|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for N(CH3)3 (Trimethylamine)
1A1 C3V
1910171554
InChI=1S/C3H9N/c1-4(2)3/h1-3H3 INChIKey=GETQZCLCWQTVFV-UHFFFAOYSA-N
B2PLYP/6-31G*
Point group is C3v
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| N1 |
0.0000 |
0.0000 |
0.3800 |
|
0.0000 |
-0.0000 |
-0.3800 |
| C2 |
0.0000 |
1.3832 |
-0.0626 |
|
1.3832 |
0.0000 |
0.0626 |
| C3 |
1.1979 |
-0.6916 |
-0.0626 |
|
-0.6916 |
-1.1979 |
0.0626 |
| C4 |
-1.1979 |
-0.6916 |
-0.0626 |
|
-0.6916 |
1.1979 |
0.0626 |
| H5 |
0.0000 |
1.4879 |
-1.1642 |
|
1.4879 |
0.0000 |
1.1642 |
| H6 |
1.2886 |
-0.7439 |
-1.1642 |
|
-0.7439 |
-1.2886 |
1.1642 |
| H7 |
-1.2886 |
-0.7439 |
-1.1642 |
|
-0.7439 |
1.2886 |
1.1642 |
| H8 |
-0.8858 |
1.8926 |
0.3264 |
|
1.8926 |
0.8858 |
-0.3264 |
| H9 |
0.8858 |
1.8926 |
0.3264 |
|
1.8926 |
-0.8858 |
-0.3264 |
| H10 |
2.0820 |
-0.1792 |
0.3264 |
|
-0.1792 |
-2.0820 |
-0.3264 |
| H11 |
1.1962 |
-1.7134 |
0.3264 |
|
-1.7134 |
-1.1962 |
-0.3264 |
| H12 |
-1.1962 |
-1.7134 |
0.3264 |
|
-1.7134 |
1.1962 |
-0.3264 |
| H13 |
-2.0820 |
-0.1792 |
0.3264 |
|
-0.1792 |
2.0820 |
-0.3264 |
Atom - Atom Distances (Å)
| |
N1 |
C2 |
C3 |
C4 |
H5 |
H6 |
H7 |
H8 |
H9 |
H10 |
H11 |
H12 |
H13 |
| N1 |
|
1.4523 |
1.4523 |
1.4523 |
2.1444 |
2.1444 |
2.1444 |
2.0904 |
2.0904 |
2.0904 |
2.0904 |
2.0904 |
2.0904 |
| C2 |
1.4523 |
| 2.3958 |
2.3958 |
1.1066 |
2.7201 |
2.7201 |
1.0934 |
1.0934 |
2.6319 |
3.3424 |
3.3424 |
2.6319 |
| C3 |
1.4523 |
2.3958 |
| 2.3958 |
2.7201 |
1.1066 |
2.7201 |
3.3424 |
2.6319 |
1.0934 |
1.0934 |
2.6319 |
3.3424 |
| C4 |
1.4523 |
2.3958 |
2.3958 |
| 2.7201 |
2.7201 |
1.1066 |
2.6319 |
3.3424 |
3.3424 |
2.6319 |
1.0934 |
1.0934 |
| H5 |
2.1444 |
1.1066 |
2.7201 |
2.7201 |
| 2.5771 |
2.5771 |
1.7806 |
1.7806 |
3.0555 |
3.7285 |
3.7285 |
3.0555 |
| H6 |
2.1444 |
2.7201 |
1.1066 |
2.7201 |
2.5771 |
| 2.5771 |
3.7285 |
3.0555 |
1.7806 |
1.7806 |
3.0555 |
3.7285 |
| H7 |
2.1444 |
2.7201 |
2.7201 |
1.1066 |
2.5771 |
2.5771 |
| 3.0555 |
3.7285 |
3.7285 |
3.0555 |
1.7806 |
1.7806 |
| H8 |
2.0904 |
1.0934 |
3.3424 |
2.6319 |
1.7806 |
3.7285 |
3.0555 |
| 1.7716 |
3.6194 |
4.1640 |
3.6194 |
2.3924 |
| H9 |
2.0904 |
1.0934 |
2.6319 |
3.3424 |
1.7806 |
3.0555 |
3.7285 |
1.7716 |
| 2.3924 |
3.6194 |
4.1640 |
3.6194 |
| H10 |
2.0904 |
2.6319 |
1.0934 |
3.3424 |
3.0555 |
1.7806 |
3.7285 |
3.6194 |
2.3924 |
| 1.7716 |
3.6194 |
4.1640 |
| H11 |
2.0904 |
3.3424 |
1.0934 |
2.6319 |
3.7285 |
1.7806 |
3.0555 |
4.1640 |
3.6194 |
1.7716 |
| 2.3924 |
3.6194 |
| H12 |
2.0904 |
3.3424 |
2.6319 |
1.0934 |
3.7285 |
3.0555 |
1.7806 |
3.6194 |
4.1640 |
3.6194 |
2.3924 |
| 1.7716 |
| H13 |
2.0904 |
2.6319 |
3.3424 |
1.0934 |
3.0555 |
3.7285 |
1.7806 |
2.3924 |
3.6194 |
4.1640 |
3.6194 |
1.7716 |
|
Maximum atom distance is 4.1640Å
between atoms H10 and H13.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C2 |
N1 |
C3 |
111.144 |
|
C2 |
N1 |
C4 |
111.144 |
|
C3 |
N1 |
C4 |
111.144 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
N1 |
C2 |
H5 |
113.171 |
|
N1 |
C2 |
H8 |
109.595 |
|
N1 |
C2 |
H9 |
109.595 |
|
N1 |
C3 |
H6 |
113.171 |
|
N1 |
C3 |
H10 |
109.595 |
|
N1 |
C3 |
H11 |
109.595 |
|
N1 |
C4 |
H7 |
113.171 |
|
N1 |
C4 |
H12 |
109.595 |
|
N1 |
C4 |
H13 |
109.595 |
|
H5 |
C2 |
H8 |
108.064 |
|
H5 |
C2 |
H9 |
108.064 |
|
H6 |
C3 |
H10 |
108.064 |
|
H6 |
C3 |
H11 |
108.064 |
|
H7 |
C4 |
H12 |
108.064 |
|
H7 |
C4 |
H13 |
108.064 |
|
H8 |
C2 |
H9 |
108.221 |
|
H10 |
C3 |
H11 |
108.221 |
|
H12 |
C4 |
H13 |
108.221 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.