|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3COCH3 (Acetone)
1A1 C2V
1910171554
InChI=1S/C3H6O/c1-3(2)4/h1-2H3 INChIKey=CSCPPACGZOOCGX-UHFFFAOYSA-N
B2PLYP=FULL/6-31G*
Point group is C2
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
0.1828 |
|
0.1828 |
-0.0000 |
0.0000 |
| O2 |
0.0000 |
0.0000 |
1.4025 |
|
1.4025 |
-0.0000 |
0.0000 |
| C3 |
0.0000 |
1.2895 |
-0.6154 |
|
-0.6154 |
0.0000 |
1.2895 |
| C4 |
0.0000 |
-1.2895 |
-0.6154 |
|
-0.6154 |
0.0000 |
-1.2895 |
| H5 |
-0.0006 |
2.1416 |
0.0638 |
|
0.0638 |
-0.0006 |
2.1416 |
| H6 |
0.0006 |
-2.1416 |
0.0638 |
|
0.0638 |
0.0006 |
-2.1416 |
| H7 |
0.8804 |
1.3367 |
-1.2646 |
|
-1.2646 |
0.8804 |
1.3367 |
| H8 |
-0.8799 |
1.3362 |
-1.2653 |
|
-1.2653 |
-0.8798 |
1.3362 |
| H9 |
-0.8804 |
-1.3367 |
-1.2646 |
|
-1.2646 |
-0.8803 |
-1.3367 |
| H10 |
0.8799 |
-1.3362 |
-1.2653 |
|
-1.2653 |
0.8799 |
-1.3362 |
Atom - Atom Distances (Å)
| |
C1 |
O2 |
C3 |
C4 |
H5 |
H6 |
H7 |
H8 |
H9 |
H10 |
| C1 |
|
1.2196 |
1.5166 |
1.5166 |
2.1449 |
2.1449 |
2.1580 |
2.1580 |
2.1580 |
2.1580 |
| O2 |
1.2196 |
| 2.3947 |
2.3947 |
2.5256 |
2.5256 |
3.1105 |
3.1108 |
3.1105 |
3.1108 |
| C3 |
1.5166 |
2.3947 |
| 2.5790 |
1.0897 |
3.4977 |
1.0949 |
1.0949 |
2.8449 |
2.8445 |
| C4 |
1.5166 |
2.3947 |
2.5790 |
| 3.4977 |
1.0897 |
2.8449 |
2.8445 |
1.0949 |
1.0949 |
| H5 |
2.1449 |
2.5256 |
1.0897 |
3.4977 |
| 4.2832 |
1.7856 |
1.7856 |
3.8259 |
3.8259 |
| H6 |
2.1449 |
2.5256 |
3.4977 |
1.0897 |
4.2832 |
| 3.8259 |
3.8259 |
1.7856 |
1.7856 |
| H7 |
2.1580 |
3.1105 |
1.0949 |
2.8449 |
1.7856 |
3.8259 |
| 1.7602 |
3.2012 |
2.6730 |
| H8 |
2.1580 |
3.1108 |
1.0949 |
2.8445 |
1.7856 |
3.8259 |
1.7602 |
| 2.6730 |
3.1998 |
| H9 |
2.1580 |
3.1105 |
2.8449 |
1.0949 |
3.8259 |
1.7856 |
3.2012 |
2.6730 |
| 1.7602 |
| H10 |
2.1580 |
3.1108 |
2.8445 |
1.0949 |
3.8259 |
1.7856 |
2.6730 |
3.1998 |
1.7602 |
|
Maximum atom distance is 4.2832Å
between atoms H5 and H6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
O2 |
C1 |
C3 |
121.759 |
|
O2 |
C1 |
C4 |
121.759 |
|
C3 |
C1 |
C4 |
116.482 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C3 |
H5 |
109.683 |
|
C1 |
C3 |
H7 |
110.414 |
|
C1 |
C3 |
H8 |
110.411 |
|
C1 |
C4 |
H6 |
109.683 |
|
C1 |
C4 |
H9 |
110.414 |
|
C1 |
C4 |
H10 |
110.411 |
|
H5 |
C3 |
H7 |
109.649 |
|
H5 |
C3 |
H8 |
109.644 |
|
H6 |
C4 |
H9 |
109.649 |
|
H6 |
C4 |
H10 |
109.644 |
|
H7 |
C3 |
H8 |
106.999 |
|
H9 |
C4 |
H10 |
106.999 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.