|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C4H6O2 (2,3-Butanedione)
1Ag C2H
1910171554
InChI=1S/C4H6O2/c1-3(5)4(2)6/h1-2H3 INChIKey=QSJXEFYPDANLFS-UHFFFAOYSA-N
CID/6-31G*
Point group is C2h
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.0781 |
0.7630 |
0.0000 |
|
0.7640 |
0.0674 |
0.0000 |
| C2 |
0.0781 |
-0.7630 |
0.0000 |
|
-0.7640 |
-0.0674 |
0.0000 |
| C3 |
1.1855 |
1.5709 |
0.0000 |
|
1.3187 |
1.4609 |
0.0000 |
| C4 |
-1.1855 |
-1.5709 |
0.0000 |
|
-1.3187 |
-1.4609 |
0.0000 |
| O5 |
-1.1855 |
1.2373 |
0.0000 |
|
1.4390 |
-0.9305 |
0.0000 |
| O6 |
1.1855 |
-1.2373 |
0.0000 |
|
-1.4390 |
0.9305 |
0.0000 |
| H7 |
0.9358 |
2.6260 |
0.0000 |
|
2.4019 |
1.4150 |
0.0000 |
| H8 |
-0.9358 |
-2.6260 |
0.0000 |
|
-2.4019 |
-1.4150 |
0.0000 |
| H9 |
1.7856 |
1.3255 |
0.8732 |
|
0.9643 |
2.0038 |
0.8732 |
| H10 |
1.7856 |
1.3255 |
-0.8732 |
|
0.9643 |
2.0038 |
-0.8732 |
| H11 |
-1.7856 |
-1.3255 |
0.8732 |
|
-0.9643 |
-2.0038 |
0.8732 |
| H12 |
-1.7856 |
-1.3255 |
-0.8732 |
|
-0.9643 |
-2.0038 |
-0.8732 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
C3 |
C4 |
O5 |
O6 |
H7 |
H8 |
H9 |
H10 |
H11 |
H12 |
| C1 |
|
1.5339 |
1.4998 |
2.5833 |
1.2047 |
2.3660 |
2.1210 |
3.4958 |
2.1336 |
2.1336 |
2.8355 |
2.8355 |
| C2 |
1.5339 |
| 2.5833 |
1.4998 |
2.3660 |
1.2047 |
3.4958 |
2.1210 |
2.8355 |
2.8355 |
2.1336 |
2.1336 |
| C3 |
1.4998 |
2.5833 |
| 3.9360 |
2.3944 |
2.8082 |
1.0842 |
4.7025 |
1.0876 |
1.0876 |
4.2402 |
4.2402 |
| C4 |
2.5833 |
1.4998 |
3.9360 |
| 2.8082 |
2.3944 |
4.7025 |
1.0842 |
4.2402 |
4.2402 |
1.0876 |
1.0876 |
| O5 |
1.2047 |
2.3660 |
2.3944 |
2.8082 |
| 3.4272 |
2.5355 |
3.8713 |
3.0981 |
3.0981 |
2.7732 |
2.7732 |
| O6 |
2.3660 |
1.2047 |
2.8082 |
2.3944 |
3.4272 |
| 3.8713 |
2.5355 |
2.7732 |
2.7732 |
3.0981 |
3.0981 |
| H7 |
2.1210 |
3.4958 |
1.0842 |
4.7025 |
2.5355 |
3.8713 |
| 5.5755 |
1.7821 |
1.7821 |
4.8768 |
4.8768 |
| H8 |
3.4958 |
2.1210 |
4.7025 |
1.0842 |
3.8713 |
2.5355 |
5.5755 |
| 4.8768 |
4.8768 |
1.7821 |
1.7821 |
| H9 |
2.1336 |
2.8355 |
1.0876 |
4.2402 |
3.0981 |
2.7732 |
1.7821 |
4.8768 |
| 1.7465 |
4.4476 |
4.7782 |
| H10 |
2.1336 |
2.8355 |
1.0876 |
4.2402 |
3.0981 |
2.7732 |
1.7821 |
4.8768 |
1.7465 |
| 4.7782 |
4.4476 |
| H11 |
2.8355 |
2.1336 |
4.2402 |
1.0876 |
2.7732 |
3.0981 |
4.8768 |
1.7821 |
4.4476 |
4.7782 |
| 1.7465 |
| H12 |
2.8355 |
2.1336 |
4.2402 |
1.0876 |
2.7732 |
3.0981 |
4.8768 |
1.7821 |
4.7782 |
4.4476 |
1.7465 |
|
Maximum atom distance is 5.5755Å
between atoms H7 and H8.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
C4 |
116.749 |
|
C1 |
C2 |
O6 |
119.030 |
|
C2 |
C1 |
C3 |
116.749 |
|
C2 |
C1 |
O5 |
119.030 |
|
C3 |
C1 |
O5 |
124.220 |
|
C4 |
C2 |
O6 |
124.220 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C3 |
H7 |
109.280 |
|
C1 |
C3 |
H9 |
110.080 |
|
C1 |
C3 |
H10 |
110.080 |
|
C2 |
C4 |
H8 |
109.280 |
|
C2 |
C4 |
H11 |
110.080 |
|
C2 |
C4 |
H12 |
110.080 |
|
H7 |
C3 |
H9 |
110.280 |
|
H7 |
C3 |
H10 |
110.280 |
|
H8 |
C4 |
H11 |
110.280 |
|
H8 |
C4 |
H12 |
110.280 |
|
H9 |
C3 |
H10 |
106.817 |
|
H11 |
C4 |
H12 |
106.817 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.