|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3COOH (Acetic acid)
1A' CS
1910171554
InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4) INChIKey=QTBSBXVTEAMEQO-UHFFFAOYSA-N
MP3=FULL/6-31G*
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.9986 |
-0.9767 |
0.0000 |
|
-1.3944 |
0.0817 |
0.0000 |
| C2 |
0.0000 |
0.1435 |
0.0000 |
|
0.0942 |
-0.1083 |
0.0000 |
| O3 |
0.2806 |
1.3229 |
0.0000 |
|
0.6563 |
-1.1824 |
0.0000 |
| H4 |
1.9854 |
-0.5225 |
0.0000 |
|
-1.8410 |
-0.9085 |
0.0000 |
| H5 |
0.8713 |
-1.6086 |
0.8838 |
|
-1.7130 |
0.6421 |
0.8838 |
| H6 |
0.8713 |
-1.6086 |
-0.8838 |
|
-1.7130 |
0.6421 |
-0.8838 |
| O7 |
-1.2706 |
-0.2955 |
0.0000 |
|
0.7649 |
1.0567 |
0.0000 |
| H8 |
-1.8001 |
0.5189 |
0.0000 |
|
1.6988 |
0.7896 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
O3 |
H4 |
H5 |
H6 |
O7 |
H8 |
| C1 |
|
1.5007 |
2.4091 |
1.0863 |
1.0939 |
1.0939 |
2.3693 |
3.1732 |
| C2 |
1.5007 |
|
1.2123 |
2.0941 |
2.1471 |
2.1471 |
1.3443 |
1.8388 |
| O3 |
2.4091 |
1.2123 |
| 2.5123 |
3.1183 |
3.1183 |
2.2418 |
2.2306 |
| H4 |
1.0863 |
2.0941 |
2.5123 |
| 1.7894 |
1.7894 |
3.2639 |
3.9261 |
| H5 |
1.0939 |
2.1471 |
3.1183 |
1.7894 |
| 1.7675 |
2.6633 |
3.5275 |
| H6 |
1.0939 |
2.1471 |
3.1183 |
1.7894 |
1.7675 |
| 2.6633 |
3.5275 |
| O7 |
2.3693 |
1.3443 |
2.2418 |
3.2639 |
2.6633 |
2.6633 |
|
0.9714 |
| H8 |
3.1732 |
1.8388 |
2.2306 |
3.9261 |
3.5275 |
3.5275 |
0.9714 |
|
Maximum atom distance is 3.9261Å
between atoms H4 and H8.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
O3 |
124.899 |
|
C1 |
C2 |
O7 |
112.655 |
|
O3 |
C2 |
O7 |
122.446 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C2 |
C1 |
H4 |
107.003 |
|
C2 |
C1 |
H5 |
110.717 |
|
C2 |
C1 |
H6 |
110.717 |
|
C2 |
O7 |
H8 |
103.967 |
|
H4 |
C1 |
H5 |
110.323 |
|
H4 |
C1 |
H6 |
110.323 |
|
H5 |
C1 |
H6 |
107.781 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.