|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for H2NCH2COOH (Glycine)
1A' CS
1910171554
InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5) INChIKey=DHMQDGOQFOQNFH-UHFFFAOYSA-N
B1B95/6-31G*
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.5464 |
0.0000 |
|
0.5370 |
-0.1008 |
0.0000 |
| O2 |
1.1797 |
0.7976 |
0.0000 |
|
1.0015 |
1.0124 |
0.0000 |
| O3 |
-0.9530 |
1.4950 |
0.0000 |
|
1.2936 |
-1.2124 |
0.0000 |
| C4 |
-0.5876 |
-0.8497 |
0.0000 |
|
-0.9435 |
-0.4208 |
0.0000 |
| N5 |
0.3855 |
-1.9125 |
0.0000 |
|
-1.8086 |
0.7316 |
0.0000 |
| H6 |
-0.4874 |
2.3477 |
0.0000 |
|
2.2175 |
-0.9120 |
0.0000 |
| H7 |
-1.2440 |
-0.9398 |
0.8711 |
|
-1.1531 |
-1.0494 |
0.8711 |
| H8 |
-1.2440 |
-0.9398 |
-0.8711 |
|
-1.1531 |
-1.0494 |
-0.8711 |
| H9 |
0.9947 |
-1.8005 |
0.8044 |
|
-1.5862 |
1.3098 |
0.8044 |
| H10 |
0.9947 |
-1.8005 |
-0.8044 |
|
-1.5862 |
1.3098 |
-0.8044 |
Atom - Atom Distances (Å)
| |
C1 |
O2 |
O3 |
C4 |
N5 |
H6 |
H7 |
H8 |
H9 |
H10 |
| C1 |
|
1.2061 |
1.3446 |
1.5148 |
2.4889 |
1.8661 |
2.1249 |
2.1249 |
2.6729 |
2.6729 |
| O2 |
1.2061 |
| 2.2438 |
2.4160 |
2.8241 |
2.2764 |
3.1067 |
3.1067 |
2.7261 |
2.7261 |
| O3 |
1.3446 |
2.2438 |
| 2.3730 |
3.6609 |
0.9715 |
2.6022 |
2.6022 |
3.9117 |
3.9117 |
| C4 |
1.5148 |
2.4160 |
2.3730 |
|
1.4410 |
3.1990 |
1.0945 |
1.0945 |
2.0137 |
2.0137 |
| N5 |
2.4889 |
2.8241 |
3.6609 |
1.4410 |
| 4.3487 |
2.0881 |
2.0881 |
1.0153 |
1.0153 |
| H6 |
1.8661 |
2.2764 |
0.9715 |
3.1990 |
4.3487 |
| 3.4841 |
3.4841 |
4.4779 |
4.4779 |
| H7 |
2.1249 |
3.1067 |
2.6022 |
1.0945 |
2.0881 |
3.4841 |
| 1.7422 |
2.3995 |
2.9258 |
| H8 |
2.1249 |
3.1067 |
2.6022 |
1.0945 |
2.0881 |
3.4841 |
1.7422 |
| 2.9258 |
2.3995 |
| H9 |
2.6729 |
2.7261 |
3.9117 |
2.0137 |
1.0153 |
4.4779 |
2.3995 |
2.9258 |
| 1.6088 |
| H10 |
2.6729 |
2.7261 |
3.9117 |
2.0137 |
1.0153 |
4.4779 |
2.9258 |
2.3995 |
1.6088 |
|
Maximum atom distance is 4.4779Å
between atoms H6 and H9.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C4 |
N5 |
114.696 |
|
O2 |
C1 |
O3 |
123.112 |
|
O2 |
C1 |
C4 |
124.847 |
|
O3 |
C1 |
C4 |
112.041 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
O3 |
H6 |
106.232 |
|
C1 |
C4 |
H7 |
107.970 |
|
C1 |
C4 |
H8 |
107.970 |
|
C4 |
N5 |
H9 |
108.901 |
|
C4 |
N5 |
H10 |
108.901 |
|
N5 |
C4 |
H7 |
110.141 |
|
N5 |
C4 |
H8 |
110.141 |
|
H7 |
C4 |
H8 |
105.488 |
|
H9 |
N5 |
H10 |
104.797 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.