|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHBr2F (dibromofluoromethane)
1A' CS
1910171554
InChI=1S/CHBr2F/c2-1(3)4/h1H INChIKey=LTUTVFXOEGMHMP-UHFFFAOYSA-N
QCISD(T)/6-31G*
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.1048 |
0.8048 |
0.0000 |
|
-0.3498 |
0.7248 |
-0.1048 |
| H2 |
-1.0099 |
1.4117 |
0.0000 |
|
-0.6136 |
1.2714 |
-1.0099 |
| F3 |
0.9975 |
1.5983 |
0.0000 |
|
-0.6947 |
1.4394 |
0.9975 |
| Br4 |
-0.1048 |
-0.2946 |
1.6119 |
|
1.5798 |
0.4352 |
-0.1048 |
| Br5 |
-0.1048 |
-0.2946 |
-1.6119 |
|
-1.3237 |
-0.9659 |
-0.1048 |
Atom - Atom Distances (Å)
| |
C1 |
H2 |
F3 |
Br4 |
Br5 |
| C1 |
|
1.0897 |
1.3582 |
1.9512 |
1.9512 |
| H2 |
1.0897 |
| 2.0160 |
2.5158 |
2.5158 |
| F3 |
1.3582 |
2.0160 |
| 2.7197 |
2.7197 |
| Br4 |
1.9512 |
2.5158 |
2.7197 |
| 3.2239 |
| Br5 |
1.9512 |
2.5158 |
2.7197 |
3.2239 |
|
Maximum atom distance is 3.2239Å
between atoms Br4 and Br5.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
F3 |
C1 |
Br4 |
109.220 |
|
F3 |
C1 |
Br5 |
109.220 |
|
Br4 |
C1 |
Br5 |
111.408 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
H2 |
C1 |
F3 |
110.406 |
|
H2 |
C1 |
Br4 |
108.290 |
|
H2 |
C1 |
Br5 |
108.290 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.