|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH5N3S (Hydrazinecarbothioamide)
1A C1
1910171554
InChI=1S/CH5N3S/c2-1(5)4-3/h3H2,(H3,2,4,5) INChIKey=BRWIZMBXBAOCCF-UHFFFAOYSA-N
MP2=FULL/6-31G*
Point group is C1
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| H1 |
-0.6071 |
-1.6702 |
0.0573 |
|
0.6509 |
-1.6535 |
0.0618 |
| N2 |
-0.8585 |
-0.7069 |
-0.1446 |
|
0.8765 |
-0.6846 |
-0.1437 |
| S3 |
1.7540 |
-0.3514 |
0.0283 |
|
-1.7441 |
-0.3973 |
0.0325 |
| C4 |
0.1810 |
0.1835 |
-0.0313 |
|
-0.1858 |
0.1786 |
-0.0316 |
| H5 |
-1.1765 |
1.7115 |
-0.0698 |
|
1.1309 |
1.7416 |
-0.0776 |
| H6 |
0.5245 |
2.1811 |
-0.0098 |
|
-0.5817 |
2.1665 |
-0.0162 |
| N7 |
-0.1947 |
1.4743 |
-0.0040 |
|
0.1558 |
1.4789 |
-0.0092 |
| H8 |
-2.5106 |
-0.5670 |
0.9810 |
|
2.5262 |
-0.4974 |
0.9785 |
| H9 |
-2.7741 |
-0.6689 |
-0.6493 |
|
2.7896 |
-0.5978 |
-0.6519 |
| N10 |
-2.1762 |
-0.2625 |
0.0666 |
|
2.1825 |
-0.2049 |
0.0637 |
Atom - Atom Distances (Å)
| |
H1 |
N2 |
S3 |
C4 |
H5 |
H6 |
N7 |
H8 |
H9 |
N10 |
| H1 |
|
1.0158 |
2.7046 |
2.0162 |
3.4316 |
4.0146 |
3.1720 |
2.3861 |
2.4896 |
2.1081 |
| N2 |
1.0158 |
| 2.6422 |
1.3734 |
2.4404 |
3.2049 |
2.2843 |
2.0040 |
1.9813 |
1.4066 |
| S3 |
2.7046 |
2.6422 |
| 1.6625 |
3.5850 |
2.8153 |
2.6704 |
4.3750 |
4.5894 |
3.9314 |
| C4 |
2.0162 |
1.3734 |
1.6625 |
| 2.0442 |
2.0270 |
1.3446 |
2.9719 |
3.1370 |
2.4010 |
| H5 |
3.4316 |
2.4404 |
3.5850 |
2.0442 |
| 1.7656 |
1.0122 |
2.8417 |
2.9248 |
2.2169 |
| H6 |
4.0146 |
3.2049 |
2.8153 |
2.0270 |
1.7656 |
|
1.0083 |
4.2125 |
4.4059 |
3.6429 |
| N7 |
3.1720 |
2.2843 |
2.6704 |
1.3446 |
1.0122 |
1.0083 |
| 3.2404 |
3.4151 |
2.6359 |
| H8 |
2.3861 |
2.0040 |
4.3750 |
2.9719 |
2.8417 |
4.2125 |
3.2404 |
| 1.6546 |
1.0201 |
| H9 |
2.4896 |
1.9813 |
4.5894 |
3.1370 |
2.9248 |
4.4059 |
3.4151 |
1.6546 |
|
1.0174 |
| N10 |
2.1081 |
1.4066 |
3.9314 |
2.4010 |
2.2169 |
3.6429 |
2.6359 |
1.0201 |
1.0174 |
|
Maximum atom distance is 4.5894Å
between atoms S3 and H9.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
N2 |
C4 |
S3 |
120.694 |
|
N2 |
C4 |
N7 |
114.373 |
|
S3 |
C4 |
N7 |
124.919 |
|
C4 |
N2 |
N10 |
119.456 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
H1 |
N2 |
C4 |
114.277 |
|
H1 |
N2 |
N10 |
120.111 |
|
N2 |
N10 |
H8 |
110.320 |
|
N2 |
N10 |
H9 |
108.579 |
|
C4 |
N7 |
H5 |
119.643 |
|
C4 |
N7 |
H6 |
118.264 |
|
H5 |
N7 |
H6 |
121.813 |
|
H8 |
N10 |
H9 |
108.596 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.