|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHBr2F (dibromofluoromethane)
1A' CS
1910171554
InChI=1S/CHBr2F/c2-1(3)4/h1H INChIKey=LTUTVFXOEGMHMP-UHFFFAOYSA-N
MP3/6-31G*
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.1041 |
0.7988 |
0.0000 |
|
-0.3466 |
0.7197 |
-0.1041 |
| H2 |
-1.0054 |
1.4028 |
0.0000 |
|
-0.6086 |
1.2639 |
-1.0054 |
| F3 |
0.9910 |
1.5908 |
0.0000 |
|
-0.6902 |
1.4333 |
0.9910 |
| Br4 |
-0.1041 |
-0.2930 |
1.6077 |
|
1.5756 |
0.4335 |
-0.1041 |
| Br5 |
-0.1041 |
-0.2930 |
-1.6077 |
|
-1.3214 |
-0.9615 |
-0.1041 |
Atom - Atom Distances (Å)
| |
C1 |
H2 |
F3 |
Br4 |
Br5 |
| C1 |
|
1.0850 |
1.3515 |
1.9434 |
1.9434 |
| H2 |
1.0850 |
| 2.0052 |
2.5046 |
2.5046 |
| F3 |
1.3515 |
2.0052 |
| 2.7079 |
2.7079 |
| Br4 |
1.9434 |
2.5046 |
2.7079 |
| 3.2154 |
| Br5 |
1.9434 |
2.5046 |
2.7079 |
3.2154 |
|
Maximum atom distance is 3.2154Å
between atoms Br4 and Br5.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
F3 |
C1 |
Br4 |
109.223 |
|
F3 |
C1 |
Br5 |
109.223 |
|
Br4 |
C1 |
Br5 |
111.636 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
H2 |
C1 |
F3 |
110.294 |
|
H2 |
C1 |
Br4 |
108.227 |
|
H2 |
C1 |
Br5 |
108.227 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.