|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for NH(CH3)CONH(CH3) (Urea, N,N'-dimethyl-)
1A C2
1910171554
InChI=1S/C3H8N2O/c1-4-3(6)5-2/h1-2H3,(H2,4,5,6) INChIKey=MGJKQDOBUOMPEZ-UHFFFAOYSA-N
B1B95/6-31G*
Point group is C2
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
0.0972 |
|
0.0000 |
0.0972 |
0.0000 |
| O2 |
0.0000 |
0.0000 |
1.3166 |
|
0.0000 |
1.3166 |
0.0000 |
| N3 |
0.0000 |
1.1542 |
-0.6570 |
|
1.1505 |
-0.6570 |
0.0928 |
| N4 |
0.0000 |
-1.1542 |
-0.6570 |
|
-1.1505 |
-0.6570 |
-0.0928 |
| C5 |
-0.2240 |
2.4158 |
0.0094 |
|
2.4260 |
0.0094 |
-0.0290 |
| C6 |
0.2240 |
-2.4158 |
0.0094 |
|
-2.4260 |
0.0094 |
0.0290 |
| H7 |
-0.3721 |
1.0740 |
-1.5910 |
|
1.1004 |
-1.5910 |
-0.2845 |
| H8 |
0.3721 |
-1.0740 |
-1.5910 |
|
-1.1004 |
-1.5910 |
0.2845 |
| H9 |
0.1924 |
3.2261 |
-0.5915 |
|
3.2002 |
-0.5915 |
0.4513 |
| H10 |
-0.1924 |
-3.2261 |
-0.5915 |
|
-3.2002 |
-0.5915 |
-0.4513 |
| H11 |
0.2878 |
2.3831 |
0.9692 |
|
2.3522 |
0.9692 |
0.4785 |
| H12 |
-0.2878 |
-2.3831 |
0.9692 |
|
-2.3522 |
0.9692 |
-0.4785 |
| H13 |
-1.2848 |
2.6187 |
0.1975 |
|
2.7136 |
0.1975 |
-1.0700 |
| H14 |
1.2848 |
-2.6187 |
0.1975 |
|
-2.7136 |
0.1975 |
1.0700 |
Atom - Atom Distances (Å)
| |
C1 |
O2 |
N3 |
N4 |
C5 |
C6 |
H7 |
H8 |
H9 |
H10 |
H11 |
H12 |
H13 |
H14 |
| C1 |
|
1.2194 |
1.3788 |
1.3788 |
2.4277 |
2.4277 |
2.0352 |
2.0352 |
3.3044 |
3.3044 |
2.5539 |
2.5539 |
2.9187 |
2.9187 |
| O2 |
1.2194 |
| 2.2863 |
2.2863 |
2.7559 |
2.7559 |
3.1218 |
3.1218 |
3.7531 |
3.7531 |
2.4254 |
2.4254 |
3.1242 |
3.1242 |
| N3 |
1.3788 |
2.2863 |
| 2.3085 |
1.4442 |
3.6386 |
1.0086 |
2.4445 |
2.0818 |
4.3851 |
2.0585 |
3.9039 |
2.1274 |
4.0763 |
| N4 |
1.3788 |
2.2863 |
2.3085 |
| 3.6386 |
1.4442 |
2.4445 |
1.0086 |
4.3851 |
2.0818 |
3.9039 |
2.0585 |
4.0763 |
2.1274 |
| C5 |
2.4277 |
2.7559 |
1.4442 |
3.6386 |
| 4.8523 |
2.0937 |
3.8852 |
1.0914 |
5.6739 |
1.0883 |
4.8943 |
1.0963 |
5.2591 |
| C6 |
2.4277 |
2.7559 |
3.6386 |
1.4442 |
4.8523 |
| 3.8852 |
2.0937 |
5.6739 |
1.0914 |
4.8943 |
1.0883 |
5.2591 |
1.0963 |
| H7 |
2.0352 |
3.1218 |
1.0086 |
2.4445 |
2.0937 |
3.8852 |
| 2.2732 |
2.4392 |
4.4184 |
2.9503 |
4.3027 |
2.5334 |
4.4250 |
| H8 |
2.0352 |
3.1218 |
2.4445 |
1.0086 |
3.8852 |
2.0937 |
2.2732 |
| 4.4184 |
2.4392 |
4.3027 |
2.9503 |
4.4250 |
2.5334 |
| H9 |
3.3044 |
3.7531 |
2.0818 |
4.3851 |
1.0914 |
5.6739 |
2.4392 |
4.4184 |
| 6.4637 |
1.7764 |
5.8421 |
1.7815 |
5.9982 |
| H10 |
3.3044 |
3.7531 |
4.3851 |
2.0818 |
5.6739 |
1.0914 |
4.4184 |
2.4392 |
6.4637 |
| 5.8421 |
1.7764 |
5.9982 |
1.7815 |
| H11 |
2.5539 |
2.4254 |
2.0585 |
3.9039 |
1.0883 |
4.8943 |
2.9503 |
4.3027 |
1.7764 |
5.8421 |
| 4.8008 |
1.7675 |
5.1583 |
| H12 |
2.5539 |
2.4254 |
3.9039 |
2.0585 |
4.8943 |
1.0883 |
4.3027 |
2.9503 |
5.8421 |
1.7764 |
4.8008 |
| 5.1583 |
1.7675 |
| H13 |
2.9187 |
3.1242 |
2.1274 |
4.0763 |
1.0963 |
5.2591 |
2.5334 |
4.4250 |
1.7815 |
5.9982 |
1.7675 |
5.1583 |
| 5.8339 |
| H14 |
2.9187 |
3.1242 |
4.0763 |
2.1274 |
5.2591 |
1.0963 |
4.4250 |
2.5334 |
5.9982 |
1.7815 |
5.1583 |
1.7675 |
5.8339 |
|
Maximum atom distance is 6.4637Å
between atoms H9 and H10.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
N3 |
C5 |
118.610 |
|
C1 |
N4 |
C6 |
118.610 |
|
O2 |
C1 |
N3 |
123.162 |
|
O2 |
C1 |
N4 |
123.162 |
|
N3 |
C1 |
N4 |
113.675 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
N3 |
H7 |
116.099 |
|
C1 |
N4 |
H8 |
116.099 |
|
N3 |
C5 |
H9 |
109.594 |
|
N3 |
C5 |
H11 |
107.926 |
|
N3 |
C5 |
H13 |
113.016 |
|
N4 |
C6 |
H10 |
109.594 |
|
N4 |
C6 |
H12 |
107.926 |
|
N4 |
C6 |
H14 |
113.016 |
|
C5 |
N3 |
H7 |
116.076 |
|
C6 |
N4 |
H8 |
116.076 |
|
H9 |
C5 |
H11 |
109.176 |
|
H9 |
C5 |
H13 |
109.038 |
|
H10 |
C6 |
H12 |
109.176 |
|
H10 |
C6 |
H14 |
109.038 |
|
H11 |
C5 |
H13 |
108.015 |
|
H12 |
C6 |
H14 |
108.015 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.