|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH2ClCHCl2 (1,1,2-trichloroethane)
1A C1
1910171554
InChI=1S/C2H3Cl3/c3-1-2(4)5/h2H,1H2 INChIKey=UBOXGVDOUJQMTN-UHFFFAOYSA-N
CCD/6-31G*
Point group is C1
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.6704 |
-0.8220 |
0.4034 |
|
-0.6787 |
-0.8127 |
0.4085 |
| C2 |
-0.4204 |
-0.0773 |
-0.3501 |
|
0.4213 |
-0.0840 |
-0.3474 |
| Cl3 |
2.2974 |
-0.3045 |
-0.0959 |
|
-2.2993 |
-0.2872 |
-0.1032 |
| H4 |
0.5520 |
-0.6541 |
1.4753 |
|
-0.5637 |
-0.6352 |
1.4791 |
| H5 |
0.5693 |
-1.8898 |
0.2012 |
|
-0.5852 |
-1.8832 |
0.2171 |
| Cl6 |
-1.9827 |
-0.8638 |
-0.0173 |
|
1.9758 |
-0.8796 |
0.0000 |
| Cl7 |
-0.4548 |
1.6437 |
0.0794 |
|
0.4675 |
1.6408 |
0.0654 |
| H8 |
-0.2411 |
-0.1431 |
-1.4229 |
|
0.2461 |
-0.1590 |
-1.4204 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
Cl3 |
H4 |
H5 |
Cl6 |
Cl7 |
H8 |
| C1 |
|
1.5206 |
1.7789 |
1.0913 |
1.0915 |
2.6865 |
2.7296 |
2.1511 |
| C2 |
1.5206 |
| 2.7391 |
2.1471 |
2.1375 |
1.7805 |
1.7741 |
1.0897 |
| Cl3 |
1.7789 |
2.7391 |
| 2.3743 |
2.3638 |
4.3172 |
3.3765 |
2.8690 |
| H4 |
1.0913 |
2.1471 |
2.3743 |
| 1.7750 |
2.9489 |
2.8709 |
3.0479 |
| H5 |
1.0915 |
2.1375 |
2.3638 |
1.7750 |
| 2.7592 |
3.6810 |
2.5190 |
| Cl6 |
2.6865 |
1.7805 |
4.3172 |
2.9489 |
2.7592 |
| 2.9379 |
2.3513 |
| Cl7 |
2.7296 |
1.7741 |
3.3765 |
2.8709 |
3.6810 |
2.9379 |
| 2.3443 |
| H8 |
2.1511 |
1.0897 |
2.8690 |
3.0479 |
2.5190 |
2.3513 |
2.3443 |
|
Maximum atom distance is 4.3172Å
between atoms Cl3 and Cl6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
Cl6 |
108.690 |
|
C1 |
C2 |
Cl7 |
111.655 |
|
C2 |
C1 |
Cl3 |
111.996 |
|
Cl6 |
C2 |
Cl7 |
111.486 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
H8 |
109.890 |
|
C2 |
C1 |
H4 |
109.483 |
|
C2 |
C1 |
H5 |
108.716 |
|
Cl3 |
C1 |
H4 |
109.278 |
|
Cl3 |
C1 |
H5 |
108.497 |
|
H4 |
C1 |
H5 |
108.811 |
|
Cl6 |
C2 |
H8 |
107.563 |
|
Cl7 |
C2 |
H8 |
107.467 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.