|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C6H4F2 (1,4-difluorobenzene)
1Ag D2H
1910171554
InChI=1S/C6H4F2/c7-5-1-2-6(8)4-3-5/h1-4H INChIKey=QUGUFLJIAFISSW-UHFFFAOYSA-N
MP3=FULL/6-31G*
Point group is D2h
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
1.3605 |
|
1.3605 |
0.0000 |
0.0000 |
| C2 |
0.0000 |
0.0000 |
-1.3605 |
|
-1.3605 |
0.0000 |
0.0000 |
| C3 |
0.0000 |
1.2150 |
0.6957 |
|
0.6957 |
1.2150 |
0.0000 |
| C4 |
0.0000 |
-1.2150 |
0.6957 |
|
0.6957 |
-1.2150 |
0.0000 |
| C5 |
0.0000 |
-1.2150 |
-0.6957 |
|
-0.6957 |
-1.2150 |
0.0000 |
| C6 |
0.0000 |
1.2150 |
-0.6957 |
|
-0.6957 |
1.2150 |
0.0000 |
| F7 |
0.0000 |
0.0000 |
2.7145 |
|
2.7145 |
0.0000 |
0.0000 |
| F8 |
0.0000 |
0.0000 |
-2.7145 |
|
-2.7145 |
0.0000 |
0.0000 |
| H9 |
0.0000 |
2.1430 |
1.2563 |
|
1.2563 |
2.1430 |
0.0000 |
| H10 |
0.0000 |
-2.1430 |
1.2563 |
|
1.2563 |
-2.1430 |
0.0000 |
| H11 |
0.0000 |
-2.1430 |
-1.2563 |
|
-1.2563 |
-2.1430 |
0.0000 |
| H12 |
0.0000 |
2.1430 |
-1.2563 |
|
-1.2563 |
2.1430 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
C3 |
C4 |
C5 |
C6 |
F7 |
F8 |
H9 |
H10 |
H11 |
H12 |
| C1 |
| 2.7210 |
1.3850 |
1.3850 |
2.3884 |
2.3884 |
1.3540 |
4.0751 |
2.1455 |
2.1455 |
3.3824 |
3.3824 |
| C2 |
2.7210 |
| 2.3884 |
2.3884 |
1.3850 |
1.3850 |
4.0751 |
1.3540 |
3.3824 |
3.3824 |
2.1455 |
2.1455 |
| C3 |
1.3850 |
2.3884 |
| 2.4301 |
2.8002 |
1.3915 |
2.3563 |
3.6203 |
1.0842 |
3.4045 |
3.8842 |
2.1614 |
| C4 |
1.3850 |
2.3884 |
2.4301 |
|
1.3915 |
2.8002 |
2.3563 |
3.6203 |
3.4045 |
1.0842 |
2.1614 |
3.8842 |
| C5 |
2.3884 |
1.3850 |
2.8002 |
1.3915 |
| 2.4301 |
3.6203 |
2.3563 |
3.8842 |
2.1614 |
1.0842 |
3.4045 |
| C6 |
2.3884 |
1.3850 |
1.3915 |
2.8002 |
2.4301 |
| 3.6203 |
2.3563 |
2.1614 |
3.8842 |
3.4045 |
1.0842 |
| F7 |
1.3540 |
4.0751 |
2.3563 |
2.3563 |
3.6203 |
3.6203 |
| 5.4291 |
2.5921 |
2.5921 |
4.5123 |
4.5123 |
| F8 |
4.0751 |
1.3540 |
3.6203 |
3.6203 |
2.3563 |
2.3563 |
5.4291 |
| 4.5123 |
4.5123 |
2.5921 |
2.5921 |
| H9 |
2.1455 |
3.3824 |
1.0842 |
3.4045 |
3.8842 |
2.1614 |
2.5921 |
4.5123 |
| 4.2860 |
4.9682 |
2.5127 |
| H10 |
2.1455 |
3.3824 |
3.4045 |
1.0842 |
2.1614 |
3.8842 |
2.5921 |
4.5123 |
4.2860 |
| 2.5127 |
4.9682 |
| H11 |
3.3824 |
2.1455 |
3.8842 |
2.1614 |
1.0842 |
3.4045 |
4.5123 |
2.5921 |
4.9682 |
2.5127 |
| 4.2860 |
| H12 |
3.3824 |
2.1455 |
2.1614 |
3.8842 |
3.4045 |
1.0842 |
4.5123 |
2.5921 |
2.5127 |
4.9682 |
4.2860 |
|
Maximum atom distance is 5.4291Å
between atoms F7 and F8.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C3 |
C6 |
118.684 |
|
C1 |
C4 |
C5 |
118.684 |
|
C2 |
C5 |
C4 |
118.684 |
|
C2 |
C6 |
C3 |
118.684 |
|
C3 |
C1 |
C4 |
122.631 |
|
C3 |
C1 |
F7 |
118.684 |
|
C4 |
C1 |
F7 |
118.684 |
|
C5 |
C2 |
C6 |
122.631 |
|
C5 |
C2 |
F8 |
118.684 |
|
C6 |
C2 |
F8 |
118.684 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C3 |
H9 |
120.178 |
|
C1 |
C4 |
H10 |
120.178 |
|
C2 |
C5 |
H11 |
120.178 |
|
C2 |
C6 |
H12 |
120.178 |
|
C3 |
C6 |
H12 |
121.138 |
|
C4 |
C5 |
H11 |
121.138 |
|
C5 |
C4 |
H10 |
121.138 |
|
C6 |
C3 |
H9 |
121.138 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.