|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHCl3 (Chloroform)
1A1 C3V
1910171554
InChI=1S/CHCl3/c2-1(3)4/h1H INChIKey=HEDRZPFGACZZDS-UHFFFAOYSA-N
B2PLYP=FULLultrafine/6-31G*
Point group is C3v
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
0.4536 |
|
0.0000 |
0.0000 |
0.4536 |
| H2 |
0.0000 |
0.0000 |
1.5376 |
|
0.0000 |
0.0000 |
1.5376 |
| Cl3 |
0.0000 |
1.6944 |
-0.0835 |
|
1.6944 |
0.0000 |
-0.0835 |
| Cl4 |
1.4674 |
-0.8472 |
-0.0835 |
|
-0.8472 |
1.4674 |
-0.0835 |
| Cl5 |
-1.4674 |
-0.8472 |
-0.0835 |
|
-0.8472 |
-1.4674 |
-0.0835 |
Atom - Atom Distances (Å)
| |
C1 |
H2 |
Cl3 |
Cl4 |
Cl5 |
| C1 |
|
1.0840 |
1.7775 |
1.7775 |
1.7775 |
| H2 |
1.0840 |
| 2.3450 |
2.3450 |
2.3450 |
| Cl3 |
1.7775 |
2.3450 |
| 2.9348 |
2.9348 |
| Cl4 |
1.7775 |
2.3450 |
2.9348 |
| 2.9348 |
| Cl5 |
1.7775 |
2.3450 |
2.9348 |
2.9348 |
|
Maximum atom distance is 2.9348Å
between atoms Cl3 and Cl4.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
Cl3 |
C1 |
Cl4 |
111.286 |
|
Cl3 |
C1 |
Cl5 |
111.286 |
|
Cl4 |
C1 |
Cl5 |
111.286 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
H2 |
C1 |
Cl3 |
107.589 |
|
H2 |
C1 |
Cl4 |
107.589 |
|
H2 |
C1 |
Cl5 |
107.589 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.