|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3NO2 (Methane, nitro-)
1A' CS Os out of place
1910171554
InChI=1S/CH3NO2/c1-2(3)4/h1H3 INChIKey=LYGJENNIWJXYER-UHFFFAOYSA-N
B1B95/6-31G*
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0011 |
-1.3128 |
0.0000 |
|
-1.3128 |
0.0000 |
-0.0013 |
| N2 |
-0.0124 |
0.1726 |
0.0000 |
|
0.1727 |
0.0000 |
-0.0121 |
| H3 |
1.0473 |
-1.6182 |
0.0000 |
|
-1.6201 |
0.0000 |
1.0443 |
| H4 |
-0.4926 |
-1.6553 |
0.9045 |
|
-1.6544 |
0.9045 |
-0.4956 |
| H5 |
-0.4926 |
-1.6553 |
-0.9045 |
|
-1.6544 |
-0.9045 |
-0.4956 |
| O6 |
0.0011 |
0.7248 |
-1.0841 |
|
0.7248 |
-1.0841 |
0.0025 |
| O7 |
0.0011 |
0.7248 |
1.0841 |
|
0.7248 |
1.0841 |
0.0025 |
Atom - Atom Distances (Å)
| |
C1 |
N2 |
H3 |
H4 |
H5 |
O6 |
O7 |
| C1 |
|
1.4855 |
1.0898 |
1.0859 |
1.0859 |
2.3080 |
2.3080 |
| N2 |
1.4855 |
| 2.0809 |
2.0952 |
2.0952 |
1.2167 |
1.2167 |
| H3 |
1.0898 |
2.0809 |
| 1.7862 |
1.7862 |
2.7855 |
2.7855 |
| H4 |
1.0859 |
2.0952 |
1.7862 |
| 1.8089 |
3.1405 |
2.4374 |
| H5 |
1.0859 |
2.0952 |
1.7862 |
1.8089 |
| 2.4374 |
3.1405 |
| O6 |
2.3080 |
1.2167 |
2.7855 |
3.1405 |
2.4374 |
| 2.1681 |
| O7 |
2.3080 |
1.2167 |
2.7855 |
2.4374 |
3.1405 |
2.1681 |
|
Maximum atom distance is 3.1405Å
between atoms H4 and O6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
N2 |
O6 |
116.983 |
|
C1 |
N2 |
O7 |
116.983 |
|
O6 |
N2 |
O7 |
126.001 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
N2 |
C1 |
H3 |
106.796 |
|
N2 |
C1 |
H4 |
108.136 |
|
N2 |
C1 |
H5 |
108.136 |
|
H3 |
C1 |
H4 |
110.370 |
|
H3 |
C1 |
H5 |
110.370 |
|
H4 |
C1 |
H5 |
112.800 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.