|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for N(CH3)3 (Trimethylamine)
1A1 C3V
1910171554
InChI=1S/C3H9N/c1-4(2)3/h1-3H3 INChIKey=GETQZCLCWQTVFV-UHFFFAOYSA-N
PBE1PBE/6-31G*
Point group is C3v
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| N1 |
0.0000 |
0.0000 |
0.3757 |
|
0.0000 |
0.0000 |
0.3757 |
| C2 |
0.0000 |
1.3780 |
-0.0614 |
|
1.2144 |
0.6512 |
-0.0614 |
| C3 |
1.1934 |
-0.6890 |
-0.0614 |
|
-1.1712 |
0.7261 |
-0.0614 |
| C4 |
-1.1934 |
-0.6890 |
-0.0614 |
|
-0.0432 |
-1.3773 |
-0.0614 |
| H5 |
0.0000 |
1.4863 |
-1.1650 |
|
1.3098 |
0.7024 |
-1.1650 |
| H6 |
1.2871 |
-0.7431 |
-1.1650 |
|
-1.2632 |
0.7832 |
-1.1650 |
| H7 |
-1.2871 |
-0.7431 |
-1.1650 |
|
-0.0466 |
-1.4855 |
-1.1650 |
| H8 |
-0.8864 |
1.8905 |
0.3283 |
|
2.0850 |
0.1122 |
0.3283 |
| H9 |
0.8864 |
1.8905 |
0.3283 |
|
1.2472 |
1.6746 |
0.3283 |
| H10 |
2.0804 |
-0.1776 |
0.3283 |
|
-1.1397 |
1.7495 |
0.3283 |
| H11 |
1.1940 |
-1.7129 |
0.3283 |
|
-2.0738 |
0.2428 |
0.3283 |
| H12 |
-1.1940 |
-1.7129 |
0.3283 |
|
-0.9453 |
-1.8618 |
0.3283 |
| H13 |
-2.0804 |
-0.1776 |
0.3283 |
|
0.8267 |
-1.9174 |
0.3283 |
Atom - Atom Distances (Å)
| |
N1 |
C2 |
C3 |
C4 |
H5 |
H6 |
H7 |
H8 |
H9 |
H10 |
H11 |
H12 |
H13 |
| N1 |
|
1.4456 |
1.4456 |
1.4456 |
2.1407 |
2.1407 |
2.1407 |
2.0885 |
2.0885 |
2.0885 |
2.0885 |
2.0885 |
2.0885 |
| C2 |
1.4456 |
| 2.3867 |
2.3867 |
1.1089 |
2.7155 |
2.7155 |
1.0955 |
1.0955 |
2.6267 |
3.3363 |
3.3363 |
2.6267 |
| C3 |
1.4456 |
2.3867 |
| 2.3867 |
2.7155 |
1.1089 |
2.7155 |
3.3363 |
2.6267 |
1.0955 |
1.0955 |
2.6267 |
3.3363 |
| C4 |
1.4456 |
2.3867 |
2.3867 |
| 2.7155 |
2.7155 |
1.1089 |
2.6267 |
3.3363 |
3.3363 |
2.6267 |
1.0955 |
1.0955 |
| H5 |
2.1407 |
1.1089 |
2.7155 |
2.7155 |
| 2.5743 |
2.5743 |
1.7830 |
1.7830 |
3.0539 |
3.7269 |
3.7269 |
3.0539 |
| H6 |
2.1407 |
2.7155 |
1.1089 |
2.7155 |
2.5743 |
| 2.5743 |
3.7269 |
3.0539 |
1.7830 |
1.7830 |
3.0539 |
3.7269 |
| H7 |
2.1407 |
2.7155 |
2.7155 |
1.1089 |
2.5743 |
2.5743 |
| 3.0539 |
3.7269 |
3.7269 |
3.0539 |
1.7830 |
1.7830 |
| H8 |
2.0885 |
1.0955 |
3.3363 |
2.6267 |
1.7830 |
3.7269 |
3.0539 |
| 1.7728 |
3.6165 |
4.1609 |
3.6165 |
2.3880 |
| H9 |
2.0885 |
1.0955 |
2.6267 |
3.3363 |
1.7830 |
3.0539 |
3.7269 |
1.7728 |
| 2.3880 |
3.6165 |
4.1609 |
3.6165 |
| H10 |
2.0885 |
2.6267 |
1.0955 |
3.3363 |
3.0539 |
1.7830 |
3.7269 |
3.6165 |
2.3880 |
| 1.7728 |
3.6165 |
4.1609 |
| H11 |
2.0885 |
3.3363 |
1.0955 |
2.6267 |
3.7269 |
1.7830 |
3.0539 |
4.1609 |
3.6165 |
1.7728 |
| 2.3880 |
3.6165 |
| H12 |
2.0885 |
3.3363 |
2.6267 |
1.0955 |
3.7269 |
3.0539 |
1.7830 |
3.6165 |
4.1609 |
3.6165 |
2.3880 |
| 1.7728 |
| H13 |
2.0885 |
2.6267 |
3.3363 |
1.0955 |
3.0539 |
3.7269 |
1.7830 |
2.3880 |
3.6165 |
4.1609 |
3.6165 |
1.7728 |
|
Maximum atom distance is 4.1609Å
between atoms H8 and H11.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C2 |
N1 |
C3 |
111.278 |
|
C2 |
N1 |
C4 |
111.278 |
|
C3 |
N1 |
C4 |
111.278 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
N1 |
C2 |
H5 |
113.201 |
|
N1 |
C2 |
H8 |
109.779 |
|
N1 |
C2 |
H9 |
109.779 |
|
N1 |
C3 |
H6 |
113.201 |
|
N1 |
C3 |
H10 |
109.779 |
|
N1 |
C3 |
H11 |
109.779 |
|
N1 |
C4 |
H7 |
113.201 |
|
N1 |
C4 |
H12 |
109.779 |
|
N1 |
C4 |
H13 |
109.779 |
|
H5 |
C2 |
H8 |
107.955 |
|
H5 |
C2 |
H9 |
107.955 |
|
H6 |
C3 |
H10 |
107.955 |
|
H6 |
C3 |
H11 |
107.955 |
|
H7 |
C4 |
H12 |
107.955 |
|
H7 |
C4 |
H13 |
107.955 |
|
H8 |
C2 |
H9 |
108.019 |
|
H10 |
C3 |
H11 |
108.019 |
|
H12 |
C4 |
H13 |
108.019 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.