|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHBrCl2 (Methane, bromodichloro-)
1A' CS
1910171554
InChI=1S/CHBrCl2/c2-1(3)4/h1H INChIKey=FMWLUWPQPKEARP-UHFFFAOYSA-N
B1B95/6-31G*
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.6717 |
-0.1385 |
0.0000 |
|
0.3804 |
-0.5536 |
-0.1385 |
| H2 |
-1.5709 |
0.4659 |
0.0000 |
|
0.8897 |
-1.2946 |
0.4659 |
| Br3 |
0.8126 |
1.1041 |
0.0000 |
|
-0.4602 |
0.6697 |
1.1041 |
| Cl4 |
-0.6717 |
-1.1258 |
1.4596 |
|
1.5834 |
0.2730 |
-1.1258 |
| Cl5 |
-0.6717 |
-1.1258 |
-1.4596 |
|
-0.8225 |
-1.3803 |
-1.1258 |
Atom - Atom Distances (Å)
| |
C1 |
H2 |
Br3 |
Cl4 |
Cl5 |
| C1 |
|
1.0834 |
1.9358 |
1.7622 |
1.7622 |
| H2 |
1.0834 |
| 2.4674 |
2.3394 |
2.3394 |
| Br3 |
1.9358 |
2.4674 |
| 3.0506 |
3.0506 |
| Cl4 |
1.7622 |
2.3394 |
3.0506 |
| 2.9192 |
| Cl5 |
1.7622 |
2.3394 |
3.0506 |
2.9192 |
|
Maximum atom distance is 3.0506Å
between atoms Br3 and Cl4.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
Br3 |
C1 |
Cl4 |
111.080 |
|
Br3 |
C1 |
Cl5 |
111.080 |
|
Cl4 |
C1 |
Cl5 |
111.846 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
H2 |
C1 |
Br3 |
106.155 |
|
H2 |
C1 |
Cl4 |
108.215 |
|
H2 |
C1 |
Cl5 |
108.215 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.