|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C2HF3 (Trifluoroethylene)
1A' CS
1910171554
InChI=1S/C2HF3/c3-1-2(4)5/h1H INChIKey=MIZLGWKEZAPEFJ-UHFFFAOYSA-N
B3LYPultrafine/6-31G*
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.4345 |
0.0000 |
|
0.4337 |
0.0273 |
0.0000 |
| C2 |
-0.7060 |
-0.6887 |
0.0000 |
|
-0.6430 |
-0.7479 |
0.0000 |
| F3 |
1.3203 |
0.4979 |
0.0000 |
|
0.4139 |
1.3490 |
0.0000 |
| F4 |
-0.5610 |
1.6355 |
0.0000 |
|
1.6675 |
-0.4570 |
0.0000 |
| F5 |
-0.0901 |
-1.8850 |
0.0000 |
|
-1.8756 |
-0.2085 |
0.0000 |
| H6 |
-1.7872 |
-0.7101 |
0.0000 |
|
-0.5963 |
-1.8283 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
F3 |
F4 |
F5 |
H6 |
| C1 |
|
1.3267 |
1.3219 |
1.3255 |
2.3213 |
2.1223 |
| C2 |
1.3267 |
| 2.3482 |
2.3287 |
1.3455 |
1.0814 |
| F3 |
1.3219 |
2.3482 |
| 2.1985 |
2.7690 |
3.3341 |
| F4 |
1.3255 |
2.3287 |
2.1985 |
| 3.5518 |
2.6468 |
| F5 |
2.3213 |
1.3455 |
2.7690 |
3.5518 |
| 2.0641 |
| H6 |
2.1223 |
1.0814 |
3.3341 |
2.6468 |
2.0641 |
|
Maximum atom distance is 3.5518Å
between atoms F4 and F5.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
F5 |
120.608 |
|
C2 |
C1 |
F3 |
124.898 |
|
C2 |
C1 |
F4 |
122.811 |
|
F3 |
C1 |
F4 |
112.290 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
H6 |
123.284 |
|
F5 |
C2 |
H6 |
116.108 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.