|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C4H6OS (Vinyl sulfoxide)
1A' CS
1910171554
InChI=1S/C4H6OS/c1-3-6(5)4-2/h3-4H,1-2H2 INChIKey=HQSMEHLVLOGBCK-UHFFFAOYSA-N
wB97X-D/6-31G*
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| S1 |
0.5876 |
-0.5007 |
0.0000 |
|
0.4842 |
-0.1276 |
0.5876 |
| O2 |
1.2989 |
0.8239 |
0.0000 |
|
-0.7967 |
0.2100 |
1.2989 |
| C3 |
-0.6169 |
-0.4850 |
1.3361 |
|
0.1284 |
-1.4156 |
-0.6169 |
| C4 |
-0.6169 |
-0.4850 |
-1.3361 |
|
0.8095 |
1.1684 |
-0.6169 |
| C5 |
-0.6169 |
0.5160 |
2.2025 |
|
-1.0603 |
-1.9983 |
-0.6169 |
| C6 |
-0.6169 |
0.5160 |
-2.2025 |
|
0.0623 |
2.2613 |
-0.6169 |
| H7 |
-1.2669 |
-1.3543 |
1.3916 |
|
0.9549 |
-1.6907 |
-1.2669 |
| H8 |
-1.2669 |
-1.3543 |
-1.3916 |
|
1.6642 |
1.0005 |
-1.2669 |
| H9 |
-1.3107 |
0.5395 |
3.0367 |
|
-1.2956 |
-2.7989 |
-1.3107 |
| H10 |
-1.3107 |
0.5395 |
-3.0367 |
|
0.2522 |
3.0739 |
-1.3107 |
| H11 |
0.0836 |
1.3382 |
2.0810 |
|
-1.8243 |
-1.6713 |
0.0836 |
| H12 |
0.0836 |
1.3382 |
-2.0810 |
|
-0.7636 |
2.3533 |
0.0836 |
Atom - Atom Distances (Å)
| |
S1 |
O2 |
C3 |
C4 |
C5 |
C6 |
H7 |
H8 |
H9 |
H10 |
H11 |
H12 |
| S1 |
| 1.5035 |
1.7989 |
1.7989 |
2.7084 |
2.7084 |
2.4707 |
2.4707 |
3.7293 |
3.7293 |
2.8224 |
2.8224 |
| O2 |
1.5035 |
| 2.6774 |
2.6774 |
2.9353 |
2.9353 |
3.6420 |
3.6420 |
4.0141 |
4.0141 |
2.4641 |
2.4641 |
| C3 |
1.7989 |
2.6774 |
| 2.6722 |
1.3239 |
3.6775 |
1.0869 |
2.9357 |
2.1031 |
4.5445 |
2.0903 |
3.9359 |
| C4 |
1.7989 |
2.6774 |
2.6722 |
| 3.6775 |
1.3239 |
2.9357 |
1.0869 |
4.5445 |
2.1031 |
3.9359 |
2.0903 |
| C5 |
2.7084 |
2.9353 |
1.3239 |
3.6775 |
| 4.4050 |
2.1397 |
4.1034 |
1.0853 |
5.2850 |
1.0868 |
4.4176 |
| C6 |
2.7084 |
2.9353 |
3.6775 |
1.3239 |
4.4050 |
| 4.1034 |
2.1397 |
5.2850 |
1.0853 |
4.4176 |
1.0868 |
| H7 |
2.4707 |
3.6420 |
1.0869 |
2.9357 |
2.1397 |
4.1034 |
| 2.7831 |
2.5090 |
4.8164 |
3.0900 |
4.5969 |
| H8 |
2.4707 |
3.6420 |
2.9357 |
1.0869 |
4.1034 |
2.1397 |
2.7831 |
| 4.8164 |
2.5090 |
4.5969 |
3.0900 |
| H9 |
3.7293 |
4.0141 |
2.1031 |
4.5445 |
1.0853 |
5.2850 |
2.5090 |
4.8164 |
| 6.0734 |
1.8696 |
5.3640 |
| H10 |
3.7293 |
4.0141 |
4.5445 |
2.1031 |
5.2850 |
1.0853 |
4.8164 |
2.5090 |
6.0734 |
| 5.3640 |
1.8696 |
| H11 |
2.8224 |
2.4641 |
2.0903 |
3.9359 |
1.0868 |
4.4176 |
3.0900 |
4.5969 |
1.8696 |
5.3640 |
| 4.1620 |
| H12 |
2.8224 |
2.4641 |
3.9359 |
2.0903 |
4.4176 |
1.0868 |
4.5969 |
3.0900 |
5.3640 |
1.8696 |
4.1620 |
|
Maximum atom distance is 6.0734Å
between atoms H9 and H10.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
S1 |
C3 |
C5 |
119.516 |
|
S1 |
C4 |
C6 |
119.516 |
|
O2 |
S1 |
C3 |
108.001 |
|
O2 |
S1 |
C4 |
108.001 |
|
C3 |
S1 |
C4 |
95.928 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
S1 |
C3 |
H7 |
115.551 |
|
S1 |
C4 |
H8 |
115.551 |
|
C3 |
C5 |
H9 |
121.291 |
|
C3 |
C5 |
H11 |
119.920 |
|
C4 |
C6 |
H10 |
121.291 |
|
C4 |
C6 |
H12 |
119.920 |
|
C5 |
C3 |
H7 |
124.847 |
|
C6 |
C4 |
H8 |
124.847 |
|
H9 |
C5 |
H11 |
118.788 |
|
H10 |
C6 |
H12 |
118.788 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.