6 and H9.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
C3 |
125.669 |
|
C1 |
C2 |
O4 |
110.354 |
|
C3 |
C2 |
O4 |
123.977 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C2 |
C1 |
H5 |
110.779 |
|
C2 |
C1 |
H6 |
110.077 |
|
C2 |
C1 |
H7 |
110.077 |
|
C2 |
C3 |
H8 |
120.651 |
|
C2 |
C3 |
H9 |
122.187 |
|
C2 |
O4 |
H10 |
108.025 |
|
H5 |
C1 |
H6 |
109.130 |
|
H5 |
C1 |
H7 |
109.130 |
|
H6 |
C1 |
H7 |
107.581 |
|
H8 |
C3 |
H9 |
117.162 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.