|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3COCH3 (Acetone)
1A1 C2V
1910171554
InChI=1S/C3H6O/c1-3(2)4/h1-2H3 INChIKey=CSCPPACGZOOCGX-UHFFFAOYSA-N
CCD/6-31G*
Point group is C2v
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
0.1872 |
|
0.1872 |
-0.0002 |
0.0000 |
| O2 |
0.0000 |
0.0000 |
1.4022 |
|
1.4022 |
-0.0013 |
0.0000 |
| C3 |
0.0000 |
1.2892 |
-0.6172 |
|
-0.6172 |
0.0006 |
1.2892 |
| C4 |
0.0000 |
-1.2892 |
-0.6172 |
|
-0.6172 |
0.0006 |
-1.2892 |
| H5 |
0.0000 |
2.1425 |
0.0657 |
|
0.0657 |
-0.0001 |
2.1425 |
| H6 |
0.0000 |
-2.1425 |
0.0657 |
|
0.0657 |
-0.0001 |
-2.1425 |
| H7 |
0.8839 |
1.3352 |
-1.2664 |
|
-1.2656 |
0.8850 |
1.3352 |
| H8 |
-0.8839 |
1.3352 |
-1.2664 |
|
-1.2673 |
-0.8827 |
1.3352 |
| H9 |
-0.8839 |
-1.3352 |
-1.2664 |
|
-1.2673 |
-0.8827 |
-1.3352 |
| H10 |
0.8839 |
-1.3352 |
-1.2664 |
|
-1.2656 |
0.8850 |
-1.3352 |
Atom - Atom Distances (Å)
| |
C1 |
O2 |
C3 |
C4 |
H5 |
H6 |
H7 |
H8 |
H9 |
H10 |
| C1 |
|
1.2150 |
1.5195 |
1.5195 |
2.1460 |
2.1460 |
2.1626 |
2.1626 |
2.1626 |
2.1626 |
| O2 |
1.2150 |
| 2.3958 |
2.3958 |
2.5252 |
2.5252 |
3.1121 |
3.1121 |
3.1121 |
3.1121 |
| C3 |
1.5195 |
2.3958 |
| 2.5784 |
1.0929 |
3.4990 |
1.0977 |
1.0977 |
2.8443 |
2.8443 |
| C4 |
1.5195 |
2.3958 |
2.5784 |
| 3.4990 |
1.0929 |
2.8443 |
2.8443 |
1.0977 |
1.0977 |
| H5 |
2.1460 |
2.5252 |
1.0929 |
3.4990 |
| 4.2851 |
1.7910 |
1.7910 |
3.8275 |
3.8275 |
| H6 |
2.1460 |
2.5252 |
3.4990 |
1.0929 |
4.2851 |
| 3.8275 |
3.8275 |
1.7910 |
1.7910 |
| H7 |
2.1626 |
3.1121 |
1.0977 |
2.8443 |
1.7910 |
3.8275 |
| 1.7677 |
3.2024 |
2.6703 |
| H8 |
2.1626 |
3.1121 |
1.0977 |
2.8443 |
1.7910 |
3.8275 |
1.7677 |
| 2.6703 |
3.2024 |
| H9 |
2.1626 |
3.1121 |
2.8443 |
1.0977 |
3.8275 |
1.7910 |
3.2024 |
2.6703 |
| 1.7677 |
| H10 |
2.1626 |
3.1121 |
2.8443 |
1.0977 |
3.8275 |
1.7910 |
2.6703 |
3.2024 |
1.7677 |
|
Maximum atom distance is 4.2851Å
between atoms H5 and H6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
O2 |
C1 |
C3 |
121.961 |
|
O2 |
C1 |
C4 |
121.961 |
|
C3 |
C1 |
C4 |
116.078 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C3 |
H5 |
109.373 |
|
C1 |
C3 |
H7 |
110.403 |
|
C1 |
C3 |
H8 |
110.403 |
|
C1 |
C4 |
H6 |
109.373 |
|
C1 |
C4 |
H9 |
110.403 |
|
C1 |
C4 |
H10 |
110.403 |
|
H5 |
C3 |
H7 |
109.686 |
|
H5 |
C3 |
H8 |
109.686 |
|
H6 |
C4 |
H9 |
109.686 |
|
H6 |
C4 |
H10 |
109.686 |
|
H7 |
C3 |
H8 |
107.262 |
|
H9 |
C4 |
H10 |
107.262 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.