|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3COCH3 (Acetone)
1A1 C2V
1910171554
InChI=1S/C3H6O/c1-3(2)4/h1-2H3 INChIKey=CSCPPACGZOOCGX-UHFFFAOYSA-N
HSEh1PBE/6-31G*
Point group is C2
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
0.1851 |
|
0.1732 |
-0.0652 |
-0.0000 |
| O2 |
0.0000 |
0.0000 |
1.3969 |
|
1.3072 |
-0.4925 |
-0.0000 |
| C3 |
0.0000 |
1.2849 |
-0.6127 |
|
-1.0263 |
-0.9864 |
-0.0000 |
| C4 |
0.0000 |
-1.2849 |
-0.6127 |
|
-0.1204 |
1.4184 |
0.0000 |
| H5 |
0.0007 |
2.1414 |
0.0636 |
|
-0.6954 |
-2.0263 |
0.0007 |
| H6 |
-0.0007 |
-2.1414 |
0.0636 |
|
0.8144 |
1.9814 |
-0.0007 |
| H7 |
0.8798 |
1.3311 |
-1.2657 |
|
-1.6537 |
-0.7994 |
0.8798 |
| H8 |
-0.8805 |
1.3317 |
-1.2647 |
|
-1.6530 |
-0.8003 |
-0.8805 |
| H9 |
-0.8798 |
-1.3311 |
-1.2657 |
|
-0.7152 |
1.6919 |
-0.8798 |
| H10 |
0.8805 |
-1.3317 |
-1.2647 |
|
-0.7140 |
1.6921 |
0.8805 |
Atom - Atom Distances (Å)
| |
C1 |
O2 |
C3 |
C4 |
H5 |
H6 |
H7 |
H8 |
H9 |
H10 |
| C1 |
|
1.2118 |
1.5124 |
1.5124 |
2.1448 |
2.1448 |
2.1566 |
2.1565 |
2.1566 |
2.1565 |
| O2 |
1.2118 |
| 2.3853 |
2.3853 |
2.5225 |
2.5225 |
3.1041 |
3.1037 |
3.1041 |
3.1037 |
| C3 |
1.5124 |
2.3853 |
| 2.5698 |
1.0913 |
3.4924 |
1.0966 |
1.0966 |
2.8362 |
2.8367 |
| C4 |
1.5124 |
2.3853 |
2.5698 |
| 3.4924 |
1.0913 |
2.8362 |
2.8367 |
1.0966 |
1.0966 |
| H5 |
2.1448 |
2.5225 |
1.0913 |
3.4924 |
| 4.2827 |
1.7879 |
1.7879 |
3.8210 |
3.8211 |
| H6 |
2.1448 |
2.5225 |
3.4924 |
1.0913 |
4.2827 |
| 3.8210 |
3.8211 |
1.7879 |
1.7879 |
| H7 |
2.1566 |
3.1041 |
1.0966 |
2.8362 |
1.7879 |
3.8210 |
| 1.7603 |
3.1912 |
2.6628 |
| H8 |
2.1565 |
3.1037 |
1.0966 |
2.8367 |
1.7879 |
3.8211 |
1.7603 |
| 2.6628 |
3.1930 |
| H9 |
2.1566 |
3.1041 |
2.8362 |
1.0966 |
3.8210 |
1.7879 |
3.1912 |
2.6628 |
| 1.7603 |
| H10 |
2.1565 |
3.1037 |
2.8367 |
1.0966 |
3.8211 |
1.7879 |
2.6628 |
3.1930 |
1.7603 |
|
Maximum atom distance is 4.2827Å
between atoms H5 and H6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
O2 |
C1 |
C3 |
121.835 |
|
O2 |
C1 |
C4 |
121.835 |
|
C3 |
C1 |
C4 |
116.330 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C3 |
H5 |
109.869 |
|
C1 |
C3 |
H7 |
110.481 |
|
C1 |
C3 |
H8 |
110.479 |
|
C1 |
C4 |
H6 |
109.869 |
|
C1 |
C4 |
H9 |
110.481 |
|
C1 |
C4 |
H10 |
110.479 |
|
H5 |
C3 |
H7 |
109.601 |
|
H5 |
C3 |
H8 |
109.601 |
|
H6 |
C4 |
H9 |
109.601 |
|
H6 |
C4 |
H10 |
109.601 |
|
H7 |
C3 |
H8 |
106.757 |
|
H9 |
C4 |
H10 |
106.757 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.