|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3CHF2 (Ethane, 1,1-difluoro-)
1A' CS
1910171554
InChI=1S/C2H4F2/c1-2(3)4/h2H,1H3 INChIKey=NPNPZTNLOVBDOC-UHFFFAOYSA-N
PBE1PBE/6-31G*
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.3244 |
0.1615 |
0.0000 |
|
-0.0628 |
0.0000 |
0.3569 |
| C2 |
-0.9033 |
1.0266 |
0.0000 |
|
1.3624 |
0.0000 |
-0.1168 |
| H3 |
1.2634 |
0.7280 |
0.0000 |
|
-0.1648 |
0.0000 |
1.4488 |
| F4 |
0.3244 |
-0.6426 |
1.0984 |
|
-0.7096 |
1.0984 |
-0.1207 |
| F5 |
0.3244 |
-0.6426 |
-1.0984 |
|
-0.7096 |
-1.0984 |
-0.1207 |
| H6 |
-1.7911 |
0.3881 |
0.0000 |
|
1.3761 |
0.0000 |
-1.2103 |
| H7 |
-0.9196 |
1.6607 |
0.8903 |
|
1.8822 |
0.8903 |
0.2467 |
| H8 |
-0.9196 |
1.6607 |
-0.8903 |
|
1.8822 |
-0.8903 |
0.2467 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
H3 |
F4 |
F5 |
H6 |
H7 |
H8 |
| C1 |
|
1.5019 |
1.0966 |
1.3612 |
1.3612 |
2.1276 |
2.1419 |
2.1419 |
| C2 |
1.5019 |
| 2.1871 |
2.3452 |
2.3452 |
1.0936 |
1.0931 |
1.0931 |
| H3 |
1.0966 |
2.1871 |
| 1.9916 |
1.9916 |
3.0733 |
2.5353 |
2.5353 |
| F4 |
1.3612 |
2.3452 |
1.9916 |
| 2.1967 |
2.5969 |
2.6260 |
3.2875 |
| F5 |
1.3612 |
2.3452 |
1.9916 |
2.1967 |
| 2.5969 |
3.2875 |
2.6260 |
| H6 |
2.1276 |
1.0936 |
3.0733 |
2.5969 |
2.5969 |
| 1.7809 |
1.7809 |
| H7 |
2.1419 |
1.0931 |
2.5353 |
2.6260 |
3.2875 |
1.7809 |
| 1.7806 |
| H8 |
2.1419 |
1.0931 |
2.5353 |
3.2875 |
2.6260 |
1.7809 |
1.7806 |
|
Maximum atom distance is 3.2875Å
between atoms F4 and H8.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C2 |
C1 |
F4 |
109.892 |
|
C2 |
C1 |
F5 |
109.892 |
|
F4 |
C1 |
F5 |
107.585 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
H6 |
109.107 |
|
C1 |
C2 |
H7 |
110.265 |
|
C1 |
C2 |
H8 |
110.265 |
|
C2 |
C1 |
H3 |
113.726 |
|
H3 |
C1 |
F4 |
107.768 |
|
H3 |
C1 |
F5 |
107.768 |
|
H6 |
C2 |
H7 |
109.058 |
|
H6 |
C2 |
H8 |
109.058 |
|
H7 |
C2 |
H8 |
109.062 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.