|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for NH2COOC2H5 (Urethane)
1A C1
1910171554
InChI=1S/C3H7NO2/c1-2-6-3(4)5/h2H2,1H3,(H2,4,5) INChIKey=JOYRKODLDBILNP-UHFFFAOYSA-N
MP2/6-31G*
Point group is C1
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
2.5414 |
-0.2550 |
0.0573 |
|
-2.5479 |
-0.1809 |
0.0522 |
| H2 |
2.6859 |
-0.8519 |
-0.8451 |
|
-2.7067 |
-0.7873 |
-0.8413 |
| H3 |
3.3623 |
0.4624 |
0.1421 |
|
-3.3480 |
0.5611 |
0.1231 |
| H4 |
2.5616 |
-0.9199 |
0.9226 |
|
-2.5899 |
-0.8314 |
0.9276 |
| C5 |
1.2218 |
0.4779 |
-0.0051 |
|
-1.2075 |
0.5127 |
-0.0168 |
| H6 |
1.0528 |
1.0711 |
0.9001 |
|
-1.0243 |
1.1149 |
0.8797 |
| H7 |
1.1985 |
1.1477 |
-0.8758 |
|
-1.1622 |
1.1680 |
-0.8977 |
| O8 |
0.2043 |
-0.5270 |
-0.1274 |
|
-0.2190 |
-0.5228 |
-0.1200 |
| N9 |
-1.3660 |
1.1706 |
0.0833 |
|
1.3989 |
1.1320 |
0.0701 |
| H10 |
-0.7443 |
1.8334 |
-0.3575 |
|
0.7979 |
1.8054 |
-0.3832 |
| H11 |
-2.3504 |
1.3868 |
-0.0041 |
|
2.3894 |
1.3183 |
-0.0172 |
| C12 |
-1.1109 |
-0.1842 |
-0.0197 |
|
1.1052 |
-0.2164 |
-0.0129 |
| O13 |
-1.9691 |
-1.0425 |
0.0449 |
|
1.9381 |
-1.0979 |
0.0680 |
Atom - Atom Distances (Å)
| |
C1 |
H2 |
H3 |
H4 |
C5 |
H6 |
H7 |
O8 |
N9 |
H10 |
H11 |
C12 |
O13 |
| C1 |
|
1.0915 |
1.0935 |
1.0914 |
1.5108 |
2.1645 |
2.1545 |
2.3601 |
4.1595 |
3.9153 |
5.1604 |
3.6538 |
4.5788 |
| H2 |
1.0915 |
| 1.7775 |
1.7733 |
2.1488 |
3.0677 |
2.4923 |
2.6036 |
4.6228 |
4.3834 |
5.5752 |
3.9424 |
4.7431 |
| H3 |
1.0935 |
1.7775 |
| 1.7779 |
2.1456 |
2.5058 |
2.4876 |
3.3203 |
4.7814 |
4.3581 |
5.7888 |
4.5226 |
5.5406 |
| H4 |
1.0914 |
1.7733 |
1.7779 |
| 2.1470 |
2.4983 |
3.0606 |
2.6103 |
4.5278 |
4.4886 |
5.5052 |
3.8621 |
4.6165 |
| C5 |
1.5108 |
2.1488 |
2.1456 |
2.1470 |
|
1.0954 |
1.0988 |
1.4353 |
2.6804 |
2.4139 |
3.6860 |
2.4249 |
3.5350 |
| H6 |
2.1645 |
3.0677 |
2.5058 |
2.4983 |
1.0954 |
| 1.7835 |
2.0808 |
2.5549 |
2.3221 |
3.5354 |
2.6652 |
3.7856 |
| H7 |
2.1545 |
2.4923 |
2.4876 |
3.0606 |
1.0988 |
1.7835 |
| 2.0864 |
2.7381 |
2.1244 |
3.6622 |
2.8000 |
3.9596 |
| O8 |
2.3601 |
2.6036 |
3.3203 |
2.6103 |
1.4353 |
2.0808 |
2.0864 |
| 2.3221 |
2.5542 |
3.1944 |
1.3634 |
2.2403 |
| N9 |
4.1595 |
4.6228 |
4.7814 |
4.5278 |
2.6804 |
2.5549 |
2.7381 |
2.3221 |
|
1.0101 |
1.0116 |
1.3825 |
2.2941 |
| H10 |
3.9153 |
4.3834 |
4.3581 |
4.4886 |
2.4139 |
2.3221 |
2.1244 |
2.5542 |
1.0101 |
| 1.7041 |
2.0783 |
3.1516 |
| H11 |
5.1604 |
5.5752 |
5.7888 |
5.5052 |
3.6860 |
3.5354 |
3.6622 |
3.1944 |
1.0116 |
1.7041 |
| 2.0012 |
2.4595 |
| C12 |
3.6538 |
3.9424 |
4.5226 |
3.8621 |
2.4249 |
2.6652 |
2.8000 |
1.3634 |
1.3825 |
2.0783 |
2.0012 |
|
1.2155 |
| O13 |
4.5788 |
4.7431 |
5.5406 |
4.6165 |
3.5350 |
3.7856 |
3.9596 |
2.2403 |
2.2941 |
3.1516 |
2.4595 |
1.2155 |
|
Maximum atom distance is 5.7888Å
between atoms H3 and H11.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C5 |
O8 |
106.444 |
|
C5 |
O8 |
C12 |
120.074 |
|
O8 |
C12 |
N9 |
115.486 |
|
O8 |
C12 |
O13 |
120.519 |
|
N9 |
C12 |
O13 |
123.899 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C5 |
H6 |
111.307 |
|
C1 |
C5 |
H7 |
110.304 |
|
H2 |
C1 |
H3 |
108.877 |
|
H2 |
C1 |
H4 |
108.655 |
|
H2 |
C1 |
C5 |
110.287 |
|
H3 |
C1 |
H4 |
108.925 |
|
H3 |
C1 |
C5 |
109.915 |
|
H4 |
C1 |
C5 |
110.146 |
|
H6 |
C5 |
H7 |
108.747 |
|
H6 |
C5 |
O8 |
109.890 |
|
H7 |
C5 |
O8 |
110.136 |
|
H10 |
N9 |
H11 |
114.899 |
|
H10 |
N9 |
C12 |
119.797 |
|
H11 |
N9 |
C12 |
112.493 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.