|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C6H4Cl2 (1,2-dichlorobenzene)
1A1 C2V
1910171554
InChI=1S/C6H4Cl2/c7-5-3-1-2-4-6(5)8/h1-4H INChIKey=RFFLAFLAYFXFSW-UHFFFAOYSA-N
B2PLYP=FULLultrafine/6-31G*
Point group is C2v
| Atom |
Internal |
| x (Å) |
y (Å) |
z (Å) |
| C1 |
0.0000 |
0.6997 |
-0.0294 |
| C2 |
0.0000 |
-0.6997 |
-0.0294 |
| C3 |
0.0000 |
1.3933 |
1.1829 |
| C4 |
0.0000 |
-1.3933 |
1.1829 |
| C5 |
0.0000 |
0.6976 |
2.3886 |
| C6 |
0.0000 |
-0.6976 |
2.3886 |
| Cl7 |
0.0000 |
1.6083 |
-1.5142 |
| Cl8 |
0.0000 |
-1.6083 |
-1.5142 |
| H9 |
0.0000 |
2.4769 |
1.1659 |
| H10 |
0.0000 |
-2.4769 |
1.1659 |
| H11 |
0.0000 |
1.2472 |
3.3235 |
| H12 |
0.0000 |
-1.2472 |
3.3235 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
C3 |
C4 |
C5 |
C6 |
Cl7 |
Cl8 |
H9 |
H10 |
H11 |
H12 |
| C1 |
|
1.3995 |
1.3966 |
2.4187 |
2.4180 |
2.7927 |
1.7408 |
2.7444 |
2.1417 |
3.3940 |
3.3973 |
3.8772 |
| C2 |
1.3995 |
| 2.4187 |
1.3966 |
2.7927 |
2.4180 |
2.7444 |
1.7408 |
3.3940 |
2.1417 |
3.8772 |
3.3973 |
| C3 |
1.3966 |
2.4187 |
| 2.7866 |
1.3920 |
2.4137 |
2.7056 |
4.0353 |
1.0837 |
3.8702 |
2.1456 |
3.3992 |
| C4 |
2.4187 |
1.3966 |
2.7866 |
| 2.4137 |
1.3920 |
4.0353 |
2.7056 |
3.8702 |
1.0837 |
3.3992 |
2.1456 |
| C5 |
2.4180 |
2.7927 |
1.3920 |
2.4137 |
|
1.3953 |
4.0076 |
4.5331 |
2.1589 |
3.4018 |
1.0845 |
2.1579 |
| C6 |
2.7927 |
2.4180 |
2.4137 |
1.3920 |
1.3953 |
| 4.5331 |
4.0076 |
3.4018 |
2.1589 |
2.1579 |
1.0845 |
| Cl7 |
1.7408 |
2.7444 |
2.7056 |
4.0353 |
4.0076 |
4.5331 |
| 3.2167 |
2.8173 |
4.8858 |
4.8512 |
5.6176 |
| Cl8 |
2.7444 |
1.7408 |
4.0353 |
2.7056 |
4.5331 |
4.0076 |
3.2167 |
| 4.8858 |
2.8173 |
5.6176 |
4.8512 |
| H9 |
2.1417 |
3.3940 |
1.0837 |
3.8702 |
2.1589 |
3.4018 |
2.8173 |
4.8858 |
| 4.9537 |
2.4835 |
4.3039 |
| H10 |
3.3940 |
2.1417 |
3.8702 |
1.0837 |
3.4018 |
2.1589 |
4.8858 |
2.8173 |
4.9537 |
| 4.3039 |
2.4835 |
| H11 |
3.3973 |
3.8772 |
2.1456 |
3.3992 |
1.0845 |
2.1579 |
4.8512 |
5.6176 |
2.4835 |
4.3039 |
| 2.4944 |
| H12 |
3.8772 |
3.3973 |
3.3992 |
2.1456 |
2.1579 |
1.0845 |
5.6176 |
4.8512 |
4.3039 |
2.4835 |
2.4944 |
|
Maximum atom distance is 5.6176Å
between atoms Cl7 and H12.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
C4 |
119.775 |
|
C1 |
C2 |
Cl8 |
121.463 |
|
C1 |
C3 |
C5 |
120.242 |
|
C2 |
C1 |
C3 |
119.775 |
|
C2 |
C1 |
Cl7 |
121.463 |
|
C2 |
C4 |
C6 |
120.242 |
|
C3 |
C1 |
Cl7 |
118.762 |
|
C3 |
C5 |
C6 |
119.983 |
|
C4 |
C2 |
Cl8 |
118.762 |
|
C4 |
C6 |
C5 |
119.983 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C3 |
H9 |
118.876 |
|
C2 |
C4 |
H10 |
118.876 |
|
C3 |
C5 |
H11 |
119.570 |
|
C4 |
C6 |
H12 |
119.570 |
|
C5 |
C3 |
H9 |
120.882 |
|
C5 |
C6 |
H12 |
120.447 |
|
C6 |
C4 |
H10 |
120.882 |
|
C6 |
C5 |
H11 |
120.447 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.