|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3NO2 (Methane, nitro-)
1A' CS Os out of place
1910171554
InChI=1S/CH3NO2/c1-2(3)4/h1H3 INChIKey=LYGJENNIWJXYER-UHFFFAOYSA-N
wB97X-D/6-31G*
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0248 |
-1.3112 |
0.0000 |
|
0.0000 |
0.0248 |
-1.3112 |
| N2 |
-0.1077 |
0.1777 |
0.0000 |
|
-0.0002 |
-0.1077 |
0.1777 |
| H3 |
1.0923 |
-1.5412 |
0.0000 |
|
0.0020 |
1.0923 |
-1.5412 |
| H4 |
-0.4419 |
-1.6931 |
0.9054 |
|
0.9046 |
-0.4435 |
-1.6931 |
| H5 |
-0.4419 |
-1.6931 |
-0.9054 |
|
-0.9062 |
-0.4402 |
-1.6931 |
| O6 |
0.0248 |
0.7219 |
-1.0786 |
|
-1.0786 |
0.0267 |
0.7219 |
| O7 |
0.0248 |
0.7219 |
1.0786 |
|
1.0787 |
0.0229 |
0.7219 |
Atom - Atom Distances (Å)
| |
C1 |
N2 |
H3 |
H4 |
H5 |
O6 |
O7 |
| C1 |
|
1.4947 |
1.0920 |
1.0879 |
1.0879 |
2.3015 |
2.3015 |
| N2 |
1.4947 |
| 2.0963 |
2.1051 |
2.1051 |
1.2154 |
1.2154 |
| H3 |
1.0920 |
2.0963 |
| 1.7878 |
1.7878 |
2.7248 |
2.7248 |
| H4 |
1.0879 |
2.1051 |
1.7878 |
| 1.8108 |
3.1602 |
2.4658 |
| H5 |
1.0879 |
2.1051 |
1.7878 |
1.8108 |
| 2.4658 |
3.1602 |
| O6 |
2.3015 |
1.2154 |
2.7248 |
3.1602 |
2.4658 |
| 2.1573 |
| O7 |
2.3015 |
1.2154 |
2.7248 |
2.4658 |
3.1602 |
2.1573 |
|
Maximum atom distance is 3.1602Å
between atoms H4 and O6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
N2 |
O6 |
115.872 |
|
C1 |
N2 |
O7 |
115.872 |
|
O6 |
N2 |
O7 |
125.113 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
N2 |
C1 |
H3 |
107.245 |
|
N2 |
C1 |
H4 |
108.163 |
|
N2 |
C1 |
H5 |
108.163 |
|
H3 |
C1 |
H4 |
110.206 |
|
H3 |
C1 |
H5 |
110.206 |
|
H4 |
C1 |
H5 |
112.667 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.